# PHREEQC database # Base de Donnee Thermoddem_MAJ2020 # Version V1.10 # BDD Date : 12/15/2020 5:30:25 AM # Converted on 12/15/2020 5:30:59 AM by ThermoBridge 1.0.3.4 # Data from Thermoddem V1.10 Code version 1.07_2.06 # Thermochemical Database # from the BRGM institute (french geological survey) # The database is regularly updated. Kindly send comments or # corrections to the Thermoddem team # https://thermoddem.brgm.fr/ LLNL_AQUEOUS_MODEL_PARAMETERS -temperatures 0.0000 25.0000 60.0000 100.0000 150.0000 200.0000 250.0000 300.0000 #debye huckel a (adh) -dh_a 0.4901 0.5095 0.5450 0.5986 0.6867 0.8046 0.9710 1.2414 #debye huckel b (bdh) -dh_b 0.3245 0.3284 0.3343 0.3420 0.3528 0.3647 0.3782 0.3950 #bdot (bdot) -bdot 0.0374 0.0410 0.0438 0.0460 0.0470 0.0470 0.0340 0.0000 #cco2 (coefficients for the Drummond (1981) polynomial) -co2_coefs -1.0312 0.0012806 255.9 0.4445 -0.00161 NAMED_EXPRESSIONS # # formation of O2 from H2O # 2H2O = O2 + 4H+ + 4e- # Log_K_O2 log_k -85.991 delta_H 559.524 kJ/mol # -analytic 2.1432E+2 3.00247E-2 -4.21233E+4 -7.2111E+1 9.29169E+5 SOLUTION_MASTER_SPECIES #element species alk gfw_formula element_gfw Alkalinity HCO3- 1 Ca0.5(CO3)0.5 50.05 E e- 0 0 0 Ag Ag+ 0 Ag 107.868 Ag(1) Ag+ 0 Ag 107.868 Ag(2) Ag+2 0 Ag 107.868 Al Al+3 0 Al 26.982 Ar Ar 0 Ar 39.948 As H2AsO4- 0 As 74.922 As(-3) AsH3 0 As 74.922 As(3) H2AsO3- 1 As 74.922 As(5) H2AsO4- 0 As 74.922 Au Au+ -1 Au 196.967 Au(1) Au+ -1 Au 196.967 Au(3) Au+3 0 Au 196.967 B B(OH)3 0 B 10.811 Ba Ba+2 0 Ba 137.34 Be Be+2 0 Be 9.012 Bi Bi+3 -2 Bi 208.98 Br Br- 0 Br 79.904 Br(-1) Br- 0 Br 79.904 Br(-0.3) Br3- 0 Br 79.904 Br(1) BrO- 1 Br 79.904 Br(5) BrO3- 0 Br 79.904 Br(7) BrO4- 0 Br 79.904 C HCO3- 1 C 12.011 C(-4) CH4 0 C 12.011 C(2) CO 0 C 12.011 C(4) HCO3- 1 C 12.011 Ca Ca+2 0 Ca 40.078 Cd Cd+2 0 Cd 112.41 Ce Ce+3 0 Ce 140.12 Ce(2) Ce+2 0 Ce 140.12 Ce(3) Ce+3 0 Ce 140.12 Ce(4) Ce+4 0 Ce 140.12 Cl Cl- 0 Cl 35.452 Cl(-1) Cl- 0 Cl 35.452 Cl(1) ClO- 1 Cl 35.452 Cl(3) ClO2- 0 Cl 35.452 Cl(4) ClO2 0 Cl 35.452 Cl(5) ClO3- 0 Cl 35.452 Cl(7) ClO4- 0 Cl 35.452 Co Co+2 0 Co 58.933 Co(2) Co+2 0 Co 58.933 Cr CrO4-2 1 Cr 51.966 Cr(2) Cr+2 0 Cr 51.966 Cr(3) Cr+3 -1 Cr 51.966 Cr(6) CrO4-2 1 Cr 51.966 Cs Cs+ 0 Cs 132.905 Cu Cu+2 0 Cu 63.546 Cu(1) Cu+ 0 Cu 63.546 Cu(2) Cu+2 0 Cu 63.546 Dy Dy+3 0 Dy 162.5 Dy(2) Dy+2 0 Dy 162.5 Dy(3) Dy+3 0 Dy 162.5 Dy(4) Dy+4 0 Dy 162.5 Er Er+3 0 Er 167.26 Er(2) Er+2 0 Er 167.26 Er(3) Er+3 0 Er 167.26 Er(4) Er+4 0 Er 167.26 Eu Eu+3 0 Eu 151.964 Eu(2) Eu+2 0 Eu 151.964 Eu(3) Eu+3 0 Eu 151.964 Eu(4) Eu+4 0 Eu 151.964 F F- 0 F 18.998 Fe Fe+2 0 Fe 55.847 Fe(2) Fe+2 0 Fe 55.847 Fe(3) Fe+3 -2 Fe 55.847 Fr Fr+ 0 Fr 223.02 Ga Ga+3 -4 Ga 69.723 Gd Gd+3 0 Gd 157.25 Gd(2) Gd+2 0 Gd 157.25 Gd(3) Gd+3 0 Gd 157.25 Gd(4) Gd+4 0 Gd 157.25 Ge Ge(OH)4 0 Ge 72.61 H H+ -1 H 1.008 H(0) H2 0 H 1.008 H(1) H+ -1 H 1.008 He He 0 He 4.003 Hf Hf+4 -3 Hf 178.49 Hg Hg+2 -2 Hg 200.59 Hg(0) Hg 0 Hg 200.59 Hg(1) Hg2+2 0 Hg 200.59 Hg(2) Hg+2 -2 Hg 200.59 Ho Ho+3 0 Ho 164.93 Ho(2) Ho+2 0 Ho 164.93 Ho(3) Ho+3 0 Ho 164.93 Ho(4) Ho+4 0 Ho 164.93 I I- 0 I 126.904 I(-1) I- 0 I 126.904 I(-0.3) I3- 0 I 126.904 I(1) IO- 0 I 126.904 I(5) IO3- 0 I 126.904 I(7) IO4- 0 I 126.904 In In+3 -2 In 114.82 K K+ 0 K 39.098 Kr Kr 0 Kr 83.8 La La+3 0 La 138.906 La(2) La+2 0 La 138.906 La(3) La+3 0 La 138.906 Li Li+ 0 Li 6.941 Lu Lu+3 0 Lu 174.967 Lu(3) Lu+3 0 Lu 174.967 Lu(4) Lu+4 0 Lu 174.967 Mg Mg+2 0 Mg 24.305 Mn Mn+2 0 Mn 54.938 Mn(2) Mn+2 0 Mn 54.938 Mn(3) Mn+3 0 Mn 54.938 Mn(6) MnO4-2 0 Mn 54.938 Mn(7) MnO4- 0 Mn 54.938 Mo MoO4-2 0 Mo 95.94 N NH3 1 N 14.007 N(-5) CN- 1 N 14.007 N(-3) NH3 1 N 14.007 N(0) N2 0 N 14.007 N(3) NO2- 0 N 14.007 N(5) NO3- 0 N 14.007 Na Na+ 0 Na 22.99 Nb NbO3- 1 Nb 92.906 Nd Nd+3 0 Nd 144.24 Nd(2) Nd+2 0 Nd 144.24 Nd(3) Nd+3 0 Nd 144.24 Nd(4) Nd+4 0 Nd 144.24 Ne Ne 0 Ne 20.18 Ni Ni+2 0 Ni 58.693 O H2O 0 O 15.999 O(-2) H2O 0 O 15.999 O(0) O2 0 O 15.999 P H2PO4- 0 P 30.974 P(-3) PH3 0 P 30.974 P(2) H2PO2- 0 P 30.974 P(3) H2PO3- 0 P 30.974 P(5) H2PO4- 0 P 30.974 Pb Pb+2 0 Pb 207.2 Pd Pd+2 -2 Pd 106.42 Pm Pm+3 0 Pm 144.913 Pm(2) Pm+2 0 Pm 144.913 Pm(3) Pm+3 0 Pm 144.913 Pm(4) Pm+4 0 Pm 144.913 Pr Pr+3 0 Pr 140.908 Pr(2) Pr+2 0 Pr 140.908 Pr(3) Pr+3 0 Pr 140.908 Pr(4) Pr+4 0 Pr 140.908 Pt Pt+2 -2 Pt 195.08 Ra Ra+2 0 Ra 226.025 Rb Rb+ 0 Rb 85.468 Re ReO4- 0 Re 186.27 Rh Rh+2 0 Rh 102.906 Rh(2) Rh+2 0 Rh 102.906 Rh(3) Rh+3 -2 Rh 102.906 Rn Rn 0 Rn 222.018 Ru RuO4-2 0 Ru 101.07 Ru(2) Ru+2 0 Ru 101.07 Ru(3) Ru+3 -2 Ru 101.07 Ru(6) RuO4-2 0 Ru 101.07 S SO4-2 0 S 32.066 S(-2) HS- 1 S 32.066 S(2) S2O3-2 0 S 32.066 S(3) S2O4-2 0 S 32.066 S(4) SO3-2 1 S 32.066 S(5) S2O6-2 0 S 32.066 S(6) SO4-2 0 S 32.066 S(7) S2O8-2 0 S 32.066 S(8) HSO5- 0 S 32.066 Sb Sb(OH)3 0 Sb 121.76 Sc Sc+3 0 Sc 44.956 Se SeO3-2 1 Se 78.96 Se(-2) HSe- 0 Se 78.96 Se(4) SeO3-2 1 Se 78.96 Se(6) SeO4-2 0 Se 78.96 Si H4SiO4 0 Si 28.086 Sm Sm+3 0 Sm 150.36 Sm(2) Sm+2 0 Sm 150.36 Sm(3) Sm+3 0 Sm 150.36 Sm(4) Sm+4 0 Sm 150.36 Sn Sn+2 -2 Sn 118.71 Sr Sr+2 0 Sr 87.62 Tb Tb+3 0 Tb 158.925 Tb(2) Tb+2 0 Tb 158.925 Tb(3) Tb+3 0 Tb 158.925 Tb(4) Tb+4 0 Tb 158.925 Tc TcO4- 0 Tc 97.907 Th Th+4 0 Th 232.038 Ti Ti(OH)4 0 Ti 47.87 Tl Tl+ -1 Tl 204.383 Tl(1) Tl+ -1 Tl 204.383 Tl(3) Tl+3 -3 Tl 204.383 Tm Tm+3 0 Tm 168.934 Tm(2) Tm+2 0 Tm 168.934 Tm(3) Tm+3 0 Tm 168.934 Tm(4) Tm+4 0 Tm 168.934 U UO2+2 0 U 238.029 U(3) U+3 0 U 238.029 U(4) U+4 -4 U 238.029 U(5) UO2+ 0 U 238.029 U(6) UO2+2 0 U 238.029 V VO+2 0 V 50.942 V(2) V+2 0 V 50.942 V(3) V+3 -2 V 50.942 V(4) VO+2 0 V 50.942 V(5) VO2+ -2 V 50.942 W WO4-2 0 W 183.84 Xe Xe 0 Xe 131.29 Y Y+3 0 Y 88.906 Yb Yb+3 0 Yb 173.04 Yb(2) Yb+2 0 Yb 173.04 Yb(3) Yb+3 0 Yb 173.04 Yb(4) Yb+4 0 Yb 173.04 Zn Zn+2 0 Zn 65.39 Zr ZrO+2 -1 Zr 91.224 SOLUTION_SPECIES 1.000H2O = H2O -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; V°: Default value; 1.000H+ = H+ -llnl_gamma 9.0 log_k 0.000 1.000e- = e- -llnl_gamma 3.6 log_k 0.000 #References = S°: 89cox/wag; V°: Default value; 1.000Al+3 = Al+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 06bla/pia; DHf/DHr: 89cox/wag; S°: Internal calculation; Cp: 95pok/hel; V°: 95pok/hel; 1.000Ar = Ar -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000B(OH)3 = B(OH)3 -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch; 1.000Ba+2 = Ba+2 -llnl_gamma 5.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Be+2 = Be+2 -llnl_gamma 8.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Bi+3 = Bi+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ca+2 = Ca+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cd+2 = Cd+2 -llnl_gamma 5.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cs+ = Cs+ -llnl_gamma 2.5 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000F- = F- -llnl_gamma 3.5 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Fr+ = Fr+ -llnl_gamma 4.1 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ga+3 = Ga+3 -llnl_gamma 4.5 log_k 0.000 #References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia; 1.000Ge(OH)4 = Ge(OH)4 -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 05pok/rou; DHf/DHr: Internal calculation; S°: 05pok/rou; Cp: 05pok/rou; V°: 05pok/rou; 1.000H4SiO4 = H4SiO4 -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 01ste; DHf/DHr: Internal calculation; S°: 01ste; Cp: 01ste; V°: 01ste; 1.000He = He -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000Hf+4 = Hf+4 -llnl_gamma 11.6 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000In+3 = In+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000K+ = K+ -llnl_gamma 3.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Kr = Kr -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000Li+ = Li+ -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Mg+2 = Mg+2 -llnl_gamma 6.5 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000MoO4-2 = MoO4-2 -llnl_gamma 4.5 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Na+ = Na+ -llnl_gamma 4.2 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000NbO3- = NbO3- -llnl_gamma 3.6 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ne = Ne -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000Ni+2 = Ni+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 10pal/gam; S°: 10pal/gam; Cp: 97asho/sas; V°: 97asho/sas; 1.000Pb+2 = Pb+2 -llnl_gamma 4.5 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Pd+2 = Pd+2 -llnl_gamma 5.7 log_k 0.000 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pt+2 = Pt+2 -llnl_gamma 5.7 log_k 0.000 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ra+2 = Ra+2 -llnl_gamma 5.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Rb+ = Rb+ -llnl_gamma 2.5 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000ReO4- = ReO4- -llnl_gamma 3.6 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Rn = Rn -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000Sb(OH)3 = Sb(OH)3 -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi; 1.000Sc+3 = Sc+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Sn+2 = Sn+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Sr+2 = Sr+2 -llnl_gamma 5.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000TcO4- = TcO4- -llnl_gamma 3.6 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Th+4 = Th+4 -llnl_gamma 11.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ti(OH)4 = Ti(OH)4 -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 01ste; DHf/DHr: Internal calculation; S°: 01ste; Cp: 01ste; V°: 01ste; 1.000WO4-2 = WO4-2 -llnl_gamma 5.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Xe = Xe -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000Y+3 = Y+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Zn+2 = Zn+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000ZrO+2 = ZrO+2 -llnl_gamma 5.7 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ag+ = Ag+ -llnl_gamma 2.5 log_k 0.000 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Au+ = Au+ -llnl_gamma 4.1 log_k 0.000 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Br- = Br- -llnl_gamma 3.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ce+3 = Ce+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- = Cl- -llnl_gamma 3.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Co+2 = Co+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 98ply/zha; S°: 98ply/zha; Cp: 97asho/sas; V°: 97asho/sas; 1.000CrO4-2 = CrO4-2 -llnl_gamma 4.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cu+2 = Cu+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: 89cox/wag; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Dy+3 = Dy+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Er+3 = Er+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Eu+3 = Eu+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Fe+2 = Fe+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: 95par/kho; DHf/DHr: 95par/kho; S°: Internal calculation; Cp: 88sho/hel,85hel,89bsho/hel,97asho/sas; V°: 88sho/hel,85hel,89bsho/hel,97asho/sas; 1.000Gd+3 = Gd+3 -llnl_gamma 4.5 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2AsO4- = H2AsO4- -llnl_gamma 3.6 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2PO4- = H2PO4- -llnl_gamma 4.2 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000HCO3- = HCO3- -llnl_gamma 4.2 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hg+2 = Hg+2 -llnl_gamma 5.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 88sho/hel; V°: 88sho/hel; 1.000Ho+3 = Ho+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000I- = I- -llnl_gamma 3.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000La+3 = La+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Lu+3 = Lu+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Mn+2 = Mn+2 -llnl_gamma 6.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Nd+3 = Nd+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000NH3 = NH3 -llnl_gamma 3.4 log_k 0.000 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000Pm+3 = Pm+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Pr+3 = Pr+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Rh+2 = Rh+2 -llnl_gamma 5.7 log_k 0.000 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000RuO4-2 = RuO4-2 -llnl_gamma 4.7 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000SeO3-2 = SeO3-2 -llnl_gamma 4.7 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Sm+3 = Sm+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000SO4-2 = SO4-2 -llnl_gamma 4.0 log_k 0.000 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Tb+3 = Tb+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Tl+ = Tl+ -llnl_gamma 2.5 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Tm+3 = Tm+3 -llnl_gamma 8.2 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000UO2+2 = UO2+2 -llnl_gamma 5.7 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000VO+2 = VO+2 -llnl_gamma 5.7 log_k 0.000 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Yb+3 = Yb+3 -llnl_gamma 9.0 log_k 0.000 #References = LogK/DGf: 00deb/cas; DHf/DHr: Internal calculation; S°: 00deb/cas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000Ag+ + 1.000H+ = Ag+2 + 0.500H2O -llnl_gamma 5.7 log_k -12.127 delta_h 23.455 #kJ/mol #88sho/hel -analytic -2.0657583E+2 -3.7349701E-2 9.0186154E+3 7.3591766E+1 -6.0111045E+5 #References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel; 1.000H2AsO4- + 1.000H+ = AsH3 + 2.000O2 -llnl_gamma 3.4 log_k -155.191 delta_h 953.551 #kJ/mol #Internal calculation -analytic 1.0159192E+3 1.6805906E-1 -1.0965043E+5 -3.6367028E+2 4.1273516E+6 #References = LogK/DGf: 92wol; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 0.500O2 + 1.000Au+ + 2.000H+ = Au+3 + 1.000H2O -llnl_gamma 8.2 log_k -4.356 delta_h -59.461 #kJ/mol #97asho/sas -analytic -4.7983001E+2 -7.7833649E-2 2.7682E+4 1.7039826E+2 -1.4050021E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500O2 + 3.000Br- + 2.000H+ = Br3- + 1.000H2O -llnl_gamma 3.6 log_k 7.064 delta_h -45.557 #kJ/mol #88sho/hel -analytic 1.3619685E+3 2.2240213E-1 -7.2926898E+4 -4.9636214E+2 4.5868973E+6 #References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel; 0.500O2 + 1.000Br- = BrO- -llnl_gamma 3.6 log_k -10.916 delta_h 33.468 #kJ/mol #97asho/sas -analytic -1.2104624E+2 -1.7516524E-2 5.9243731E+3 4.1227804E+1 -5.807676E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.500O2 + 1.000Br- = BrO3- -llnl_gamma 3.5 log_k -17.143 delta_h 72.640 #kJ/mol #97asho/sas -analytic -1.8193484E+2 -2.9510238E-2 9.4046739E+3 6.2639673E+1 -1.1512341E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000O2 + 1.000Br- = BrO4- -llnl_gamma 3.6 log_k -33.102 delta_h 158.659 #kJ/mol #97asho/sas -analytic -1.9678304E+2 -3.3029409E-2 6.1026016E+3 6.7668921E+1 -1.2784481E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ce+3 + 0.500H2O = Ce+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -85.049 delta_h 546.025 #kJ/mol #97asho/sas -analytic 2.9075419E+2 4.7815997E-2 -4.4743395E+4 -1.0192219E+2 1.0854253E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000Ce+3 + 1.000H+ = Ce+4 + 0.500H2O -llnl_gamma 11.0 log_k -8.042 delta_h -15.531 #kJ/mol #97asho/sas -analytic -1.0233128E+2 -1.8184502E-2 2.4367778E+3 3.602259E+1 2.1354773E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000HCO3- + 1.000H+ + 1.000H2O = CH4 + 2.000O2 -llnl_gamma 3.4 log_k -144.119 delta_h 863.586 #kJ/mol #01sch/sho -analytic 1.1299846E+3 1.8230999E-1 -1.1241163E+5 -4.0551385E+2 4.6214962E+6 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 0.500O2 + 1.000Cl- = ClO- -llnl_gamma 3.6 log_k -15.088 delta_h 65.482 #kJ/mol #97asho/sas -analytic -1.2718166E+2 -1.754872E-2 4.9174081E+3 4.3632661E+1 -6.3414497E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.250O2 + 1.000Cl- + 1.000H+ = ClO2 + 0.500H2O -llnl_gamma 3.4 log_k -19.629 delta_h 114.140 #kJ/mol #01sch/sho -analytic 1.7204718E+2 4.2430351E-2 -9.6430135E+3 -6.8520713E+1 -2.163155E+5 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 1.000O2 + 1.000Cl- = ClO2- -llnl_gamma 4.2 log_k -23.094 delta_h 112.653 #kJ/mol #97asho/sas -analytic -1.6180729E+2 -2.4105415E-2 5.185463E+3 5.5981341E+1 -8.9021873E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.500O2 + 1.000Cl- = ClO3- -llnl_gamma 3.5 log_k -17.247 delta_h 81.246 #kJ/mol #97asho/sas -analytic -1.7354206E+2 -2.7187912E-2 8.4148495E+3 5.9993555E+1 -1.090937E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000O2 + 1.000Cl- = ClO4- -llnl_gamma 3.5 log_k -15.695 delta_h 62.602 #kJ/mol #89cox/wag -analytic -2.6466887E+2 -4.0304843E-2 1.5479657E+4 9.1600227E+1 -1.5633429E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000HCO3- + 1.000NH3 = CN- + 0.500O2 + 2.000H2O -llnl_gamma 3.0 log_k -56.046 delta_h 344.462 #kJ/mol #97asho/sas -analytic 1.1852296E+2 1.7256275E-2 -2.6323686E+4 -4.0118961E+1 6.9760155E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000HCO3- + 1.000H+ = CO + 0.500O2 + 1.000H2O -llnl_gamma 3.4 log_k -41.717 delta_h 277.073 #kJ/mol #93sho/mck, 01sch/sho -analytic 8.5353613E+2 1.3933213E-1 -6.4626271E+4 -3.0647727E+2 3.4064568E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 93sho/mck, 01sch/sho; S°: 82wag/eva; Cp: 93sho/mck, 01sch/sho; V°: 93sho/mck, 01sch/sho; 1.000CrO4-2 + 4.000H+ = Cr+2 + 1.000O2 + 2.000H2O -llnl_gamma 5.7 log_k -18.750 delta_h 137.506 #kJ/mol #04chi -analytic 1.1149548E+3 1.8590414E-1 -7.1904098E+4 -4.0280473E+2 4.3335266E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000CrO4-2 + 5.000H+ = Cr+3 + 0.750O2 + 2.500H2O -llnl_gamma 9.0 log_k 9.128 delta_h -85.176 #kJ/mol #04chi -analytic 8.890801E+2 1.4807745E-1 -4.8673588E+4 -3.239627E+2 3.6246194E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cu+2 + 0.500H2O = Cu+ + 0.250O2 + 1.000H+ -llnl_gamma 4.1 log_k -18.665 delta_h 145.276 #kJ/mol #Internal calculation -analytic 2.6404224E+2 4.2104999E-2 -2.1941255E+4 -9.3632203E+1 8.9047513E+5 #References = LogK/DGf: 95bev/pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97asho/sas; V°: 97asho/sas; 1.000Dy+3 + 0.500H2O = Dy+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -62.473 delta_h 418.654 #kJ/mol #97asho/sas -analytic 2.5338772E+2 4.1769908E-2 -3.5297323E+4 -8.8675977E+1 8.4420174E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000Dy+3 + 1.000H+ = Dy+4 + 0.500H2O -llnl_gamma 11.6 log_k -54.001 delta_h 249.675 #kJ/mol #97asho/sas -analytic -1.3014124E+2 -2.2813493E-2 -9.0016229E+3 4.5808809E+1 -1.933883E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Er+3 + 0.500H2O = Er+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -71.562 delta_h 472.033 #kJ/mol #97asho/sas -analytic 2.6052089E+2 4.2799355E-2 -3.862162E+4 -9.1065942E+1 8.9169235E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000Er+3 + 1.000H+ = Er+4 + 0.500H2O -llnl_gamma 11.6 log_k -75.112 delta_h 373.168 #kJ/mol #97asho/sas -analytic -1.2530275E+2 -2.2044431E-2 -1.5788749E+4 4.4287713E+1 1.1753294E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Eu+3 + 0.500H2O = Eu+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -27.435 delta_h 217.412 #kJ/mol #97asho/sas -analytic 2.6616359E+2 4.3567406E-2 -2.5786489E+4 -9.3179264E+1 9.3036057E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000Eu+3 + 1.000H+ = Eu+4 + 0.500H2O -llnl_gamma 11.6 log_k -82.808 delta_h 412.235 #kJ/mol #97asho/sas -analytic -1.2383718E+2 -2.1933829E-2 -1.8160786E+4 4.3614331E+1 4.9714097E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000Fe+2 + 1.000H+ = Fe+3 + 0.500H2O -llnl_gamma 9.0 log_k 8.490 delta_h -98.882 #kJ/mol #95par/kho -analytic -2.1237347E+2 -3.5300742E-2 1.6059769E+4 7.4699184E+1 -6.5023697E+5 #References = LogK/DGf: 95par/kho; DHf/DHr: 95par/kho; S°: Internal calculation; Cp: 88sho/hel,89bsho/hel,97asho/sas; V°: 88sho/hel,89bsho/hel,97asho/sas; 1.000Gd+3 + 0.500H2O = Gd+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -86.376 delta_h 544.603 #kJ/mol #97asho/sas -analytic 2.6214444E+2 4.3067982E-2 -4.2833109E+4 -9.2162612E+1 9.2020863E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000Gd+3 + 1.000H+ = Gd+4 + 0.500H2O -llnl_gamma 11.6 log_k -104.366 delta_h 523.048 #kJ/mol #97asho/sas -analytic -1.2786149E+2 -2.2564553E-2 -2.3882817E+4 4.4446215E+1 3.0823378E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2O = H2 + 0.500O2 -CO2_llnl_gamma log_k -46.072 delta_h 275.563 #kJ/mol #82wag/eva -analytic 1.9265056E+2 3.3721081E-2 -2.6491918E+4 -6.8822847E+1 9.2233489E+5 #References = LogK/DGf: 82wag/eva; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000H2AsO4- = H2AsO3- + 0.500O2 -llnl_gamma 3.6 log_k -30.565 delta_h 194.451 #kJ/mol #Internal calculation -analytic 2.9326858E+2 4.8837428E-2 -2.8918064E+4 -1.0408625E+2 1.4357821E+6 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000H2PO4- = H2PO2- + 1.000O2 -llnl_gamma 3.6 log_k -112.399 delta_h 676.548 #kJ/mol #97asho/sas -analytic 1.8769881E+2 3.1944112E-2 -4.739622E+4 -6.5257081E+1 9.6182174E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2PO4- = H2PO3- + 0.500O2 -llnl_gamma 3.6 log_k -52.346 delta_h 327.001 #kJ/mol #97asho/sas -analytic 1.659843E+2 2.7516639E-2 -2.7411128E+4 -5.7969451E+1 7.8621025E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hg+2 + 1.000H2O = Hg + 0.500O2 + 2.000H+ -llnl_gamma 3.4 log_k -20.650 delta_h 122.056 #kJ/mol #Internal calculation -analytic 5.567368E+2 8.8981012E-2 -4.1241387E+4 -1.9964099E+2 2.5251708E+6 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 2.000Hg+2 + 1.000H2O = Hg2+2 + 0.500O2 + 2.000H+ -llnl_gamma 5.7 log_k -12.202 delta_h 106.213 #kJ/mol #89cox/wag -analytic 4.3669923E+2 6.636136E-2 -2.950441E+4 -1.5596628E+2 1.4400152E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ho+3 + 0.500H2O = Ho+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -68.776 delta_h 452.641 #kJ/mol #97asho/sas -analytic 2.5769347E+2 4.248515E-2 -3.7417222E+4 -9.0309823E+1 8.7355517E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Ho+3 = Ho+4 + 0.500H2O -llnl_gamma 11.6 log_k -74.452 delta_h 365.036 #kJ/mol #97asho/sas -analytic -1.276532E+2 -2.2327255E-2 -1.5242785E+4 4.4848358E+1 7.3282983E+2 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H+ + 1.000SO4-2 = HS- + 2.000O2 -llnl_gamma 3.5 log_k -138.286 delta_h 868.772 #kJ/mol #89cox/wag -analytic 1.0441949E+3 1.6867211E-1 -1.0699853E+5 -3.7241269E+2 4.2326498E+6 #References = LogK/DGf: 89cox/wag; DHf/DHr: Internal calculation; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000H+ + 1.000SeO3-2 = HSe- + 1.500O2 -llnl_gamma 3.6 log_k -76.843 delta_h 507.180 #kJ/mol #97asho/sas -analytic 9.3740801E+2 1.5397659E-1 -8.0712835E+4 -3.3560865E+2 3.6442044E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500O2 + 1.000H+ + 1.000SO4-2 = HSO5- -llnl_gamma 3.6 log_k -17.206 delta_h 139.702 #kJ/mol #97asho/sas -analytic 8.9276273E+2 1.4042283E-1 -5.7825135E+4 -3.2083246E+2 3.1992215E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500O2 + 2.000H+ + 3.000I- = I3- + 1.000H2O -llnl_gamma 3.6 log_k 24.722 delta_h -160.570 #kJ/mol #88sho/hel -analytic 1.2968773E+3 2.1633197E-1 -6.2986978E+4 -4.745428E+2 4.3406424E+6 #References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel; 0.500O2 + 1.000I- = IO- -llnl_gamma 3.6 log_k -0.903 delta_h -44.643 #kJ/mol #97asho/sas -analytic -1.9219512E+2 -2.7455202E-2 1.416178E+4 6.5360203E+1 -8.6678728E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.500O2 + 1.000I- = IO3- -llnl_gamma 4.2 log_k 17.682 delta_h -146.163 #kJ/mol #97asho/sas -analytic -2.5165335E+2 -3.9000199E-2 2.4364112E+4 8.6615705E+1 -1.3404455E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000O2 + 1.000I- = IO4- -llnl_gamma 3.5 log_k 6.964 delta_h -70.413 #kJ/mol #97asho/sas -analytic -1.9590107E+2 -3.1524372E-2 1.8212262E+4 6.6978074E+1 -1.2936854E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000La+3 + 0.500H2O = La+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -84.756 delta_h 547.220 #kJ/mol #97asho/sas -analytic 2.6287551E+2 4.2546551E-2 -4.2906034E+4 -9.1684447E+1 9.2966642E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Lu+3 = Lu+4 + 0.500H2O -llnl_gamma 11.6 log_k -115.134 delta_h 603.486 #kJ/mol #97asho/sas -analytic -1.2896046E+2 -2.2767194E-2 -2.7489803E+4 4.568381E+1 -2.0041519E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Mn+2 = Mn+3 + 0.500H2O -llnl_gamma 8.2 log_k -4.011 delta_h -46.901 #kJ/mol #97asho/sas -analytic -2.3287768E+2 -3.8806757E-2 1.4675899E+4 8.0810977E+1 -7.7758964E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.250O2 + 1.000Mn+2 + 1.500H2O = MnO4- + 3.000H+ -llnl_gamma 3.5 log_k -20.212 delta_h 121.692 #kJ/mol #97asho/sas -analytic -3.2811384E+2 -5.8736046E-2 1.5072728E+4 1.1872115E+2 -1.6808293E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000O2 + 1.000Mn+2 + 2.000H2O = MnO4-2 + 4.000H+ -llnl_gamma 4.7 log_k -32.328 delta_h 149.866 #kJ/mol #97asho/sas -analytic -1.1203039E+3 -1.8684747E-1 5.7477125E+4 4.0431449E+2 -4.4041732E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.500O2 + 2.000NH3 = N2 + 3.000H2O -llnl_gamma 3.4 log_k 116.443 delta_h -686.530 #kJ/mol #89bsho/hel, 01sch/sho -analytic 7.0576158E+1 1.0950681E-3 3.0221983E+4 -2.4321491E+1 3.8731568E+5 #References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000Nd+3 + 0.500H2O = Nd+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -65.771 delta_h 434.239 #kJ/mol #97asho/sas -analytic 2.696062E+2 4.4271549E-2 -3.7629698E+4 -9.4383931E+1 9.9389245E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Nd+3 = Nd+4 + 0.500H2O -llnl_gamma 11.6 log_k -61.771 delta_h 293.526 #kJ/mol #97asho/sas -analytic -1.1141075E+2 -1.9899192E-2 -1.3023676E+4 3.9410268E+1 1.5432344E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.500O2 + 1.000NH3 = NO2- + 1.000H+ + 1.000H2O -llnl_gamma 3.0 log_k 46.860 delta_h -290.816 #kJ/mol #97asho/sas -analytic -7.8034587E+2 -1.3125158E-1 6.0315794E+4 2.8208575E+2 -3.0192075E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000O2 + 1.000NH3 = NO3- + 1.000H+ + 1.000H2O -llnl_gamma 3.0 log_k 62.095 delta_h -386.885 #kJ/mol #97asho/sas -analytic -8.298251E+2 -1.3990188E-1 6.8801778E+4 2.9915423E+2 -3.3217568E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H2O = O2 + 4.000e- + 4.000H+ -CO2_llnl_gamma log_k -85.991 delta_h 559.524 #kJ/mol #By convention -analytic 2.1432049E+2 3.0024652E-2 -4.2123282E+4 -7.2110967E+1 9.2916949E+5 #References = LogK/DGf: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000H+ + 1.000H2PO4- = PH3 + 2.000O2 -llnl_gamma 3.4 log_k -209.460 delta_h 1267.173 #kJ/mol #01sch/sho -analytic 1.0769538E+3 1.7678067E-1 -1.3003273E+5 -3.8505428E+2 4.4271547E+6 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 0.500H2O + 1.000Pm+3 = Pm+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -69.363 delta_h 453.618 #kJ/mol #97asho/sas -analytic 2.8289543E+2 4.6479471E-2 -3.9433524E+4 -9.926782E+1 1.0468456E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Pm+3 = Pm+4 + 0.500H2O -llnl_gamma 11.6 log_k -69.248 delta_h 335.579 #kJ/mol #97asho/sas -analytic -1.0627208E+2 -1.8767757E-2 -1.5494016E+4 3.7442915E+1 1.721935E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500H2O + 1.000Pr+3 = Pr+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -72.735 delta_h 476.108 #kJ/mol #97asho/sas -analytic 2.8312534E+2 4.6471003E-2 -4.0327333E+4 -9.9314903E+1 1.0037468E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Pr+3 = Pr+4 + 0.500H2O -llnl_gamma 11.6 log_k -44.399 delta_h 195.239 #kJ/mol #97asho/sas -analytic -1.1184137E+2 -1.965722E-2 -7.6440681E+3 3.9434097E+1 1.2128573E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Rh+2 = Rh+3 + 0.500H2O -llnl_gamma 8.2 log_k 3.356 delta_h -71.111 #kJ/mol #97asho/sas,98sas/sho -analytic -2.3440826E+2 -3.8914188E-2 1.6283112E+4 8.2344542E+1 -8.0035213E+5 #References = LogK/DGf: 97asho/sas,98sas/sho; DHf/DHr: Internal calculation; S°: 97asho/sas,98sas/sho; Cp: 97asho/sas,98sas/sho; V°: 97asho/sas,98sas/sho; 4.000H+ + 1.000RuO4-2 = Ru+2 + 1.000O2 + 2.000H2O -llnl_gamma 5.7 log_k 1.395 delta_h 24.827 #kJ/mol #98sas/sho -analytic 1.1196807E+3 1.8646373E-1 -6.5402676E+4 -4.0488377E+2 4.208257E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 5.000H+ + 1.000RuO4-2 = Ru+3 + 0.750O2 + 2.500H2O -llnl_gamma 8.2 log_k 18.832 delta_h -127.532 #kJ/mol #98sas/sho -analytic 8.9598641E+2 1.4928792E-1 -4.5813524E+4 -3.2628208E+2 3.4987171E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 2.000H+ + 2.000SO4-2 = S2O3-2 + 2.000O2 + 1.000H2O -llnl_gamma 4.7 log_k -133.412 delta_h 856.296 #kJ/mol #04chi -analytic 1.733264E+3 2.7921733E-1 -1.4472362E+5 -6.2187136E+2 6.6012742E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H+ + 2.000SO4-2 = S2O4-2 + 1.500O2 + 1.000H2O -llnl_gamma 5.0 log_k -118.280 delta_h 761.149 #kJ/mol #04chi -analytic 1.6894585E+3 2.7120058E-1 -1.3662141E+5 -6.0678585E+2 6.3189982E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H+ + 2.000SO4-2 = S2O6-2 + 0.500O2 + 1.000H2O -llnl_gamma 4.7 log_k -50.822 delta_h 353.589 #kJ/mol #97asho/sas -analytic 1.5608113E+3 2.4832074E-1 -1.0652801E+5 -5.6213548E+2 5.5642127E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500O2 + 2.000H+ + 2.000SO4-2 = S2O8-2 + 1.000H2O -llnl_gamma 4.7 log_k -22.379 delta_h 194.179 #kJ/mol #97asho/sas -analytic 1.5275233E+3 2.4060196E-1 -9.4877209E+4 -5.5036229E+2 5.1929459E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500O2 + 1.000SeO3-2 = SeO4-2 -llnl_gamma 4.7 log_k 13.984 delta_h -83.838 #kJ/mol #97asho/sas -analytic -6.0078355E+1 -1.0501177E-2 8.5380155E+3 2.1213969E+1 -3.4988829E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500H2O + 1.000Sm+3 = Sm+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -47.959 delta_h 326.954 #kJ/mol #97asho/sas -analytic 2.7485159E+2 4.485272E-2 -3.2509759E+4 -9.6492889E+1 1.0329494E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Sm+3 = Sm+4 + 0.500H2O -llnl_gamma 11.6 log_k -65.876 delta_h 315.460 #kJ/mol #97asho/sas -analytic -1.1123676E+2 -1.984073E-2 -1.4161055E+4 3.9233434E+1 1.5042396E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000SO4-2 = SO3-2 + 0.500O2 -llnl_gamma 4.5 log_k -46.615 delta_h 272.213 #kJ/mol #04chi -analytic 9.6718748E+1 1.4160691E-2 -2.0794588E+4 -3.379293E+1 5.1632043E+5 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas; 0.500H2O + 1.000Tb+3 = Tb+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -80.211 delta_h 519.284 #kJ/mol #97asho/sas -analytic 2.6941166E+2 4.4396063E-2 -4.1621672E+4 -9.4441058E+1 9.2702692E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Tb+3 = Tb+4 + 0.500H2O -llnl_gamma 11.6 log_k -30.765 delta_h 115.296 #kJ/mol #97asho/sas -analytic -1.2122705E+2 -2.1217186E-2 -2.6720181E+3 4.2547035E+1 4.1770292E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500O2 + 2.000H+ + 1.000Tl+ = Tl+3 + 1.000H2O -llnl_gamma 8.2 log_k -0.281 delta_h -88.585 #kJ/mol #Internal calculation -analytic -4.3040062E+2 -7.0560248E-2 2.5654218E+4 1.5265599E+2 -1.1222464E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500H2O + 1.000Tm+3 = Tm+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -59.834 delta_h 403.343 #kJ/mol #97asho/sas -analytic 2.5313548E+2 4.188993E-2 -3.4630377E+4 -8.8536341E+1 8.6845097E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Tm+3 = Tm+4 + 0.500H2O -llnl_gamma 11.6 log_k -73.646 delta_h 363.428 #kJ/mol #97asho/sas -analytic -1.2502148E+2 -2.192915E-2 -1.5289373E+4 4.4080624E+1 1.0675332E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H+ + 1.000UO2+2 = U+3 + 0.750O2 + 0.500H2O -llnl_gamma 8.2 log_k -65.059 delta_h 377.959 #kJ/mol #97asho/sas -analytic -1.2165579E+2 -1.6192696E-2 -1.3049369E+4 4.4151415E+1 -3.6065373E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H+ + 1.000UO2+2 = U+4 + 0.500O2 + 1.000H2O -llnl_gamma 11.6 log_k -33.959 delta_h 136.009 #kJ/mol #97asho/sas -analytic -2.4123228E+2 -3.7333955E-2 2.6508413E+3 8.5983925E+1 -2.8871609E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500H2O + 1.000UO2+2 = UO2+ + 0.250O2 + 1.000H+ -llnl_gamma 4.1 log_k -20.024 delta_h 133.821 #kJ/mol #97asho/sas -analytic 8.7871001E+1 1.6321781E-2 -9.3669369E+3 -3.2601192E+1 -6.0038674E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000VO+2 = V+2 + 0.500O2 -llnl_gamma 5.7 log_k -41.545 delta_h 254.628 #kJ/mol #97asho/sas -analytic -1.8041661E+0 6.8848917E-4 -1.1973287E+4 8.7119464E-1 -1.7271618E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H+ + 1.000VO+2 = V+3 + 0.250O2 + 0.500H2O -llnl_gamma 8.2 log_k -15.722 delta_h 79.603 #kJ/mol #97asho/sas -analytic -1.8237496E+2 -2.9049355E-2 6.1110664E+3 6.5528679E+1 -6.5152594E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 0.500H2O + 1.000VO+2 = VO2+ + 1.000H+ -llnl_gamma 4.1 log_k 4.581 delta_h -17.379 #kJ/mol #97asho/sas -analytic -1.2924216E+0 -1.0283206E-3 4.7835316E+3 -1.1847103E+0 -6.16289E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.500H2O + 1.000Yb+3 = Yb+2 + 0.250O2 + 1.000H+ -llnl_gamma 5.7 log_k -39.298 delta_h 279.889 #kJ/mol #97asho/sas -analytic 2.571531E+2 4.2349491E-2 -2.8687646E+4 -9.0196375E+1 9.1791424E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.250O2 + 1.000H+ + 1.000Yb+3 = Yb+4 + 0.500H2O -llnl_gamma 11.6 log_k -93.279 delta_h 473.623 #kJ/mol #97asho/sas -analytic -1.2230787E+2 -2.145478E-2 -2.1306744E+4 4.3034565E+1 3.5807202E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000CH4 + 1.000H2O + 2.000Hg+2 = (CH3Hg)2OH+ + 3.000H+ -llnl_gamma 4.1 log_k 3.849 delta_h -51.052 #kJ/mol #Internal calculation -analytic 1.9165425E+2 1.7962117E-2 -1.9485039E+3 -7.3196661E+1 -4.8935722E+5 #References = LogK/DGf: 18bla/bur; DHf/DHr: Internal calculation; S°: 03ald/gan; V°: Default value; 1.000Ag+ + 1.000HCO3- = Ag(CO3)- + 1.000H+ -llnl_gamma 3.6 log_k -7.625 delta_h -7.695 #kJ/mol #97sve/sho -analytic 8.4651911E+1 7.6902515E-3 -5.3377686E+3 -3.2488438E+1 3.3101911E+5 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ag+ + 2.000HCO3- = Ag(CO3)2-3 + 2.000H+ -llnl_gamma 6.7 log_k -18.473 delta_h 1.186 #kJ/mol #97sve/sho -analytic -4.5906328E+2 -8.623166E-2 2.0926686E+4 1.6500764E+2 -1.0835008E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ag+ + 2.000HS- = Ag(HS)2- -llnl_gamma 4.5 log_k 17.586 delta_h -101.091 #kJ/mol #01aki/zot -analytic 1.0878147E+3 1.6776771E-1 -5.5051572E+4 -3.9447291E+2 3.5995721E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Ag+ + 2.000H2O = Ag(OH)2- + 2.000H+ -llnl_gamma 3.6 log_k -24.211 delta_h 93.954 #kJ/mol #01aki/zot -analytic -4.135193E+2 -7.571665E-2 1.805993E+4 1.4901557E+2 -1.548508E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Ag+ + 1.000Cl- = AgCl -llnl_gamma 3.4 log_k 3.272 delta_h -17.432 #kJ/mol #01aki/zot -analytic 7.1369211E+2 1.1107321E-1 -3.7903218E+4 -2.5933589E+2 2.2491237E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Ag+ + 2.000Cl- = AgCl2- -llnl_gamma 3.6 log_k 5.170 delta_h -23.043 #kJ/mol #01aki/zot, d'apres 97tag/zot -analytic 1.0064096E+3 1.5935015E-1 -5.3662662E+4 -3.6576419E+2 3.2264014E+6 #References = LogK/DGf: 01aki/zot, d'apres 97tag/zot; DHf/DHr: Internal calculation; S°: 01aki/zot, d'apres 97tag/zot; Cp: 01aki/zot, d'apres 97tag/zot; V°: 01aki/zot, d'apres 97tag/zot; 1.000Ag+ + 3.000Cl- = AgCl3-2 -llnl_gamma 4.7 log_k 5.169 delta_h -46.497 #kJ/mol #97sve/sho -analytic 8.7083926E+2 1.3955959E-1 -4.8314056E+4 -3.1621901E+2 3.3094144E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ag+ + 4.000Cl- = AgCl4-3 -llnl_gamma 6.7 log_k 3.855 delta_h -67.726 #kJ/mol #97sve/sho -analytic 8.4377547E+2 1.3674414E-1 -4.7783794E+4 -3.072141E+2 3.5342408E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ag+ + 1.000F- = AgF -llnl_gamma 3.4 log_k 0.440 delta_h 0.604 #kJ/mol #97sve/sho -analytic 8.2472648E+2 1.2774281E-1 -4.5563406E+4 -2.9905362E+2 2.7055728E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ag+ + 1.000H2AsO3- = AgH2AsO3 -llnl_gamma 3.4 log_k 1.220 delta_h -12.252 #kJ/mol #Internal calculation -analytic 5.3646422E+2 7.7632696E-2 -2.7629696E+4 -1.9492959E+2 1.4774385E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Ag+ + 1.000HS- = AgHS -llnl_gamma 3.4 log_k 13.606 delta_h -74.337 #kJ/mol #01aki/zot -analytic 7.3849739E+2 1.1292029E-1 -3.6606291E+4 -2.6768104E+2 2.3626874E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Ag+ + 1.000NO3- = AgNO3 -llnl_gamma 3.4 log_k -0.251 delta_h -3.135 #kJ/mol #97sve/sho -analytic 7.2342807E+2 1.0880002E-1 -4.1228371E+4 -2.6135579E+2 2.5664439E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ag+ + 1.000H2O = AgO- + 2.000H+ -llnl_gamma 3.6 log_k -24.007 delta_h 111.633 #kJ/mol #97asho/sas -analytic -5.0250177E+2 -8.6787958E-2 2.2083116E+4 1.8205904E+2 -1.7947767E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ag+ + 1.000H2O = AgOH + 1.000H+ -llnl_gamma 3.4 log_k -11.899 delta_h 49.628 #kJ/mol #01aki/zot -analytic 9.769342E+1 9.0769024E-3 -7.3868208E+3 -3.6006528E+1 1.3979518E+5 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Al+3 + 2.000H2O = Al(OH)2+ + 2.000H+ -llnl_gamma 4.1 log_k -10.592 delta_h 111.289 #kJ/mol #Internal calculation -analytic 3.0242922E+2 5.4151633E-2 -2.1423313E+4 -1.0832543E+2 9.5398614E+5 #References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 95pok/hel; V°: 95pok/hel; 1.000Al+3 + 1.000H2AsO4- = AlAsO4 + 2.000H+ -llnl_gamma 3.4 log_k -8.064 delta_h 65.458 #kJ/mol #Internal calculation -analytic 8.077854E+2 1.3844116E-1 -4.1721191E+4 -2.9797478E+2 1.7892057E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Al+3 + 1.000F- = AlF+2 -llnl_gamma 5.7 log_k 6.980 delta_h -0.346 #kJ/mol #Internal calculation -analytic 8.4659404E+2 1.3829049E-1 -4.6152377E+4 -3.0616536E+2 2.8034064E+6 #References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch; 1.000Al+3 + 2.000F- = AlF2+ -llnl_gamma 4.1 log_k 12.500 delta_h 0.419 #kJ/mol #Internal calculation -analytic 1.7120205E+3 2.7760152E-1 -9.3606823E+4 -6.1919223E+2 5.6733803E+6 #References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch; 1.000Al+3 + 3.000F- = AlF3 -llnl_gamma 3.4 log_k 16.550 delta_h 0.615 #kJ/mol #Internal calculation -analytic 2.565441E+3 4.1575855E-1 -1.401093E+5 -9.2872423E+2 8.4579433E+6 #References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch; 1.000Al+3 + 4.000F- = AlF4- -llnl_gamma 3.6 log_k 18.930 delta_h 0.823 #kJ/mol #Internal calculation -analytic 2.6280275E+3 4.2423088E-1 -1.4521848E+5 -9.4931749E+2 8.9344578E+6 #References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch; 1.000Al+3 + 1.000H2AsO3- = AlH2AsO3+2 -llnl_gamma 5.7 log_k 7.164 delta_h -48.031 #kJ/mol #Internal calculation -analytic 6.4521956E+2 9.4795631E-2 -3.1633386E+4 -2.3465102E+2 1.8141781E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Al+3 + 1.000H2AsO4- = AlH2AsO4+2 -llnl_gamma 5.7 log_k 2.506 delta_h -19.575 #kJ/mol #Internal calculation -analytic 8.4061174E+2 1.276049E-1 -4.6025869E+4 -3.0453835E+2 2.8251201E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Al+3 + 1.000H2PO4- = AlH2PO4+2 -llnl_gamma 5.7 log_k 3.098 #References = LogK/DGf: 79lan; #References = LogK/DGf: 79lan; V°: Default value; 1.000Al+3 + 1.000H4SiO4 = AlH3SiO4+2 + 1.000H+ -llnl_gamma 5.7 log_k -2.380 delta_h 75.017 #kJ/mol #Internal calculation -analytic -9.904345E+0 1.4796271E-2 3.7896393E+3 4.3274439E-1 -9.4835712E+5 #References = LogK/DGf: 01tag/sch, d'apres 98sal/pok; DHf/DHr: Internal calculation; S°: 01tag/sch, d'apres 98sal/pok; Cp: 01tag/sch, d'apres 98sal/pok; V°: 01tag/sch, d'apres 98sal/pok; 1.000Al+3 + 1.000H2AsO4- = AlHAsO4+ + 1.000H+ -llnl_gamma 4.1 log_k -0.495 delta_h 11.152 #kJ/mol #Internal calculation -analytic 7.5176456E+2 1.1972102E-1 -3.8060264E+4 -2.7529115E+2 1.8570525E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Al+3 + 1.000H2PO4- = AlHPO4+ + 1.000H+ -llnl_gamma 4.1 log_k 0.188 #References = LogK/DGf: 79lan; #References = LogK/DGf: 79lan; V°: Default value; 1.000Al+3 + 2.000H2O = AlO2- + 4.000H+ -llnl_gamma 3.6 log_k -22.872 delta_h 180.865 #kJ/mol #Internal calculation -analytic -1.7804863E+2 -2.6890119E-2 1.8671726E+3 6.6832788E+1 -7.5043954E+5 #References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel; 1.000Al+3 + 1.000H2O = AlOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -4.951 delta_h 49.758 #kJ/mol #Internal calculation -analytic 1.6145683E+2 3.018521E-2 -1.1505645E+4 -5.8055033E+1 6.0767162E+5 #References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel; 1.000Al+3 + 1.000SO4-2 = AlSO4+ -llnl_gamma 4.1 log_k 3.170 delta_h 18.869 #kJ/mol #Internal calculation -analytic 2.3192944E+3 3.6142931E-1 -1.3493481E+5 -8.3585467E+2 8.6188288E+6 #References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch; 1.000H2AsO3- + 1.000H+ = As(OH)3 -llnl_gamma 3.4 log_k 9.256 delta_h -28.176 #kJ/mol #Internal calculation -analytic 1.4914501E+1 1.5860089E-2 4.9992329E+3 -8.7541689E+0 -4.8834206E+5 #References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok; 1.000H2AsO4- = AsO4-3 + 2.000H+ -llnl_gamma 6.7 log_k -18.460 delta_h 21.915 #kJ/mol #Internal calculation -analytic -1.5040869E+3 -2.4299555E-1 8.2186102E+4 5.4181996E+2 -5.1803237E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Au+ + 2.000HS- = Au(HS)2- -llnl_gamma 3.6 log_k 31.536 delta_h -167.409 #kJ/mol #01aki/zot -analytic 9.748226E+2 1.4920268E-1 -4.5421601E+4 -3.5238686E+2 3.2474397E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Au+ + 2.000H2O = Au(OH)2- + 2.000H+ -llnl_gamma 3.6 log_k -5.721 delta_h -13.559 #kJ/mol #01aki/zot -analytic -3.494866E+2 -6.242185E-2 2.0985378E+4 1.2457024E+2 -1.4445224E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Au+ + 1.000Cl- = AuCl -llnl_gamma 3.4 log_k 7.933 delta_h -30.688 #kJ/mol #01aki/zot -analytic 6.4840507E+2 1.032363E-1 -3.2991539E+4 -2.3553558E+2 1.9751403E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Au+ + 2.000Cl- = AuCl2- -llnl_gamma 3.6 log_k 9.581 delta_h -50.195 #kJ/mol #01aki/zot -analytic 4.8501548E+2 9.8333012E-2 -2.0375873E+4 -1.8189812E+2 1.2163919E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Au+ + 3.000Cl- = AuCl3-2 -llnl_gamma 4.7 log_k 9.328 delta_h -47.873 #kJ/mol #97sve/sho -analytic 8.3327128E+2 1.3522704E-1 -4.309319E+4 -3.0328218E+2 2.7313036E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Au+3 + 4.000Cl- = AuCl4- -llnl_gamma 3.6 log_k -41.913 delta_h 199.282 #kJ/mol #97sve/sho -analytic 2.3945086E+3 3.9162149E-1 -1.4143643E+5 -8.7562563E+2 7.8115342E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Au+ + 1.000HS- = AuHS -llnl_gamma 3.4 log_k 26.016 delta_h -134.682 #kJ/mol #01aki/zot -analytic 8.1512422E+2 1.1760818E-1 -3.866775E+4 -2.9300397E+2 2.7146428E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Au+ + 1.000H2O = AuOH + 1.000H+ -llnl_gamma 3.4 log_k 11.022 delta_h -77.054 #kJ/mol #01aki/zot -analytic 5.8273598E+1 4.3431282E-3 1.494163E+3 -2.171427E+1 1.5336336E+4 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000B(OH)3 + 1.000H2O = B(OH)4- + 1.000H+ -llnl_gamma 3.6 log_k -9.243 delta_h 14.069 #kJ/mol #95pok/sch -analytic -4.9835469E+2 -7.5280182E-2 2.8167289E+4 1.7713522E+2 -1.8868727E+6 #References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch; 1.000Ba+2 + 1.000HCO3- = Ba(HCO3)+ -llnl_gamma 4.1 log_k 1.034 delta_h 20.309 #kJ/mol #95sho/kor -analytic 9.2777025E+2 1.4836435E-1 -5.2385332E+4 -3.3564941E+2 3.1355167E+6 #References = LogK/DGf: 95sho/kor; DHf/DHr: Internal calculation; S°: 95sho/kor; Cp: 95sho/kor; V°: 95sho/kor; 1.000Ba+2 + 1.000Cl- = BaCl+ -llnl_gamma 4.1 log_k -0.485 delta_h 12.964 #kJ/mol #97sve/sho -analytic 8.0870215E+2 1.3328694E-1 -4.4762732E+4 -2.9445734E+2 2.6511191E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ba+2 + 1.000HCO3- = BaCO3 + 1.000H+ -llnl_gamma 3.4 log_k -7.667 delta_h 31.514 #kJ/mol #97sve/sho -analytic 6.6880196E+2 1.1124343E-1 -3.5057328E+4 -2.4693095E+2 1.6855493E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ba+2 + 1.000F- = BaF+ -llnl_gamma 4.1 log_k -0.143 delta_h 8.925 #kJ/mol #97sve/sho -analytic 8.2520409E+2 1.3420958E-1 -4.5844967E+4 -3.0007457E+2 2.7483725E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Ba+2 = BaH2AsO3+ -llnl_gamma 4.1 log_k 1.463 delta_h 0.131 #kJ/mol #Internal calculation -analytic 5.5629355E+2 9.1454479E-2 -2.8046882E+4 -2.0384348E+2 1.4551382E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Ba+2 + 1.000H2O = BaOH+ + 1.000H+ -llnl_gamma 4.1 log_k -13.494 delta_h 87.599 #kJ/mol #97asho/sas -analytic 1.3006325E+2 2.1000683E-2 -9.5608825E+3 -4.8012131E+1 9.3482077E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Be+2 + 1.000Cl- = BeCl+ -llnl_gamma 4.1 log_k -4.835 delta_h 165.918 #kJ/mol #97sve/sho -analytic 1.4310104E+3 2.2804857E-1 -8.534038E+4 -5.1275469E+2 4.548962E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Be+2 + 2.000Cl- = BeCl2 -llnl_gamma 3.4 log_k -5.683 delta_h 201.449 #kJ/mol #97sve/sho -analytic 1.6810811E+3 2.6952393E-1 -1.0259918E+5 -6.0096501E+2 5.6932323E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Be+2 + 1.000F- = BeF+ -llnl_gamma 4.1 log_k 0.482 delta_h 115.257 #kJ/mol #97sve/sho -analytic 1.2125411E+3 1.939563E-1 -7.142536E+4 -4.3427562E+2 3.9345255E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Be+2 + 2.000F- = BeF2 -llnl_gamma 3.4 log_k 4.592 delta_h 111.529 #kJ/mol #97sve/sho -analytic 1.83336E+3 2.9242206E-1 -1.068392E+5 -6.5781627E+2 6.2323368E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Be+2 + 3.000F- = BeF3-1 -llnl_gamma 3.6 log_k 7.422 delta_h 140.733 #kJ/mol #97sve/sho -analytic 2.6366086E+3 4.178817E-1 -1.5336649E+5 -9.4609351E+2 9.0370795E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Be+2 + 4.000F- = BeF4-2 -llnl_gamma 4.7 log_k 8.062 delta_h 247.651 #kJ/mol #97sve/sho -analytic 3.2813241E+3 5.1721885E-1 -1.9459117E+5 -1.1727229E+3 1.1290997E+7 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Be+2 + 1.000H2O = BeO + 2.000H+ -llnl_gamma 3.4 log_k -13.655 delta_h 65.815 #kJ/mol #97asho/sas -analytic 3.45563E+2 5.5462702E-2 -2.1609247E+4 -1.270664E+2 9.9034524E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Be+2 + 2.000H2O = BeO2-2 + 4.000H+ -llnl_gamma 4.7 log_k -37.389 delta_h 160.594 #kJ/mol #97asho/sas -analytic -9.5944815E+2 -1.5864289E-1 4.2532511E+4 3.4763186E+2 -2.9769447E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Be+2 + 1.000H2O = BeOH+ + 1.000H+ -llnl_gamma 4.1 log_k -5.372 delta_h 27.518 #kJ/mol #97asho/sas -analytic 2.1898601E+2 3.2917783E-2 -1.423665E+4 -7.9061373E+1 8.1865103E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000B(OH)3 + 4.000F- + 3.000H+ = BF4- + 3.000H2O -llnl_gamma 3.6 log_k 18.145 delta_h -19.282 #kJ/mol #88sho/hel -analytic 2.3767387E+3 3.7694759E-1 -1.299062E+5 -8.5857917E+2 7.9315717E+6 #References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel; 1.000Bi+3 + 1.000H2O = BiO+ + 2.000H+ -llnl_gamma 4.1 log_k -3.298 delta_h 77.925 #kJ/mol #97asho/sas -analytic 1.6682384E+2 2.6735453E-2 -6.1473575E+3 -6.1266475E+1 -5.2222674E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Bi+3 + 2.000H2O = BiO2- + 4.000H+ -llnl_gamma 3.6 log_k -21.095 delta_h 191.082 #kJ/mol #97asho/sas -analytic -2.0624372E+2 -3.8098808E-2 1.0086283E+4 7.5067808E+1 -2.0509303E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Bi+3 + 1.000H2O = BiOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -1.099 delta_h 17.221 #kJ/mol #97asho/sas -analytic 1.143915E+2 1.6629762E-2 -5.0879279E+3 -4.1936958E+1 3.4368009E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000HCO3- + 1.000Ca+2 = Ca(HCO3)+ -llnl_gamma 4.1 log_k 1.103 delta_h -8.895 #kJ/mol #Internal calculation -analytic 8.6860476E+2 1.4583333E-1 -4.8281225E+4 -3.167311E+2 3.0832247E+6 #References = LogK/DGf: 82plu/bus; DHf/DHr: Internal calculation; S°: 99aki/zot; Cp: 99aki/zot; V°: 99aki/zot; 1.000H2AsO4- + 1.000Ca+2 = CaAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -14.839 delta_h 113.307 #kJ/mol #Internal calculation -analytic 2.5836626E+2 3.8536281E-2 -1.5534058E+4 -9.4530772E+1 1.1707092E+5 #References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Ca+2 + 1.000Cl- = CaCl+ -llnl_gamma 4.1 log_k -0.290 delta_h 7.149 #kJ/mol #Internal calculation -analytic 7.8430049E+2 1.2981026E-1 -4.3492375E+4 -2.8572394E+2 2.63E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ca+2 + 2.000Cl- = CaCl2 -llnl_gamma 3.4 log_k -0.640 delta_h -5.857 #kJ/mol #Internal calculation -analytic 1.56211E+3 2.5579437E-1 -8.5800777E+4 -5.6981616E+2 5.2211638E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Ca+2 = CaCO3 + 1.000H+ -llnl_gamma 3.4 log_k -7.107 delta_h 29.530 #kJ/mol #82plu/bus -analytic 6.9542939E+2 1.1632931E-1 -3.6152348E+4 -2.5684303E+2 1.7402592E+6 #References = LogK/DGf: 82plu/bus; DHf/DHr: 82plu/bus; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho; 1.000Ca+2 + 1.000CrO4-2 = CaCrO4 -llnl_gamma 3.4 log_k 2.770 #References = LogK/DGf: 00per/pal; #References = LogK/DGf: 00per/pal; V°: Default value; 1.000Ca+2 + 1.000F- = CaF+ -llnl_gamma 4.1 log_k 0.719 delta_h 5.541 #kJ/mol #97sve/sho -analytic 8.5112291E+2 1.3865645E-1 -4.7741292E+4 -3.0905372E+2 2.9435917E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Ca+2 = CaH2AsO3+ -llnl_gamma 4.1 log_k 1.745 #References = LogK/DGf: 07mar/acc; #References = LogK/DGf: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Ca+2 = CaH2AsO4+ -llnl_gamma 4.1 log_k 1.398 delta_h -3.075 #kJ/mol #Internal calculation -analytic 8.1838467E+2 1.309461E-1 -4.5283605E+4 -2.9716863E+2 2.7715193E+6 #References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Ca+2 + 1.000H2PO4- = CaH2PO4+ -llnl_gamma 4.1 log_k 1.500 delta_h 7.776 #kJ/mol #Internal calculation -analytic 9.2198728E+2 1.44563E-1 -4.9725223E+4 -3.3475721E+2 2.8023976E+6 #References = LogK/DGf: 68chu/mar; DHf/DHr: Internal calculation; S°: 68chu/mar; V°: Default value; 1.000H2AsO4- + 1.000Ca+2 = CaHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.080 delta_h 9.480 #kJ/mol #Internal calculation -analytic 8.505557E+2 1.3673726E-1 -4.5213965E+4 -3.1174192E+2 2.4561126E+6 #References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Ca+2 + 1.000H2PO4- = CaHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.370 delta_h 17.564 #kJ/mol #Internal calculation -analytic 9.1783212E+2 1.44563E-1 -5.0236502E+4 -3.3475721E+2 2.8023976E+6 #References = LogK/DGf: 68chu/mar; DHf/DHr: Internal calculation; S°: 68chu/mar; V°: Default value; 1.000Ca+2 + 1.000H2O = CaOH+ + 1.000H+ -llnl_gamma 4.1 log_k -12.781 delta_h 77.207 #kJ/mol #Internal calculation -analytic 1.3129766E+2 2.1418381E-2 -1.0189734E+4 -4.8224772E+1 2.7032707E+5 #References = LogK/DGf: 87gar/par; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ca+2 + 2.000H2PO4- = CaP2O7-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -11.010 #References = LogK/DGf: 76smi/mar; #References = LogK/DGf: 76smi/mar; V°: Default value; 1.000Ca+2 + 1.000H2PO4- = CaPO4- + 2.000H+ -llnl_gamma 3.6 log_k -13.110 delta_h 38.532 #kJ/mol #Internal calculation -analytic 1.0277723E+3 1.6138722E-1 -5.7688437E+4 -3.7631665E+2 3.1698606E+6 #References = LogK/DGf: 68chu/mar; DHf/DHr: Internal calculation; S°: 68chu/mar; V°: Default value; 1.000Ca+2 + 1.000SO4-2 = CaSO4 -llnl_gamma 3.4 log_k 2.310 delta_h 4.291 #kJ/mol #Internal calculation -analytic 1.720334E+3 2.6573378E-1 -9.4254922E+4 -6.2356103E+2 5.4972745E+6 #References = LogK/DGf: 53bell/geo; DHf/DHr: Internal calculation; S°: 97sve/sho; V°: Default value; 2.000HCO3- + 1.000Cd+2 = Cd(CO3)2-2 + 2.000H+ -llnl_gamma 4.7 log_k -14.154 #References = LogK/DGf: 91rai/fel; #References = LogK/DGf: 91rai/fel; V°: Default value; 1.000Cd+2 + 1.000H2PO4- = Cd(H2PO4)+ -llnl_gamma 4.1 log_k 1.800 #References = LogK/DGf: 01aya/mad; #References = LogK/DGf: 01aya/mad; V°: Default value; 1.000Cd+2 + 2.000HS- = Cd(HS)2 -llnl_gamma 3.4 log_k 14.430 #References = LogK/DGf: 99wan/tes; #References = LogK/DGf: 99wan/tes; V°: Default value; 1.000Cd+2 + 2.000SO4-2 = Cd(SO4)2-2 -llnl_gamma 4.7 log_k 3.440 #References = LogK/DGf: 76smi/mar; #References = LogK/DGf: 76smi/mar; V°: Default value; 2.000Cd+2 + 1.000H2O = Cd2OH+3 + 1.000H+ -llnl_gamma 8.2 log_k -9.390 delta_h 49.083 #kJ/mol #06bla/pia -analytic 6.4452526E+2 9.783847E-2 -3.6589833E+4 -2.3480419E+2 1.8351506E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 06bla/pia; V°: Default value; 4.000Cd+2 + 4.000H2O = Cd4(OH)4+4 + 4.000H+ -llnl_gamma 11.6 log_k -32.076 delta_h 172.135 #kJ/mol #99yun/glu -analytic 1.3419038E+3 1.9583393E-1 -7.9397739E+4 -4.8792886E+2 3.6696627E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 99yun/glu; S°: 99yun/glu; V°: Default value; 1.000Cd+2 + 1.000Cl- = CdCl+ -llnl_gamma 4.2 log_k 1.970 delta_h -5.521 #kJ/mol #Internal calculation -analytic 8.0941004E+2 1.3169312E-1 -4.4807432E+4 -2.9412173E+2 2.7881921E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97cro; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cd+2 + 2.000Cl- = CdCl2 -llnl_gamma 3.4 log_k 2.590 delta_h -13.968 #kJ/mol #Internal calculation -analytic 1.6082169E+3 2.6110353E-1 -8.8756923E+4 -5.8505444E+2 5.5021787E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cd+2 + 3.000Cl- = CdCl3- -llnl_gamma 3.6 log_k 2.400 delta_h -29.073 #kJ/mol #Internal calculation -analytic 1.6305933E+3 2.6642709E-1 -9.142449E+4 -5.9316042E+2 5.9334096E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cd+2 + 4.000Cl- = CdCl4-2 -llnl_gamma 4.7 log_k 1.470 delta_h -44.766 #kJ/mol #Internal calculation -analytic 1.6152923E+3 2.6481694E-1 -9.192457E+4 -5.8775952E+2 6.2146892E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97cro; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Cd+2 = CdCO3 + 1.000H+ -llnl_gamma 3.4 log_k -5.627 delta_h 19.000 #kJ/mol #Internal calculation -analytic 9.294725E+2 1.444084E-1 -5.1233705E+4 -3.3885674E+2 2.8590555E+6 #References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 97sve/sho; V°: Default value; 1.000Cd+2 + 1.000F- = CdF+ -llnl_gamma 4.1 log_k 1.106 delta_h 3.153 #kJ/mol #97sve/sho -analytic 8.6860724E+2 1.3907163E-1 -4.8793028E+4 -3.1489835E+2 3.0119326E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cd+2 + 2.000F- = CdF2 -llnl_gamma 3.4 log_k 1.476 delta_h -8.083 #kJ/mol #97sve/sho -analytic 1.7658928E+3 2.8400177E-1 -9.8001296E+4 -6.4190608E+2 6.0412892E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Cd+2 = CdHCO3+ -llnl_gamma 4.1 log_k 1.503 #References = LogK/DGf: 92sti/par; #References = LogK/DGf: 92sti/par; V°: Default value; 1.000Cd+2 + 1.000H2PO4- = CdHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -2.380 #References = LogK/DGf: 01aya/mad; #References = LogK/DGf: 01aya/mad; V°: Default value; 1.000Cd+2 + 1.000HS- = CdHS+ -llnl_gamma 4.1 log_k 7.380 #References = LogK/DGf: 99wan/tes; #References = LogK/DGf: 99wan/tes; V°: Default value; 1.000Cd+2 + 1.000H2O = CdO + 2.000H+ -llnl_gamma 3.4 log_k -20.901 delta_h 114.908 #kJ/mol #Internal calculation -analytic 2.5360367E+2 4.0290623E-2 -1.7872087E+4 -9.3801559E+1 4.917393E+5 #References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cd+2 + 2.000H2O = CdO2-2 + 4.000H+ -llnl_gamma 4.7 log_k -47.482 delta_h 225.688 #kJ/mol #Internal calculation -analytic -1.0196666E+3 -1.6933521E-1 4.4897737E+4 3.6868458E+2 -3.573682E+6 #References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cd+2 + 1.000H2O = CdOH+ + 1.000H+ -llnl_gamma 4.1 log_k -10.081 delta_h 54.808 #kJ/mol #Internal calculation -analytic 1.8391243E+2 2.7018987E-2 -1.2809154E+4 -6.6798446E+1 5.5125943E+5 #References = LogK/DGf: 81bae/mes; DHf/DHr: Internal calculation; S°: 81bae/mes; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cd+2 + 2.000H2PO4- = CdP2O7-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -9.110 #References = LogK/DGf: 06bla/pia; #References = LogK/DGf: 06bla/pia; V°: Default value; 1.000Cd+2 + 1.000S2O3-2 = CdS2O3 -llnl_gamma 3.4 log_k 2.459 delta_h 5.405 #kJ/mol #74nau/ryz -analytic 1.651486E+3 2.5979388E-1 -9.0543035E+4 -5.9921486E+2 5.326193E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: Default value; 1.000Cd+2 + 1.000SO4-2 = CdSO4 -llnl_gamma 3.4 log_k 3.440 delta_h 8.700 #kJ/mol #97smi/mar -analytic 1.7076044E+3 2.670935E-1 -9.4180412E+4 -6.1854172E+2 5.5669977E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value; 1.000Br- + 1.000Ce+3 = CeBr+2 -llnl_gamma 5.7 log_k 0.380 delta_h 3.059 #kJ/mol #95haa/sho -analytic 8.2693258E+2 1.3442435E-1 -4.6674137E+4 -3.0023701E+2 2.9184796E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000Cl- = CeCl+2 -llnl_gamma 5.7 log_k 0.321 delta_h 14.848 #kJ/mol #95haa/sho -analytic 8.3468541E+2 1.3664496E-1 -4.7387297E+4 -3.0267925E+2 2.915068E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 2.000Cl- = CeCl2+ -llnl_gamma 4.1 log_k 0.056 delta_h 20.694 #kJ/mol #95haa/sho -analytic 1.5937511E+3 2.5971223E-1 -8.8186986E+4 -5.7961464E+2 5.2332188E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 3.000Cl- = CeCl3 -llnl_gamma 3.4 log_k -0.356 delta_h 15.775 #kJ/mol #95haa/sho -analytic 2.2998571E+3 3.7318309E-1 -1.2390706E+5 -8.3884218E+2 7.0909287E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 4.000Cl- = CeCl4- -llnl_gamma 3.6 log_k -0.695 delta_h -2.036 #kJ/mol #95haa/sho -analytic 1.7735262E+3 2.997484E-1 -9.0032161E+4 -6.529228E+2 4.7996539E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000ClO4- = CeClO4+2 -llnl_gamma 5.7 log_k 1.910 delta_h -49.621 #kJ/mol #95haa/sho -analytic 7.9639902E+2 1.2548148E-1 -4.4858429E+4 -2.8969599E+2 3.1458152E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Ce+3 = CeCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.912 delta_h -2.239 #kJ/mol #95haa/sho -analytic 8.9003653E+2 1.399476E-1 -4.667524E+4 -3.2597914E+2 2.5325726E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000F- = CeF+2 -llnl_gamma 5.7 log_k 4.262 delta_h 23.074 #kJ/mol #95haa/sho -analytic 9.2556331E+2 1.4957752E-1 -5.2486449E+4 -3.3368444E+2 3.1844153E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 2.000F- = CeF2+ -llnl_gamma 4.1 log_k 7.351 delta_h 14.795 #kJ/mol #95haa/sho -analytic 1.7515304E+3 2.8132856E-1 -9.65276E+4 -6.3411408E+2 5.7577706E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 3.000F- = CeF3 -llnl_gamma 3.4 log_k 9.634 delta_h -6.097 #kJ/mol #95haa/sho -analytic 2.5476445E+3 4.0837409E-1 -1.3652006E+5 -9.2589648E+2 7.9287157E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 4.000F- = CeF4- -llnl_gamma 3.6 log_k 11.550 delta_h -45.853 #kJ/mol #95haa/sho -analytic 2.5036098E+3 3.9603946E-1 -1.3084927E+5 -9.1159356E+2 7.5035411E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000H2PO4- = CeH2PO4+2 -llnl_gamma 5.7 log_k 1.256 delta_h -5.935 #kJ/mol #95haa/sho -analytic 8.6781969E+2 1.388024E-1 -4.9895174E+4 -3.1412105E+2 3.260084E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Ce+3 = CeHCO3+2 -llnl_gamma 5.7 log_k 1.936 delta_h 8.888 #kJ/mol #95haa/sho -analytic 8.8257465E+2 1.4152087E-1 -5.101329E+4 -3.1862313E+2 3.2604375E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000IO3- = CeIO3+2 -llnl_gamma 5.7 log_k 1.900 delta_h -21.162 #kJ/mol #95haa/sho -analytic 8.2463602E+2 1.3171092E-1 -4.6619643E+4 -2.9919542E+2 3.0843268E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000NO3- = CeNO3+2 -llnl_gamma 5.7 log_k 0.655 delta_h -26.590 #kJ/mol #95haa/sho -analytic 7.9612577E+2 1.2675841E-1 -4.5076687E+4 -2.8938182E+2 3.0206153E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000H2O = CeO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.404 delta_h 150.615 #kJ/mol #95haa/sho -analytic 2.4849638E+2 4.0099364E-2 -1.723781E+4 -8.9431827E+1 2.0028476E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 2.000H2O = CeO2- + 4.000H+ -llnl_gamma 3.6 log_k -38.745 delta_h 288.714 #kJ/mol #95haa/sho -analytic -1.4934194E+2 -2.7864032E-2 -1.2127248E+3 5.5875909E+1 -1.3591423E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 2.000H2O = CeO2H + 3.000H+ -llnl_gamma 3.4 log_k -26.138 delta_h 229.099 #kJ/mol #95haa/sho -analytic 2.4791913E+2 3.571409E-2 -1.7519638E+4 -8.9366091E+1 -4.2787278E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000H2O = CeOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -8.414 delta_h 84.925 #kJ/mol #95haa/sho -analytic 1.8955802E+2 2.9219906E-2 -1.3675377E+4 -6.7123216E+1 4.6893067E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ce+3 + 1.000SO4-2 = CeSO4+ -llnl_gamma 4.1 log_k 3.723 delta_h 18.642 #kJ/mol #95haa/sho -analytic 1.6476675E+3 2.6134533E-1 -8.9771705E+4 -5.9763179E+2 5.1586415E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 4.000F- + 5.000H+ = CF4 + 3.000H2O -llnl_gamma 3.4 log_k -26.875 delta_h 243.525 #kJ/mol #01sch/sho -analytic 3.7594031E+3 5.9885315E-1 -2.2411277E+5 -1.3586198E+3 1.3215605E+7 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 1.000CH4 + 1.000Hg+2 = CH3Hg+ + 1.000H+ -llnl_gamma 4.1 log_k 3.000 delta_h -12.867 #kJ/mol #Internal calculation -analytic 8.6387411E+1 9.0151552E-3 -1.0803883E+3 -3.2219217E+1 -2.4243792E+5 #References = LogK/DGf: 18bla/bur; DHf/DHr: Internal calculation; S°: 18bla/bur; V°: Default value; 1.000CH4 + 1.000Cl- + 1.000Hg+2 = CH3HgCl + 1.000H+ -llnl_gamma 3.4 log_k 8.450 delta_h -51.567 #kJ/mol #Internal calculation -analytic 6.255863E+2 9.8694212E-2 -2.8238238E+4 -2.2975713E+2 1.4817267E+6 #References = LogK/DGf: 18bla/bur; DHf/DHr: Internal calculation; S°: 03ald/gan; V°: Default value; 1.000CH4 + 1.000H2O + 1.000Hg+2 = CH3HgOH + 2.000H+ -llnl_gamma 3.4 log_k -1.531 delta_h -8.122 #kJ/mol #Internal calculation -analytic 1.0815377E+2 8.9469616E-3 -2.4384525E+3 -4.0977444E+1 -2.469193E+5 #References = LogK/DGf: 18bla/bur; DHf/DHr: Internal calculation; S°: 03ald/gan; V°: Default value; 1.000CH4 + 1.000HS- + 1.000Hg+2 = CH3HgS- + 2.000H+ -llnl_gamma 3.6 log_k 7.000 #References = LogK/DGf: 18bla/bur; #References = LogK/DGf: 18bla/bur; V°: Default value; 1.000CH4 + 1.000HS- + 1.000Hg+2 = CH3HgSH + 1.000H+ -llnl_gamma 3.4 log_k 17.500 #References = LogK/DGf: 18bla/bur; #References = LogK/DGf: 18bla/bur; V°: Default value; 1.000Co+2 + 2.000HS- = Co(HS)2 -llnl_gamma 3.4 log_k 8.770 #References = LogK/DGf: 74nau/ryz; #References = LogK/DGf: 74nau/ryz; V°: Default value; 1.000HCO3- + 1.000H+ = CO2 + 1.000H2O -CO2_llnl_gamma log_k 6.354 delta_h -9.160 #kJ/mol #89cox/wag -analytic 6.8216082E+2 1.1432034E-1 -3.8165149E+4 -2.4658624E+2 2.5136382E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 2.000Co+2 + 1.000H2O = Co2OH+3 + 1.000H+ -llnl_gamma 8.2 log_k -9.831 delta_h 30.030 #kJ/mol #98ply/zha -analytic 6.799409E+2 1.0606208E-1 -3.7703166E+4 -2.4942013E+2 1.9766835E+6 #References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: Default value; 1.000HCO3- = CO3-2 + 1.000H+ -llnl_gamma 4.5 log_k -10.327 delta_h 14.700 #kJ/mol #89cox/wag -analytic -7.7058011E+2 -1.2433467E-1 4.2038591E+4 2.7739354E+2 -2.6727243E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 4.000Co+2 + 4.000H2O = Co4(OH)4+4 + 4.000H+ -llnl_gamma 11.6 log_k -29.884 delta_h 149.720 #kJ/mol #98ply/zha -analytic 1.4185577E+3 2.1228114E-1 -8.2444082E+4 -5.1716074E+2 3.9527286E+6 #References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: Default value; 1.000H2AsO4- + 1.000Co+2 = CoAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -11.805 delta_h 86.431 #kJ/mol #Internal calculation -analytic 2.394832E+2 3.2348369E-2 -1.3569818E+4 -8.746078E+1 8.8584941E+4 #References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Co+2 = CoCl+ -llnl_gamma 4.1 log_k 0.570 delta_h -2.167 #kJ/mol #Internal calculation -analytic 8.0574427E+2 1.3135558E-1 -4.4524051E+4 -2.9329044E+2 2.7312086E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 2.000Cl- + 1.000Co+2 = CoCl2 -llnl_gamma 3.4 log_k 0.020 delta_h 4.070 #kJ/mol #89pan/sus -analytic 1.7082364E+3 2.5831757E-1 -9.2266157E+4 -6.199283E+2 5.1736511E+6 #References = LogK/DGf: 89pan/sus; DHf/DHr: 89pan/sus; S°: Internal calculation; V°: Default value; 3.000Cl- + 1.000Co+2 = CoCl3- -llnl_gamma 3.6 log_k -1.710 delta_h 6.690 #kJ/mol #89pan/sus -analytic 2.3905305E+3 3.6098046E-1 -1.2943638E+5 -8.6786525E+2 7.2662259E+6 #References = LogK/DGf: 89pan/sus; DHf/DHr: 89pan/sus; S°: Internal calculation; V°: Default value; 4.000Cl- + 1.000Co+2 = CoCl4-2 -llnl_gamma 4.7 log_k -2.090 delta_h 22.570 #kJ/mol #89pan/sus -analytic 3.1843876E+3 4.6364335E-1 -1.7210204E+5 -1.152894E+3 9.3588007E+6 #References = LogK/DGf: 89pan/sus; DHf/DHr: 89pan/sus; S°: Internal calculation; V°: Default value; 1.000HCO3- + 1.000Co+2 = CoCO3 + 1.000H+ -llnl_gamma 3.4 log_k -6.097 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000Co+2 + 1.000F- = CoF+ -llnl_gamma 4.1 log_k 1.500 delta_h -0.619 #kJ/mol #Internal calculation -analytic 8.5095337E+2 1.378658E-1 -4.6822342E+4 -3.0933992E+2 2.8380397E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO4- + 1.000Co+2 = CoH2AsO4+ -llnl_gamma 4.1 log_k 0.068 delta_h -5.168 #kJ/mol #Internal calculation -analytic 8.1774351E+2 1.278571E-1 -4.5499278E+4 -2.9684761E+2 2.7858691E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Co+2 = CoHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.236 delta_h 7.924 #kJ/mol #Internal calculation -analytic 8.9531849E+2 1.4279267E-1 -4.7685424E+4 -3.2794927E+2 2.6044572E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000HCO3- + 1.000Co+2 = CoHCO3+ -llnl_gamma 4.1 log_k 1.893 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000Co+2 + 1.000H2PO4- = CoHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.150 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000Co+2 + 1.000HS- = CoHS+ -llnl_gamma 4.1 log_k 5.670 #References = LogK/DGf: 74nau/ryz; #References = LogK/DGf: 74nau/ryz; V°: Default value; 1.000Co+2 + 1.000H2O = CoO + 2.000H+ -llnl_gamma 3.4 log_k -18.601 delta_h 105.707 #kJ/mol #Internal calculation -analytic 3.1328181E+2 5.0768623E-2 -2.1353247E+4 -1.1499319E+2 8.1273479E+5 #References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 98ply/zha; Cp: 97asho/sas; V°: 97asho/sas; 1.000Co+2 + 2.000H2O = CoO2-2 + 4.000H+ -llnl_gamma 4.7 log_k -46.422 delta_h 214.485 #kJ/mol #Internal calculation -analytic -9.6639832E+2 -1.5989582E-1 4.1017755E+4 3.4976688E+2 -3.1468584E+6 #References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Co+2 + 1.000H2O = CoOH+ + 1.000H+ -llnl_gamma 4.1 log_k -9.231 delta_h 45.961 #kJ/mol #Internal calculation -analytic 2.2297572E+2 3.3971906E-2 -1.5185488E+4 -8.0960562E+1 7.9368937E+5 #References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 06bla/pia; Cp: 97asho/sas; V°: 97asho/sas; 1.000Co+2 + 1.000S2O3-2 = CoS2O3 -llnl_gamma 3.4 log_k 2.050 #References = LogK/DGf: 51den/mon; #References = LogK/DGf: 51den/mon; V°: Default value; 1.000Co+2 + 1.000SO4-2 = CoSO4 -llnl_gamma 3.4 log_k 2.300 delta_h 2.090 #kJ/mol #97smi/mar -analytic 1.7249035E+3 2.712053E-1 -9.4889438E+4 -6.2584969E+2 5.6377642E+6 #References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value; 1.000Cr+3 + 1.000H2PO4- + 3.000H2O = Cr(OH)3(H2PO4)- + 3.000H+ -llnl_gamma 3.6 log_k -4.391 delta_h 49.800 #kJ/mol #98zie/jon -analytic 1.321583E+3 1.9751002E-1 -7.2520713E+4 -4.7863243E+2 3.7973918E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value; 1.000Cr+3 + 1.000H2PO4- + 3.000H2O = Cr(OH)3(HPO4)-2 + 4.000H+ -llnl_gamma 4.7 log_k -13.275 delta_h 59.600 #kJ/mol #98zie/jon -analytic 1.4294234E+3 2.1433424E-1 -7.938932E+4 -5.2019187E+2 4.1648548E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value; 1.000Cr+3 + 1.000H2PO4- + 3.000H2O = Cr(OH)3(PO4)-3 + 5.000H+ -llnl_gamma 6.7 log_k -24.581 delta_h 116.120 #kJ/mol #98zie/jon -analytic 1.5430251E+3 2.3115846E-1 -8.8698268E+4 -5.6175132E+2 4.5323178E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value; 1.000Cr+3 + 2.000H2PO4- + 4.000H2O = Cr(OH)4(HPO4)(H2PO4)-4 + 5.000H+ -llnl_gamma 9.6 log_k -22.913 delta_h 53.950 #kJ/mol #98zie/jon -analytic 2.3071296E+3 3.451039E-1 -1.2720376E+5 -8.4196735E+2 6.8538475E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value; 2.000Cl- + 1.000Cr+3 + 1.000H2O = Cr(OH)Cl2 + 1.000H+ -llnl_gamma 3.4 log_k -5.731 delta_h 32.720 #kJ/mol #76del/hep -analytic 1.7982728E+3 2.8881186E-1 -9.8928557E+4 -6.5549992E+2 5.661331E+6 #References = LogK/DGf: 76del/hep; DHf/DHr: 76del/hep; S°: Internal calculation; V°: Default value; 2.000Cr+3 + 2.000H2O = Cr2(OH)2+4 + 2.000H+ -llnl_gamma 11.6 log_k -5.000 #References = LogK/DGf: 87rai/sas; #References = LogK/DGf: 87rai/sas; V°: Default value; 2.000CrO4-2 + 2.000H+ = Cr2O7-2 + 1.000H2O -llnl_gamma 4.7 log_k 14.751 delta_h -3.753 #kJ/mol #Internal calculation -analytic 1.5673025E+3 2.514521E-1 -8.6785648E+4 -5.6462916E+2 5.3955261E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas; 3.000Cr+3 + 4.000H2O = Cr3(OH)4+5 + 4.000H+ -llnl_gamma 15.9 log_k -10.750 #References = LogK/DGf: 87rai/sas; #References = LogK/DGf: 87rai/sas; V°: Default value; 1.000Br- + 1.000Cr+3 = CrBr+2 -llnl_gamma 5.7 log_k -0.657 delta_h 22.708 #kJ/mol #76del/hep -analytic 1.1396737E+3 1.8584069E-1 -6.2633207E+4 -4.147693E+2 3.6138545E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 76del/hep; S°: 76del/hep; V°: Default value; 1.000Cl- + 1.000Cr+2 = CrCl+ -llnl_gamma 4.1 log_k 5.600 delta_h -20.200 #kJ/mol #91all/bro -analytic 9.6874977E+2 1.5500587E-1 -5.1412439E+4 -3.5220401E+2 3.0738695E+6 #References = LogK/DGf: 91all/bro; DHf/DHr: 91all/bro; S°: Internal calculation; V°: Default value; 1.000Cl- + 1.000Cr+3 = CrCl+2 -llnl_gamma 5.7 log_k 0.620 delta_h 20.920 #kJ/mol #64sil/mar -analytic 1.1354893E+3 1.8607048E-1 -6.2019908E+4 -4.1321779E+2 3.5690754E+6 #References = LogK/DGf: 64sil/mar; DHf/DHr: 64sil/mar; S°: Internal calculation; V°: Default value; 2.000Cl- + 1.000Cr+3 = CrCl2+ -llnl_gamma 4.1 log_k -0.710 delta_h 20.920 #kJ/mol #64sil/mar -analytic 1.7746314E+3 2.8873337E-1 -9.7134949E+4 -6.4633968E+2 5.6616502E+6 #References = LogK/DGf: 64sil/mar; DHf/DHr: 64sil/mar; S°: Internal calculation; V°: Default value; 1.000Cr+3 + 1.000H2PO4- = CrH2PO4+2 -llnl_gamma 5.7 log_k 2.549 #References = LogK/DGf: 76bae/mes; #References = LogK/DGf: 76bae/mes; V°: Default value; 1.000Cr+3 + 1.000H2PO4- = CrHPO4+ + 1.000H+ -llnl_gamma 4.1 log_k 2.200 #References = LogK/DGf: 71sil/mar; #References = LogK/DGf: 71sil/mar; V°: Default value; 1.000Cr+3 + 1.000H2O = CrO+ + 2.000H+ -llnl_gamma 4.1 log_k -9.841 delta_h 98.557 #kJ/mol #Internal calculation -analytic 2.6719511E+2 4.3344511E-2 -1.6800539E+4 -9.6449621E+1 4.4876034E+5 #References = LogK/DGf: 87rai/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cr+3 + 2.000H2O = CrO2- + 4.000H+ -llnl_gamma 3.6 log_k -27.652 delta_h 203.812 #kJ/mol #Internal calculation -analytic -1.4181637E+2 -2.4795424E-2 -8.8480997E+2 5.371086E+1 -7.4486152E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- + 1.000CrO4-2 + 2.000H+ = CrO3Cl- + 1.000H2O -llnl_gamma 3.6 log_k 8.080 delta_h 5.450 #kJ/mol #76del/hep -analytic 2.079232E+3 3.3092138E-1 -1.1480449E+5 -7.5273593E+2 6.9190961E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 76del/hep; S°: 76del/hep; V°: Default value; 1.000Cr+2 + 1.000H2O = CrOH+ + 1.000H+ -llnl_gamma 4.1 log_k -5.301 delta_h 30.313 #kJ/mol #Internal calculation -analytic 3.2728308E+2 5.2421472E-2 -1.8976264E+4 -1.1946254E+2 9.8097547E+5 #References = LogK/DGf: 83mic/deb; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97sho/sas; 1.000Cr+3 + 1.000H2O = CrOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -3.571 delta_h 38.068 #kJ/mol #Internal calculation -analytic 2.3314727E+2 3.6201743E-2 -1.5165555E+4 -8.3278255E+1 8.3740288E+5 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Br- + 1.000Cs+ = CsBr -llnl_gamma 3.4 log_k 0.022 delta_h 7.047 #kJ/mol #97sve/sho -analytic 6.4329231E+2 9.9916955E-2 -3.5069999E+4 -2.3350243E+2 1.9868872E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cl- + 1.000Cs+ = CsCl -llnl_gamma 3.4 log_k -0.126 delta_h 9.828 #kJ/mol #97sve/sho -analytic 5.3671191E+2 8.4468653E-2 -2.9379828E+4 -1.9485009E+2 1.6589284E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cs+ + 1.000I- = CsI -llnl_gamma 3.4 log_k 0.982 delta_h -1.802 #kJ/mol #97sve/sho -analytic 5.4186384E+2 8.5367942E-2 -2.9035394E+4 -1.9709354E+2 1.6664179E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cs+ + 1.000H2O = CsOH + 1.000H+ -llnl_gamma 3.4 log_k -15.678 delta_h 73.808 #kJ/mol #97asho/sas -analytic 3.1858552E+1 -1.5007639E-4 -4.3079828E+3 -1.2547063E+1 -1.7745211E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cu+ + 2.000HS- = Cu(HS)2- -llnl_gamma 3.6 log_k 16.880 delta_h -86.990 #kJ/mol #01aki/zot -analytic 1.0004589E+3 1.569816E-1 -4.9906901E+4 -3.6323139E+2 3.1822069E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 01aki/zot; V°: 01aki/zot; 1.000Cu+2 + 4.000NH3 = Cu(NH3)4+2 -llnl_gamma 5.7 log_k 12.350 delta_h -89.045 #kJ/mol #Internal calculation -analytic 6.5057285E+2 7.6875021E-2 -3.4924021E+4 -2.3104824E+2 2.4629175E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 1.000Cu+ + 2.000H2O = Cu(OH)2- + 2.000H+ -llnl_gamma 3.6 log_k -16.183 delta_h -1.706 #kJ/mol #Internal calculation -analytic -4.8525575E+2 -8.2823109E-2 2.7721816E+4 1.7070319E+2 -1.9206929E+6 #References = LogK/DGf: 95bev/pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 01aki/zot; V°: 01aki/zot; 2.000Cu+2 + 1.000H2O = Cu2(OH)+3 + 1.000H+ -llnl_gamma 8.2 log_k -6.401 delta_h 24.661 #kJ/mol #Internal calculation -analytic 6.4115019E+2 1.0512591E-1 -3.5425412E+4 -2.3517192E+2 1.9414761E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; V°: Default value; 2.000Cu+2 + 2.000H2O = Cu2(OH)2+2 + 2.000H+ -llnl_gamma 5.7 log_k -10.432 delta_h 73.916 #kJ/mol #Internal calculation -analytic 6.5455072E+2 1.052044E-1 -3.8383385E+4 -2.3821514E+2 1.9411569E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; V°: Default value; 2.000Cu+ + 3.000HS- = Cu2S(HS)2-2 + 1.000H+ -llnl_gamma 4.7 log_k 29.300 delta_h -227.532 #kJ/mol #Internal calculation -analytic 2.3103904E+3 3.4433386E-1 -1.1328616E+5 -8.4148785E+2 6.9707492E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 3.000Cu+2 + 4.000H2O = Cu3(OH)4+2 + 4.000H+ -llnl_gamma 5.7 log_k -21.104 delta_h 109.827 #kJ/mol #Internal calculation -analytic 9.6115092E+2 1.578851E-1 -5.6844365E+4 -3.5217063E+2 2.9114161E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; V°: Default value; 1.000H2AsO4- + 1.000Cu+2 = CuAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -9.325 delta_h 76.057 #kJ/mol #Internal calculation -analytic 2.626073E+2 3.5516884E-2 -1.4171376E+4 -9.5619907E+1 1.4350145E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Cu+2 = CuCl+ -llnl_gamma 4.1 log_k 0.830 delta_h 6.359 #kJ/mol #Internal calculation -analytic 8.3390521E+2 1.3507993E-1 -4.6804817E+4 -3.0257864E+2 2.8753437E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cl- + 1.000Cu+ = CuCl -llnl_gamma 3.4 log_k 3.601 delta_h -11.542 #kJ/mol #Internal calculation -analytic 6.9681754E+2 1.1145523E-1 -3.6152723E+4 -2.5390211E+2 2.051111E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 2.000Cl- + 1.000Cu+2 = CuCl2 -llnl_gamma 3.4 log_k 0.600 delta_h 13.649 #kJ/mol #Internal calculation -analytic 1.6510546E+3 2.6756367E-1 -9.2495163E+4 -5.9955609E+2 5.650422E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho; 2.000Cl- + 1.000Cu+ = CuCl2- -llnl_gamma 3.6 log_k 4.813 delta_h -1.390 #kJ/mol #Internal calculation -analytic 9.3079385E+2 1.494387E-1 -4.9495748E+4 -3.3804517E+2 2.8396488E+6 #References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 3.000Cl- + 1.000Cu+2 = CuCl3- -llnl_gamma 3.6 log_k -1.280 delta_h 21.876 #kJ/mol #Internal calculation -analytic 1.6530252E+3 2.6875422E-1 -9.5507799E+4 -5.9904871E+2 6.0631898E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho; 3.000Cl- + 1.000Cu+ = CuCl3-2 -llnl_gamma 4.7 log_k 4.593 delta_h -24.914 #kJ/mol #Internal calculation -analytic 8.1933075E+2 1.3272212E-1 -4.2717224E+4 -2.9893016E+2 2.5466317E+6 #References = LogK/DGf: 05liu/mcp; DHf/DHr: Internal calculation; S°: 05liu/mcp; Cp: 05liu/mcp; V°: 05liu/mcp; 4.000Cl- + 1.000Cu+2 = CuCl4-2 -llnl_gamma 4.7 log_k -3.980 delta_h 27.657 #kJ/mol #Internal calculation -analytic 1.646818E+3 2.6794805E-1 -9.7852707E+4 -5.9597E+2 6.4182616E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Cu+2 = CuCO3 + 1.000H+ -llnl_gamma 3.4 log_k -3.560 delta_h 14.258 #kJ/mol #Internal calculation -analytic 9.9493512E+2 1.4805212E-1 -5.3947175E+4 -3.6147969E+2 2.9122183E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 1.000Cu+2 + 1.000F- = CuF+ -llnl_gamma 4.1 log_k 1.580 delta_h 12.707 #kJ/mol #Internal calculation -analytic 9.0349106E+2 1.4391531E-1 -5.1152201E+4 -3.2670735E+2 3.1256667E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Cu+2 = CuH2AsO3+ -llnl_gamma 4.1 log_k 7.054 delta_h -46.255 #kJ/mol #Internal calculation -analytic 6.4048192E+2 9.7286724E-2 -3.1510789E+4 -2.3336288E+2 1.8396788E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Cu+2 = CuH2AsO4+ -llnl_gamma 4.1 log_k 1.760 delta_h -10.919 #kJ/mol #Internal calculation -analytic 8.3708326E+2 1.3054379E-1 -4.6267199E+4 -3.0355991E+2 2.8512706E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cu+ + 1.000H2PO4- = CuH2PO4 -llnl_gamma 3.4 log_k 0.870 delta_h 0.072 #kJ/mol #Internal calculation -analytic 7.5823266E+2 1.1422352E-1 -4.0572596E+4 -2.7506552E+2 2.2485098E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 1.000Cu+2 + 1.000H2PO4- = CuH2PO4+ -llnl_gamma 4.1 log_k 1.140 delta_h -5.145 #kJ/mol #Internal calculation -analytic 8.9465245E+2 1.4956644E-1 -4.8398894E+4 -3.2681514E+2 2.9252836E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; V°: Default value; 1.000H2AsO4- + 1.000Cu+2 = CuHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.241 delta_h 4.151 #kJ/mol #Internal calculation -analytic 9.0174376E+2 1.4276292E-1 -4.7805103E+4 -3.3001007E+2 2.6115411E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000HCO3- + 1.000Cu+2 = CuHCO3+ -llnl_gamma 4.1 log_k 1.840 delta_h 8.599 #kJ/mol #Internal calculation -analytic 8.9894018E+2 1.4805212E-1 -4.9182002E+4 -3.2696172E+2 2.9122183E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 1.000Cu+2 + 1.000H2PO4- = CuHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.960 delta_h 18.003 #kJ/mol #Internal calculation -analytic 9.8806398E+2 1.4956644E-1 -5.38128E+4 -3.5928849E+2 2.9252836E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 1.000Cu+ + 1.000HS- = CuHS -llnl_gamma 3.4 log_k 13.020 delta_h -49.570 #kJ/mol #Internal calculation -analytic 7.2535776E+2 1.1352028E-1 -3.5911324E+4 -2.6273887E+2 2.168426E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot; 1.000Cu+2 + 1.000NO2- = CuNO2+ -llnl_gamma 4.1 log_k 1.960 delta_h -5.953 #kJ/mol #Internal calculation -analytic 9.1084088E+2 1.4749476E-1 -4.978949E+4 -3.3134417E+2 3.0248528E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 1.000Cu+2 + 1.000NO3- = CuNO3+ -llnl_gamma 4.1 log_k 0.500 delta_h -7.587 #kJ/mol #Internal calculation -analytic 8.7787692E+2 1.4269939E-1 -4.7836804E+4 -3.2011231E+2 2.8996803E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value; 1.000Cu+2 + 1.000H2O = CuO + 2.000H+ -llnl_gamma 3.4 log_k -16.201 delta_h 85.087 #kJ/mol #Internal calculation -analytic -8.7149135E+1 -1.3485807E-2 1.1918581E+3 3.0620115E+1 -4.2633991E+5 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cu+2 + 2.000H2O = CuO2-2 + 4.000H+ -llnl_gamma 4.7 log_k -39.742 delta_h 178.319 #kJ/mol #Internal calculation -analytic -9.8990166E+2 -1.6461176E-1 4.5503226E+4 3.5779639E+2 -3.4422913E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cu+2 + 1.000H2O = CuOH+ + 1.000H+ -llnl_gamma 4.1 log_k -7.951 delta_h 50.497 #kJ/mol #Internal calculation -analytic 2.0602498E+2 3.0281135E-2 -1.3784298E+4 -7.4298786E+1 6.2900562E+5 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cu+ + 1.000H2O = CuOH + 1.000H+ -llnl_gamma 3.4 log_k -11.555 delta_h 100.371 #kJ/mol #Internal calculation -analytic -4.1481835E+2 -3.801405E-2 2.4684244E+4 1.4405042E+2 -2.190106E+6 #References = LogK/DGf: 95bev/pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 01aki/zot; V°: 01aki/zot; 1.000Cu+2 + 1.000SO4-2 = CuSO4 -llnl_gamma 3.4 log_k 2.350 delta_h 7.300 #kJ/mol #07pow/bro -analytic 1.7631488E+3 2.7073722E-1 -9.6741388E+4 -6.3863896E+2 5.6201604E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: 07pow/bro; S°: Internal calculation; V°: Default value; 1.000Cl- + 1.000Dy+3 = DyCl+2 -llnl_gamma 5.7 log_k 0.248 delta_h 13.769 #kJ/mol #95haa/sho -analytic 8.3240482E+2 1.3607074E-1 -4.72526E+4 -3.0188268E+2 2.911125E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Dy+3 = DyCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 17.245 #kJ/mol #95haa/sho -analytic 1.6092072E+3 2.6228525E-1 -8.9639636E+4 -5.8502132E+2 5.4069277E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Dy+3 = DyCl3 -llnl_gamma 3.4 log_k -0.429 delta_h 8.709 #kJ/mol #95haa/sho -analytic 2.3531558E+3 3.829353E-1 -1.2811742E+5 -8.5790436E+2 7.5362961E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Dy+3 = DyCl4- -llnl_gamma 3.6 log_k -0.841 delta_h -14.298 #kJ/mol #95haa/sho -analytic 2.2301534E+3 3.6216901E-1 -1.1943024E+5 -8.1506523E+2 6.9711425E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Dy+3 = DyCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.316 delta_h -7.263 #kJ/mol #95haa/sho -analytic 7.3151175E+2 1.1889994E-1 -3.6613025E+4 -2.6980602E+2 1.8792518E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 1.000F- = DyF+2 -llnl_gamma 5.7 log_k 4.702 delta_h 23.183 #kJ/mol #95haa/sho -analytic 9.2537808E+2 1.4948246E-1 -5.2430454E+4 -3.3346772E+2 3.1781321E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 2.000F- = DyF2+ -llnl_gamma 4.1 log_k 8.231 delta_h 12.519 #kJ/mol #95haa/sho -analytic 1.7736739E+3 2.8506069E-1 -9.8272375E+4 -6.4162369E+2 5.9406617E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 3.000F- = DyF3 -llnl_gamma 3.4 log_k 10.880 delta_h -12.087 #kJ/mol #95haa/sho -analytic 2.6024499E+3 4.1812618E-1 -1.4078655E+5 -9.4495822E+2 8.374077E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 4.000F- = DyF4- -llnl_gamma 3.6 log_k 13.016 delta_h -57.465 #kJ/mol #95haa/sho -analytic 2.6223269E+3 4.1563229E-1 -1.3980488E+5 -9.5321842E+2 8.3873693E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 1.000H2PO4- = DyH2PO4+2 -llnl_gamma 5.7 log_k 0.963 delta_h -7.629 #kJ/mol #95haa/sho -analytic 8.6571276E+2 1.3816756E-1 -4.9784606E+4 -3.1346556E+2 3.2609892E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Dy+3 = DyHCO3+2 -llnl_gamma 5.7 log_k 1.716 delta_h 7.024 #kJ/mol #95haa/sho -analytic 8.7431568E+2 1.400267E-1 -5.0541461E+4 -3.1574276E+2 3.2404154E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 1.000NO3- = DyNO3+2 -llnl_gamma 5.7 log_k 0.141 delta_h -30.398 #kJ/mol #95haa/sho -analytic 7.9613206E+2 1.2634232E-1 -4.5042889E+4 -2.8965026E+2 3.0344417E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 1.000H2O = DyO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.111 delta_h 145.698 #kJ/mol #95haa/sho -analytic 2.2134729E+2 3.5633866E-2 -1.5304395E+4 -7.9858383E+1 7.5843612E+4 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 2.000H2O = DyO2- + 4.000H+ -llnl_gamma 3.6 log_k -33.468 delta_h 253.849 #kJ/mol #95haa/sho -analytic -1.5670382E+2 -2.9389413E-2 5.8222508E+2 5.8571782E+1 -1.3232983E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 2.000H2O = DyO2H + 3.000H+ -llnl_gamma 3.4 log_k -24.818 delta_h 217.576 #kJ/mol #95haa/sho -analytic 2.6362394E+2 3.8631017E-2 -1.8018305E+4 -9.5260401E+1 -3.3875445E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 1.000H2O = DyOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.828 delta_h 79.083 #kJ/mol #95haa/sho -analytic 1.6882254E+2 2.5734929E-2 -1.198771E+4 -5.9863348E+1 3.5660503E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Dy+3 + 1.000SO4-2 = DySO4+ -llnl_gamma 4.1 log_k 3.723 delta_h 19.765 #kJ/mol #95haa/sho -analytic 1.6458326E+3 2.6071025E-1 -8.928871E+4 -5.9710723E+2 5.079193E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Cl- + 1.000Er+3 = ErCl+2 -llnl_gamma 5.7 log_k 0.321 delta_h 12.603 #kJ/mol #95haa/sho -analytic 8.2676712E+2 1.3504078E-1 -4.67563E+4 -2.9993639E+2 2.8700137E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Er+3 = ErCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 15.374 #kJ/mol #95haa/sho -analytic 1.5960588E+3 2.5983481E-1 -8.8470728E+4 -5.8051678E+2 5.3013509E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Er+3 = ErCl3 -llnl_gamma 3.4 log_k -0.429 delta_h 5.091 #kJ/mol #95haa/sho -analytic 2.3306175E+3 3.7922048E-1 -1.2590783E+5 -8.504052E+2 7.3299428E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Er+3 = ErCl4- -llnl_gamma 3.6 log_k -0.841 delta_h -20.785 #kJ/mol #95haa/sho -analytic 2.1932191E+3 3.5535427E-1 -1.1596956E+5 -8.0257333E+2 6.6554384E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Er+3 = ErCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.169 delta_h -8.973 #kJ/mol #95haa/sho -analytic 7.3934469E+2 1.1995466E-1 -3.6987359E+4 -2.7265916E+2 1.9072191E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 1.000F- = ErF+2 -llnl_gamma 5.7 log_k 4.775 delta_h 24.137 #kJ/mol #95haa/sho -analytic 9.2008982E+2 1.4857189E-1 -5.2017464E+4 -3.3155023E+2 3.133967E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 2.000F- = ErF2+ -llnl_gamma 4.1 log_k 8.377 delta_h 13.054 #kJ/mol #95haa/sho -analytic 1.7618166E+3 2.8294036E-1 -9.7221306E+4 -6.3744761E+2 5.8319659E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 3.000F- = ErF3 -llnl_gamma 3.4 log_k 11.026 delta_h -12.424 #kJ/mol #95haa/sho -analytic 2.5806326E+3 4.1441135E-1 -1.3874827E+5 -9.3745897E+2 8.1677234E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 4.000F- = ErF4- -llnl_gamma 3.6 log_k 13.236 delta_h -60.342 #kJ/mol #95haa/sho -analytic 2.6019304E+3 4.1141589E-1 -1.3733497E+5 -9.4648565E+2 8.1144297E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 1.000H2PO4- = ErH2PO4+2 -llnl_gamma 5.7 log_k 1.037 delta_h -9.794 #kJ/mol #95haa/sho -analytic 8.605117E+2 1.3715286E-1 -4.9285741E+4 -3.1171805E+2 3.2236187E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Er+3 = ErHCO3+2 -llnl_gamma 5.7 log_k 1.789 delta_h 4.984 #kJ/mol #95haa/sho -analytic 8.6599887E+2 1.3856721E-1 -4.9872667E+4 -3.1286569E+2 3.1926771E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 1.000NO3- = ErNO3+2 -llnl_gamma 5.7 log_k 0.141 delta_h -33.891 #kJ/mol #95haa/sho -analytic 7.9270518E+2 1.2553468E-1 -4.4610395E+4 -2.8862531E+2 3.0060762E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 1.000H2O = ErO+ + 2.000H+ -llnl_gamma 4.1 log_k -15.964 delta_h 143.738 #kJ/mol #95haa/sho -analytic 2.2763044E+2 3.6632863E-2 -1.5948969E+4 -8.1967483E+1 1.5996727E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 2.000H2O = ErO2- + 4.000H+ -llnl_gamma 3.6 log_k -32.588 delta_h 246.957 #kJ/mol #95haa/sho -analytic -1.5372142E+2 -2.8947515E-2 6.8194187E+1 5.7811757E+1 -1.2015005E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 2.000H2O = ErO2H + 3.000H+ -llnl_gamma 3.4 log_k -24.305 delta_h 213.151 #kJ/mol #95haa/sho -analytic 2.8747002E+2 4.269491E-2 -1.9686474E+4 -1.0371082E+2 -1.6448388E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 1.000H2O = ErOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.755 delta_h 77.916 #kJ/mol #95haa/sho -analytic 1.7672529E+2 2.6971445E-2 -1.2734861E+4 -6.2551071E+1 4.418032E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Er+3 + 1.000SO4-2 = ErSO4+ -llnl_gamma 4.1 log_k 3.649 delta_h 20.059 #kJ/mol #95haa/sho -analytic 1.6363856E+3 2.5910227E-1 -8.883243E+4 -5.9363228E+2 5.0546786E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Cl- + 1.000Eu+2 = EuCl+ -llnl_gamma 4.1 log_k 0.321 delta_h 8.611 #kJ/mol #95haa/sho -analytic 8.7689106E+2 1.4309214E-1 -5.0463111E+4 -3.1771985E+2 3.2177901E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Cl- + 1.000Eu+3 = EuCl+2 -llnl_gamma 5.7 log_k 0.321 delta_h 13.850 #kJ/mol #95haa/sho -analytic 8.238151E+2 1.3443343E-1 -4.6518539E+4 -2.9884573E+2 2.8377358E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Eu+3 = EuCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 18.617 #kJ/mol #95haa/sho -analytic 1.5865848E+3 2.5819383E-1 -8.7692605E+4 -5.7710225E+2 5.2039588E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Eu+2 = EuCl2 -llnl_gamma 3.4 log_k 1.229 delta_h 5.891 #kJ/mol #95haa/sho -analytic 1.6456329E+3 2.6723309E-1 -9.4211704E+4 -5.9644348E+2 6.0241509E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Eu+3 = EuCl3 -llnl_gamma 3.4 log_k -0.429 delta_h 11.329 #kJ/mol #95haa/sho -analytic 2.3076256E+3 3.7460572E-1 -1.2432252E+5 -8.4187845E+2 7.1478641E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Eu+2 = EuCl3- -llnl_gamma 3.6 log_k 1.989 delta_h -3.227 #kJ/mol #95haa/sho -analytic 1.8618067E+3 3.0434429E-1 -1.0853988E+5 -6.7402E+2 7.227534E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Eu+3 = EuCl4- -llnl_gamma 3.6 log_k -0.841 delta_h -9.682 #kJ/mol #95haa/sho -analytic 2.1620221E+3 3.5015112E-1 -1.1348436E+5 -7.9130159E+2 6.3462481E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Eu+2 = EuCl4-2 -llnl_gamma 4.7 log_k 2.824 delta_h -19.999 #kJ/mol #95haa/sho -analytic 1.916995E+3 3.1639231E-1 -1.1392685E+5 -6.9342232E+2 7.9503781E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Eu+3 = EuCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.389 delta_h -6.221 #kJ/mol #95haa/sho -analytic 7.2456116E+2 1.1771798E-1 -3.6310087E+4 -2.6720946E+2 1.8604618E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+2 + 1.000F- = EuF+ -llnl_gamma 4.1 log_k -1.382 delta_h 17.118 #kJ/mol #95haa/sho -analytic 9.0224383E+2 1.4533312E-1 -5.267501E+4 -3.2649187E+2 3.3422662E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 1.000F- = EuF+2 -llnl_gamma 5.7 log_k 4.482 delta_h 23.440 #kJ/mol #95haa/sho -analytic 9.1671907E+2 1.4780499E-1 -5.1730846E+4 -3.3048004E+2 3.1070113E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 2.000F- = EuF2+ -llnl_gamma 4.1 log_k 7.791 delta_h 14.031 #kJ/mol #95haa/sho -analytic 1.7496003E+3 2.8072103E-1 -9.629607E+4 -6.3330131E+2 5.7367301E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+2 + 2.000F- = EuF2 -llnl_gamma 3.4 log_k -2.031 delta_h 17.703 #kJ/mol #95haa/sho -analytic 1.8014906E+3 2.9000867E-1 -1.0370843E+5 -6.5304643E+2 6.5578913E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 3.000F- = EuF3 -llnl_gamma 3.4 log_k 10.293 delta_h -9.114 #kJ/mol #95haa/sho -analytic 2.5563965E+3 4.0979671E-1 -1.3701018E+5 -9.2893272E+2 7.9856509E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+2 + 3.000F- = EuF3- -llnl_gamma 3.6 log_k -2.461 delta_h 3.810 #kJ/mol #95haa/sho -analytic 1.8653631E+3 3.0178367E-1 -1.1030823E+5 -6.7525371E+2 7.3822715E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 4.000F- = EuF4- -llnl_gamma 3.6 log_k 12.283 delta_h -52.158 #kJ/mol #95haa/sho -analytic 2.5367016E+3 4.0101664E-1 -1.3298926E+5 -9.2331586E+2 7.7116295E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+2 + 4.000F- = EuF4-2 -llnl_gamma 4.7 log_k -2.743 delta_h -37.366 #kJ/mol #95haa/sho -analytic 2.0277848E+3 3.2467665E-1 -1.2234194E+5 -7.3335734E+2 8.6805463E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 1.000H2PO4- = EuH2PO4+2 -llnl_gamma 5.7 log_k 1.037 delta_h -6.925 #kJ/mol #95haa/sho -analytic 8.5703543E+2 1.3656607E-1 -4.9058459E+4 -3.1037682E+2 3.185406E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Eu+3 = EuHCO3+2 -llnl_gamma 5.7 log_k 1.642 delta_h 8.441 #kJ/mol #95haa/sho -analytic 8.6818797E+2 1.3879631E-1 -4.9995692E+4 -3.1358177E+2 3.1731665E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 1.000NO3- = EuNO3+2 -llnl_gamma 5.7 log_k 0.874 delta_h -32.212 #kJ/mol #95haa/sho -analytic 7.8646976E+2 1.2464808E-1 -4.4100868E+4 -2.8615161E+2 2.9529873E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 1.000H2O = EuO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.331 delta_h 148.075 #kJ/mol #95haa/sho -analytic 2.2765249E+2 3.6505777E-2 -1.5847506E+4 -8.2011819E+1 1.0829636E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 2.000H2O = EuO2- + 4.000H+ -llnl_gamma 3.6 log_k -34.494 delta_h 261.329 #kJ/mol #95haa/sho -analytic -1.5920807E+2 -2.9821979E-2 4.7543806E+2 5.9502961E+1 -1.353429E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 2.000H2O = EuO2H + 3.000H+ -llnl_gamma 3.4 log_k -25.405 delta_h 222.296 #kJ/mol #95haa/sho -analytic 3.7116681E+2 5.628658E-2 -2.3756441E+4 -1.3463576E+2 -4.6802414E+4 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 1.000H2O = EuOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.901 delta_h 80.374 #kJ/mol #95haa/sho -analytic 1.7258446E+2 2.6194621E-2 -1.2357342E+4 -6.1092439E+1 3.8405339E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Eu+3 + 1.000SO4-2 = EuSO4+ -llnl_gamma 4.1 log_k 3.723 delta_h 20.264 #kJ/mol #95haa/sho -analytic 1.6444036E+3 2.6037942E-1 -8.9254214E+4 -5.9652657E+2 5.076988E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000HCO3- + 1.000Fe+3 = Fe(CO3)2- + 2.000H+ -llnl_gamma 3.6 log_k -1.053 #References = LogK/DGf: 04chi; #References = LogK/DGf: 04chi; V°: Default value; 2.000HCO3- + 1.000Fe+2 = Fe(CO3)2-2 + 2.000H+ -llnl_gamma 4.7 log_k -13.690 delta_h -10.380 #kJ/mol #Internal calculation -analytic 1.6792207E+3 2.4368936E-1 -8.998357E+4 -6.1370379E+2 4.8722193E+6 #References = LogK/DGf: 17bbla; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 1.000Fe+2 + 2.000HS- = Fe(HS)2 -llnl_gamma 3.4 log_k 6.450 delta_h -36.849 #kJ/mol #Internal calculation -analytic 1.6097764E+3 2.5928073E-1 -8.6157617E+4 -5.8625727E+2 5.2445791E+6 #References = LogK/DGf: 99dav/phi; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 1.000Fe+3 + 4.000H2O = Fe(OH)4- + 4.000H+ -llnl_gamma 3.6 log_k -21.604 delta_h 144.982 #kJ/mol #Internal calculation -analytic -3.5412445E+2 -3.3996622E-2 1.7227197E+4 1.2318536E+2 -1.7723537E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 99dia/sch; Cp: 99dia/sch; V°: 99dia/sch; 2.000Fe+3 + 2.000H2O = Fe2(OH)2+4 + 2.000H+ -llnl_gamma 11.6 log_k -2.922 delta_h 56.480 #kJ/mol #76bae/mes -analytic 9.8561666E+2 1.5463064E-1 -5.3189669E+4 -3.5798472E+2 2.628317E+6 #References = LogK/DGf: 07ste; DHf/DHr: 76bae/mes; S°: Internal calculation; V°: Default value; 1.000H2AsO4- + 1.000Fe+3 = FeAsO4 + 2.000H+ -llnl_gamma 3.4 log_k -4.427 delta_h 42.544 #kJ/mol #Internal calculation -analytic 7.6691918E+2 1.2863321E-1 -3.6919146E+4 -2.8354416E+2 1.3992875E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Fe+2 = FeAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -10.980 delta_h 85.100 #kJ/mol #Internal calculation -analytic 2.4918198E+2 3.4099947E-2 -1.3982837E+4 -9.0834371E+1 1.1856173E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Fe+2 = FeCl+ -llnl_gamma 4.1 log_k -0.160 delta_h 21.550 #kJ/mol #17bbla -analytic 8.1211306E+2 1.3182113E-1 -4.6120838E+4 -2.9423909E+2 2.7725831E+6 #References = LogK/DGf: 04chi; DHf/DHr: 17bbla; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cl- + 1.000Fe+3 = FeCl+2 -llnl_gamma 5.7 log_k 1.520 delta_h 22.480 #kJ/mol #17bbla -analytic 8.1445764E+2 1.3244659E-1 -4.5719558E+4 -2.9480872E+2 2.7025839E+6 #References = LogK/DGf: 00tag/dia; DHf/DHr: 17bbla; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho; 2.000Cl- + 1.000Fe+3 = FeCl2+ -llnl_gamma 4.1 log_k 0.700 delta_h 22.180 #kJ/mol #17bbla -analytic 1.8008911E+3 2.8747526E-1 -9.8236714E+4 -6.5463437E+2 5.6390215E+6 #References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value; 2.000Cl- + 1.000Fe+2 = FeCl2 -llnl_gamma 3.4 log_k -1.740 delta_h 9.900 #kJ/mol #17bbla -analytic 1.6056019E+3 2.6112437E-1 -8.8964588E+4 -5.8478635E+2 5.3521165E+6 #References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Fe+3 = FeCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -0.607 delta_h -49.765 #kJ/mol #Internal calculation -analytic 1.1016241E+3 1.7767788E-1 -5.6871574E+4 -4.0520415E+2 3.3951924E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value; 1.000HCO3- + 1.000Fe+2 = FeCO3 + 1.000H+ -llnl_gamma 3.4 log_k -5.140 delta_h 14.400 #kJ/mol #17bbla -analytic 9.679726E+2 1.4816095E-1 -5.293247E+4 -3.5269522E+2 2.9308987E+6 #References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value; 1.000HCO3- + 1.000Fe+2 + 1.000H2O = FeCO3OH- + 2.000H+ -llnl_gamma 3.6 log_k -14.358 #References = LogK/DGf: 04chi; #References = LogK/DGf: 04chi; V°: Default value; 1.000CrO4-2 + 1.000Fe+3 = FeCrO4+ -llnl_gamma 4.1 log_k 7.800 delta_h 19.100 #kJ/mol #96bbar/pal -analytic 1.8409988E+3 2.9366224E-1 -1.0087706E+5 -6.6638423E+2 5.9126109E+6 #References = LogK/DGf: 96bbar/pal; DHf/DHr: 96bbar/pal; S°: Internal calculation; V°: Default value; 1.000F- + 1.000Fe+2 = FeF+ -llnl_gamma 4.1 log_k 1.430 delta_h 0.150 #kJ/mol #Internal calculation -analytic 8.7587621E+2 1.4031911E-1 -4.8713189E+4 -3.178321E+2 2.9830234E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97sve/sho; V°: 97sve/sho; 1.000F- + 1.000Fe+3 = FeF+2 -llnl_gamma 5.7 log_k 6.000 delta_h 20.832 #kJ/mol #Internal calculation -analytic 9.0321706E+2 1.4595301E-1 -5.0109539E+4 -3.2568539E+2 2.9532654E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Fe+3 = FeH2AsO3+2 -llnl_gamma 5.7 log_k 7.485 delta_h -47.156 #kJ/mol #Internal calculation -analytic 6.861598E+2 1.010876E-1 -3.5091E+4 -2.4860876E+2 2.1377338E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Fe+2 = FeH2AsO4+ -llnl_gamma 4.1 log_k 2.966 delta_h -20.323 #kJ/mol #Internal calculation -analytic 8.173727E+2 1.278786E-1 -4.4686163E+4 -2.9663667E+2 2.7869956E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Fe+3 = FeH2AsO4+2 -llnl_gamma 5.7 log_k 4.433 delta_h -26.990 #kJ/mol #Internal calculation -analytic 8.8043002E+2 1.3378917E-1 -4.8973152E+4 -3.1805275E+2 3.1442912E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Fe+2 + 1.000H2PO4- = FeH2PO4+ -llnl_gamma 4.1 log_k 2.693 #References = LogK/DGf: 72bnri, 76smi/mar; #References = LogK/DGf: 72bnri, 76smi/mar; V°: Default value; 1.000Fe+3 + 1.000H2PO4- = FeH2PO4+2 -llnl_gamma 5.7 log_k 5.423 #References = LogK/DGf: 72cnri; #References = LogK/DGf: 72cnri; V°: Default value; 1.000H2AsO4- + 1.000Fe+2 = FeHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.435 delta_h 3.862 #kJ/mol #Internal calculation -analytic 8.9223042E+2 1.421203E-1 -4.734188E+4 -3.2673886E+2 2.5993229E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Fe+3 = FeHAsO4+ + 1.000H+ -llnl_gamma 4.1 log_k 3.142 delta_h -13.135 #kJ/mol #Internal calculation -analytic 7.6208406E+2 1.2019338E-1 -3.7827005E+4 -2.7878925E+2 1.9503984E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000HCO3- + 1.000Fe+2 = FeHCO3+ -llnl_gamma 4.1 log_k 1.440 delta_h 3.626 #kJ/mol #Internal calculation -analytic 9.521787E+2 1.4816095E-1 -5.1457764E+4 -3.4565212E+2 2.9308987E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value; 1.000Fe+3 + 1.000H2PO4- = FeHPO4+ + 1.000H+ -llnl_gamma 4.1 log_k 3.674 delta_h -29.668 #kJ/mol #Internal calculation -analytic 1.1187415E+3 1.7919221E-1 -5.8323333E+4 -4.0866572E+2 3.4082578E+6 #References = LogK/DGf: 65lah; DHf/DHr: Internal calculation; S°: 65lah; V°: Default value; 1.000Fe+2 + 1.000H2PO4- = FeHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.608 #References = LogK/DGf: 72bnri; #References = LogK/DGf: 72bnri; V°: Default value; 1.000Fe+2 + 1.000SO4-2 + 1.000H+ = FeHSO4+ -llnl_gamma 4.1 log_k 1.740 delta_h 9.900 #kJ/mol #17bbla -analytic 1.6672872E+3 2.7084605E-1 -9.272565E+4 -6.0568591E+2 5.6388409E+6 #References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value; 1.000Fe+3 + 1.000SO4-2 + 1.000H+ = FeHSO4+2 -llnl_gamma 5.7 log_k 2.480 delta_h 75.275 #kJ/mol #Internal calculation -analytic 1.921485E+3 3.0036299E-1 -1.0795589E+5 -6.9313976E+2 6.1031346E+6 #References = LogK/DGf: 08bla; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 1.000Fe+2 + 1.000H2O = FeO + 2.000H+ -llnl_gamma 3.4 log_k -20.601 delta_h 119.662 #kJ/mol #76bae/mes -analytic 2.9801735E+2 4.8033373E-2 -2.1047608E+4 -1.0934625E+2 7.3112082E+5 #References = LogK/DGf: 04chi; DHf/DHr: 76bae/mes; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas; 1.000Fe+3 + 1.000H2O = FeO+ + 2.000H+ -llnl_gamma 4.1 log_k -5.483 delta_h 79.606 #kJ/mol #97asho/sas -analytic 2.4453735E+2 3.9811555E-2 -1.3316723E+4 -8.8609916E+1 1.8080609E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Fe+2 + 1.000H2O = FeOH+ + 1.000H+ -llnl_gamma 4.1 log_k -9.501 delta_h 55.228 #kJ/mol #76bae/mes -analytic 2.0044169E+2 3.0052015E-2 -1.394772E+4 -7.2506144E+1 6.480235E+5 #References = LogK/DGf: 76bae/mes; DHf/DHr: 76bae/mes; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas; 1.000Fe+3 + 1.000H2O = FeOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -2.191 delta_h 35.903 #kJ/mol #Internal calculation -analytic 1.8256378E+2 2.847781E-2 -1.0694132E+4 -6.5541931E+1 4.2687247E+5 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Fe+2 + 1.000H2PO4- = FePO4- + 2.000H+ -llnl_gamma 3.6 log_k -11.626 #References = LogK/DGf: 79mat/spo; #References = LogK/DGf: 79mat/spo; V°: Default value; 1.000Fe+3 + 1.000SO4-2 = FeSO4+ -llnl_gamma 4.1 log_k 4.250 delta_h 26.000 #kJ/mol #17bbla -analytic 1.9864651E+3 3.0036299E-1 -1.0858023E+5 -7.1783875E+2 6.1031346E+6 #References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value; 1.000Fe+2 + 1.000SO4-2 = FeSO4 -llnl_gamma 3.4 log_k 2.440 delta_h 8.400 #kJ/mol #17bbla -analytic 1.7511642E+3 2.7084605E-1 -9.6361704E+4 -6.3437191E+2 5.6388409E+6 #References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value; 1.000Ga+3 + 2.000H2O = Ga(OH)2+ + 2.000H+ -llnl_gamma 4.5 log_k -7.270 delta_h 74.711 #kJ/mol #Internal calculation -analytic -9.322444E+2 -1.7256427E-1 4.3134662E+4 3.4785755E+2 -2.5780056E+6 #References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia; 1.000Ga+3 + 3.000H2O = Ga(OH)3 + 3.000H+ -llnl_gamma 3.0 log_k -11.924 delta_h 104.965 #kJ/mol #Internal calculation -analytic -9.2015042E+2 -1.7507184E-1 4.0677481E+4 3.445661E+2 -2.5437331E+6 #References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia; 1.000Ga+3 + 4.000H2O = Ga(OH)4- + 4.000H+ -llnl_gamma 4.5 log_k -15.633 delta_h 106.332 #kJ/mol #99dia/sch -analytic -1.342829E+3 -2.4411019E-1 6.3111904E+4 4.97759E+2 -3.8555639E+6 #References = LogK/DGf: 99dia/sch; DHf/DHr: Internal calculation; S°: 99dia/sch; Cp: 99dia/sch; V°: 99dia/sch; 1.000Ga+3 + 1.000H2O = GaOH+2 + 1.000H+ -llnl_gamma 4.5 log_k -2.836 delta_h 93.041 #kJ/mol #Internal calculation -analytic 2.0217371E+2 1.66864E-2 -1.72604E+4 -6.5163316E+1 8.1329418E+5 #References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia; 1.000Cl- + 1.000Gd+3 = GdCl+2 -llnl_gamma 5.7 log_k -0.053 delta_h 14.848 #kJ/mol #95haa/sho -analytic 8.2939993E+2 1.3564543E-1 -4.693983E+4 -3.0089682E+2 2.8526372E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Gd+3 = GdCl2+ -llnl_gamma 4.1 log_k -0.392 delta_h 20.988 #kJ/mol #95haa/sho -analytic 1.5972152E+3 2.602796E-1 -8.8497171E+4 -5.8088986E+2 5.2434214E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Gd+3 = GdCl3 -llnl_gamma 3.4 log_k -0.804 delta_h 15.944 #kJ/mol #95haa/sho -analytic 2.3148468E+3 3.7577571E-1 -1.252276E+5 -8.4411193E+2 7.2027801E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Gd+3 = GdCl4- -llnl_gamma 3.6 log_k -1.216 delta_h -1.574 #kJ/mol #95haa/sho -analytic 2.1880502E+3 3.5487598E-1 -1.1553806E+5 -8.0028406E+2 6.4621111E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Gd+3 = GdCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.837 delta_h -4.804 #kJ/mol #95haa/sho -analytic 7.1898344E+2 1.1724319E-1 -3.6101843E+4 -2.65239E+2 1.8335482E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Gd+3 = GdF+2 -llnl_gamma 5.7 log_k 4.254 delta_h 21.107 #kJ/mol #95haa/sho -analytic 9.2090464E+2 1.4871256E-1 -5.1959824E+4 -3.3213443E+2 3.1227998E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Gd+3 = GdF2+ -llnl_gamma 4.1 log_k 7.636 delta_h 11.154 #kJ/mol #95haa/sho -analytic 1.7544539E+3 2.8176381E-1 -9.6609943E+4 -6.351642E+2 5.7672383E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Gd+3 = GdF3 -llnl_gamma 3.4 log_k 10.212 delta_h -11.536 #kJ/mol #95haa/sho -analytic 2.5626765E+3 4.1096658E-1 -1.3754757E+5 -9.3116571E+2 8.0405607E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Gd+3 = GdF4- -llnl_gamma 3.6 log_k 12.275 delta_h -52.254 #kJ/mol #95haa/sho -analytic 2.5335377E+3 4.0124876E-1 -1.3314097E+5 -9.2202279E+2 7.7468286E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Gd+3 + 1.000H2PO4- = GdH2PO4+2 -llnl_gamma 5.7 log_k 0.662 delta_h -4.679 #kJ/mol #95haa/sho -analytic 8.6261287E+2 1.3781172E-1 -4.9518141E+4 -3.1236628E+2 3.1979618E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Gd+3 = GdHCO3+2 -llnl_gamma 5.7 log_k 1.341 delta_h 10.143 #kJ/mol #95haa/sho -analytic 8.7789277E+2 1.4065577E-1 -5.0654894E+4 -3.1707264E+2 3.1988156E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Gd+3 + 1.000NO3- = GdNO3+2 -llnl_gamma 5.7 log_k 0.060 delta_h -25.460 #kJ/mol #95haa/sho -analytic 7.9142958E+2 1.2589444E-1 -4.4712191E+4 -2.8783408E+2 2.9590175E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Gd+3 + 1.000H2O = GdO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.705 delta_h 150.071 #kJ/mol #95haa/sho -analytic 2.2786336E+2 3.6738867E-2 -1.5618443E+4 -8.2275166E+1 3.9714967E+4 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Gd+3 + 2.000H2O = GdO2- + 4.000H+ -llnl_gamma 3.6 log_k -34.795 delta_h 263.904 #kJ/mol #95haa/sho -analytic -1.8390206E+2 -3.3109244E-2 2.4553508E+3 6.8032643E+1 -1.5644536E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Gd+3 + 2.000H2O = GdO2H + 3.000H+ -llnl_gamma 3.4 log_k -25.633 delta_h 223.954 #kJ/mol #95haa/sho -analytic 2.2889116E+2 3.2627784E-2 -1.5762248E+4 -8.2787565E+1 -5.8069709E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Gd+3 + 1.000H2O = GdOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -8.276 delta_h 81.996 #kJ/mol #95haa/sho -analytic 1.6984519E+2 2.6018714E-2 -1.1975007E+4 -6.0299596E+1 3.1054152E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Gd+3 + 1.000SO4-2 = GdSO4+ -llnl_gamma 4.1 log_k 3.348 delta_h 19.640 #kJ/mol #95haa/sho -analytic 1.6474744E+3 2.6115913E-1 -8.9441961E+4 -5.9776996E+2 5.0795308E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ge(OH)4 = GeO(OH)3- + 1.000H+ -llnl_gamma 4.5 log_k -9.309 delta_h 27.364 #kJ/mol #98pok/sch -analytic -2.3900584E+2 -5.2430474E-2 9.7373089E+3 8.88644E+1 -6.4175606E+5 #References = LogK/DGf: 98pok/sch; DHf/DHr: Internal calculation; S°: 98pok/sch; Cp: 98pok/sch; V°: 98pok/sch; 3.000H2AsO3- + 6.000HS- + 8.000H+ = H2As3S6- + 9.000H2O -llnl_gamma 3.6 log_k 100.896 delta_h -503.405 #kJ/mol #Internal calculation -analytic 4.9991939E+3 8.103392E-1 -2.476806E+5 -1.8164716E+3 1.6495466E+7 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000CrO4-2 + 2.000H+ = H2CrO4 -llnl_gamma 3.4 log_k 6.320 delta_h 39.595 #kJ/mol #Internal calculation -analytic 1.3545703E+3 2.1151276E-1 -7.6293524E+4 -4.8721485E+2 4.4587391E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value; 0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H2O + 0.666666666666667H+ = H2N2O2 -llnl_gamma 3.4 log_k -35.640 delta_h 210.897 #kJ/mol #97asho/sas -analytic 5.5135053E+2 8.3220208E-2 -4.1015812E+4 -1.9948206E+2 1.7219364E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H2PO4- = H2P2O7-2 + 1.000H2O -llnl_gamma 4.7 log_k -1.759 delta_h 24.397 #kJ/mol #Internal calculation -analytic 9.4821779E+1 1.5740091E-2 -8.6638259E+3 -3.2312144E+1 6.879313E+5 #References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000F- + 1.000H2PO4- + 2.000H+ = H2PO3F + 1.000H2O -llnl_gamma 3.4 log_k 3.725 #References = LogK/DGf: 82wag/eva; #References = LogK/DGf: 82wag/eva; V°: Default value; 1.000HS- + 1.000H+ = H2S -llnl_gamma 3.4 log_k 6.989 delta_h -22.300 #kJ/mol #89cox/wag -analytic 7.4840235E+2 1.1981739E-1 -4.1346833E+4 -2.7032197E+2 2.7054412E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho; 1.000S2O3-2 + 2.000H+ = H2S2O3 -llnl_gamma 3.4 log_k 2.320 delta_h 22.916 #kJ/mol #Internal calculation -analytic 1.4978457E+3 2.3814241E-1 -8.4048537E+4 -5.4206379E+2 5.0379338E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000S2O4-2 + 2.000H+ = H2S2O4 -llnl_gamma 3.4 log_k 2.800 delta_h 20.193 #kJ/mol #Internal calculation -analytic 1.5238086E+3 2.4187759E-1 -8.5503757E+4 -5.5133352E+2 5.1465289E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 4.000HS- + 2.000Sb(OH)3 + 4.000H+ = H2Sb2S4 + 6.000H2O -llnl_gamma 3.4 log_k 58.089 delta_h -307.718 #kJ/mol #Internal calculation -analytic 2.5377019E+3 4.1753376E-1 -1.2186629E+5 -9.2465532E+2 8.2351176E+6 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000SeO3-2 + 2.000H+ = H2SeO3 -llnl_gamma 3.4 log_k 9.859 delta_h 1.856 #kJ/mol #97asho/sas -analytic 1.5653221E+3 2.4888692E-1 -8.6809664E+4 -5.6508325E+2 5.3117245E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H4SiO4 = H2SiO4-2 + 2.000H+ -llnl_gamma 4.7 log_k -23.270 delta_h 75.000 #kJ/mol #92gre/fug -analytic 5.0628236E+2 4.2835675E-2 -3.4394739E+4 -1.8000322E+2 1.639456E+6 #References = LogK/DGf: 01fel/cho; DHf/DHr: 92gre/fug; S°: Internal calculation; V°: Default value; 1.000SO3-2 + 2.000H+ = H2SO3 -llnl_gamma 3.4 log_k 9.030 delta_h 21.452 #kJ/mol #Internal calculation -analytic 1.2947587E+3 2.1816277E-1 -7.3029473E+4 -4.6771565E+2 4.5780174E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value; 1.000VO2+ + 2.000H2O = H2VO4- + 2.000H+ -llnl_gamma 3.6 log_k -7.087 delta_h 47.506 #kJ/mol #97asho/sas -analytic -1.6588352E+2 -3.4517213E-2 4.0275461E+3 6.3757317E+1 -1.9414525E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 3.000H2AsO3- + 6.000HS- + 9.000H+ = H3As3S6 + 9.000H2O -llnl_gamma 3.4 log_k 104.476 delta_h -520.971 #kJ/mol #Internal calculation -analytic 5.0101536E+3 8.125097E-1 -2.467788E+5 -1.820706E+3 1.6444457E+7 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000H2AsO4- + 1.000H+ = H3AsO4 -llnl_gamma 3.4 log_k 2.302 delta_h 11.056 #kJ/mol #Internal calculation -analytic 1.6315798E+2 4.072998E-2 -7.3546098E+3 -6.1578275E+1 3.590386E+5 #References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok; 2.000H2PO4- + 1.000H+ = H3P2O7- + 1.000H2O -llnl_gamma 3.6 log_k 0.491 delta_h 26.523 #kJ/mol #Internal calculation -analytic 8.0953847E+2 1.2990245E-1 -4.7077964E+4 -2.9196531E+2 2.8953565E+6 #References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2PO2- + 1.000H+ = H3PO2 -llnl_gamma 3.4 log_k 1.969 delta_h 4.727 #kJ/mol #97asho/sas -analytic 6.8841114E+2 1.0842457E-1 -3.7570856E+4 -2.4947114E+2 2.1818456E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2PO3- + 1.000H+ = H3PO3 -llnl_gamma 3.4 log_k 1.777 delta_h 4.700 #kJ/mol #97asho/sas -analytic 7.1612262E+2 1.1249217E-1 -3.9032373E+4 -2.5960307E+2 2.2579858E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2PO4- + 1.000H+ = H3PO4 -llnl_gamma 3.4 log_k 2.140 delta_h 8.480 #kJ/mol #92gre/fug -analytic 7.1025502E+2 1.1203519E-1 -3.9337065E+4 -2.5690201E+2 2.3206641E+6 #References = LogK/DGf: 92gre/fug; DHf/DHr: 92gre/fug; S°: Internal calculation; Cp: 89bsho/hel; V°: 89bsho/hel; 1.000VO2+ + 2.000H2O = H3VO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.268 delta_h 35.811 #kJ/mol #97asho/sas -analytic 3.4737348E+2 4.8356993E-2 -2.0930147E+4 -1.24101E+2 1.0863345E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H2PO4- + 2.000H+ = H4P2O7 + 1.000H2O -llnl_gamma 3.4 log_k 1.491 delta_h 39.160 #kJ/mol #92gre/fug -analytic 1.5915746E+3 2.5209768E-1 -9.0201163E+4 -5.7514933E+2 5.3743838E+6 #References = LogK/DGf: 92gre/fug; DHf/DHr: 92gre/fug; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas; 1.000Al+3 + 2.000H2O = HAlO2 + 3.000H+ -llnl_gamma 3.4 log_k -16.422 delta_h 144.672 #kJ/mol #Internal calculation -analytic 3.4561264E+2 6.0310894E-2 -2.5787154E+4 -1.2375721E+2 1.129243E+6 #References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel; 3.000H2AsO3- + 6.000HS- + 7.000H+ = HAs3S6-2 + 9.000H2O -llnl_gamma 4.7 log_k 92.989 delta_h -475.787 #kJ/mol #Internal calculation -analytic 4.0596965E+3 6.6336637E-1 -1.9822099E+5 -1.4758773E+3 1.3539198E+7 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000H2AsO4- = HAsO4-2 + 1.000H+ -llnl_gamma 4.7 log_k -6.960 delta_h 4.300 #kJ/mol #Internal calculation -analytic -7.5496385E+2 -1.2127676E-1 4.1238614E+4 2.724917E+2 -2.5259453E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Be+2 + 2.000H2O = HBeO2- + 3.000H+ -llnl_gamma 3.6 log_k -23.242 delta_h 89.448 #kJ/mol #97asho/sas -analytic -1.2687707E+2 -2.7577326E-2 -1.2642123E+3 4.6771863E+1 3.2277325E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Br- + 1.000H+ = HBr -llnl_gamma 3.4 log_k -8.600 delta_h 73.414 #kJ/mol #18las/bla -analytic -2.5897713E+2 -2.5546307E-2 9.8674943E+3 9.3502034E+1 -5.7484365E+5 #References = LogK/DGf: 12liu/bor; DHf/DHr: 18las/bla; S°: Internal calculation; Cp: 18las/bla; V°: 18las/bla; 1.000BrO- + 1.000H+ = HBrO -llnl_gamma 3.4 log_k 8.576 delta_h -18.890 #kJ/mol #97asho/sas -analytic 7.2538439E+2 1.148023E-1 -3.88363E+4 -2.6179537E+2 2.4015962E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cd+2 + 2.000H2O = HCdO2- + 3.000H+ -llnl_gamma 3.6 log_k -33.302 delta_h 156.474 #kJ/mol #Internal calculation -analytic -3.0951893E+2 -5.4688749E-2 8.3874974E+3 1.1156503E+2 -1.0373718E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- + 1.000H+ = HCl -llnl_gamma 3.4 log_k -0.710 delta_h -12.298 #kJ/mol #Internal calculation -analytic 4.7680293E+2 9.0812819E-2 -2.5456962E+4 -1.7702289E+2 1.6734984E+6 #References = LogK/DGf: 97tag/zot; DHf/DHr: Internal calculation; S°: 99aki/zot, d'apres 97tag/zot; Cp: 99aki/zot, d'apres 97tag/zot; V°: 99aki/zot, d'apres 97tag/zot; 1.000ClO- + 1.000H+ = HClO -llnl_gamma 3.4 log_k 7.550 delta_h -13.281 #kJ/mol #97asho/sas -analytic 7.2521427E+2 1.147631E-1 -3.9121157E+4 -2.617469E+2 2.4008033E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000ClO2- + 1.000H+ = HClO2 -llnl_gamma 3.4 log_k 1.979 delta_h 14.650 #kJ/mol #97asho/sas -analytic 7.8823184E+2 1.2433314E-1 -4.4591623E+4 -2.8450217E+2 2.6863984E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000CN- + 1.000H+ = HCN -llnl_gamma 3.4 log_k 9.236 delta_h -43.612 #kJ/mol #93sho/mck -analytic 6.7984155E+2 1.0836058E-1 -3.6475824E+4 -2.4584018E+2 2.4661309E+6 #References = LogK/DGf: 93sho/mck; DHf/DHr: Internal calculation; S°: 93sho/mck; Cp: 93sho/mck; V°: 93sho/mck; 1.000Co+2 + 2.000H2O = HCoO2- + 3.000H+ -llnl_gamma 3.6 log_k -31.702 delta_h 139.444 #kJ/mol #Internal calculation -analytic -1.5068561E+2 -3.116226E-2 -1.6802729E+3 5.4958317E+1 -1.8494349E+5 #References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cr+3 + 2.000H2O = HCrO2 + 3.000H+ -llnl_gamma 3.4 log_k -16.192 delta_h 154.241 #kJ/mol #97asho/sas -analytic 4.1185363E+2 6.4897144E-2 -2.5827678E+4 -1.4869592E+2 6.373717E+5 #References = LogK/DGf: 87rai/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000CrO4-2 + 1.000H+ = HCrO4- -llnl_gamma 3.6 log_k 6.520 delta_h 7.379 #kJ/mol #97asho/sas -analytic 8.4378241E+2 1.3502825E-1 -4.7404104E+4 -3.037181E+2 2.9338129E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cu+2 + 2.000H2O = HCuO2- + 3.000H+ -llnl_gamma 3.6 log_k -26.602 delta_h 139.438 #kJ/mol #Internal calculation -analytic 4.6058039E+1 2.3361402E-3 -7.4761642E+3 -1.8185832E+1 -2.9172674E+5 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000F- + 1.000H+ = HF -llnl_gamma 3.4 log_k 3.208 delta_h 13.871 #kJ/mol #89bsho/hel -analytic 6.6852284E+2 1.0837606E-1 -3.7234833E+4 -2.4152987E+2 2.2142303E+6 #References = LogK/DGf: 89bsho/hel; DHf/DHr: Internal calculation; S°: 89bsho/hel; Cp: 89bsho/hel; V°: 89bsho/hel; 2.000F- + 1.000H+ = HF2- -llnl_gamma 3.6 log_k 2.630 delta_h 20.783 #kJ/mol #88sho/hel -analytic 7.3982947E+2 1.1859444E-1 -4.0367467E+4 -2.6775489E+2 2.2558689E+6 #References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel; 1.000Fe+3 + 2.000H2O = HFeO2 + 3.000H+ -llnl_gamma 3.4 log_k -14.302 delta_h 150.625 #kJ/mol #Internal calculation -analytic 3.2853473E+2 5.0357636E-2 -1.9143962E+4 -1.1889896E+2 5.0313883E+4 #References = LogK/DGf: 07ste; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Fe+2 + 2.000H2O = HFeO2- + 3.000H+ -llnl_gamma 3.6 log_k -31.932 delta_h 152.121 #kJ/mol #Internal calculation -analytic -1.7417344E+2 -3.4755142E-2 -2.4333271E+2 6.3714895E+1 -3.7678014E+5 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hf+4 + 1.000H2O = HfO+2 + 2.000H+ -llnl_gamma 5.7 log_k -2.404 delta_h 73.943 #kJ/mol #97asho/sas -analytic 2.5312717E+2 4.1789098E-2 -1.454566E+4 -9.040826E+1 4.0050254E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hf+4 + 2.000H2O = HfO2 + 4.000H+ -llnl_gamma 3.4 log_k -10.671 delta_h 101.647 #kJ/mol #97asho/sas -analytic 6.8189581E+2 1.1294646E-1 -4.0735993E+4 -2.4738855E+2 2.0031066E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hf+4 + 1.000H2O = HfOH+3 + 1.000H+ -llnl_gamma 8.2 log_k -0.205 delta_h 28.209 #kJ/mol #97asho/sas -analytic 2.2758035E+2 3.5899887E-2 -1.4701237E+4 -8.0521313E+1 8.9465128E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hg+2 + 2.000HS- = Hg(HS)2 -llnl_gamma 3.4 log_k 39.759 delta_h -194.111 #kJ/mol #Internal calculation -analytic 1.5703216E+3 2.4882639E-1 -7.6283746E+4 -5.687585E+2 5.1969628E+6 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000Hg+2 + 2.000H2O = Hg(OH)2 + 2.000H+ -llnl_gamma 3.4 log_k -6.077 delta_h 50.266 #kJ/mol #Internal calculation -analytic 2.971886E+2 4.0966815E-2 -1.7978686E+4 -1.0663777E+2 7.7240412E+5 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 12bla; Cp: 05bes/app; V°: 05bes/app; 1.000HCO3- + 1.000Hg+2 + 1.000H2O = Hg(OH)CO3- + 2.000H+ -llnl_gamma 3.6 log_k -5.095 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; 1.000Hg2+2 + 1.000H2O = Hg2(OH)+ + 1.000H+ -llnl_gamma 4.1 log_k -5.000 #References = LogK/DGf: 76bae/mes; #References = LogK/DGf: 76bae/mes; V°: Default value; 2.000Hg+2 + 1.000H2O = Hg2(OH)+3 + 1.000H+ -llnl_gamma 8.2 log_k -3.331 delta_h 12.803 #kJ/mol #76bae/mes -analytic 6.0697682E+2 9.0887971E-2 -3.2328388E+4 -2.2128194E+2 1.6508927E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: 76bae/mes; S°: Internal calculation; V°: Default value; 3.000Hg+2 + 3.000H2O = Hg3(OH)3+3 + 3.000H+ -llnl_gamma 8.2 log_k -6.420 #References = LogK/DGf: 76bae/mes; #References = LogK/DGf: 76bae/mes; V°: Default value; 1.000Hg+2 + 1.000Cl- = HgCl+ -llnl_gamma 4.1 log_k 7.210 delta_h -32.683 #kJ/mol #Internal calculation -analytic 8.3901583E+2 1.3660114E-1 -4.5239944E+4 -3.0460502E+2 2.927023E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 2.000Cl- + 1.000Hg+2 = HgCl2 -llnl_gamma 3.4 log_k 13.980 delta_h -72.022 #kJ/mol #Internal calculation -analytic 1.6287495E+3 2.6423846E-1 -8.7764608E+4 -5.9148288E+2 5.7245183E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 3.000Cl- + 1.000Hg+2 = HgCl3- -llnl_gamma 3.6 log_k 15.060 delta_h -87.739 #kJ/mol #Internal calculation -analytic 1.7509092E+3 2.8618938E-1 -9.6316342E+4 -6.3530694E+2 6.5688389E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 4.000Cl- + 1.000Hg+2 = HgCl4-2 -llnl_gamma 4.7 log_k 15.420 delta_h -109.352 #kJ/mol #Internal calculation -analytic 1.6653853E+3 2.7781516E-1 -9.2970467E+4 -6.0481422E+2 6.7205177E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Hg+2 = HgCO3 + 1.000H+ -llnl_gamma 3.4 log_k 1.050 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; 1.000F- + 1.000Hg+2 = HgF+ -llnl_gamma 4.1 log_k 1.667 delta_h -0.202 #kJ/mol #97sve/sho -analytic 8.7968293E+2 1.4114324E-1 -4.9515548E+4 -3.1880911E+2 3.0980174E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Hg+2 = HgHCO3+ -llnl_gamma 4.1 log_k 5.380 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; 1.000Hg+2 + 1.000H2PO4- = HgHPO4 + 1.000H+ -llnl_gamma 3.4 log_k 1.587 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; 1.000Hg+2 + 1.000H2O = HgOH+ + 1.000H+ -llnl_gamma 4.1 log_k -3.401 delta_h 30.174 #kJ/mol #Internal calculation -analytic 2.7849935E+2 4.2311865E-2 -1.7809238E+4 -9.9688771E+1 1.0569599E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hg+2 + 1.000Cl- + 1.000H2O = HgOHCl + 1.000H+ -llnl_gamma 3.4 log_k 4.059 delta_h 0.005 #kJ/mol #76bae/mes -analytic 9.6186198E+2 1.4814612E-1 -5.1533752E+4 -3.4834297E+2 2.9178616E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: 76bae/mes; S°: Internal calculation; V°: Default value; 1.000Hg+2 + 1.000H2PO4- = HgPO4- + 2.000H+ -llnl_gamma 3.6 log_k -3.962 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; 1.000Hg+2 + 2.000HS- = HgS(HS)- + 1.000H+ -llnl_gamma 3.6 log_k 33.628 delta_h -176.127 #kJ/mol #Internal calculation -analytic 1.0519009E+3 1.6731094E-1 -4.8800006E+4 -3.8143256E+2 3.4978736E+6 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000Hg+2 + 2.000HS- = HgS2-2 + 2.000H+ -llnl_gamma 4.7 log_k 25.328 #References = LogK/DGf: 63sch/wid; #References = LogK/DGf: 63sch/wid; V°: Default value; 1.000Hg + 1.000HSO5- + 1.000H+ = HgSO4 + 1.000H2O -llnl_gamma 3.4 log_k 39.255 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; 1.000Hf+4 + 2.000H2O = HHfO2+ + 3.000H+ -llnl_gamma 4.1 log_k -5.980 delta_h 67.509 #kJ/mol #97asho/sas -analytic 6.5804843E+2 1.0343865E-1 -4.0925588E+4 -2.3620182E+2 2.387873E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hf+4 + 3.000H2O = HHfO3- + 5.000H+ -llnl_gamma 3.6 log_k -17.180 delta_h 131.409 #kJ/mol #97asho/sas -analytic 1.5398918E+2 1.91636E-2 -1.5488751E+4 -5.2861288E+1 5.2167683E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Hg+2 + 2.000H2O = HHgO2- + 3.000H+ -llnl_gamma 3.6 log_k -21.102 delta_h 92.387 #kJ/mol #Internal calculation -analytic -3.5527596E+2 -6.25913E-2 1.6060615E+4 1.275503E+2 -1.4798029E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000In+3 + 2.000H2O = HInO2 + 3.000H+ -llnl_gamma 3.4 log_k -12.431 delta_h 141.752 #kJ/mol #97asho/sas -analytic 2.9395295E+2 4.4420963E-2 -1.6132337E+4 -1.065324E+2 -1.6997303E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000IO- + 1.000H+ = HIO -llnl_gamma 3.4 log_k 10.629 delta_h -30.480 #kJ/mol #97asho/sas -analytic 6.4142751E+2 1.020626E-1 -3.3047675E+4 -2.3170778E+2 2.0409305E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000IO3- + 1.000H+ = HIO3 -llnl_gamma 3.4 log_k 0.806 delta_h 9.868 #kJ/mol #97asho/sas -analytic 7.165435E+2 1.1308494E-1 -4.0076773E+4 -2.5940292E+2 2.3859256E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Mn+2 + 2.000H2O = HMnO2- + 3.000H+ -llnl_gamma 3.6 log_k -34.787 delta_h 165.700 #kJ/mol #97asho/sas -analytic -2.9963926E+2 -5.2516471E-2 7.7242198E+3 1.0769592E+2 -1.0563926E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000MoO4-2 + 1.000H+ = HMoO4- -llnl_gamma 3.6 log_k 4.398 delta_h 4.211 #kJ/mol #97asho/sas -analytic 7.9783743E+2 1.285935E-1 -4.5529953E+4 -2.8764197E+2 2.9050307E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H2O = HN2O2- + 0.333333333333333H+ -llnl_gamma 3.6 log_k -42.676 delta_h 228.610 #kJ/mol #97asho/sas -analytic -2.2857803E+2 -3.9101606E-2 7.0800973E+2 8.2558503E+1 -8.0898012E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000NbO3- + 1.000H+ = HNbO3 -llnl_gamma 3.4 log_k 7.110 delta_h -5.781 #kJ/mol #97asho/sas -analytic 9.7365947E+2 1.5468696E-1 -5.4364891E+4 -3.5110732E+2 3.4191631E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ni+2 + 2.000H2O = HNiO2- + 3.000H+ -llnl_gamma 3.6 log_k -31.502 delta_h 128.446 #kJ/mol #Internal calculation -analytic -1.1258582E+2 -2.5264697E-2 -4.274717E+3 4.1154062E+1 9.963932E+4 #References = LogK/DGf: 12bla; DHf/DHr: Internal calculation; S°: 12coo/oli; Cp: 97asho/sas; V°: 97asho/sas; 1.000NO2- + 1.000H+ = HNO2 -llnl_gamma 3.4 log_k 3.225 delta_h -14.668 #kJ/mol #97asho/sas -analytic 6.4401715E+2 1.0196656E-1 -3.4771091E+4 -2.3381642E+2 2.1328223E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000NO3- + 1.000H+ = HNO3 -llnl_gamma 3.4 log_k -1.303 delta_h 16.890 #kJ/mol #97asho/sas -analytic 7.1469352E+2 1.122887E-1 -4.0454469E+4 -2.5890316E+2 2.3867006E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- + 1.000Ho+3 = HoCl+2 -llnl_gamma 5.7 log_k 0.248 delta_h 14.019 #kJ/mol #95haa/sho -analytic 8.309322E+2 1.3592251E-1 -4.7056051E+4 -3.0142496E+2 2.8866799E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Ho+3 = HoCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 17.744 #kJ/mol #95haa/sho -analytic 1.6029986E+3 2.6130038E-1 -8.9032768E+4 -5.8291199E+2 5.3400293E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Ho+3 = HoCl3 -llnl_gamma 3.4 log_k -0.429 delta_h 9.832 #kJ/mol #95haa/sho -analytic 2.3394977E+3 3.8054592E-1 -1.2692221E+5 -8.5313943E+2 7.4092857E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Ho+3 = HoCl4- -llnl_gamma 3.6 log_k -0.841 delta_h -12.427 #kJ/mol #95haa/sho -analytic 2.2089312E+3 3.5855722E-1 -1.1752417E+5 -8.0770442E+2 6.7659988E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Ho+3 = HoCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.243 delta_h -7.432 #kJ/mol #95haa/sho -analytic 7.2948E+2 1.1872233E-1 -3.6463468E+4 -2.6909319E+2 1.8696978E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Ho+3 = HoF+2 -llnl_gamma 5.7 log_k 4.775 delta_h 22.390 #kJ/mol #95haa/sho -analytic 9.2355918E+2 1.492425E-1 -5.2178487E+4 -3.3290731E+2 3.1543027E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Ho+3 = HoF2+ -llnl_gamma 4.1 log_k 8.377 delta_h 11.307 #kJ/mol #95haa/sho -analytic 1.7668602E+3 2.8395888E-1 -9.756201E+4 -6.393358E+2 5.8735454E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Ho+3 = HoF3 -llnl_gamma 3.4 log_k 11.026 delta_h -13.048 #kJ/mol #95haa/sho -analytic 2.5885746E+3 4.1573691E-1 -1.3948256E+5 -9.4019374E+2 8.2470724E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Ho+3 = HoF4- -llnl_gamma 3.6 log_k 13.163 delta_h -57.927 #kJ/mol #95haa/sho -analytic 2.595255E+3 4.1115554E-1 -1.3747819E+5 -9.4382429E+2 8.1655191E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ho+3 + 1.000H2PO4- = HoH2PO4+2 -llnl_gamma 5.7 log_k 1.037 delta_h -7.549 #kJ/mol #95haa/sho -analytic 8.6398498E+2 1.3798195E-1 -4.9561363E+4 -3.1290174E+2 3.2354358E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Ho+3 = HoHCO3+2 -llnl_gamma 5.7 log_k 1.716 delta_h 7.399 #kJ/mol #95haa/sho -analytic 8.740355E+2 1.4007946E-1 -5.0409724E+4 -3.1571701E+2 3.2189804E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ho+3 + 1.000NO3- = HoNO3+2 -llnl_gamma 5.7 log_k 0.215 delta_h -29.818 #kJ/mol #95haa/sho -analytic 7.9393439E+2 1.2608575E-1 -4.4812596E+4 -2.8888825E+2 3.0068428E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ho+3 + 1.000H2O = HoO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.038 delta_h 145.778 #kJ/mol #95haa/sho -analytic 2.2407397E+2 3.6160052E-2 -1.5435642E+4 -8.0847231E+1 8.2668698E+4 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ho+3 + 2.000H2O = HoO2- + 4.000H+ -llnl_gamma 3.6 log_k -33.468 delta_h 254.473 #kJ/mol #95haa/sho -analytic -1.5775613E+2 -2.9424924E-2 7.2063971E+2 5.8902822E+1 -1.3428981E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ho+3 + 2.000H2O = HoO2H + 3.000H+ -llnl_gamma 3.4 log_k -24.525 delta_h 216.527 #kJ/mol #95haa/sho -analytic 2.603044E+2 3.8111555E-2 -1.7689378E+4 -9.407076E+1 -3.6358229E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ho+3 + 1.000H2O = HoOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.755 delta_h 79.039 #kJ/mol #95haa/sho -analytic 1.7051224E+2 2.6095428E-2 -1.2060168E+4 -6.0480107E+1 3.6062857E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Ho+3 + 1.000SO4-2 = HoSO4+ -llnl_gamma 4.1 log_k 3.649 delta_h 20.183 #kJ/mol #95haa/sho -analytic 1.6455968E+3 2.6077336E-1 -8.9276752E+4 -5.9705121E+2 5.0760809E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000H2PO4- = HP2O7-3 + 1.000H2O + 1.000H+ -llnl_gamma 6.7 log_k -8.409 delta_h 27.426 #kJ/mol #Internal calculation -analytic -5.6732929E+2 -9.3832759E-2 2.7021233E+4 2.0729311E+2 -1.4815617E+6 #References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Pb+2 + 2.000H2O = HPbO2- + 3.000H+ -llnl_gamma 3.6 log_k -27.202 delta_h 130.486 #kJ/mol #Internal calculation -analytic -3.6756019E+2 -6.4891308E-2 1.6117043E+4 1.3143972E+2 -1.7414527E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2PO3- = HPO3-2 + 1.000H+ -llnl_gamma 4.7 log_k -6.144 delta_h 0.516 #kJ/mol #97asho/sas -analytic -7.7016322E+2 -1.2356824E-1 4.2208561E+4 2.7809446E+2 -2.563151E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000F- + 1.000H2PO4- + 1.000H+ = HPO3F- + 1.000H2O -llnl_gamma 3.6 log_k 2.919 #References = LogK/DGf: 82wag/eva; #References = LogK/DGf: 82wag/eva; V°: Default value; 1.000H2PO4- = HPO4-2 + 1.000H+ -llnl_gamma 4.0 log_k -7.212 delta_h 3.600 #kJ/mol #89cox/wag -analytic -7.466061E+2 -1.2024182E-1 4.0983107E+4 2.6925857E+2 -2.5313893E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 1.000S2O3-2 + 1.000H+ = HS2O3- -llnl_gamma 3.6 log_k 1.720 delta_h 8.253 #kJ/mol #Internal calculation -analytic 7.6374275E+2 1.2282727E-1 -4.3349734E+4 -2.7623629E+2 2.6917567E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000S2O4-2 + 1.000H+ = HS2O4- -llnl_gamma 3.6 log_k 2.500 delta_h 3.818 #kJ/mol #Internal calculation -analytic 7.6785921E+2 1.2335334E-1 -4.3510905E+4 -2.7760746E+2 2.7308809E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 4.000HS- + 2.000Sb(OH)3 + 3.000H+ = HSb2S4- + 6.000H2O -llnl_gamma 3.6 log_k 53.028 delta_h -302.105 #kJ/mol #Internal calculation -analytic 2.0735093E+3 3.4443133E-1 -9.5834763E+4 -7.5796985E+2 6.5607411E+6 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000Sc+3 + 2.000H2O = HScO2 + 3.000H+ -llnl_gamma 3.4 log_k -16.096 delta_h 164.044 #kJ/mol #97asho/sas -analytic 2.8354404E+2 4.2565645E-2 -1.6343969E+4 -1.0286017E+2 -2.659603E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000SeO3-2 + 1.000H+ = HSeO3- -llnl_gamma 3.6 log_k 7.286 delta_h -5.164 #kJ/mol #97asho/sas -analytic 7.9466768E+2 1.2793535E-1 -4.4347573E+4 -2.8632224E+2 2.8181559E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000SeO4-2 + 1.000H+ = HSeO4- -llnl_gamma 3.6 log_k 1.906 delta_h 17.563 #kJ/mol #97asho/sas -analytic 7.9284475E+2 1.2748453E-1 -4.5582806E+4 -2.8605958E+2 2.8243941E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H4SiO4 = HSiO3- + 1.000H2O + 1.000H+ -llnl_gamma 3.6 log_k -9.819 delta_h 26.884 #kJ/mol #Internal calculation -analytic -1.8375672E+2 -5.0579914E-2 4.6983651E+3 7.0958395E+1 -2.0642699E+5 #References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Sn+2 + 2.000H2O = HSnO2- + 3.000H+ -llnl_gamma 3.6 log_k -16.587 delta_h 69.671 #kJ/mol #97asho/sas -analytic -3.493042E+2 -6.1507829E-2 1.6925159E+4 1.2555105E+2 -1.4559988E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000SO3-2 + 1.000H+ = HSO3- -llnl_gamma 4.2 log_k 7.170 delta_h 3.667 #kJ/mol #Internal calculation -analytic 8.1037351E+2 1.3067603E-1 -4.535994E+4 -2.9173714E+2 2.8319627E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas; 1.000SO4-2 + 1.000H+ = HSO4- -llnl_gamma 3.6 log_k 1.982 delta_h 22.440 #kJ/mol #04chi -analytic 8.1698008E+2 1.2949832E-1 -4.7437431E+4 -2.9402094E+2 2.9364246E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas; 1.000Tl+3 + 2.000H2O = HTlO2 + 3.000H+ -llnl_gamma 3.4 log_k -3.302 delta_h 100.748 #kJ/mol #Internal calculation -analytic 1.4438534E+2 1.8619426E-2 -2.2648729E+3 -5.3249839E+1 -1.2337586E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000U+4 + 2.000H2O = HUO2+ + 3.000H+ -llnl_gamma 4.1 log_k -4.991 delta_h 96.790 #kJ/mol #97bsho/sas -analytic 4.2213458E+2 6.7242242E-2 -2.4043395E+4 -1.5172768E+2 7.9192177E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000U+3 + 2.000H2O = HUO2 + 3.000H+ -llnl_gamma 3.4 log_k -21.190 delta_h 202.729 #kJ/mol #97bsho/sas -analytic 2.0720196E+2 2.8823161E-2 -1.2882635E+4 -7.4999805E+1 -7.28472E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000U+4 + 3.000H2O = HUO3- + 5.000H+ -llnl_gamma 3.6 log_k -16.557 delta_h 104.650 #kJ/mol #97bsho/sas -analytic 1.8339274E+2 2.3291824E-2 -1.678554E+4 -6.4303956E+1 7.5744435E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000UO2+2 + 2.000H2O = HUO4- + 3.000H+ -llnl_gamma 3.6 log_k -19.233 delta_h 72.175 #kJ/mol #97bsho/sas -analytic -3.1939827E+2 -5.428582E-2 1.3137453E+4 1.146927E+2 -1.0233544E+6 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000VO2+ + 2.000H2O = HVO4-2 + 3.000H+ -llnl_gamma 4.7 log_k -15.143 delta_h 62.301 #kJ/mol #97asho/sas -analytic -6.2765274E+2 -1.1126012E-1 2.3415516E+4 2.3346197E+2 -9.3695934E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000WO4-2 + 1.000H+ = HWO4- -llnl_gamma 3.6 log_k 3.592 delta_h 6.318 #kJ/mol #97asho/sas -analytic 7.9451317E+2 1.2806542E-1 -4.5447474E+4 -2.8660145E+2 2.8893928E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Y+3 + 2.000H2O = HYO2 + 3.000H+ -llnl_gamma 3.4 log_k -25.991 delta_h 221.152 #kJ/mol #97asho/sas -analytic 2.6793461E+2 3.9922729E-2 -1.8227636E+4 -9.7265274E+1 -3.5702822E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Zn+2 + 2.000H2O = HZnO2- + 3.000H+ -llnl_gamma 3.6 log_k -28.140 delta_h 144.668 #kJ/mol #14aki/tag -analytic -2.8915838E+2 -5.200839E-2 8.6724758E+3 1.0491204E+2 -1.0810376E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 1.000ZrO+2 + 1.000H2O = HZrO2+ + 1.000H+ -llnl_gamma 4.1 log_k -3.357 delta_h 2.913 #kJ/mol #97asho/sas -analytic 3.5560139E+2 5.4759312E-2 -2.3278403E+4 -1.2787202E+2 1.706986E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000ZrO+2 + 2.000H2O = HZrO3- + 3.000H+ -llnl_gamma 3.6 log_k -14.263 delta_h 65.514 #kJ/mol #97asho/sas -analytic -1.218036E+2 -2.6025908E-2 6.8865585E+2 4.5970138E+1 -6.7540487E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- + 1.000In+3 = InCl+2 -llnl_gamma 5.7 log_k 3.272 delta_h -5.365 #kJ/mol #97sve/sho -analytic 8.0564469E+2 1.3148007E-1 -4.3715289E+4 -2.9287704E+2 2.6449007E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000F- + 1.000In+3 = InF+2 -llnl_gamma 5.7 log_k 4.640 delta_h 26.865 #kJ/mol #97sve/sho -analytic 8.9887292E+2 1.4513136E-1 -4.9986234E+4 -3.2431973E+2 2.9031673E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000In+3 + 1.000H2O = InO+ + 2.000H+ -llnl_gamma 4.1 log_k -7.828 delta_h 99.167 #kJ/mol #97asho/sas -analytic 2.0224088E+2 3.2825218E-2 -1.137909E+4 -7.3174996E+1 -5.5401319E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000In+3 + 2.000H2O = InO2- + 4.000H+ -llnl_gamma 3.6 log_k -22.033 delta_h 182.466 #kJ/mol #97asho/sas -analytic -1.6540867E+2 -3.0638101E-2 4.1319219E+3 6.1725725E+1 -1.2520057E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000In+3 + 1.000H2O = InOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -4.016 delta_h 24.892 #kJ/mol #97asho/sas -analytic 2.0215457E+2 3.0376701E-2 -1.2788621E+4 -7.2869098E+1 7.0895805E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Al+3 + 1.000K+ + 2.000H2O = KAlO2 + 4.000H+ -llnl_gamma 3.4 log_k -24.224 delta_h 211.675 #kJ/mol #97apok/hel -analytic 6.4898432E+2 9.8197261E-2 -4.4681059E+4 -2.3170404E+2 1.841148E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 97apok/hel; S°: 97apok/hel; Cp: 97apok/hel; V°: 97apok/hel; 1.000H2AsO4- + 1.000K+ = KAsO4-2 + 2.000H+ -llnl_gamma 4.7 log_k -14.003 delta_h 119.613 #kJ/mol #Internal calculation -analytic -2.5155995E+2 -5.1873394E-2 1.0009804E+4 9.4532025E+1 -1.2856822E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Br- + 1.000K+ = KBr -llnl_gamma 3.4 log_k -1.746 delta_h 14.345 #kJ/mol #97sve/sho -analytic 6.5418733E+2 1.0441228E-1 -3.6116244E+4 -2.3806364E+2 2.0573498E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cl- + 1.000K+ = KCl -llnl_gamma 3.4 log_k -0.500 delta_h 4.180 #kJ/mol #97smi/mar -analytic 7.8954315E+2 1.2046911E-1 -4.4722195E+4 -2.8553339E+2 2.7176259E+6 #References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; Cp: 97bpok/hel; V°: 97bpok/hel; 1.000H2AsO4- + 1.000K+ = KH2AsO4 -llnl_gamma 3.4 log_k -1.903 delta_h 13.748 #kJ/mol #Internal calculation -analytic 6.6054606E+2 1.0281261E-1 -3.6976883E+4 -2.3970458E+2 2.1380303E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000K+ + 1.000H2PO4- = KH2PO4 -llnl_gamma 3.4 log_k 0.440 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000H2AsO4- + 1.000K+ = KHAsO4- + 1.000H+ -llnl_gamma 3.6 log_k -6.434 delta_h 9.920 #kJ/mol #Internal calculation -analytic 1.4673963E+2 1.732212E-2 -8.6601791E+3 -5.4068442E+1 3.9976775E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000K+ + 1.000H2PO4- = KHPO4- + 1.000H+ -llnl_gamma 3.6 log_k -6.432 delta_h 31.590 #kJ/mol #97smi/mar -analytic 8.4152475E+2 1.2701276E-1 -4.7518124E+4 -3.0549408E+2 2.6202354E+6 #References = LogK/DGf: 89mar/smi; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value; 1.000I- + 1.000K+ = KI -llnl_gamma 3.4 log_k -1.606 delta_h 8.560 #kJ/mol #97sve/sho -analytic 6.1043989E+2 9.8873976E-2 -3.3332222E+4 -2.2276046E+2 1.9092154E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000K+ + 1.000H2O = KOH + 1.000H+ -llnl_gamma 3.4 log_k -14.461 delta_h 66.438 #kJ/mol #Internal calculation -analytic 1.4239065E+2 1.6361293E-2 -1.1313422E+4 -5.1781943E+1 3.8638962E+5 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97apok/hel; Cp: 97apok/hel; V°: 97apok/hel; 1.000K+ + 2.000H2PO4- = KP2O7-3 + 1.000H2O + 2.000H+ -llnl_gamma 6.7 log_k -15.709 delta_h 39.592 #kJ/mol #76smi/mar -analytic 1.6687934E+3 2.5762544E-1 -9.3691143E+4 -6.0894907E+2 5.3098665E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value; 1.000K+ + 1.000H2PO4- = KPO4-2 + 2.000H+ -llnl_gamma 4.7 log_k -18.260 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000K+ + 1.000SO4-2 = KSO4- -llnl_gamma 3.6 log_k 0.880 delta_h 2.949 #kJ/mol #Internal calculation -analytic 9.1524972E+2 1.434877E-1 -5.1253575E+4 -3.315177E+2 3.1178195E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cl- + 1.000La+3 = LaCl+2 -llnl_gamma 5.7 log_k 0.321 delta_h 14.100 #kJ/mol #95haa/sho -analytic 8.1634992E+2 1.3260344E-1 -4.6231329E+4 -2.9593873E+2 2.8247841E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000La+3 = LaCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 19.241 #kJ/mol #95haa/sho -analytic 1.5772265E+3 2.5601738E-1 -8.725879E+4 -5.7351329E+2 5.1747592E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000La+3 = LaCl3 -llnl_gamma 3.4 log_k -0.356 delta_h 12.158 #kJ/mol #95haa/sho -analytic 2.2943766E+3 3.7167037E-1 -1.2361533E+5 -8.3685398E+2 7.0938925E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000La+3 = LaCl4- -llnl_gamma 3.6 log_k -0.768 delta_h -7.980 #kJ/mol #95haa/sho -analytic 2.1478018E+3 3.4713233E-1 -1.1261389E+5 -7.8597533E+2 6.2657631E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000La+3 = LaCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -3.195 delta_h -1.369 #kJ/mol #95haa/sho -analytic 8.8069985E+2 1.3716892E-1 -4.6016324E+4 -3.2253412E+2 2.4567447E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000La+3 = LaF+2 -llnl_gamma 5.7 log_k 3.895 delta_h 26.413 #kJ/mol #95haa/sho -analytic 9.0881585E+2 1.4587257E-1 -5.1579298E+4 -3.2743797E+2 3.0943233E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000La+3 = LaF2+ -llnl_gamma 4.1 log_k 6.765 delta_h 19.514 #kJ/mol #95haa/sho -analytic 1.7394142E+3 2.784031E-1 -9.6089752E+4 -6.2946264E+2 5.7065496E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000La+3 = LaF3 -llnl_gamma 3.4 log_k 8.827 delta_h -0.995 #kJ/mol #95haa/sho -analytic 2.5428838E+3 4.0686124E-1 -1.3668365E+5 -9.2390776E+2 7.9316731E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000La+3 = LaF4- -llnl_gamma 3.6 log_k 10.524 delta_h -41.617 #kJ/mol #95haa/sho -analytic 2.5159075E+3 3.969999E-1 -1.3224947E+5 -9.1569334E+2 7.6129444E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000La+3 + 1.000H2PO4- = LaH2PO4+2 -llnl_gamma 5.7 log_k 1.330 delta_h -7.975 #kJ/mol #95haa/sho -analytic 8.4941099E+2 1.3470811E-1 -4.8689854E+4 -3.0739008E+2 3.1716089E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000La+3 = LaHCO3+2 -llnl_gamma 5.7 log_k 2.009 delta_h 6.972 #kJ/mol #95haa/sho -analytic 8.6124314E+2 1.3701914E-1 -4.9646784E+4 -3.1083503E+2 3.1619943E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000La+3 + 1.000NO3- = LaNO3+2 -llnl_gamma 5.7 log_k 0.581 delta_h -29.415 #kJ/mol #95haa/sho -analytic 7.7848056E+2 1.2273421E-1 -4.3906053E+4 -2.8300449E+2 2.9375084E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000La+3 + 1.000H2O = LaO+ + 2.000H+ -llnl_gamma 4.1 log_k -18.163 delta_h 159.159 #kJ/mol #95haa/sho -analytic 2.2239703E+2 3.5067195E-2 -1.6212712E+4 -7.9912578E+1 9.7837946E+4 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000La+3 + 2.000H2O = LaO2- + 4.000H+ -llnl_gamma 3.6 log_k -40.798 delta_h 298.184 #kJ/mol #95haa/sho -analytic -1.7159293E+2 -3.2272206E-2 -7.3662721E+2 6.4124208E+1 -1.4030409E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000La+3 + 2.000H2O = LaO2H + 3.000H+ -llnl_gamma 3.4 log_k -27.897 delta_h 237.270 #kJ/mol #95haa/sho -analytic 2.4275405E+2 3.4272614E-2 -1.7828479E+4 -8.7402792E+1 -4.2667646E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000La+3 + 1.000H2O = LaOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -8.634 delta_h 85.057 #kJ/mol #95haa/sho -analytic 1.6651917E+2 2.4643621E-2 -1.234983E+4 -5.8705719E+1 3.7194078E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000La+3 + 1.000SO4-2 = LaSO4+ -llnl_gamma 4.1 log_k 3.723 delta_h 18.143 #kJ/mol #95haa/sho -analytic 1.6377681E+3 2.572115E-1 -8.8909314E+4 -5.9381884E+2 5.0523657E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Cl- + 1.000Li+ = LiCl -llnl_gamma 3.4 log_k -1.499 delta_h 4.704 #kJ/mol #97sve/sho -analytic 7.6754981E+2 1.2375957E-1 -4.2240117E+4 -2.7980277E+2 2.4961357E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Li+ + 1.000H2O = LiOH + 1.000H+ -llnl_gamma 3.4 log_k -13.643 delta_h 56.014 #kJ/mol #97asho/sas -analytic 1.189022E+2 1.669755E-2 -8.4427854E+3 -4.4932738E+1 1.757402E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- + 1.000Lu+3 = LuCl+2 -llnl_gamma 5.7 log_k -0.045 delta_h 13.572 #kJ/mol #95haa/sho -analytic 8.3064858E+2 1.3557662E-1 -4.7247523E+4 -3.0126661E+2 2.9172513E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Lu+3 = LuCl2+ -llnl_gamma 4.1 log_k -0.604 delta_h 15.727 #kJ/mol #95haa/sho -analytic 1.6101226E+3 2.6205139E-1 -8.9751122E+4 -5.8552003E+2 5.4225656E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Lu+3 = LuCl3 -llnl_gamma 3.4 log_k -1.162 delta_h 3.412 #kJ/mol #95haa/sho -analytic 2.3529274E+3 3.8350168E-1 -1.2778178E+5 -8.5856737E+2 7.5221913E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Lu+3 = LuCl4- -llnl_gamma 3.6 log_k -1.721 delta_h -25.993 #kJ/mol #95haa/sho -analytic 2.2401583E+3 3.6276449E-1 -1.1968401E+5 -8.1942912E+2 7.02335E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Lu+3 = LuCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.023 delta_h -11.057 #kJ/mol #95haa/sho -analytic 9.2406266E+2 1.4413121E-1 -4.7864568E+4 -3.3852843E+2 2.5909836E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Lu+3 = LuF+2 -llnl_gamma 5.7 log_k 4.848 delta_h 25.714 #kJ/mol #95haa/sho -analytic 9.2299835E+2 1.4904399E-1 -5.2422765E+4 -3.3237886E+2 3.1725262E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Lu+3 = LuF2+ -llnl_gamma 4.1 log_k 8.524 delta_h 14.338 #kJ/mol #95haa/sho -analytic 1.7748057E+3 2.8514005E-1 -9.8383425E+4 -6.4182001E+2 5.9403007E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Lu+3 = LuF3 -llnl_gamma 3.4 log_k 11.219 delta_h -12.652 #kJ/mol #95haa/sho -analytic 2.6041242E+3 4.1869268E-1 -1.4069815E+5 -9.4562169E+2 8.3599781E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Lu+3 = LuF4- -llnl_gamma 3.6 log_k 13.456 delta_h -64.092 #kJ/mol #95haa/sho -analytic 2.6641587E+3 4.213141E-1 -1.4179985E+5 -9.6851144E+2 8.5159719E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Lu+3 + 1.000H2PO4- = LuH2PO4+2 -llnl_gamma 5.7 log_k 1.183 delta_h -13.375 #kJ/mol #95haa/sho -analytic 8.6590301E+2 1.3785804E-1 -4.9658355E+4 -3.1366862E+2 3.2788531E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Lu+3 = LuHCO3+2 -llnl_gamma 5.7 log_k 1.936 delta_h 1.528 #kJ/mol #95haa/sho -analytic 8.6599382E+2 1.3847482E-1 -4.9953347E+4 -3.1285684E+2 3.2307152E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Lu+3 + 1.000NO3- = LuNO3+2 -llnl_gamma 5.7 log_k 0.581 delta_h -41.640 #kJ/mol #95haa/sho -analytic 8.019714E+2 1.2673884E-1 -4.5031696E+4 -2.9209462E+2 3.0782758E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Lu+3 + 1.000H2O = LuO+ + 2.000H+ -llnl_gamma 4.1 log_k -15.305 delta_h 136.978 #kJ/mol #95haa/sho -analytic 2.2943238E+2 3.6792722E-2 -1.6134946E+4 -8.2523518E+1 2.3194775E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Lu+3 + 2.000H2O = LuO2- + 4.000H+ -llnl_gamma 3.6 log_k -31.928 delta_h 238.950 #kJ/mol #95haa/sho -analytic -1.6095972E+2 -2.9432083E-2 1.1122665E+2 6.0535033E+1 -1.0984226E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Lu+3 + 2.000H2O = LuO2H + 3.000H+ -llnl_gamma 3.4 log_k -23.865 delta_h 207.023 #kJ/mol #95haa/sho -analytic 3.1921803E+2 4.8163595E-2 -2.189193E+4 -1.1507882E+2 6.5556739E+4 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Lu+3 + 1.000H2O = LuOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.608 delta_h 74.709 #kJ/mol #95haa/sho -analytic 1.8512515E+2 2.8070592E-2 -1.3441099E+4 -6.5464972E+1 5.3052023E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Lu+3 + 1.000SO4-2 = LuSO4+ -llnl_gamma 4.1 log_k 3.649 delta_h 19.185 #kJ/mol #95haa/sho -analytic 1.6468397E+3 2.6057133E-1 -8.9434501E+4 -5.974135E+2 5.0976729E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Mg+2 = Mg(HCO3)+ -llnl_gamma 4.1 log_k 1.038 delta_h 1.841 #kJ/mol #Internal calculation -analytic 8.7719152E+2 1.3812485E-1 -5.0324694E+4 -3.1704995E+2 3.1978381E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 74rea/lan; Cp: 95sho/kor; V°: 95sho/kor; 4.000Mg+2 + 4.000H2O = Mg4(OH)4+4 + 4.000H+ -llnl_gamma 11.6 log_k -39.754 delta_h 229.187 #kJ/mol #Internal calculation -analytic 1.3448905E+3 2.2219545E-1 -8.4561812E+4 -4.9120416E+2 4.2830869E+6 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 99yun/glu; V°: Default value; 1.000H2AsO4- + 1.000Mg+2 = MgAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -12.735 delta_h 99.689 #kJ/mol #Internal calculation -analytic 2.724103E+2 3.5612873E-2 -1.6231704E+4 -9.8493145E+1 2.1275459E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Mg+2 = MgCl+ -llnl_gamma 4.1 log_k 0.350 delta_h -1.729 #kJ/mol #Internal calculation -analytic 8.362486E+2 1.3422557E-1 -4.6833261E+4 -3.0373153E+2 2.9090756E+6 #References = LogK/DGf: 96bou; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Mg+2 = MgCO3 + 1.000H+ -llnl_gamma 3.4 log_k -7.347 delta_h 23.505 #kJ/mol #Internal calculation -analytic 7.769792E+2 1.2651382E-1 -4.0717685E+4 -2.8627656E+2 2.0351429E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 74rea/lan; Cp: 97sve/sho; V°: 97sve/sho; 1.000F- + 1.000Mg+2 = MgF+ -llnl_gamma 4.1 log_k 1.149 delta_h 3.388 #kJ/mol #97sve/sho -analytic 9.305036E+2 1.4739446E-1 -5.2880884E+4 -3.3670964E+2 3.3093949E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Mg+2 = MgH2AsO3+ -llnl_gamma 4.1 log_k 1.674 delta_h -21.477 #kJ/mol #Internal calculation -analytic 6.4358587E+2 9.5687384E-2 -3.344971E+4 -2.342365E+2 1.8981183E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Mg+2 = MgH2AsO4+ -llnl_gamma 4.1 log_k 1.512 delta_h -15.687 #kJ/mol #Internal calculation -analytic 8.3847159E+2 1.2866674E-1 -4.6573309E+4 -3.0382206E+2 2.904498E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Mg+2 + 1.000H2PO4- = MgH2PO4+ -llnl_gamma 4.1 log_k 1.170 delta_h 13.510 #kJ/mol #96bou -analytic 9.8987559E+2 1.525131E-1 -5.3901944E+4 -3.5863715E+2 3.0254769E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: 96bou; S°: Internal calculation; V°: Default value; 1.000H2AsO4- + 1.000Mg+2 = MgHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.539 delta_h 10.494 #kJ/mol #Internal calculation -analytic 9.2236556E+2 1.4553155E-1 -4.9509414E+4 -3.3734707E+2 2.711604E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Mg+2 + 1.000H2PO4- = MgHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.303 delta_h 16.152 #kJ/mol #76smi/mar -analytic 9.8486594E+2 1.525131E-1 -5.4039945E+4 -3.5863715E+2 3.0254769E+6 #References = LogK/DGf: 63tay/fra, 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value; 1.000Mg+2 + 1.000H2O = MgOH+ + 1.000H+ -llnl_gamma 4.1 log_k -11.681 delta_h 62.834 #kJ/mol #Internal calculation -analytic 2.435508E+2 3.4906997E-2 -1.7787625E+4 -8.7502059E+1 9.3682965E+5 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Mg+2 + 2.000H2PO4- = MgP2O7-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -10.609 delta_h 45.031 #kJ/mol #76smi/mar -analytic 1.8187626E+3 2.8312577E-1 -1.0130344E+5 -6.6209214E+2 5.715108E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value; 1.000Mg+2 + 1.000H2PO4- = MgPO4- + 2.000H+ -llnl_gamma 3.6 log_k -14.710 delta_h 31.170 #kJ/mol #96bou -analytic 1.0920963E+3 1.6933732E-1 -6.1181105E+4 -4.001966E+2 3.3929399E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: 96bou; S°: Internal calculation; V°: Default value; 1.000Mg+2 + 1.000SO4-2 = MgSO4 -llnl_gamma 3.4 log_k 2.230 delta_h 5.860 #kJ/mol #76smi/mar -analytic 1.6922933E+3 2.6688291E-1 -9.1845736E+4 -6.1481011E+2 5.3091773E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; Cp: 97mcc/sho; V°: 97mcc/sho; 1.000H2AsO4- + 1.000Mn+2 = MnAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -12.330 delta_h 78.986 #kJ/mol #Internal calculation -analytic 2.3867904E+2 3.2373438E-2 -1.328689E+4 -8.7779659E+1 9.8538805E+4 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Mn+2 = MnCl+ -llnl_gamma 4.1 log_k -0.126 delta_h 19.022 #kJ/mol #97sve/sho -analytic 8.5360276E+2 1.3944778E-1 -4.8024815E+4 -3.0980373E+2 2.8765919E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000F- + 1.000Mn+2 = MnF+ -llnl_gamma 4.1 log_k 0.920 delta_h 2.479 #kJ/mol #97sve/sho -analytic 8.8233139E+2 1.4187932E-1 -4.9330512E+4 -3.202196E+2 3.0317368E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO4- + 1.000Mn+2 = MnH2AsO4+ -llnl_gamma 4.1 log_k 1.006 delta_h -2.373 #kJ/mol #Internal calculation -analytic 8.5232998E+2 1.3468648E-1 -4.7596222E+4 -3.0908643E+2 2.9309634E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Mn+2 + 1.000H2PO4- = MnH2PO4+ -llnl_gamma 4.1 log_k 1.343 #References = LogK/DGf: 79mat/spo; #References = LogK/DGf: 79mat/spo; V°: Default value; 1.000H2AsO4- + 1.000Mn+2 = MnHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.065 delta_h 9.357 #kJ/mol #Internal calculation -analytic 8.9132777E+2 1.4178862E-1 -4.7598059E+4 -3.2624407E+2 2.5998729E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Mn+2 + 1.000H2PO4- = MnHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.632 #References = LogK/DGf: 79mat/spo; #References = LogK/DGf: 79mat/spo; V°: Default value; 1.000Mn+2 + 1.000H2O = MnO + 2.000H+ -llnl_gamma 3.4 log_k -22.195 delta_h 122.917 #kJ/mol #97asho/sas -analytic 2.6391741E+2 4.249812E-2 -1.8624121E+4 -9.7751419E+1 4.9443928E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Mn+2 + 2.000H2O = MnO2-2 + 4.000H+ -llnl_gamma 4.7 log_k -48.274 delta_h 235.076 #kJ/mol #97asho/sas -analytic -1.0163249E+3 -1.6829842E-1 4.5018798E+4 3.6720843E+2 -3.680045E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Mn+2 + 1.000H2O = MnOH+ + 1.000H+ -llnl_gamma 4.1 log_k -10.613 delta_h 60.303 #kJ/mol #97asho/sas -analytic 1.9891301E+2 3.0037154E-2 -1.3547092E+4 -7.2431629E+1 5.4959243E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Mn+2 + 1.000H2PO4- = MnPO4- + 2.000H+ -llnl_gamma 3.6 log_k -12.344 #References = LogK/DGf: 79mat/spo; #References = LogK/DGf: 79mat/spo; V°: Default value; 1.000Mn+2 + 1.000SO4-2 = MnSO4 -llnl_gamma 3.4 log_k 1.993 delta_h 9.555 #kJ/mol #97sve/sho -analytic 1.6669915E+3 2.6400874E-1 -9.0477378E+4 -6.0575091E+2 5.2127865E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.33333333333333NH3 + 0.333333333333333N2 + 1.000H+ = N2H5+ -llnl_gamma 4.1 log_k -19.616 delta_h 104.619 #kJ/mol #97asho/sas -analytic 5.8563027E+1 -2.6409537E-3 -9.6379895E+3 -1.9202698E+1 2.1777513E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.33333333333333NH3 + 0.333333333333333N2 + 2.000H+ = N2H6+2 -llnl_gamma 5.7 log_k -20.643 delta_h 95.382 #kJ/mol #97asho/sas -analytic -9.7146654E+1 -2.8900934E-2 -1.478413E+3 3.7243242E+1 -1.8457957E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H+ = N2O + 0.333333333333333H2O -llnl_gamma 3.4 log_k -7.654 delta_h 42.826 #kJ/mol #01sch/sho -analytic 1.7863969E+2 3.8081879E-2 -9.2432665E+3 -6.8377311E+1 2.2661515E+5 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H2O = N2O2-2 + 1.33333333333333H+ -llnl_gamma 4.7 log_k -53.671 delta_h 257.189 #kJ/mol #97asho/sas -analytic -1.0223894E+3 -1.6683336E-1 4.3874461E+4 3.6864883E+2 -3.6351903E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000Na+ + 2.000H2PO4- = Na2P2O7-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -13.620 #References = LogK/DGf: 76smi/mar; #References = LogK/DGf: 76smi/mar; V°: Default value; 1.000Al+3 + 1.000Na+ + 2.000H2O = NaAlO2 + 4.000H+ -llnl_gamma 3.4 log_k -23.631 delta_h 190.348 #kJ/mol #95pok/hel -analytic 7.0419419E+2 1.1134123E-1 -4.7487012E+4 -2.5312881E+2 2.1869214E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95pok/hel; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel; 1.000H2AsO4- + 1.000Na+ = NaAsO4-2 + 2.000H+ -llnl_gamma 4.7 log_k -13.867 delta_h 87.299 #kJ/mol #Internal calculation -analytic -3.4933341E+2 -7.1708066E-2 1.6125209E+4 1.2933599E+2 -1.535333E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000B(OH)3 + 1.000Na+ + 1.000H2O = NaB(OH)4 + 1.000H+ -llnl_gamma 3.0 log_k -8.977 delta_h 13.466 #kJ/mol #95pok/sch -analytic -2.9853208E+1 3.3203413E-3 2.8438652E+3 5.8780992E+0 -3.7313403E+5 #References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch; 1.000Br- + 1.000Na+ = NaBr -llnl_gamma 3.4 log_k -1.369 delta_h 8.228 #kJ/mol #97sve/sho -analytic 7.7683714E+2 1.2166393E-1 -4.318765E+4 -2.8215325E+2 2.5371295E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Na+ = NaCO3- + 1.000H+ -llnl_gamma 3.6 log_k -9.057 delta_h 32.452 #kJ/mol #Internal calculation -analytic 8.7000767E+2 1.1461962E-1 -4.8239216E+4 -3.1451953E+2 2.3836494E+6 #References = LogK/DGf: 90nor/plu; DHf/DHr: Internal calculation; S°: 13ste/ben; V°: Default value; 1.000F- + 1.000Na+ = NaF -llnl_gamma 3.4 log_k -0.970 delta_h 7.196 #kJ/mol #97sve/sho -analytic 8.349296E+2 1.3086137E-1 -4.6137375E+4 -3.0331266E+2 2.6984991E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Na+ = NaH2AsO3 -llnl_gamma 3.4 log_k 0.273 delta_h -8.134 #kJ/mol #Internal calculation -analytic 5.4981154E+2 8.1312652E-2 -2.8352689E+4 -2.0026573E+2 1.4985828E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Na+ = NaH2AsO4 -llnl_gamma 3.4 log_k -1.788 delta_h 9.245 #kJ/mol #Internal calculation -analytic 7.4433644E+2 1.1409449E-1 -4.206536E+4 -2.6964583E+2 2.5038843E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Na+ + 1.000H2PO4- = NaH2PO4 -llnl_gamma 3.4 log_k 0.410 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000H2AsO4- + 1.000Na+ = NaHAsO4- + 1.000H+ -llnl_gamma 3.6 log_k -6.298 delta_h 7.794 #kJ/mol #Internal calculation -analytic 1.8757937E+2 2.0070146E-2 -1.1257017E+4 -6.8100531E+1 5.6937493E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000HCO3- + 1.000Na+ = NaHCO3 -llnl_gamma 3.4 log_k -0.247 delta_h 11.979 #kJ/mol #Internal calculation -analytic 7.8588594E+2 1.1461962E-1 -4.319257E+4 -2.8380335E+2 2.3836494E+6 #References = LogK/DGf: 90nor/plu; DHf/DHr: Internal calculation; S°: 13ste/ben; V°: Default value; 1.000Na+ + 2.000H2PO4- = NaHP2O7-2 + 1.000H2O + 1.000H+ -llnl_gamma 4.7 log_k -7.010 #References = LogK/DGf: 76smi/mar; #References = LogK/DGf: 76smi/mar; V°: Default value; 1.000Na+ + 1.000H2PO4- = NaHPO4- + 1.000H+ -llnl_gamma 3.6 log_k -6.340 delta_h 34.940 #kJ/mol #97smi/mar -analytic 8.9613811E+2 1.3295816E-1 -5.061644E+4 -3.2469905E+2 2.7641778E+6 #References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value; 1.000I- + 1.000Na+ = NaI -llnl_gamma 3.4 log_k -1.553 delta_h 6.654 #kJ/mol #97sve/sho -analytic 6.9652453E+2 1.1039538E-1 -3.8647875E+4 -2.5339072E+2 2.2785916E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Na+ + 1.000H2O = NaOH + 1.000H+ -llnl_gamma 3.4 log_k -14.751 delta_h 53.395 #kJ/mol #Internal calculation -analytic 5.6334876E+2 8.5075501E-2 -3.4107556E+4 -2.0591888E+2 1.8192148E+6 #References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel; 1.000Na+ + 2.000H2PO4- = NaP2O7-3 + 1.000H2O + 2.000H+ -llnl_gamma 6.7 log_k -15.519 delta_h 38.336 #kJ/mol #76smi/mar -analytic 1.722698E+3 2.6357083E-1 -9.6548904E+4 -6.2815404E+2 5.4538089E+6 #References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value; 1.000Na+ + 1.000H2PO4- = NaPO4-2 + 2.000H+ -llnl_gamma 4.7 log_k -18.070 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000Na+ + 1.000SO4-2 = NaSO4- -llnl_gamma 4.5 log_k 0.936 delta_h -2.788 #kJ/mol #Internal calculation -analytic 9.358708E+2 1.4438495E-1 -5.3022649E+4 -3.3839614E+2 3.3063776E+6 #References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch; 1.000Cl- + 1.000Nd+3 = NdCl+2 -llnl_gamma 4.5 log_k 0.321 delta_h 14.723 #kJ/mol #Internal calculation -analytic 8.1545635E+2 1.3290054E-1 -4.5700896E+4 -2.959651E+2 2.7439937E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Nd+3 = NdCl2+ -llnl_gamma 4.5 log_k 0.056 delta_h 20.320 #kJ/mol #Internal calculation -analytic 1.5608345E+3 2.5357847E-1 -8.5275485E+4 -5.6818794E+2 4.9403665E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Nd+3 = NdCl3 -llnl_gamma 3.4 log_k -0.283 delta_h 14.733 #kJ/mol #95haa/sho -analytic 2.2484686E+3 3.6383024E-1 -1.1928654E+5 -8.2107479E+2 6.6276816E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Nd+3 = NdCl4- -llnl_gamma 3.6 log_k -0.695 delta_h -3.159 #kJ/mol #95haa/sho -analytic 1.6636121E+3 2.8151179E-1 -8.1236994E+4 -6.1456541E+2 3.994219E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Nd+3 = NdCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.609 delta_h -4.092 #kJ/mol #95haa/sho -analytic 7.1584766E+2 1.1644076E-1 -3.5928831E+4 -2.6401012E+2 1.8319354E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Nd+3 = NdF+2 -llnl_gamma 5.7 log_k 4.408 delta_h 22.486 #kJ/mol #95haa/sho -analytic 9.0700608E+2 1.4596778E-1 -5.0799572E+4 -3.2720315E+2 3.0141621E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Nd+3 = NdF2+ -llnl_gamma 4.1 log_k 7.644 delta_h 13.371 #kJ/mol #95haa/sho -analytic 1.7189021E+3 2.7521607E-1 -9.3572231E+4 -6.2275063E+2 5.4656127E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Nd+3 = NdF3 -llnl_gamma 3.4 log_k 10.000 delta_h -8.064 #kJ/mol #95haa/sho -analytic 2.4963871E+3 3.9902123E-1 -1.3185121E+5 -9.0812905E+2 7.4654683E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Nd+3 = NdF4- -llnl_gamma 3.6 log_k 11.990 delta_h -48.613 #kJ/mol #95haa/sho -analytic 2.0115722E+3 3.2824571E-1 -9.923865E+4 -7.3716381E+2 5.2858774E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Nd+3 + 1.000H2PO4- = NdH2PO4+2 -llnl_gamma 5.7 log_k 1.103 delta_h -5.272 #kJ/mol #95haa/sho -analytic 8.4864766E+2 1.3506583E-1 -4.8254427E+4 -3.0743224E+2 3.0893002E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Nd+3 = NdHCO3+2 -llnl_gamma 5.7 log_k 1.862 delta_h 9.057 #kJ/mol #95haa/sho -analytic 8.6312092E+2 1.3775386E-1 -4.9329531E+4 -3.1183779E+2 3.0885476E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000NO3- + 1.000Nd+3 = NdNO3+2 -llnl_gamma 5.7 log_k 0.790 delta_h -27.851 #kJ/mol #95haa/sho -analytic 7.7708387E+2 1.2304454E-1 -4.3346102E+4 -2.8275638E+2 2.8504883E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Nd+3 + 1.000H2O = NdO+ + 2.000H+ -llnl_gamma 4.1 log_k -17.064 delta_h 154.131 #kJ/mol #95haa/sho -analytic 2.3819228E+2 3.8116357E-2 -1.6751761E+4 -8.570707E+1 1.4594807E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Nd+3 + 2.000H2O = NdO2- + 4.000H+ -llnl_gamma 3.6 log_k -37.059 delta_h 278.717 #kJ/mol #95haa/sho -analytic -1.6311882E+2 -3.0299566E-2 1.3119783E+2 6.0862948E+1 -1.417697E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Nd+3 + 2.000H2O = NdO2H + 3.000H+ -llnl_gamma 3.4 log_k -26.358 delta_h 230.105 #kJ/mol #95haa/sho -analytic 2.4107809E+2 3.4321221E-2 -1.7125691E+4 -8.6887028E+1 -4.6513406E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Nd+3 + 1.000H2O = NdOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -8.121 delta_h 83.126 #kJ/mol #95haa/sho -analytic 1.7993266E+2 2.7345024E-2 -1.2939793E+4 -6.3642966E+1 4.1548299E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Nd+3 + 1.000SO4-2 = NdSO4+ -llnl_gamma 4.1 log_k 3.723 delta_h 19.640 #kJ/mol #95haa/sho -analytic 1.6353073E+3 2.5876186E-1 -8.8784189E+4 -5.9319153E+2 5.0547369E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000NO2- + 4.000H+ = NF3 + 2.000H2O -llnl_gamma 3.4 log_k -59.035 delta_h 398.898 #kJ/mol #01sch/sho -analytic 2.9348049E+3 4.6865606E-1 -1.8594797E+5 -1.0613021E+3 1.033171E+7 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 1.000NH3 + 1.000H+ = NH4+ -llnl_gamma 2.5 log_k 9.241 delta_h -51.750 #kJ/mol #97asho/sas -analytic 3.7494408E+1 -1.5452368E-3 -6.9560062E+2 -1.1496355E+1 2.655499E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ni+2 + 4.000CN- = Ni(CN)4-2 -llnl_gamma 4.7 log_k 34.083 delta_h -189.579 #kJ/mol #05gam/bug -analytic 3.1157118E+3 4.8046739E-1 -1.6103564E+5 -1.1305335E+3 1.0015423E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value; 1.000Ni+2 + 5.000CN- = Ni(CN)5-3 -llnl_gamma 6.7 log_k 33.337 delta_h -203.321 #kJ/mol #05gam/bug -analytic 3.8659541E+3 5.956038E-1 -2.0178816E+5 -1.4037206E+3 1.2446798E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value; 1.000H2AsO4- + 1.000Ni+2 = NiAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -10.665 delta_h 84.853 #kJ/mol #Internal calculation -analytic 2.2480603E+2 2.9293092E-2 -1.2692869E+4 -8.1674589E+1 4.1399361E+4 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Ni+2 = NiCl+ -llnl_gamma 4.1 log_k 0.151 delta_h 5.242 #kJ/mol #Internal calculation -analytic 7.9675849E+2 1.2938975E-1 -4.4201147E+4 -2.8974022E+2 2.6676433E+6 #References = LogK/DGf: 05gam/bug; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Ni+2 = NiCO3 + 1.000H+ -llnl_gamma 3.4 log_k -6.056 #References = LogK/DGf: 05gam/bug; #References = LogK/DGf: 05gam/bug; V°: Default value; 1.000F- + 1.000Ni+2 = NiF+ -llnl_gamma 4.1 log_k 1.501 delta_h 13.990 #kJ/mol #05gam/bug -analytic 8.7794739E+2 1.3998113E-1 -4.9222365E+4 -3.1775043E+2 2.9480287E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO4- + 1.000Ni+2 = NiH2AsO4+ -llnl_gamma 4.1 log_k 1.680 delta_h -9.191 #kJ/mol #Internal calculation -analytic 8.0557284E+2 1.2506729E-1 -4.4376502E+4 -2.9209319E+2 2.704456E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Ni+2 = NiHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.786 delta_h 12.531 #kJ/mol #Internal calculation -analytic 8.9542941E+2 1.4271702E-1 -4.783787E+4 -3.2756597E+2 2.5977159E+6 #References = LogK/DGf: 05gam/bug; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Ni+2 + 2.000H2PO4- = NiHP2O7- + 1.000H2O + 1.000H+ -llnl_gamma 3.6 log_k -3.200 #References = LogK/DGf: 05gam/bug; #References = LogK/DGf: 05gam/bug; V°: Default value; 1.000Ni+2 + 1.000H2PO4- = NiHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.091 #References = LogK/DGf: 05gam/bug; #References = LogK/DGf: 05gam/bug; V°: Default value; 1.000Ni+2 + 1.000HS- = NiHS+ -llnl_gamma 4.1 log_k 5.251 #References = LogK/DGf: 05gam/bug; #References = LogK/DGf: 05gam/bug; V°: Default value; 1.000NO3- + 1.000Ni+2 = NiNO3+ -llnl_gamma 4.1 log_k 0.551 #References = LogK/DGf: 05gam/bug; #References = LogK/DGf: 05gam/bug; V°: Default value; 1.000Ni+2 + 1.000H2O = NiO + 2.000H+ -llnl_gamma 3.4 log_k -19.501 delta_h 98.873 #kJ/mol #Internal calculation -analytic 3.6026241E+2 5.7732513E-2 -2.4281238E+4 -1.3233624E+2 1.059672E+6 #References = LogK/DGf: 12bla; DHf/DHr: Internal calculation; S°: 12coo/oli; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ni+2 + 1.000H2O = NiOH+ + 1.000H+ -llnl_gamma 4.1 log_k -9.501 delta_h 35.577 #kJ/mol #Internal calculation -analytic 2.3696944E+2 3.6212326E-2 -1.6157506E+4 -8.636598E+1 9.4514802E+5 #References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 12coo/oli; Cp: 97asho/sas; V°: 97asho/sas; 1.000Ni+2 + 2.000H2PO4- = NiP2O7-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -9.008 delta_h 8.643 #kJ/mol #Internal calculation -analytic 1.7906449E+3 2.8122558E-1 -9.819552E+4 -6.5385543E+2 5.6688658E+6 #References = LogK/DGf: 05gam/bug; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; 1.000Ni+2 + 1.000SO4-2 = NiSO4 -llnl_gamma 3.4 log_k 2.420 delta_h 10.150 #kJ/mol #05gam/bug -analytic 1.7287472E+3 2.7178368E-1 -9.5601893E+4 -6.2662385E+2 5.6741115E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value; 0.166666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H+ = NO + 0.333333333333333H2O -llnl_gamma 3.4 log_k -7.261 delta_h 54.740 #kJ/mol #01sch/sho -analytic 5.4270966E+2 8.8266951E-2 -3.4476911E+4 -1.957306E+2 2.1042284E+6 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 1.000CN- + 0.500O2 = OCN- -llnl_gamma 3.5 log_k 48.713 delta_h -290.559 #kJ/mol #97asho/sas -analytic -7.470346E+1 -1.2812853E-2 2.0195896E+4 2.5943932E+1 -4.175178E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000H2O = OH- + 1.000H+ -llnl_gamma 3.5 log_k -14.002 delta_h 55.815 #kJ/mol #89cox/wag -analytic -7.0195411E+2 -1.1273948E-1 3.6168089E+4 2.5360011E+2 -2.423262E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas; 2.000H2PO4- = P2O7-4 + 1.000H2O + 2.000H+ -llnl_gamma 9.6 log_k -17.810 delta_h 32.478 #kJ/mol #Internal calculation -analytic -1.5373765E+3 -2.4808173E-1 8.3161679E+4 5.5500874E+2 -5.2203742E+6 #References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 97asho/sas; V°: 97asho/sas; 1.000HCO3- + 1.000Pb+2 = Pb(CO3) + 1.000H+ -llnl_gamma 3.4 log_k -3.327 delta_h 11.685 #kJ/mol #06bla/pia -analytic 9.2698891E+2 1.4344226E-1 -5.1261042E+4 -3.371417E+2 2.9408009E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 06bla/pia; V°: Default value; 2.000HCO3- + 1.000Pb+2 = Pb(CO3)2-2 + 2.000H+ -llnl_gamma 4.7 log_k -10.524 #References = LogK/DGf: 06bla/pia; #References = LogK/DGf: 06bla/pia; V°: Default value; 1.000H2PO4- + 1.000Pb+2 = Pb(H2PO4)+ -llnl_gamma 4.1 log_k 1.500 #References = LogK/DGf: 72anri; #References = LogK/DGf: 72anri; V°: Default value; 1.000Pb+2 + 2.000HS- = Pb(HS)2 -llnl_gamma 3.4 log_k 15.010 delta_h -65.580 #kJ/mol #Internal calculation -analytic 1.6254117E+3 2.5826405E-1 -8.6954283E+4 -5.8916053E+2 5.5187048E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Pb+2 + 3.000HS- = Pb(HS)3- -llnl_gamma 3.6 log_k 16.260 delta_h -73.330 #kJ/mol #Internal calculation -analytic 1.9733404E+3 3.1294593E-1 -1.0667492E+5 -7.1501176E+2 6.8140498E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Pb+2 + 4.000H2O = Pb(OH)4-2 + 4.000H+ -llnl_gamma 4.7 log_k -38.904 delta_h 197.475 #kJ/mol #Internal calculation -analytic 5.0743539E+2 4.8227827E-2 -3.6287128E+4 -1.8195677E+2 9.9820342E+5 #References = LogK/DGf: 01per/hef; DHf/DHr: Internal calculation; S°: 97cro; V°: Default value; 1.000Pb+2 + 2.000SO4-2 = Pb(SO4)2-2 -llnl_gamma 4.7 log_k 3.470 #References = LogK/DGf: 06bla/pia; #References = LogK/DGf: 06bla/pia; V°: Default value; 2.000Pb+2 + 1.000H2O = Pb2(OH)+3 + 1.000H+ -llnl_gamma 8.2 log_k -7.180 #References = LogK/DGf: 99lot/och; #References = LogK/DGf: 99lot/och; V°: Default value; 4.000Pb+2 + 4.000H2O = Pb4(OH)4+4 + 4.000H+ -llnl_gamma 11.6 log_k -20.634 delta_h 82.038 #kJ/mol #Internal calculation -analytic 1.3235532E+3 1.9196939E-1 -7.6329308E+4 -4.8106871E+2 3.9966443E+6 #References = LogK/DGf: 99lot/och; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; 6.000Pb+2 + 8.000H2O = Pb6(OH)8+4 + 8.000H+ -llnl_gamma 11.6 log_k -42.688 delta_h 192.158 #kJ/mol #Internal calculation -analytic 2.0388889E+3 2.8811107E-1 -1.2045783E+5 -7.3992355E+2 5.994328E+6 #References = LogK/DGf: 99lot/och; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; 1.000H2AsO4- + 1.000Pb+2 = PbAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -11.735 delta_h 95.026 #kJ/mol #Internal calculation -analytic 3.5533311E+2 5.2767108E-2 -2.0155818E+4 -1.2948352E+2 4.6229891E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Pb+2 = PbCl+ -llnl_gamma 4.1 log_k 1.440 delta_h 4.318 #kJ/mol #Internal calculation -analytic 8.6381866E+2 1.4020171E-1 -4.7427207E+4 -3.1399054E+2 2.8304505E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 2.000Cl- + 1.000Pb+2 = PbCl2 -llnl_gamma 3.4 log_k 2.000 delta_h 7.948 #kJ/mol #Internal calculation -analytic 1.5426169E+3 2.4867155E-1 -8.4545453E+4 -5.6074042E+2 5.0068443E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 3.000Cl- + 1.000Pb+2 = PbCl3- -llnl_gamma 3.6 log_k 1.690 delta_h 7.811 #kJ/mol #Internal calculation -analytic 1.7729993E+3 2.865683E-1 -9.7270049E+4 -6.448192E+2 5.7832948E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 4.000Cl- + 1.000Pb+2 = PbCl4-2 -llnl_gamma 4.7 log_k 1.400 delta_h 1.324 #kJ/mol #Internal calculation -analytic 1.7059874E+3 2.7716686E-1 -9.3612476E+4 -6.2096082E+2 5.6251873E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000F- + 1.000Pb+2 = PbF+ -llnl_gamma 4.1 log_k 2.270 delta_h -4.055 #kJ/mol #Internal calculation -analytic 8.7137062E+2 1.3980107E-1 -4.7875203E+4 -3.1641801E+2 2.9110495E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 2.000F- + 1.000Pb+2 = PbF2 -llnl_gamma 3.4 log_k 3.010 delta_h -8.880 #kJ/mol #Internal calculation -analytic 1.7070306E+3 2.7307779E-1 -9.3362198E+4 -6.2056351E+2 5.6219366E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Pb+2 = PbH2AsO3+ -llnl_gamma 4.1 log_k 5.172 delta_h -20.319 #kJ/mol #Internal calculation -analytic 7.3145269E+2 1.1407821E-1 -3.7319588E+4 -2.6618197E+2 2.0914377E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Pb+2 = PbH2AsO4+ -llnl_gamma 4.1 log_k 1.534 delta_h 6.559 #kJ/mol #Internal calculation -analytic 9.3632249E+2 1.4861231E-1 -5.2073502E+4 -3.3932426E+2 3.1285274E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2PO4- + 1.000Pb+2 = PbH2PO4+ -llnl_gamma 4.1 log_k -1.500 #References = LogK/DGf: 74nri; #References = LogK/DGf: 74nri; V°: Default value; 1.000H2AsO4- + 1.000Pb+2 = PbHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.166 delta_h 11.030 #kJ/mol #Internal calculation -analytic 8.6079462E+2 1.356431E-1 -4.6327365E+4 -3.1465411E+2 2.5397679E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000HCO3- + 1.000Pb+2 = PbHCO3+ -llnl_gamma 4.1 log_k 3.443 #References = LogK/DGf: 89mar/smi; #References = LogK/DGf: 89mar/smi; V°: Default value; 1.000H2PO4- + 1.000Pb+2 = PbHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.105 #References = LogK/DGf: 72anri, 76smi/mar; #References = LogK/DGf: 72anri, 76smi/mar; V°: Default value; 1.000Pb+2 + 1.000H2O = PbO + 2.000H+ -llnl_gamma 3.4 log_k -16.951 delta_h 97.824 #kJ/mol #Internal calculation -analytic 1.8259665E+2 2.7874046E-2 -1.2184514E+4 -6.7986728E+1 1.1000287E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Pb+2 + 1.000H2O = PbOH+ + 1.000H+ -llnl_gamma 4.1 log_k -7.511 delta_h 4.021 #kJ/mol #Internal calculation -analytic 8.5257852E+1 1.1377634E-2 -4.2238231E+3 -3.3591773E+1 1.0012203E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H2PO4- + 1.000Pb+2 = PbP2O7-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -9.478 #References = LogK/DGf: 82wag/eva; #References = LogK/DGf: 82wag/eva; V°: Default value; 1.000Pb+2 + 1.000SO4-2 = PbSO4 -llnl_gamma 3.4 log_k 2.820 delta_h 6.860 #kJ/mol #Internal calculation -analytic 1.70316E+3 2.6612736E-1 -9.449375E+4 -6.1682668E+2 5.6487431E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 06bla/pia; V°: Default value; 1.000Pd+2 + 2.000SO4-2 = Pd(SO4)2-2 -llnl_gamma 4.7 log_k 4.543 delta_h 13.311 #kJ/mol #98sas/sho -analytic 1.832795E+3 2.8730487E-1 -1.0245499E+5 -6.6270289E+2 6.1815203E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pd+2 + 3.000SO4-2 = Pd(SO4)3-4 -llnl_gamma 9.6 log_k 6.330 delta_h 22.791 #kJ/mol #98sas/sho -analytic 2.0039129E+3 3.1048858E-1 -1.1510724E+5 -7.2128643E+2 7.1730748E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Cl- + 1.000Pd+2 = PdCl+ -llnl_gamma 4.1 log_k 6.112 delta_h -30.306 #kJ/mol #98sas/sho -analytic 8.1838728E+2 1.3409366E-1 -4.3614989E+4 -2.9786625E+2 2.7628525E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 2.000Cl- + 1.000Pd+2 = PdCl2 -llnl_gamma 3.4 log_k 10.728 delta_h -63.428 #kJ/mol #98sas/sho -analytic 1.6134783E+3 2.6312616E-1 -8.5772393E+4 -5.8778955E+2 5.4160873E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 3.000Cl- + 1.000Pd+2 = PdCl3- -llnl_gamma 3.6 log_k 13.138 delta_h -96.181 #kJ/mol #98sas/sho -analytic 1.6089528E+3 2.6370202E-1 -8.5837979E+4 -5.8634035E+2 5.7181439E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 4.000Cl- + 1.000Pd+2 = PdCl4-2 -llnl_gamma 4.7 log_k 15.138 delta_h -142.184 #kJ/mol #98sas/sho -analytic 1.5764809E+3 2.5922264E-1 -8.3560665E+4 -5.7571001E+2 5.8839186E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pd+2 + 1.000H2O = PdO + 2.000H+ -llnl_gamma 3.4 log_k -2.184 delta_h 6.074 #kJ/mol #98sas/sho -analytic 2.9119088E+2 4.7651938E-2 -1.4350767E+4 -1.0777241E+2 6.4237875E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pd+2 + 1.000H2O = PdOH+ + 1.000H+ -llnl_gamma 4.1 log_k -0.989 delta_h 6.864 #kJ/mol #98sas/sho -analytic 1.9846565E+2 3.0793354E-2 -1.0840088E+4 -7.2242887E+1 5.7624594E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pd+2 + 1.000SO4-2 = PdSO4 -llnl_gamma 3.4 log_k 2.477 delta_h 5.546 #kJ/mol #98sas/sho -analytic 1.6703449E+3 2.6532341E-1 -9.0413222E+4 -6.0720656E+2 5.2239121E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000F- + 1.000H2PO4- = PO3F-2 + 1.000H2O -llnl_gamma 4.7 log_k -1.180 #References = LogK/DGf: 82wag/eva; #References = LogK/DGf: 82wag/eva; V°: Default value; 1.000H2PO4- = PO4-3 + 2.000H+ -llnl_gamma 4.0 log_k -19.560 delta_h 18.200 #kJ/mol #89cox/wag -analytic -1.4841595E+3 -2.40379E-1 8.1179531E+4 5.3408042E+2 -5.1163686E+6 #References = LogK/DGf: 89cox/wag; DHf/DHr: 89cox/wag; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- + 1.000Pr+3 = PrCl+2 -llnl_gamma 5.7 log_k 0.321 delta_h 14.599 #kJ/mol #95haa/sho -analytic 8.2254301E+2 1.3443941E-1 -4.6166589E+4 -2.9856825E+2 2.7846877E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Pr+3 = PrCl2+ -llnl_gamma 4.1 log_k 0.056 delta_h 20.070 #kJ/mol #95haa/sho -analytic 1.5750449E+3 2.563597E-1 -8.6405665E+4 -5.7323523E+2 5.050608E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Pr+3 = PrCl3 -llnl_gamma 3.4 log_k -0.283 delta_h 14.109 #kJ/mol #95haa/sho -analytic 2.275443E+3 3.6890619E-1 -1.2146741E+5 -8.306044E+2 6.8416809E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Pr+3 = PrCl4- -llnl_gamma 3.6 log_k -0.695 delta_h -4.157 #kJ/mol #95haa/sho -analytic 1.7182082E+3 2.9070183E-1 -8.5507347E+4 -6.3375192E+2 4.3909077E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Pr+3 = PrCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.756 delta_h -3.380 #kJ/mol #95haa/sho -analytic 7.2138296E+2 1.1758338E-1 -3.6202729E+4 -2.6611711E+2 1.8416874E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Pr+3 = PrF+2 -llnl_gamma 5.7 log_k 4.262 delta_h 23.448 #kJ/mol #95haa/sho -analytic 9.1398371E+2 1.4748891E-1 -5.131259E+4 -3.2975248E+2 3.0542579E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Pr+3 = PrF2+ -llnl_gamma 4.1 log_k 7.424 delta_h 14.875 #kJ/mol #95haa/sho -analytic 1.7346569E+3 2.7829505E-1 -9.4856483E+4 -6.2834975E+2 5.5784545E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Pr+3 = PrF3 -llnl_gamma 3.4 log_k 9.780 delta_h -6.684 #kJ/mol #95haa/sho -analytic 2.5234912E+3 4.0409706E-1 -1.3413665E+5 -9.1765819E+2 7.6794616E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Pr+3 = PrF4- -llnl_gamma 3.6 log_k 11.697 delta_h -47.314 #kJ/mol #95haa/sho -analytic 2.4721985E+3 3.9032509E-1 -1.2770247E+5 -9.0092257E+2 7.174863E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000H2PO4- + 1.000Pr+3 = PrH2PO4+2 -llnl_gamma 5.7 log_k 1.183 delta_h -6.015 #kJ/mol #95haa/sho -analytic 8.5579111E+2 1.3661523E-1 -4.8692969E+4 -3.1006558E+2 3.1303163E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Pr+3 = PrHCO3+2 -llnl_gamma 5.7 log_k 1.936 delta_h -13.317 #kJ/mol #95haa/sho -analytic 8.4631902E+2 1.350292E-1 -4.7807504E+4 -3.0679259E+2 3.0973152E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000NO3- + 1.000Pr+3 = PrNO3+2 -llnl_gamma 5.7 log_k 0.655 delta_h -27.588 #kJ/mol #95haa/sho -analytic 7.8435293E+2 1.2461399E-1 -4.3847158E+4 -2.8544811E+2 2.8921306E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Pr+3 + 1.000H2O = PrO+ + 2.000H+ -llnl_gamma 4.1 log_k -17.284 delta_h 155.136 #kJ/mol #95haa/sho -analytic 2.3729949E+2 3.8289818E-2 -1.6589158E+4 -8.5554282E+1 1.1907844E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Pr+3 + 2.000H2O = PrO2- + 4.000H+ -llnl_gamma 3.6 log_k -37.573 delta_h 281.272 #kJ/mol #95haa/sho -analytic -1.6354321E+2 -3.00551E-2 1.3562404E+2 6.0869811E+1 -1.4348912E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Pr+3 + 2.000H2O = PrO2H + 3.000H+ -llnl_gamma 3.4 log_k -26.578 delta_h 230.986 #kJ/mol #95haa/sho -analytic 2.4796025E+2 3.5075905E-2 -1.7372222E+4 -8.9468671E+1 -4.7509796E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Pr+3 + 1.000H2O = PrOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -8.268 delta_h 83.714 #kJ/mol #95haa/sho -analytic 1.7910838E+2 2.7507621E-2 -1.2763523E+4 -6.3508715E+1 3.8933027E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Pr+3 + 1.000SO4-2 = PrSO4+ -llnl_gamma 4.1 log_k -3.607 delta_h 61.106 #kJ/mol #95haa/sho -analytic 1.6468274E+3 2.6102526E-1 -9.1474449E+4 -5.9754525E+2 5.0788508E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Pt+2 + 2.000SO4-2 = Pt(SO4)2-2 -llnl_gamma 4.7 log_k 4.858 delta_h 11.138 #kJ/mol #98sas/sho -analytic 1.8256106E+3 2.8625795E-1 -1.0194701E+5 -6.6013009E+2 6.1585564E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pt+2 + 3.000SO4-2 = Pt(SO4)3-4 -llnl_gamma 9.6 log_k 6.242 delta_h 22.544 #kJ/mol #98sas/sho -analytic 1.9956555E+3 3.0926494E-1 -1.1461862E+5 -7.1836054E+2 7.1424438E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Cl- + 1.000Pt+2 = PtCl+ -llnl_gamma 4.1 log_k 8.692 delta_h -45.782 #kJ/mol #98sas/sho -analytic 8.1368089E+2 1.3336855E-1 -4.2477924E+4 -2.9625054E+2 2.7353877E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 2.000Cl- + 1.000Pt+2 = PtCl2 -llnl_gamma 3.4 log_k 15.515 delta_h -92.745 #kJ/mol #98sas/sho -analytic 1.6086577E+3 2.6251361E-1 -8.3744187E+4 -5.863356E+2 5.3618039E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 3.000Cl- + 1.000Pt+2 = PtCl3- -llnl_gamma 3.6 log_k 18.526 delta_h -130.801 #kJ/mol #98sas/sho -analytic 1.5878896E+3 2.6017069E-1 -8.2562327E+4 -5.7909277E+2 5.5922158E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 4.000Cl- + 1.000Pt+2 = PtCl4-2 -llnl_gamma 4.7 log_k 20.057 delta_h -177.245 #kJ/mol #98sas/sho -analytic 1.5484256E+3 2.5438282E-1 -7.970325E+4 -5.6619741E+2 5.7008538E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pt+2 + 1.000H2O = PtO + 2.000H+ -llnl_gamma 3.4 log_k 4.435 delta_h -32.955 #kJ/mol #98sas/sho -analytic 3.0248248E+2 4.970448E-2 -1.3165226E+4 -1.1185901E+2 7.1803995E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pt+2 + 1.000H2O = PtOH+ + 1.000H+ -llnl_gamma 4.1 log_k 2.463 delta_h -13.841 #kJ/mol #98sas/sho -analytic 2.0903797E+2 3.2408781E-2 -1.0630587E+4 -7.5961331E+1 6.5597033E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Pt+2 + 1.000SO4-2 = PtSO4 -llnl_gamma 3.4 log_k 2.990 delta_h 2.368 #kJ/mol #98sas/sho -analytic 1.671333E+3 2.6568475E-1 -9.0259416E+4 -6.076424E+2 5.2221217E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Br- + 1.000Rb+ = RbBr -llnl_gamma 3.4 log_k -1.217 delta_h 13.931 #kJ/mol #97sve/sho -analytic 6.493888E+2 1.0249979E-1 -3.5678675E+4 -2.3605258E+2 2.008785E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cl- + 1.000Rb+ = RbCl -llnl_gamma 3.4 log_k -0.947 delta_h 13.180 #kJ/mol #97sve/sho -analytic 6.4893355E+2 1.0345472E-1 -3.5313843E+4 -2.3619228E+2 1.9698829E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000F- + 1.000Rb+ = RbF -llnl_gamma 3.4 log_k 1.000 delta_h 1.899 #kJ/mol #97sve/sho -analytic 7.2298773E+2 1.1414094E-1 -3.888063E+4 -2.6290417E+2 2.2158183E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000I- + 1.000Rb+ = RbI -llnl_gamma 3.4 log_k -0.960 delta_h 7.975 #kJ/mol #97sve/sho -analytic 5.9916358E+2 9.5931008E-2 -3.2537894E+4 -2.1835591E+2 1.8413791E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Rb+ + 1.000H2O = RbOH + 1.000H+ -llnl_gamma 3.4 log_k -14.205 delta_h 64.213 #kJ/mol #97asho/sas -analytic 2.2766071E+1 1.618384E-4 -3.0743368E+3 -9.7533177E+0 -2.2881424E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Rh+3 + 2.000SO4-2 = Rh(SO4)2- -llnl_gamma 3.6 log_k 2.131 delta_h 67.868 #kJ/mol #98sas/sho -analytic 2.5513074E+3 4.0341082E-1 -1.4205323E+5 -9.2337344E+2 8.1624604E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+2 + 2.000SO4-2 = Rh(SO4)2-2 -llnl_gamma 4.7 log_k 4.513 delta_h 12.231 #kJ/mol #98sas/sho -analytic 1.8024932E+3 2.8181216E-1 -1.009668E+5 -6.5150595E+2 6.1115247E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+3 + 3.000SO4-2 = Rh(SO4)3-3 -llnl_gamma 6.7 log_k 1.969 delta_h 108.811 #kJ/mol #98sas/sho -analytic 2.7847149E+3 4.3682783E-1 -1.5921278E+5 -1.0036905E+3 9.296724E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+2 + 3.000SO4-2 = Rh(SO4)3-4 -llnl_gamma 9.6 log_k 6.110 delta_h 22.050 #kJ/mol #98sas/sho -analytic 1.973939E+3 3.0503986E-1 -1.1363504E+5 -7.1026833E+2 7.0999265E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Cl- + 1.000Rh+2 = RhCl+ -llnl_gamma 4.1 log_k -0.207 delta_h 3.515 #kJ/mol #98sas/sho -analytic 7.9942098E+2 1.3016799E-1 -4.4358864E+4 -2.9094996E+2 2.6916782E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Cl- + 1.000Rh+3 = RhCl+2 -llnl_gamma 5.7 log_k 2.022 delta_h -0.348 #kJ/mol #98sas/sho -analytic 8.3282981E+2 1.3629335E-1 -4.6668187E+4 -3.0224243E+2 2.93002E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 2.000Cl- + 1.000Rh+3 = RhCl2+ -llnl_gamma 4.1 log_k 3.303 delta_h -11.813 #kJ/mol #98sas/sho -analytic 1.6310643E+3 2.6553912E-1 -8.9750896E+4 -5.933253E+2 5.5326373E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 2.000Cl- + 1.000Rh+2 = RhCl2 -llnl_gamma 3.4 log_k -0.772 delta_h -3.394 #kJ/mol #98sas/sho -analytic 1.592734E+3 2.5933545E-1 -8.7318037E+4 -5.8080651E+2 5.2630806E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 3.000Cl- + 1.000Rh+3 = RhCl3 -llnl_gamma 3.4 log_k 3.338 delta_h -32.382 #kJ/mol #98sas/sho -analytic 2.3666082E+3 3.8724948E-1 -1.2704087E+5 -8.6422958E+2 7.6313648E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 3.000Cl- + 1.000Rh+2 = RhCl3- -llnl_gamma 3.6 log_k -2.093 delta_h -20.215 #kJ/mol #98sas/sho -analytic 1.5502361E+3 2.5286135E-1 -8.5900102E+4 -5.6586836E+2 5.3864651E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 4.000Cl- + 1.000Rh+3 = RhCl4- -llnl_gamma 3.6 log_k 3.300 delta_h -72.492 #kJ/mol #98sas/sho -analytic 2.3207293E+3 3.7507356E-1 -1.2284792E+5 -8.4908606E+2 7.4479114E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 4.000Cl- + 1.000Rh+2 = RhCl4-2 -llnl_gamma 4.7 log_k -3.297 delta_h -56.417 #kJ/mol #98sas/sho -analytic 1.4969138E+3 2.444351E-1 -8.2503761E+4 -5.4840133E+2 5.3881248E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+3 + 1.000H2O = RhO+ + 2.000H+ -llnl_gamma 4.1 log_k -5.402 delta_h 75.962 #kJ/mol #98sas/sho -analytic 2.4708519E+2 4.0026999E-2 -1.4473707E+4 -8.8962661E+1 3.7836874E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+2 + 1.000H2O = RhO + 2.000H+ -llnl_gamma 3.4 log_k -15.950 delta_h 81.032 #kJ/mol #98sas/sho -analytic 3.1405806E+2 5.1150083E-2 -2.0383153E+4 -1.1576781E+2 8.5046889E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+2 + 1.000H2O = RhOH+ + 1.000H+ -llnl_gamma 4.1 log_k -7.835 delta_h 43.198 #kJ/mol #98sas/sho -analytic 2.2356249E+2 3.3738144E-2 -1.5117932E+4 -8.0753274E+1 8.0606176E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+3 + 1.000H2O = RhOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -2.499 delta_h 42.178 #kJ/mol #98sas/sho -analytic 1.9684414E+2 3.0495179E-2 -1.2853102E+4 -6.9750442E+1 6.4600168E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+3 + 1.000SO4-2 = RhSO4+ -llnl_gamma 4.1 log_k 1.560 delta_h 31.110 #kJ/mol #98sas/sho -analytic 1.6670619E+3 2.642195E-1 -9.1392176E+4 -6.0470209E+2 5.2045442E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Rh+2 + 1.000SO4-2 = RhSO4 -llnl_gamma 3.4 log_k 2.477 delta_h 4.798 #kJ/mol #98sas/sho -analytic 1.6662208E+3 2.6432319E-1 -9.0242269E+4 -6.0563896E+2 5.2212441E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+3 + 2.000SO4-2 = Ru(SO4)2- -llnl_gamma 3.6 log_k 2.710 delta_h 64.563 #kJ/mol #98sas/sho -analytic 2.5456446E+3 4.0235711E-1 -1.41287E+5 -9.2146323E+2 8.0966263E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+2 + 2.000SO4-2 = Ru(SO4)2-2 -llnl_gamma 4.7 log_k 4.147 delta_h 14.572 #kJ/mol #98sas/sho -analytic 1.8095619E+3 2.8292403E-1 -1.0145925E+5 -6.5406993E+2 6.1319114E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+3 + 3.000SO4-2 = Ru(SO4)3-3 -llnl_gamma 6.7 log_k 2.328 delta_h 106.761 #kJ/mol #98sas/sho -analytic 2.7804944E+3 4.3599172E-1 -1.5859043E+5 -1.0023035E+3 9.235339E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+2 + 3.000SO4-2 = Ru(SO4)3-4 -llnl_gamma 9.6 log_k 5.304 delta_h 27.151 #kJ/mol #98sas/sho -analytic 1.9783259E+3 3.0571737E-1 -1.1412874E+5 -7.1183657E+2 7.1124813E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Cl- + 1.000Ru+2 = RuCl+ -llnl_gamma 4.1 log_k -0.493 delta_h 5.645 #kJ/mol #98sas/sho -analytic 8.0085686E+2 1.3040388E-1 -4.4592021E+4 -2.9141439E+2 2.7040459E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Cl- + 1.000Ru+3 = RuCl+2 -llnl_gamma 5.7 log_k 2.183 delta_h -1.019 #kJ/mol #98sas/sho -analytic 8.4565856E+2 1.3854402E-1 -4.7776368E+4 -3.0665568E+2 3.0454602E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 2.000Cl- + 1.000Ru+3 = RuCl2+ -llnl_gamma 4.1 log_k 3.779 delta_h -14.033 #kJ/mol #98sas/sho -analytic 1.6644237E+3 2.7145897E-1 -9.2650509E+4 -6.0479587E+2 5.8402547E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 2.000Cl- + 1.000Ru+2 = RuCl2 -llnl_gamma 3.4 log_k -1.293 delta_h 0.824 #kJ/mol #98sas/sho -analytic 1.5955207E+3 2.5972086E-1 -8.7828073E+4 -5.8164465E+2 5.2953048E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 3.000Cl- + 1.000Ru+3 = RuCl3 -llnl_gamma 3.4 log_k 4.335 delta_h -37.199 #kJ/mol #98sas/sho -analytic 2.4332537E+3 3.9886877E-1 -1.3271282E+5 -8.8718139E+2 8.2272763E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 3.000Cl- + 1.000Ru+2 = RuCl3- -llnl_gamma 3.6 log_k -2.790 delta_h -13.870 #kJ/mol #98sas/sho -analytic 1.5591329E+3 2.5444943E-1 -8.6909466E+4 -5.6886182E+2 5.4510013E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 4.000Cl- + 1.000Ru+3 = RuCl4- -llnl_gamma 3.6 log_k 4.194 delta_h -75.975 #kJ/mol #98sas/sho -analytic 2.422649E+3 3.9314942E-1 -1.3186961E+5 -8.8412883E+2 8.386198E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 4.000Cl- + 1.000Ru+2 = RuCl4-2 -llnl_gamma 4.7 log_k -4.140 delta_h -47.364 #kJ/mol #98sas/sho -analytic 1.5103603E+3 2.4688837E-1 -8.4007718E+4 -5.5288768E+2 5.4880936E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 5.000Cl- + 1.000Ru+3 = RuCl5-2 -llnl_gamma 4.7 log_k 3.907 delta_h -165.659 #kJ/mol #98sas/sho -analytic 2.440593E+3 3.9395171E-1 -1.3121559E+5 -8.9436264E+2 8.8003351E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 6.000Cl- + 1.000Ru+3 = RuCl6-3 -llnl_gamma 6.7 log_k 3.525 delta_h -265.789 #kJ/mol #98sas/sho -analytic 2.3986671E+3 3.8299613E-1 -1.2423733E+5 -8.8470391E+2 8.5785132E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+3 + 1.000H2O = RuO+ + 2.000H+ -llnl_gamma 4.1 log_k -3.511 delta_h 65.666 #kJ/mol #98sas/sho -analytic 2.3278218E+2 3.7687648E-2 -1.2698857E+4 -8.3997096E+1 2.5852116E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+2 + 1.000H2O = RuO + 2.000H+ -llnl_gamma 3.4 log_k -15.400 delta_h 78.642 #kJ/mol #98sas/sho -analytic 3.0726734E+2 4.9945697E-2 -1.9739908E+4 -1.1331861E+2 8.0439886E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+2 + 1.000H2O = RuOH+ + 1.000H+ -llnl_gamma 4.1 log_k -7.557 delta_h 42.231 #kJ/mol #98sas/sho -analytic 2.1465798E+2 3.2412844E-2 -1.4399221E+4 -7.7600316E+1 7.496886E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+3 + 1.000H2O = RuOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -2.235 delta_h 40.921 #kJ/mol #98sas/sho -analytic 1.8359445E+2 2.8310258E-2 -1.1623699E+4 -6.5172418E+1 5.3164471E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+3 + 1.000SO4-2 = RuSO4+ -llnl_gamma 4.1 log_k 2.066 delta_h 28.223 #kJ/mol #98sas/sho -analytic 1.6577992E+3 2.6264434E-1 -9.0447764E+4 -6.0149254E+2 5.1270885E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000Ru+2 + 1.000SO4-2 = RuSO4 -llnl_gamma 3.4 log_k 2.403 delta_h 5.341 #kJ/mol #98sas/sho -analytic 1.6653862E+3 2.6410257E-1 -9.0243637E+4 -6.0530093E+2 5.2208168E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; 1.000HS- = S-2 + 1.000H+ -llnl_gamma 5.0 log_k -17.100 delta_h 73.277 #kJ/mol #Internal calculation -analytic 7.5990577E+2 1.0332409E-1 -4.4623962E+4 -2.7564897E+2 2.1275005E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value; 1.500HS- + 0.250S2O3-2 = S2-2 + 0.750H2O -llnl_gamma 4.7 log_k -3.332 delta_h 8.189 #kJ/mol #04chi -analytic -6.7494608E+1 -8.3051219E-3 3.5841897E+3 2.3253269E+1 -2.5968306E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel; 2.000SO3-2 + 2.000H+ = S2O5-2 + 1.000H2O -llnl_gamma 4.7 log_k 12.851 delta_h 2.605 #kJ/mol #Internal calculation -analytic 1.4398326E+3 2.3207016E-1 -7.9779598E+4 -5.1891599E+2 4.9275901E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas; 2.000HS- + 0.500S2O3-2 + 1.000H+ = S3-2 + 1.500H2O -llnl_gamma 4.7 log_k 7.905 delta_h -44.062 #kJ/mol #04chi -analytic 6.0944351E+2 1.0131316E-1 -3.1252624E+4 -2.2227278E+2 2.0513662E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel; 1.000S2O4-2 + 1.000SO3-2 + 2.000H+ = S3O6-2 + 1.000H2O -llnl_gamma 4.7 log_k 18.882 delta_h -68.607 #kJ/mol #97asho/sas -analytic 1.3915088E+3 2.2410736E-1 -7.344261E+4 -5.0366254E+2 4.7259086E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.500HS- + 0.750S2O3-2 + 2.000H+ = S4-2 + 2.250H2O -llnl_gamma 4.7 log_k 18.039 delta_h -90.143 #kJ/mol #04chi -analytic 1.2851749E+3 2.108594E-1 -6.6321358E+4 -4.674034E+2 4.3556807E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel; 1.000S2O3-2 + 1.000S2O4-2 + 2.000H+ = S4O6-2 + 1.000H2O -llnl_gamma 4.7 log_k 27.057 delta_h -104.283 #kJ/mol #97asho/sas -analytic 1.4881486E+3 2.3891761E-1 -7.6989541E+4 -5.3794071E+2 5.066786E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 3.000HS- + 1.000S2O3-2 + 3.000H+ = S5-2 + 3.000H2O -llnl_gamma 4.7 log_k 27.953 delta_h -134.964 #kJ/mol #04chi -analytic 1.9639823E+3 3.2084145E-1 -1.0162344E+5 -7.1364456E+2 6.6692789E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel; 2.500S2O3-2 + 3.000H+ = S5O6-2 + 1.500H2O -llnl_gamma 4.7 log_k 0.873 delta_h 26.266 #kJ/mol #97asho/sas -analytic 2.0689312E+3 3.3258469E-1 -1.1610663E+5 -7.5037952E+2 7.01997E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 4.000HS- + 2.000Sb(OH)3 + 2.000H+ = Sb2S4-2 + 6.000H2O -llnl_gamma 4.7 log_k 43.527 delta_h -258.255 #kJ/mol #Internal calculation -analytic 1.0090656E+3 1.8217565E-1 -3.7210477E+4 -3.7419458E+2 2.744198E+6 #References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app; 1.000CN- + 0.500HS- + 0.250S2O3-2 + 1.000H+ = SCN- + 0.750H2O -llnl_gamma 3.5 log_k 23.307 delta_h -117.402 #kJ/mol #97asho/sas -analytic 7.0313314E+2 1.1369087E-1 -3.2819997E+4 -2.5482736E+2 2.3920376E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Sc+3 + 1.000H2O = ScO+ + 2.000H+ -llnl_gamma 4.1 log_k -9.734 delta_h 106.303 #kJ/mol #97asho/sas -analytic 2.0996003E+2 3.4063531E-2 -1.2170602E+4 -7.6231148E+1 -3.5591983E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Sc+3 + 2.000H2O = ScO2- + 4.000H+ -llnl_gamma 3.6 log_k -25.991 delta_h 206.682 #kJ/mol #97asho/sas -analytic -1.8859669E+2 -3.3898954E-2 4.6758138E+3 6.9861707E+1 -1.4079381E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Sc+3 + 1.000H2O = ScOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -4.310 delta_h 60.247 #kJ/mol #97asho/sas -analytic 1.6067565E+2 2.4732952E-2 -9.8054372E+3 -5.7333991E+1 2.1312403E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000CN- + 0.750HSe- + 0.250SeO4-2 + 1.250H+ = SeCN- + 1.000H2O -llnl_gamma 3.6 log_k 43.892 delta_h -221.410 #kJ/mol #97asho/sas -analytic 9.242059E+2 1.4808733E-1 -3.9746951E+4 -3.3409613E+2 3.1596671E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 6.000F- + 1.000SO4-2 + 8.000H+ = SF6 + 4.000H2O -llnl_gamma 3.4 log_k -70.059 delta_h 548.922 #kJ/mol #01sch/sho -analytic 5.9960136E+3 9.5151254E-1 -3.6609435E+5 -2.1658085E+3 2.1091951E+7 #References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho; 2.000H4SiO4 = Si2O2(OH)5- + 1.000H2O + 1.000H+ -llnl_gamma 3.6 log_k -8.499 delta_h 16.986 #kJ/mol #Internal calculation -analytic 7.8101365E+2 8.5739544E-2 -5.0901363E+4 -2.7533082E+2 3.2833934E+6 #References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 2.000H4SiO4 = Si2O3(OH)4-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -19.399 delta_h 52.399 #kJ/mol #Internal calculation -analytic 8.6570631E+2 8.5739544E-2 -5.6730365E+4 -3.0606191E+2 3.2833934E+6 #References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 3.000H4SiO4 = Si3O5(OH)5-3 + 2.000H2O + 3.000H+ -llnl_gamma 4.5 log_k -29.398 delta_h 80.312 #kJ/mol #Internal calculation -analytic 1.2990071E+3 1.2864341E-1 -8.5216622E+4 -4.5924499E+2 4.9273308E+6 #References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 3.000H4SiO4 = Si3O6(OH)3-3 + 3.000H2O + 3.000H+ -llnl_gamma 4.5 log_k -29.397 delta_h 80.312 #kJ/mol #Internal calculation -analytic 1.2999024E+3 1.2871161E-1 -8.527988E+4 -4.5954923E+2 4.9318122E+6 #References = LogK/DGf: 07las; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 4.000H4SiO4 = Si4O12H4-4 + 4.000H2O + 4.000H+ -llnl_gamma 9.6 log_k -39.196 delta_h 107.083 #kJ/mol #Internal calculation -analytic 1.7332032E+3 1.7161548E-1 -1.1370651E+5 -6.1273231E+2 6.5757496E+6 #References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 4.000H4SiO4 = Si4O6(OH)6-2 + 4.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -15.196 delta_h 23.697 #kJ/mol #Internal calculation -analytic 1.5638178E+3 1.7161548E-1 -1.0139257E+5 -5.5127012E+2 6.5757496E+6 #References = LogK/DGf: 07las; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 4.000H4SiO4 = Si4O7(OH)6-4 + 3.000H2O + 4.000H+ -llnl_gamma 9.6 log_k -39.097 delta_h 106.512 #kJ/mol #Internal calculation -analytic 1.7323079E+3 1.7154728E-1 -1.1361343E+5 -6.1242807E+2 6.5712682E+6 #References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 4.000H4SiO4 = Si4O8(OH)4-4 + 4.000H2O + 4.000H+ -llnl_gamma 9.6 log_k -39.096 delta_h 106.512 #kJ/mol #Internal calculation -analytic 1.7332032E+3 1.7161548E-1 -1.1367669E+5 -6.1273231E+2 6.5757496E+6 #References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 6.000H4SiO4 = Si6O15-6 + 9.000H2O + 6.000H+ -llnl_gamma 4.5 log_k -61.491 delta_h 176.036 #kJ/mol #Internal calculation -analytic 2.6024906E+3 2.5762779E-1 -1.7155454E+5 -9.200112E+2 9.8770686E+6 #References = LogK/DGf: 07las; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value; 6.000F- + 1.000H4SiO4 + 4.000H+ = SiF6-2 + 4.000H2O -llnl_gamma 4.7 log_k 26.230 delta_h -61.424 #kJ/mol #88sho/hel -analytic 3.1934139E+3 4.9694767E-1 -1.7458722E+5 -1.1524674E+3 1.0838297E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 88sho/hel; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel; 1.000Cl- + 1.000Sm+3 = SmCl+2 -llnl_gamma 5.7 log_k 0.321 delta_h 14.474 #kJ/mol #95haa/sho -analytic 8.1417211E+2 1.3280197E-1 -4.5594837E+4 -2.9554583E+2 2.7369219E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Sm+3 = SmCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 19.990 #kJ/mol #95haa/sho -analytic 1.5580684E+3 2.5323028E-1 -8.5086085E+4 -5.6725841E+2 4.9280355E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Sm+3 = SmCl3 -llnl_gamma 3.4 log_k -0.356 delta_h 13.779 #kJ/mol #95haa/sho -analytic 2.2472115E+3 3.6383277E-1 -1.1911301E+5 -8.2077449E+2 6.61506E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Sm+3 = SmCl4- -llnl_gamma 3.6 log_k -0.768 delta_h -5.236 #kJ/mol #95haa/sho -analytic 1.6568796E+3 2.8048496E-1 -8.0746573E+4 -6.1229376E+2 3.9675027E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Sm+3 = SmCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.462 delta_h -5.178 #kJ/mol #95haa/sho -analytic 7.1835641E+2 1.1692165E-1 -3.5990078E+4 -2.6496479E+2 1.8374614E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Sm+3 = SmF+2 -llnl_gamma 5.7 log_k 4.408 delta_h 22.985 #kJ/mol #95haa/sho -analytic 9.0554589E+2 1.4583337E-1 -5.0713701E+4 -3.2667564E+2 3.0058895E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Sm+3 = SmF2+ -llnl_gamma 4.1 log_k 7.717 delta_h 13.451 #kJ/mol #95haa/sho -analytic 1.7179479E+3 2.7518152E-1 -9.3475138E+4 -6.22421E+2 5.4564174E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Sm+3 = SmF3 -llnl_gamma 3.4 log_k 10.147 delta_h -8.776 #kJ/mol #95haa/sho -analytic 2.4953922E+3 3.9902376E-1 -1.3169031E+5 -9.0782875E+2 7.4528467E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Sm+3 = SmF4- -llnl_gamma 3.6 log_k 12.136 delta_h -50.074 #kJ/mol #95haa/sho -analytic 2.0120082E+3 3.2837569E-1 -9.9124291E+4 -7.3741155E+2 5.2770984E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000H2PO4- + 1.000Sm+3 = SmH2PO4+2 -llnl_gamma 5.7 log_k 1.037 delta_h -5.553 #kJ/mol #95haa/sho -analytic 8.4697763E+2 1.3486774E-1 -4.8140877E+4 -3.0688355E+2 3.0825285E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Sm+3 = SmHCO3+2 -llnl_gamma 5.7 log_k 1.789 delta_h 8.851 #kJ/mol #95haa/sho -analytic 8.6053586E+2 1.3744737E-1 -4.9163259E+4 -3.1096402E+2 3.0781802E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000NO3- + 1.000Sm+3 = SmNO3+2 -llnl_gamma 5.7 log_k 0.801 delta_h -29.298 #kJ/mol #95haa/sho -analytic 7.7580751E+2 1.2290978E-1 -4.3203029E+4 -2.8239195E+2 2.8456795E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Sm+3 + 1.000H2O = SmO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.477 delta_h 150.160 #kJ/mol #95haa/sho -analytic 2.3947792E+2 3.8444535E-2 -1.6711908E+4 -8.6175799E+1 1.6631257E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Sm+3 + 2.000H2O = SmO2- + 4.000H+ -llnl_gamma 3.6 log_k -35.007 delta_h 266.129 #kJ/mol #95haa/sho -analytic -1.534254E+2 -2.8782339E-2 3.2144694E+1 5.7423699E+1 -1.3511117E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Sm+3 + 2.000H2O = SmO2H + 3.000H+ -llnl_gamma 3.4 log_k -25.918 delta_h 226.722 #kJ/mol #95haa/sho -analytic 3.6714266E+2 5.5496773E-2 -2.3719045E+4 -1.3307918E+2 -6.7297773E+4 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Sm+3 + 1.000H2O = SmOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.975 delta_h 81.791 #kJ/mol #95haa/sho -analytic 1.8272046E+2 2.7909271E-2 -1.3103937E+4 -6.4659494E+1 4.3827895E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000SO4-2 + 1.000Sm+3 = SmSO4+ -llnl_gamma 4.1 log_k 3.723 delta_h 19.890 #kJ/mol #95haa/sho -analytic 1.6441652E+3 2.60395E-1 -8.9216456E+4 -5.9647633E+2 5.0754538E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Sn+2 + 1.000H2O = SnO + 2.000H+ -llnl_gamma 3.4 log_k -7.073 delta_h 42.963 #kJ/mol #97asho/sas -analytic 2.1228185E+2 3.2818669E-2 -1.1494323E+4 -7.8384229E+1 2.9949478E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Sn+2 + 1.000H2O = SnOH+ + 1.000H+ -llnl_gamma 4.1 log_k -3.408 delta_h 27.532 #kJ/mol #97asho/sas -analytic 1.7410041E+2 2.5991343E-2 -9.8497669E+3 -6.3233284E+1 3.7737577E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000HCO3- + 1.000Sr+2 = Sr(CO3) + 1.000H+ -llnl_gamma 3.4 log_k -7.522 delta_h 36.523 #kJ/mol #Internal calculation -analytic 7.1800436E+2 1.171315E-1 -3.8145554E+4 -2.6404948E+2 1.8547807E+6 #References = LogK/DGf: 84bus/plu; DHf/DHr: Internal calculation; S°: 84bus/plu; Cp: 97sve/sho; V°: 97sve/sho; 1.000HCO3- + 1.000Sr+2 = Sr(HCO3)+ -llnl_gamma 4.1 log_k 1.180 delta_h 25.315 #kJ/mol #Internal calculation -analytic 9.6005853E+2 1.5199472E-1 -5.512222E+4 -3.463306E+2 3.3475113E+6 #References = LogK/DGf: 84bus/plu; DHf/DHr: Internal calculation; S°: 84bus/plu; Cp: 95sho/kor; V°: 95sho/kor; 1.000H2AsO4- + 1.000Sr+2 = SrAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -13.586 delta_h 106.774 #kJ/mol #Internal calculation -analytic 3.0904721E+2 4.4557781E-2 -1.832413E+4 -1.1237028E+2 3.1953307E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Cl- + 1.000Sr+2 = SrCl+ -llnl_gamma 4.1 log_k -0.230 delta_h 7.551 #kJ/mol #Internal calculation -analytic 8.1483026E+2 1.3239194E-1 -4.5357106E+4 -2.9629935E+2 2.7351601E+6 #References = LogK/DGf: 96bou; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000F- + 1.000Sr+2 = SrF+ -llnl_gamma 4.1 log_k 0.174 delta_h 4.780 #kJ/mol #97sve/sho -analytic 8.5496899E+2 1.368167E-1 -4.7790674E+4 -3.1037331E+2 2.9069966E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO3- + 1.000Sr+2 = SrH2AsO3+ -llnl_gamma 4.1 log_k 0.399 delta_h 0.626 #kJ/mol #Internal calculation -analytic 6.6324976E+2 1.0241115E-1 -3.4997772E+4 -2.4144499E+2 1.9057487E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2AsO4- + 1.000Sr+2 = SrH2AsO4+ -llnl_gamma 4.1 log_k 0.820 delta_h 3.838 #kJ/mol #Internal calculation -analytic 8.6396585E+2 1.3631095E-1 -4.8294185E+4 -3.1310918E+2 2.9299955E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2PO4- + 1.000Sr+2 = SrH2PO4+ -llnl_gamma 4.1 log_k 0.830 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000H2AsO4- + 1.000Sr+2 = SrHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -5.151 delta_h 16.090 #kJ/mol #Internal calculation -analytic 8.6809689E+2 1.3702902E-1 -4.693967E+4 -3.1741697E+2 2.5566549E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2PO4- + 1.000Sr+2 = SrHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -4.700 #References = LogK/DGf: 97smi/mar; #References = LogK/DGf: 97smi/mar; V°: Default value; 1.000Sr+2 + 1.000H2O = SrOH+ + 1.000H+ -llnl_gamma 4.1 log_k -13.291 delta_h 82.608 #kJ/mol #Internal calculation -analytic 1.6150632E+2 2.3851214E-2 -1.2107439E+4 -5.8671532E+1 3.4480512E+5 #References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000H2PO4- + 1.000Sr+2 = SrP2O7-2 + 1.000H2O + 2.000H+ -llnl_gamma 4.7 log_k -12.410 #References = LogK/DGf: 76smi/mar; #References = LogK/DGf: 76smi/mar; V°: Default value; 1.000H2PO4- + 1.000Sr+2 = SrPO4- + 2.000H+ -llnl_gamma 3.6 log_k -13.560 #References = LogK/DGf: 96bou; #References = LogK/DGf: 96bou; V°: Default value; 1.000SO4-2 + 1.000Sr+2 = SrSO4 -llnl_gamma 3.4 log_k 2.300 delta_h 7.029 #kJ/mol #06bla/ign -analytic 1.7733453E+3 2.6670271E-1 -9.7497524E+4 -6.413138E+2 5.6300434E+6 #References = LogK/DGf: 06bla/ign; DHf/DHr: 06bla/ign; S°: Internal calculation; V°: Default value; 1.000Cl- + 1.000Tb+3 = TbCl+2 -llnl_gamma 5.7 log_k 0.248 delta_h 14.019 #kJ/mol #95haa/sho -analytic 8.2636104E+2 1.3516797E-1 -4.6635953E+4 -2.9986247E+2 2.8440851E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Tb+3 = TbCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 17.994 #kJ/mol #95haa/sho -analytic 1.5906954E+3 2.5921921E-1 -8.7918237E+4 -5.7867999E+2 5.2256902E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Tb+3 = TbCl3 -llnl_gamma 3.4 log_k -0.429 delta_h 10.206 #kJ/mol #95haa/sho -analytic 2.3151183E+3 3.7630779E-1 -1.247778E+5 -8.4469864E+2 7.1927767E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Tb+3 = TbCl4- -llnl_gamma 3.6 log_k -0.841 delta_h -11.803 #kJ/mol #95haa/sho -analytic 2.1704268E+3 3.5191218E-1 -1.1409841E+5 -7.9440436E+2 6.4180145E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Tb+3 = TbCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.389 delta_h -6.595 #kJ/mol #95haa/sho -analytic 7.1212505E+2 1.1821654E-1 -3.5408636E+4 -2.6324747E+2 1.8124839E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Tb+3 = TbF+2 -llnl_gamma 5.7 log_k 4.702 delta_h 22.684 #kJ/mol #95haa/sho -analytic 9.1896466E+2 1.4848782E-1 -5.177363E+4 -3.313443E+2 3.1117015E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Tb+3 = TbF2+ -llnl_gamma 4.1 log_k 8.231 delta_h 12.020 #kJ/mol #95haa/sho -analytic 1.7544687E+3 2.8187539E-1 -9.6470192E+4 -6.350959E+2 5.7591124E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Tb+3 = TbF3 -llnl_gamma 3.4 log_k 10.807 delta_h -11.918 #kJ/mol #95haa/sho -analytic 2.5641075E+3 4.1149879E-1 -1.3737764E+5 -9.3175286E+2 8.0305635E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Tb+3 = TbF4- -llnl_gamma 3.6 log_k 12.943 delta_h -56.422 #kJ/mol #95haa/sho -analytic 2.5515098E+3 4.0376057E-1 -1.3381086E+5 -9.2865621E+2 7.8008251E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000H2PO4- + 1.000Tb+3 = TbH2PO4+2 -llnl_gamma 5.7 log_k 0.963 delta_h -7.005 #kJ/mol #95haa/sho -analytic 8.5978383E+2 1.3733122E-1 -4.9177603E+4 -3.114809E+2 3.1926732E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Tb+3 = TbHCO3+2 -llnl_gamma 5.7 log_k 1.716 delta_h -14.557 #kJ/mol #95haa/sho -analytic 8.5057733E+2 1.3578269E-1 -4.829781E+4 -3.0831738E+2 3.1608408E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000NO3- + 1.000Tb+3 = TbNO3+2 -llnl_gamma 5.7 log_k 0.508 delta_h -31.242 #kJ/mol #95haa/sho -analytic 7.8947618E+2 1.2539959E-1 -4.4309528E+4 -2.8736823E+2 2.9630605E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tb+3 + 1.000H2O = TbO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.184 delta_h 146.740 #kJ/mol #95haa/sho -analytic 2.3041021E+2 3.7258499E-2 -1.5919285E+4 -8.3105957E+1 1.1830429E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tb+3 + 2.000H2O = TbO2- + 4.000H+ -llnl_gamma 3.6 log_k -34.201 delta_h 258.906 #kJ/mol #95haa/sho -analytic -1.495695E+2 -2.8083973E-2 -2.3142501E+1 5.597371E+1 -1.3052849E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tb+3 + 2.000H2O = TbO2H + 3.000H+ -llnl_gamma 3.4 log_k -25.038 delta_h 219.580 #kJ/mol #95haa/sho -analytic 2.6483149E+2 3.8897158E-2 -1.8164965E+4 -9.5678399E+1 -3.370285E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tb+3 + 1.000H2O = TbOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.828 delta_h 79.582 #kJ/mol #95haa/sho -analytic 1.7703049E+2 2.7233874E-2 -1.2534766E+4 -6.2805138E+1 3.9742806E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000SO4-2 + 1.000Tb+3 = TbSO4+ -llnl_gamma 4.1 log_k 3.723 delta_h 19.266 #kJ/mol #95haa/sho -analytic 1.6378251E+3 2.5957544E-1 -8.8820202E+4 -5.94252E+2 5.0533547E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tl+3 + 2.000H2O = Tl(OH)2+ + 2.000H+ -llnl_gamma 4.1 log_k -1.572 delta_h 59.815 #kJ/mol #Internal calculation -analytic 4.7218515E+2 6.9545809E-2 -2.6023983E+4 -1.6940589E+2 1.0646261E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 17abla; V°: Default value; 1.000Tl+3 + 1.000SO4-2 = Tl(SO4)+ -llnl_gamma 4.1 log_k 4.380 delta_h 11.958 #kJ/mol #Internal calculation -analytic 1.8636003E+3 2.9458614E-1 -1.0166412E+5 -6.7594522E+2 5.9126895E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 17abla; V°: Default value; 1.000Tl+3 + 1.000Cl- = TlCl+2 -llnl_gamma 5.7 log_k 7.743 delta_h -27.242 #kJ/mol #Internal calculation -analytic 7.8251409E+2 1.2726044E-1 -4.001214E+4 -2.8493608E+2 2.3595039E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 97sve/sho; V°: 97sve/sho; 1.000Cl- + 1.000Tl+ = TlCl -llnl_gamma 3.4 log_k 0.523 delta_h -11.690 #kJ/mol #09xio -analytic 6.4703392E+2 1.0349928E-1 -3.4122023E+4 -2.3649987E+2 1.9805263E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: 09xio; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho; 1.000Tl+3 + 2.000Cl- = TlCl2+ -llnl_gamma 4.1 log_k 13.500 delta_h -44.780 #kJ/mol #Internal calculation -analytic 1.750445E+3 2.8169841E-1 -9.1628977E+4 -6.3646924E+2 5.4485764E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; 1.000Tl+ + 2.000Cl- = TlCl2- -llnl_gamma 3.6 log_k 0.003 delta_h -17.850 #kJ/mol #82wag/eva -analytic 1.3893248E+3 2.1764815E-1 -7.5784216E+4 -5.0567911E+2 4.5547087E+6 #References = LogK/DGf: 09xio; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value; 1.000Tl+3 + 3.000Cl- = TlCl3 -llnl_gamma 3.4 log_k 16.500 delta_h -47.474 #kJ/mol #Internal calculation -analytic 2.3934452E+3 3.843613E-1 -1.2660332E+5 -8.6959112E+2 7.5411512E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; 1.000Tl+3 + 4.000Cl- = TlCl4- -llnl_gamma 3.6 log_k 18.340 delta_h -42.354 #kJ/mol #Internal calculation -analytic 3.0366544E+3 4.8702419E-1 -1.6198581E+5 -1.102713E+3 9.6337261E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; 1.000Tl+ + 1.000HCO3- = TlCO3- + 1.000H+ -llnl_gamma 3.6 log_k -8.170 delta_h 11.100 #kJ/mol #17abla -analytic 7.4258904E+2 1.0785078E-1 -4.1546418E+4 -2.7059248E+2 2.3108796E+6 #References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value; 1.000F- + 1.000Tl+ = TlF -llnl_gamma 3.4 log_k 0.100 delta_h 7.510 #kJ/mol #Internal calculation -analytic 7.2684871E+2 1.1460751E-1 -3.9447134E+4 -2.6421494E+2 2.2374501E+6 #References = LogK/DGf: 09xio; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000Tl+ + 1.000HCO3- = TlHCO3 -llnl_gamma 3.4 log_k 0.900 delta_h 8.480 #kJ/mol #17abla -analytic 6.9710113E+2 1.0785078E-1 -3.9001301E+4 -2.5199367E+2 2.3108796E+6 #References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value; 1.000HS- + 1.000Tl+ = TlHS -llnl_gamma 3.4 log_k 2.710 delta_h 8.473 #kJ/mol #17abla -analytic 7.5537043E+2 1.1564646E-1 -4.2183394E+4 -2.7228323E+2 2.4970595E+6 #References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value; 1.000Tl+3 + 2.000H2O = TlO2- + 4.000H+ -llnl_gamma 3.6 log_k -15.002 delta_h 155.557 #kJ/mol #Internal calculation -analytic -2.0948209E+2 -3.8490419E-2 1.1887029E+4 7.6320668E+1 -2.0235551E+6 #References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Tl+3 + 1.000H2O = TlOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -0.645 delta_h 10.635 #kJ/mol #Internal calculation -analytic 1.2102576E+2 1.7623845E-2 -5.4871523E+3 -4.4364466E+1 1.1166343E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Tl+ + 1.000H2O = TlOH + 1.000H+ -llnl_gamma 3.4 log_k -13.311 delta_h 58.237 #kJ/mol #Internal calculation -analytic 1.1431624E+1 -1.7536167E-3 -2.2386304E+3 -5.6072879E+0 -2.5214866E+5 #References = LogK/DGf: 09xio; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Tl+ + 1.000H2PO4- = TlPO4-2 + 2.000H+ -llnl_gamma 4.7 log_k -16.020 delta_h 3.600 #kJ/mol #17abla -analytic 7.9859329E+2 1.093651E-1 -4.4043004E+4 -2.9325589E+2 2.323945E+6 #References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value; 1.000Tl+ + 1.000SO4-2 = TlSO4- -llnl_gamma 3.6 log_k 1.380 delta_h -0.840 #kJ/mol #82wag/eva -analytic 1.5130908E+3 2.3053588E-1 -8.4059115E+4 -5.4758698E+2 5.0188218E+6 #References = LogK/DGf: 09xio; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value; 1.000Cl- + 1.000Tm+3 = TmCl+2 -llnl_gamma 5.7 log_k 0.248 delta_h 13.021 #kJ/mol #95haa/sho -analytic 8.2725254E+2 1.3522114E-1 -4.6781641E+4 -3.0014456E+2 2.8689133E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Tm+3 = TmCl2+ -llnl_gamma 4.1 log_k -0.018 delta_h 15.499 #kJ/mol #95haa/sho -analytic 1.596674E+3 2.6008877E-1 -8.8474395E+4 -5.8078125E+2 5.2992002E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Tm+3 = TmCl3 -llnl_gamma 3.4 log_k -0.429 delta_h 5.216 #kJ/mol #95haa/sho -analytic 2.3311248E+3 3.7940083E-1 -1.2591784E+5 -8.5061337E+2 7.3288424E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Tm+3 = TmCl4- -llnl_gamma 3.6 log_k -0.841 delta_h -20.411 #kJ/mol #95haa/sho -analytic 2.1934565E+3 3.5555354E-1 -1.1596144E+5 -8.0268756E+2 6.6517664E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Tm+3 = TmCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -2.096 delta_h -9.266 #kJ/mol #95haa/sho -analytic 7.3741081E+2 1.1985828E-1 -3.6824427E+4 -2.720086E+2 1.8965221E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Tm+3 = TmF+2 -llnl_gamma 5.7 log_k 4.848 delta_h 23.594 #kJ/mol #95haa/sho -analytic 9.2055338E+2 1.4875225E-1 -5.1992581E+4 -3.3175841E+2 3.1328666E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Tm+3 = TmF2+ -llnl_gamma 4.1 log_k 8.450 delta_h 12.511 #kJ/mol #95haa/sho -analytic 1.7625729E+3 2.8321721E-1 -9.7201143E+4 -6.3777764E+2 5.8304994E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Tm+3 = TmF3 -llnl_gamma 3.4 log_k 11.100 delta_h -12.843 #kJ/mol #95haa/sho -analytic 2.581118E+3 4.145917E-1 -1.387299E+5 -9.3766715E+2 8.166623E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Tm+3 = TmF4- -llnl_gamma 3.6 log_k 13.309 delta_h -60.635 #kJ/mol #95haa/sho -analytic 2.5968229E+3 4.1089444E-1 -1.3698725E+5 -9.4470067E+2 8.0924911E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000H2PO4- + 1.000Tm+3 = TmH2PO4+2 -llnl_gamma 5.7 log_k 1.037 delta_h -9.794 #kJ/mol #95haa/sho -analytic 8.6116717E+2 1.3741429E-1 -4.9286637E+4 -3.1200451E+2 3.2217001E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Tm+3 = TmHCO3+2 -llnl_gamma 5.7 log_k 1.789 delta_h 4.984 #kJ/mol #95haa/sho -analytic 8.6648429E+2 1.3874757E-1 -4.9876153E+4 -3.1307386E+2 3.1915767E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000NO3- + 1.000Tm+3 = TmNO3+2 -llnl_gamma 5.7 log_k 0.215 delta_h -34.060 #kJ/mol #95haa/sho -analytic 7.932343E+2 1.2571503E-1 -4.4605059E+4 -2.8883348E+2 3.0049758E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tm+3 + 1.000H2O = TmO+ + 2.000H+ -llnl_gamma 4.1 log_k -15.891 delta_h 142.945 #kJ/mol #95haa/sho -analytic 2.2770462E+2 3.6724939E-2 -1.5905776E+4 -8.2035852E+1 1.596092E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tm+3 + 2.000H2O = TmO2- + 4.000H+ -llnl_gamma 3.6 log_k -32.661 delta_h 247.001 #kJ/mol #95haa/sho -analytic -1.5124606E+2 -2.8469133E-2 -6.8329283E+1 5.6871852E+1 -1.1932921E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tm+3 + 2.000H2O = TmO2H + 3.000H+ -llnl_gamma 3.4 log_k -24.159 delta_h 211.940 #kJ/mol #95haa/sho -analytic 2.9020407E+2 4.300493E-2 -1.9754531E+4 -1.0472071E+2 -1.6028079E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Tm+3 + 1.000H2O = TmOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.681 delta_h 77.123 #kJ/mol #95haa/sho -analytic 1.7767273E+2 2.7229271E-2 -1.2731747E+4 -6.2946444E+1 4.4330242E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000SO4-2 + 1.000Tm+3 = TmSO4+ -llnl_gamma 4.1 log_k 3.649 delta_h 19.684 #kJ/mol #95haa/sho -analytic 1.645014E+3 2.6061557E-1 -8.924154E+4 -5.9684661E+2 5.0765674E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000U+4 + 1.000H2O = U(OH)+3 + 1.000H+ -llnl_gamma 8.2 log_k -0.535 delta_h 46.808 #kJ/mol #97bsho/sas -analytic 1.7101348E+2 2.7066935E-2 -1.0634169E+4 -6.0084821E+1 4.2003067E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000U+3 + 1.000H2O = UO+ + 2.000H+ -llnl_gamma 4.1 log_k -12.702 delta_h 130.982 #kJ/mol #97bsho/sas -analytic 2.3111318E+2 3.7178722E-2 -1.4465797E+4 -8.3476779E+1 1.564297E+4 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000U+4 + 1.000H2O = UO+2 + 2.000H+ -llnl_gamma 5.7 log_k -2.001 delta_h 73.139 #kJ/mol #97bsho/sas -analytic 2.308384E+2 3.8167946E-2 -1.2316234E+4 -8.2788607E+1 1.7290833E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000U+4 + 2.000H2O = UO2 + 4.000H+ -llnl_gamma 3.4 log_k -4.551 delta_h 76.066 #kJ/mol #97bsho/sas -analytic 5.9175465E+2 9.7336954E-2 -3.241666E+4 -2.1504124E+2 1.3782915E+6 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000UO2+2 + 1.000H2O = UO2OH+ + 1.000H+ -llnl_gamma 4.1 log_k -5.211 delta_h 43.313 #kJ/mol #97bsho/sas -analytic 1.2256731E+2 1.9794452E-2 -7.1064014E+3 -4.4921584E+1 1.1648421E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000UO2+ + 1.000H2O = UO2OH + 1.000H+ -llnl_gamma 3.4 log_k -18.156 delta_h 72.918 #kJ/mol #97bsho/sas -analytic 2.6086013E+2 4.0103499E-2 -1.9758974E+4 -9.5644948E+1 1.0637182E+6 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000UO2+2 + 1.000H2O = UO3 + 2.000H+ -llnl_gamma 3.4 log_k -10.305 delta_h 51.185 #kJ/mol #97bsho/sas -analytic 2.2788881E+2 3.8664183E-2 -1.262414E+4 -8.5383135E+1 3.4620169E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000UO2+ + 1.000H2O = UO3- + 2.000H+ -llnl_gamma 3.6 log_k -36.481 delta_h 170.532 #kJ/mol #97bsho/sas -analytic -3.3047935E+2 -5.8240061E-2 6.1303609E+3 1.2062567E+2 -6.8261122E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000UO2+2 + 2.000H2O = UO4-2 + 4.000H+ -llnl_gamma 4.7 log_k -33.013 delta_h 142.227 #kJ/mol #97bsho/sas -analytic -1.0408635E+3 -1.7075415E-1 5.0554951E+4 3.7593102E+2 -3.6462617E+6 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000U+3 + 1.000H2O = UOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -6.179 delta_h 73.411 #kJ/mol #97bsho/sas -analytic 1.6701811E+2 2.5515959E-2 -1.1019904E+4 -5.9329998E+1 2.6354985E+5 #References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas; 1.000V+3 + 1.000H2O = VO+ + 2.000H+ -llnl_gamma 4.1 log_k -6.215 delta_h 89.338 #kJ/mol #97asho/sas -analytic 2.0995699E+2 3.4110521E-2 -1.0386006E+4 -7.6592412E+1 -1.7641742E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000VO2+ + 2.000H2O = VO4-3 + 4.000H+ -llnl_gamma 6.7 log_k -28.410 delta_h 89.131 #kJ/mol #97asho/sas -analytic -1.266962E+3 -2.1762336E-1 5.6529425E+4 4.6396661E+2 -3.0418819E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000V+2 + 1.000H2O = VOH+ + 1.000H+ -llnl_gamma 4.1 log_k -6.509 delta_h 34.502 #kJ/mol #97asho/sas -analytic 2.4010799E+2 3.6386614E-2 -1.5867164E+4 -8.6664385E+1 9.0661687E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000V+3 + 1.000H2O = VOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -2.257 delta_h 47.409 #kJ/mol #97asho/sas -analytic 1.4320961E+2 2.1803112E-2 -7.6452307E+3 -5.1357679E+1 6.7215145E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000VO+2 + 1.000H2O = VOOH+ + 1.000H+ -llnl_gamma 4.1 log_k -5.629 delta_h 29.107 #kJ/mol #97asho/sas -analytic 1.4555154E+2 2.1494564E-2 -8.3262407E+3 -5.3602352E+1 2.6426314E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Cl- + 1.000Yb+3 = YbCl+2 -llnl_gamma 5.7 log_k 0.333 delta_h 13.785 #kJ/mol #95haa/sho -analytic 8.2488046E+2 1.3489572E-1 -4.6522415E+4 -2.9931396E+2 2.8359431E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000Cl- + 1.000Yb+3 = YbCl2+ -llnl_gamma 4.1 log_k -0.079 delta_h 17.474 #kJ/mol #95haa/sho -analytic 1.5878363E+3 2.5863439E-1 -8.77071E+4 -5.7769176E+2 5.209526E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000Cl- + 1.000Yb+3 = YbCl3 -llnl_gamma 3.4 log_k -0.565 delta_h 8.358 #kJ/mol #95haa/sho -analytic 2.3001138E+3 3.7624092E-1 -1.2384903E+5 -8.3980157E+2 7.1622577E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000Cl- + 1.000Yb+3 = YbCl4- -llnl_gamma 3.6 log_k -0.976 delta_h -16.270 #kJ/mol #95haa/sho -analytic 2.1638343E+3 3.5055793E-1 -1.1343544E+5 -7.9233787E+2 6.3757106E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Yb+3 = YbCO3+ + 1.000H+ -llnl_gamma 4.1 log_k -1.865 delta_h -9.464 #kJ/mol #95haa/sho -analytic 7.4105886E+2 1.2046211E-1 -3.7100317E+4 -2.7321315E+2 1.9240048E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000F- + 1.000Yb+3 = YbF+2 -llnl_gamma 5.7 log_k 5.006 delta_h 23.066 #kJ/mol #95haa/sho -analytic 9.179499E+2 1.4835679E-1 -5.1674109E+4 -3.3088189E+2 3.1010742E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 2.000F- + 1.000Yb+3 = YbF2+ -llnl_gamma 4.1 log_k 8.609 delta_h 11.983 #kJ/mol #95haa/sho -analytic 1.7534795E+3 2.8169805E-1 -9.6313719E+4 -6.3465697E+2 5.7421414E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 3.000F- + 1.000Yb+3 = YbF3 -llnl_gamma 3.4 log_k 11.331 delta_h -13.539 #kJ/mol #95haa/sho -analytic 2.562976E+3 4.1143192E-1 -1.3704712E+5 -9.3138478E+2 8.0000444E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 4.000F- + 1.000Yb+3 = YbF4- -llnl_gamma 3.6 log_k 13.541 delta_h -60.458 #kJ/mol #95haa/sho -analytic 2.5622195E+3 4.0508659E-1 -1.3402503E+5 -9.3263002E+2 7.804744E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000H2PO4- + 1.000Yb+3 = YbH2PO4+2 -llnl_gamma 5.7 log_k 1.268 delta_h -9.505 #kJ/mol #95haa/sho -analytic 8.5853416E+2 1.3704918E-1 -4.8983087E+4 -3.1105899E+2 3.1875167E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000HCO3- + 1.000Yb+3 = YbHCO3+2 -llnl_gamma 5.7 log_k 2.014 delta_h 5.195 #kJ/mol #95haa/sho -analytic 8.6527744E+2 1.3861987E-1 -4.9642822E+4 -3.1265861E+2 3.1613768E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000NO3- + 1.000Yb+3 = YbNO3+2 -llnl_gamma 5.7 log_k 0.373 delta_h -32.716 #kJ/mol #95haa/sho -analytic 7.8981106E+2 1.2529328E-1 -4.4290668E+4 -2.8758469E+2 2.9660832E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Yb+3 + 1.000H2O = YbO+ + 2.000H+ -llnl_gamma 4.1 log_k -15.586 delta_h 142.704 #kJ/mol #95haa/sho -analytic 2.3085797E+2 3.7325098E-2 -1.6026277E+4 -8.3126742E+1 1.6635003E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Yb+3 + 2.000H2O = YbO2- + 4.000H+ -llnl_gamma 3.6 log_k -32.503 delta_h 247.846 #kJ/mol #95haa/sho -analytic -1.5571639E+2 -2.9002889E-2 2.9112414E+2 5.8483761E+1 -1.2294431E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Yb+3 + 2.000H2O = YbO2H + 3.000H+ -llnl_gamma 3.4 log_k -23.707 delta_h 210.986 #kJ/mol #95haa/sho -analytic 2.8726132E+2 4.2278767E-2 -1.9408728E+4 -1.0358532E+2 -1.9217377E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Yb+3 + 1.000H2O = YbOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.450 delta_h 77.175 #kJ/mol #95haa/sho -analytic 1.7990797E+2 2.7683251E-2 -1.2826988E+4 -6.3705386E+1 4.4846911E+5 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000SO4-2 + 1.000Yb+3 = YbSO4+ -llnl_gamma 4.1 log_k 3.807 delta_h 19.531 #kJ/mol #95haa/sho -analytic 1.6441577E+3 2.6056591E-1 -8.9158771E+4 -5.9651812E+2 5.0711182E+6 #References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho; 1.000Y+3 + 1.000H2O = YO+ + 2.000H+ -llnl_gamma 4.1 log_k -16.404 delta_h 144.876 #kJ/mol #97asho/sas -analytic 1.9607957E+2 3.1746857E-2 -1.3335148E+4 -7.11862E+1 -9.57392E+4 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Y+3 + 2.000H2O = YO2- + 4.000H+ -llnl_gamma 3.6 log_k -36.473 delta_h 267.261 #kJ/mol #97asho/sas -analytic -1.771422E+2 -3.2428094E-2 1.0912832E+3 6.5672868E+1 -1.4068141E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000Y+3 + 1.000H2O = YOH+2 + 1.000H+ -llnl_gamma 5.7 log_k -7.681 delta_h 76.375 #kJ/mol #97asho/sas -analytic 1.461105E+2 2.2221495E-2 -1.0017949E+4 -5.2100917E+1 1.8699011E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 2.000HS- + 1.000Zn+2 = Zn(HS)2 -llnl_gamma 3.4 log_k 9.688 delta_h -25.428 #kJ/mol #14aki/tag -analytic 1.3697011E+3 2.3985132E-1 -7.1784109E+4 -5.0120469E+2 4.3948013E+6 #References = LogK/DGf: 14aki/tag; DHf/DHr: 14aki/tag; S°: Internal calculation; Cp: 14aki/tag; V°: 14aki/tag; 2.000HS- + 1.000Zn+2 + 1.000H2O = Zn(HS)2OH- + 1.000H+ -llnl_gamma 3.6 log_k 3.450 delta_h -15.391 #kJ/mol #14aki/tag -analytic 3.0809716E+1 5.4932382E-2 1.1491841E+4 -2.6910778E+1 -1.3950136E+6 #References = LogK/DGf: 14aki/tag; DHf/DHr: 14aki/tag; S°: Internal calculation; Cp: 14aki/tag; V°: 14aki/tag; 3.000HS- + 1.000Zn+2 = Zn(HS)3- -llnl_gamma 3.6 log_k 13.261 delta_h -47.972 #kJ/mol #14aki/tag -analytic 1.8887087E+3 3.001466E-1 -1.0404038E+5 -6.8337985E+2 6.6666278E+6 #References = LogK/DGf: 14aki/tag; DHf/DHr: 14aki/tag; S°: Internal calculation; Cp: 14aki/tag; V°: 14aki/tag; 4.000HS- + 1.000Zn+2 = Zn(HS)4-2 -llnl_gamma 4.7 log_k 14.422 delta_h -55.182 #kJ/mol #14aki/tag -analytic 1.9390201E+3 3.0749579E-1 -1.082167E+5 -7.005019E+2 7.1139995E+6 #References = LogK/DGf: 14aki/tag; DHf/DHr: 14aki/tag; S°: Internal calculation; Cp: 14aki/tag; V°: 14aki/tag; 2.000Zn+2 + 1.000H2O = Zn2OH+3 + 1.000H+ -llnl_gamma 8.2 log_k -7.900 #References = LogK/DGf: 13pow/bro; #References = LogK/DGf: 13pow/bro; V°: Default value; 1.000H2AsO4- + 1.000Zn+2 = ZnAsO4- + 2.000H+ -llnl_gamma 3.6 log_k -11.051 delta_h 84.413 #kJ/mol #Internal calculation -analytic 2.6279953E+2 3.4757121E-2 -1.4936863E+4 -9.5458378E+1 1.8580873E+5 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000Br- + 1.000Zn+2 = ZnBr+ -llnl_gamma 4.1 log_k -0.600 delta_h 12.644 #kJ/mol #18las/bla -analytic 2.1871288E+3 3.7000624E-1 -1.1686597E+5 -8.0098541E+2 6.7479398E+6 #References = LogK/DGf: 12liu/bor; DHf/DHr: 18las/bla; S°: Internal calculation; Cp: 18las/bla; V°: 18las/bla; 2.000Br- + 1.000Zn+2 = ZnBr2 -llnl_gamma 3.4 log_k -1.000 delta_h 44.176 #kJ/mol #18las/bla -analytic 3.4973497E+3 6.0799813E-1 -1.8795473E+5 -1.2821009E+3 1.0956471E+7 #References = LogK/DGf: 12liu/bor; DHf/DHr: 18las/bla; S°: Internal calculation; Cp: 18las/bla; V°: 18las/bla; 3.000Br- + 1.000Zn+2 = ZnBr3- -llnl_gamma 3.6 log_k -1.800 delta_h 45.292 #kJ/mol #18las/bla -analytic 1.1951492E+3 2.4740138E-1 -6.3318177E+4 -4.4485712E+2 3.7715864E+6 #References = LogK/DGf: 12liu/bor; DHf/DHr: 18las/bla; S°: Internal calculation; Cp: 18las/bla; V°: 18las/bla; 4.000Br- + 1.000Zn+2 = ZnBr4-2 -llnl_gamma 4.7 log_k -1.300 delta_h 14.919 #kJ/mol #18las/bla -analytic 1.2534971E+4 1.9885931E+0 -6.8170832E+5 -4.5623671E+3 3.969726E+7 #References = LogK/DGf: 12liu/bor; DHf/DHr: 18las/bla; S°: Internal calculation; Cp: 18las/bla; V°: 18las/bla; 1.000Cl- + 1.000Zn+2 = ZnCl+ -llnl_gamma 4.1 log_k 0.394 delta_h 14.732 #kJ/mol #14aki/tag -analytic 7.5385635E+2 1.2884929E-1 -4.1526201E+4 -2.7497535E+2 2.4720643E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 2.000Cl- + 1.000Zn+2 = ZnCl2 -llnl_gamma 3.4 log_k 0.470 delta_h 27.707 #kJ/mol #14aki/tag -analytic 1.6193931E+3 2.6158376E-1 -9.0926778E+4 -5.8736607E+2 5.4629569E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 3.000Cl- + 1.000Zn+2 = ZnCl3- -llnl_gamma 3.6 log_k 0.537 delta_h 24.494 #kJ/mol #14aki/tag -analytic 1.6459292E+3 2.7794257E-1 -9.198497E+4 -5.9935831E+2 5.6297735E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 4.000Cl- + 1.000Zn+2 = ZnCl4-2 -llnl_gamma 4.7 log_k -0.384 delta_h 28.134 #kJ/mol #14aki/tag -analytic 1.6394766E+3 2.7846195E-1 -9.329168E+4 -5.9646267E+2 5.8604073E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 1.000HCO3- + 1.000Zn+2 = ZnCO3 + 1.000H+ -llnl_gamma 3.4 log_k -5.577 #References = LogK/DGf: 13pow/bro; #References = LogK/DGf: 13pow/bro; V°: Default value; 1.000F- + 1.000Zn+2 = ZnF+ -llnl_gamma 4.1 log_k 1.199 delta_h 2.748 #kJ/mol #97sve/sho -analytic 8.9752406E+2 1.4254963E-1 -5.0259745E+4 -3.2528445E+2 3.0793283E+6 #References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho; 1.000H2AsO4- + 1.000Zn+2 = ZnH2AsO4+ -llnl_gamma 4.1 log_k 0.534 delta_h -5.671 #kJ/mol #Internal calculation -analytic 8.3966786E+2 1.3021327E-1 -4.7009052E+4 -3.0428858E+2 2.9028001E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000H2PO4- + 1.000Zn+2 = ZnH2PO4+ -llnl_gamma 4.1 log_k 1.593 #References = LogK/DGf: 73bnri; #References = LogK/DGf: 73bnri; V°: Default value; 1.000H2AsO4- + 1.000Zn+2 = ZnHAsO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.937 delta_h 7.877 #kJ/mol #Internal calculation -analytic -4.3975167E+2 -5.7657192E-2 -2.1640529E+4 1.8509619E+2 6.0073694E+6 #References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc; 1.000HCO3- + 1.000Zn+2 = ZnHCO3+ -llnl_gamma 4.1 log_k 1.620 delta_h 3.560 #kJ/mol #13pow/bro -analytic 8.3907763E+3 1.2847431E+0 -4.5555549E+5 -3.0460668E+3 2.604861E+7 #References = LogK/DGf: 13pow/bro; DHf/DHr: 13pow/bro; S°: Internal calculation; Cp: 18las/bla; V°: 18las/bla; 1.000H2PO4- + 1.000Zn+2 = ZnHPO4 + 1.000H+ -llnl_gamma 3.4 log_k -3.912 #References = LogK/DGf: 73bnri; #References = LogK/DGf: 73bnri; V°: Default value; 1.000Zn+2 + 1.000H2O = ZnO + 2.000H+ -llnl_gamma 3.4 log_k -19.173 delta_h 137.231 #kJ/mol #14aki/tag -analytic 4.3906948E+2 5.5379885E-2 -3.0039744E+4 -1.5627088E+2 1.1273191E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 1.000Zn+2 + 2.000H2O = ZnO2-2 + 4.000H+ -llnl_gamma 4.7 log_k -40.518 delta_h 172.339 #kJ/mol #14aki/tag -analytic -9.3081286E+2 -1.5548536E-1 4.01997E+4 3.3714158E+2 -2.8812319E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 1.000Zn+2 + 1.000H2O = ZnOH+ + 1.000H+ -llnl_gamma 4.1 log_k -8.674 delta_h 46.781 #kJ/mol #14aki/tag -analytic 4.7637521E+1 1.6290474E-2 -3.8292893E+3 -1.9715903E+1 4.0942952E+4 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 14aki/tag; Cp: 14aki/tag; V°: 14aki/tag; 1.000H2PO4- + 1.000Zn+2 = ZnPO4- + 2.000H+ -llnl_gamma 3.6 log_k -11.514 #References = LogK/DGf: 79mat/spo; #References = LogK/DGf: 79mat/spo; V°: Default value; 1.000SO4-2 + 1.000Zn+2 = ZnSO4 -llnl_gamma 3.4 log_k 2.460 delta_h 14.000 #kJ/mol #18las/bla -analytic 1.740406E+3 2.7195031E-1 -9.6340376E+4 -6.3038264E+2 5.6838383E+6 #References = LogK/DGf: 18las/bla; DHf/DHr: 18las/bla; S°: Internal calculation; V°: Default value; 1.000ZrO+2 + 2.000H+ = Zr+4 + 1.000H2O -llnl_gamma 11.0 log_k 1.722 delta_h -59.949 #kJ/mol #97asho/sas -analytic -2.670101E+2 -4.3822917E-2 1.5170181E+4 9.5718067E+1 -5.272473E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000ZrO+2 + 1.000H2O = ZrO2 + 2.000H+ -llnl_gamma 3.4 log_k -7.975 delta_h 36.757 #kJ/mol #97asho/sas -analytic 4.2075385E+2 6.9561546E-2 -2.5545709E+4 -1.5373316E+2 1.476988E+6 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; 1.000ZrO+2 + 1.000H+ = ZrOH+3 -llnl_gamma 8.2 log_k 2.052 delta_h -34.419 #kJ/mol #97asho/sas -analytic -4.2410379E+1 -8.4292173E-3 8.5853689E+2 1.6257324E+1 3.4390346E+5 #References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas; PHASES 2K2SO4.Fe2(SO4)3:14H2O K4Fe2(SO4)5:14H2O = 2.000Fe+3 + 4.000K+ + 5.000SO4-2 + 14.000H2O log_k -13.032 #References = LogK/DGf: 04chr; #References = LogK/DGf: 04chr; V°: Default value; 2KCl.FeCl3:H2O K2FeCl5:H2O = 5.000Cl- + 1.000Fe+3 + 2.000K+ + 1.000H2O log_k 5.631 #References = LogK/DGf: 04chr; #References = LogK/DGf: 04chr; V°: Default value; Acanthite(alpha) Ag2S + 1.000H+ = 2.000Ag+ + 1.000HS- log_k -36.070 delta_h 226.837 #kJ/mol #78hel/del -analytic -8.8668277E+2 -1.3249371E-1 3.7956106E+4 3.2176875E+2 -2.9677242E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Adamite Zn2AsO4(OH) + 3.000H+ = 1.000H2AsO4- + 2.000Zn+2 + 1.000H2O log_k 5.711 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Aegerine(alpha) NaFe(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Fe+3 + 1.000Na+ + 2.000H4SiO4 log_k 0.921 delta_h -50.902 #kJ/mol #95rob/hem -analytic -1.3269183E+3 -1.7923949E-1 8.042349E+4 4.7137251E+2 -4.875199E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del; Afwillite Ca3Si2O4(OH)6 + 6.000H+ = 3.000Ca+2 + 2.000H4SiO4 + 2.000H2O log_k 49.422 delta_h -264.562 #kJ/mol #10abla/bou -analytic -1.6142822E+3 -2.1834047E-1 1.0738813E+5 5.7888781E+2 -5.671339E+6 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 52meg; Ag(element) Ag + 0.500O2 + 2.000H+ = 1.000Ag+2 + 1.000H2O log_k -4.136 delta_h -10.653 #kJ/mol #Internal calculation -analytic -4.0915782E+2 -6.3075772E-2 2.3013138E+4 1.4627168E+2 -1.3599563E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Ag2O Ag2O + 2.000H+ = 2.000Ag+ + 1.000H2O log_k 12.570 delta_h -43.307 #kJ/mol #Internal calculation -analytic -2.8494996E+2 -3.3482379E-2 1.8828474E+4 1.0296307E+2 -9.2655701E+5 #References = LogK/DGf: 74nau/ryz; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 74nau/ryz; Akermanite Ca2MgSi2O7 + 6.000H+ + 1.000H2O = 2.000Ca+2 + 1.000Mg+2 + 2.000H4SiO4 log_k 46.094 delta_h -308.213 #kJ/mol #Internal calculation -analytic -1.6695244E+3 -2.3351244E-1 1.1207999E+5 5.9635452E+2 -5.8952957E+6 #References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Al(element) Al + 0.750O2 + 3.000H+ = 1.000Al+3 + 1.500H2O log_k 149.924 delta_h -958.045 #kJ/mol #By convention -analytic -6.2729914E+2 -1.0258284E-1 8.3655223E+4 2.2250662E+2 -2.0757715E+6 #References = S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem; Alabandite MnS + 1.000H+ = 1.000Mn+2 + 1.000HS- log_k -0.003 delta_h -24.167 #kJ/mol #Internal calculation -analytic -9.5452833E+2 -1.5284462E-1 5.2895037E+4 3.4627314E+2 -3.0352852E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Alamosite PbSiO3 + 2.000H+ + 1.000H2O = 1.000Pb+2 + 1.000H4SiO4 log_k 6.177 delta_h -27.117 #kJ/mol #98cha -analytic -6.464242E+2 -8.7125282E-2 4.0360344E+4 2.3091989E+2 -2.5057398E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan; Albite(low) NaAlSi3O8 + 4.000H+ + 4.000H2O = 1.000Al+3 + 1.000Na+ + 3.000H4SiO4 log_k 3.007 delta_h -77.003 #kJ/mol #95rob/hem -analytic -1.6580418E+3 -2.197277E-1 1.0357481E+5 5.8663771E+2 -6.4383377E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; AlF3 AlF3 = 1.000Al+3 + 3.000F- log_k -17.324 delta_h -34.050 #kJ/mol #89cox/wag -analytic -2.5363674E+3 -4.1169047E-1 1.384551E+5 9.168972E+2 -8.1243361E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Almandine(alpha) Fe3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Fe+2 + 3.000H4SiO4 log_k 42.180 delta_h -458.683 #kJ/mol #95rob/hem -analytic -3.0848427E+3 -4.4981168E-1 1.9672956E+5 1.0990475E+3 -1.0509115E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Alunite(K) KAl3(OH)6(SO4)2 + 6.000H+ = 3.000Al+3 + 1.000K+ + 2.000SO4-2 + 6.000H2O log_k -0.523 delta_h -230.738 #kJ/mol #Internal calculation -analytic -4.0636275E+3 -6.6562738E-1 2.2900483E+5 1.4699301E+3 -1.2780316E+7 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Alunite(Na) NaAl3(SO4)2(OH)6 + 6.000H+ = 3.000Al+3 + 1.000Na+ + 2.000SO4-2 + 6.000H2O log_k 2.340 delta_h -257.759 #kJ/mol #Internal calculation -analytic -4.3291826E+3 -7.0539753E-1 2.4414706E+5 1.5659468E+3 -1.3500184E+7 #References = LogK/DGf: 90sto/cyg; DHf/DHr: Internal calculation; S°: 90sto/cyg; Cp: 90sto/cyg; V°: Default value; Amesite Mg4Al2(Al2Si2)O10(OH)8 + 20.000H+ = 4.000Al+3 + 4.000Mg+2 + 2.000H4SiO4 + 10.000H2O log_k 69.410 delta_h -761.722 #kJ/mol #05vid/par -analytic -4.0615346E+3 -6.1544793E-1 2.5538153E+5 1.4531422E+3 -1.2251219E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par; Amesite(Fe) Fe4Al2(Al2Si2)O10(OH)8 + 20.000H+ = 4.000Al+3 + 4.000Fe+2 + 2.000H4SiO4 + 10.000H2O log_k 57.042 delta_h -682.162 #kJ/mol #05vid/par -analytic -3.9260763E+3 -6.0068024E-1 2.4387915E+5 1.4055208E+3 -1.1879079E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par; Amorphous_silica SiO2 + 2.000H2O = 1.000H4SiO4 log_k -2.697 delta_h 15.949 #kJ/mol #00gun/arn -analytic -3.5339604E+2 -4.0433695E-2 2.2631079E+4 1.2344453E+2 -1.6539534E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 00gun/arn; S°: 00gun/arn; Cp: 00gun/arn; V°: 78hel/del; Analcime Na0.99Al0.99Si2.01O6:H2O + 3.960H+ + 1.040H2O = 0.990Al+3 + 0.990Na+ + 2.010H4SiO4 log_k 6.654 delta_h -98.000 #kJ/mol #04neu/hov -analytic -1.3403358E+3 -1.8135021E-1 8.3684586E+4 4.7527556E+2 -4.9476886E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04neu/hov; S°: 82joh/flo, 04neu/hov; Cp: 82joh/flo; V°: 97coo/alb; Andalusite Al2SiO5 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 1.000H2O log_k 16.206 delta_h -244.610 #kJ/mol #Internal calculation -analytic -1.339469E+3 -2.048042E-1 8.5279067E+4 4.7661954E+2 -4.3249835E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Andradite Ca3Fe2Si3O12 + 12.000H+ = 3.000Ca+2 + 2.000Fe+3 + 3.000H4SiO4 log_k 33.787 delta_h -327.864 #kJ/mol #Internal calculation -analytic -2.9077837E+3 -4.2372897E-1 1.7981493E+5 1.040602E+3 -9.7870213E+6 #References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Anglesite PbSO4 = 1.000Pb+2 + 1.000SO4-2 log_k -7.848 delta_h 11.550 #kJ/mol #89cox/wag -analytic -1.6531905E+3 -2.6395706E-1 9.1051907E+4 5.9877724E+2 -5.5987833E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 78hel/del; V°: 95rob/hem; Anhydrite CaSO4 = 1.000Ca+2 + 1.000SO4-2 log_k -4.436 delta_h -17.940 #kJ/mol #95rob/hem -analytic -1.6180709E+3 -2.6204311E-1 8.9584938E+4 5.866302E+2 -5.3589079E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Anilite Cu1.75S + 1.000H+ = 1.500Cu+ + 0.250Cu+2 + 1.000HS- log_k -31.220 delta_h 176.426 #kJ/mol #Internal calculation -analytic -8.8799094E+2 -1.3923697E-1 3.8770491E+4 3.2302098E+2 -2.7598554E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 00pui; V°: 95rob/hem; Annite KFe3(AlSi3)O10(OH)2 + 10.000H+ = 1.000Al+3 + 3.000Fe+2 + 1.000K+ + 3.000H4SiO4 log_k 32.771 delta_h -306.153 #kJ/mol #92cir/nav -analytic -2.6382558E+3 -3.7460641E-1 1.6621477E+5 9.4111433E+2 -9.2002058E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 92cir/nav; S°: 95dac/ben; Cp: 95dac/ben; V°: 78hel/del; Anorthite Ca(Al2Si2)O8 + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 2.000H4SiO4 log_k 24.235 delta_h -303.522 #kJ/mol #95rob/hem -analytic -1.9788284E+3 -2.9190197E-1 1.2612201E+5 7.0425974E+2 -6.7173266E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Antarcticite CaCl2:6H2O = 1.000Ca+2 + 2.000Cl- + 6.000H2O log_k 3.947 delta_h 13.990 #kJ/mol #87gar/par -analytic -1.6295682E+3 -2.3838587E-1 8.6900443E+4 5.9279239E+2 -4.7737295E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 63wyc; Anthophyllite Mg7Si8O22(OH)2 + 14.000H+ + 8.000H2O = 7.000Mg+2 + 8.000H4SiO4 log_k 73.783 delta_h -583.247 #kJ/mol #95rob/hem -analytic -5.2321622E+3 -7.0079895E-1 3.3845592E+5 1.8579984E+3 -1.9360477E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Antigorite Mg48Si34O85(OH)62 + 96.000H+ = 48.000Mg+2 + 34.000H4SiO4 + 11.000H2O log_k 500.080 delta_h -3743.421 #kJ/mol #98hol/pow -analytic -2.9383249E+4 -4.0195982E+0 1.8738549E+6 1.0481455E+4 -1.0123582E+8 #References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow; Antlerite Cu3SO4(OH)4 + 4.000H+ = 3.000Cu+2 + 1.000SO4-2 + 4.000H2O log_k 8.912 delta_h -128.158 #kJ/mol #Internal calculation -analytic -2.3201815E+3 -3.6568954E-1 1.3242642E+5 8.3938238E+2 -7.3811544E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam; Aplowite CoSO4:H2O = 1.000Co+2 + 1.000SO4-2 + 1.000H2O log_k -1.049 delta_h -52.050 #kJ/mol #74nau/ryz -analytic -1.7188433E+3 -2.6476287E-1 9.6596288E+4 6.203035E+2 -5.5249789E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: 94pan; Aragonite CaCO3 + 1.000H+ = 1.000HCO3- + 1.000Ca+2 log_k 2.014 delta_h -25.150 #kJ/mol #87gar/par -analytic -8.590273E+2 -1.3909045E-1 4.7686137E+4 3.1246802E+2 -2.721065E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; Cp: 87gar/par; V°: 78hel/del,82plu/bus; Arcanite K2(SO4) = 2.000K+ + 1.000SO4-2 log_k -1.849 delta_h 24.080 #kJ/mol #98cha -analytic -1.4895978E+3 -2.3691323E-1 8.2162114E+4 5.4168048E+2 -5.1150985E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem; Argutite(alpha) GeO2 + 2.000H2O = 1.000Ge(OH)4 log_k -5.024 delta_h 34.742 #kJ/mol #98pok/sch -analytic -1.4824527E+2 -1.9630913E-2 6.6761533E+3 5.3445441E+1 -4.9465477E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 98pok/sch; S°: 98pok/sch; Cp: 98pok/sch; V°: 98pok/sch; Argutite(beta) GeO2 + 2.000H2O = 1.000Ge(OH)4 log_k -1.975 #delta_h 0.000 #kJ/mol -analytic -1.4819636E+2 -1.909519E-2 7.9209063E+3 5.2947428E+1 -5.0374798E+5 #References = LogK/DGf: Internal calculation; Cp: 98pok/sch; V°: Default value; Arsenocrandallite CaAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Ca+2 + 6.000H2O log_k 10.146 #References = LogK/DGf: 93sch/got; #References = LogK/DGf: 93sch/got; V°: Default value; Arsenoflorencite(Ce) CeAl3(AsO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Ce+3 + 6.000H2O log_k 9.351 #References = LogK/DGf: 93sch/got; #References = LogK/DGf: 93sch/got; V°: Default value; Arsenoflorencite(La) LaAl3(AsO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000La+3 + 6.000H2O log_k 9.628 #References = LogK/DGf: 93sch/got; #References = LogK/DGf: 93sch/got; V°: Default value; Arsenogorceixite BaAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Ba+2 + 6.000H2O log_k 7.115 #References = LogK/DGf: 93sch/got; #References = LogK/DGf: 93sch/got; V°: Default value; Arsenogoyazite SrAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Sr+2 + 6.000H2O log_k 9.933 #References = LogK/DGf: 93sch/got; #References = LogK/DGf: 93sch/got; V°: Default value; Arsenolite As2O3 + 3.000H2O = 2.000H2AsO3- + 2.000H+ log_k -19.864 delta_h 96.123 #kJ/mol #Internal calculation -analytic -4.9427978E+2 -9.1883532E-2 1.7334955E+4 1.8383582E+2 -9.9745764E+5 #References = LogK/DGf: 96pok/gou; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou; Arsenopyrite FeAsS + 1.000H+ + 1.500H2O = 1.000AsH3 + 1.000Fe+2 + 1.000HS- + 0.750O2 log_k -92.129 delta_h 525.884 #kJ/mol #Internal calculation -analytic -5.6913698E+2 -9.5561738E-2 5.3458889E+2 2.0987371E+2 -1.3877748E+6 #References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok; Artinite Mg2(OH)2(CO3):3H2O + 3.000H+ = 1.000HCO3- + 2.000Mg+2 + 5.000H2O log_k 20.142 delta_h -132.468 #kJ/mol #73hem/rob -analytic -1.2920631E+3 -1.9865269E-1 7.5563611E+4 4.6912486E+2 -3.8070101E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 73hem/rob; S°: 72hem/rob; Cp: 78hel/del; V°: 78hel/del; As(element) As + 1.500H2O = 1.000AsH3 + 0.750O2 log_k -81.939 delta_h 487.814 #kJ/mol #Internal calculation -analytic 2.8384136E+2 4.472113E-2 -4.3128642E+4 -1.0058438E+2 1.2827157E+6 #References = S°: 73hul/des; Cp: 73hul/des; V°: 96pok/gou; As2O5 As2O5 + 3.000H2O = 2.000H2AsO4- + 2.000H+ log_k 2.238 delta_h -36.939 #kJ/mol #01gas/aza -analytic -1.0425421E+3 -1.7648403E-1 5.8968029E+4 3.7952389E+2 -3.5102109E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 01gas/aza; S°: 01gas/aza; Cp: 01gas/aza; V°: 84pan/stu; Atacamite Cu4Cl2(OH)6 + 6.000H+ = 2.000Cl- + 4.000Cu+2 + 6.000H2O log_k 14.926 delta_h -142.094 #kJ/mol #Internal calculation -analytic -2.5884643E+3 -4.0624673E-1 1.4553345E+5 9.3940336E+2 -7.8316144E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam; Au(element) Au + 0.750O2 + 3.000H+ = 1.000Au+3 + 1.500H2O log_k -11.446 delta_h -10.259 #kJ/mol #Internal calculation -analytic -6.2441652E+2 -9.8368017E-2 3.3850496E+4 2.2265417E+2 -1.9715639E+6 #References = S°: 95rob/hem; Cp: 78hel/del; V°: 78hel/del; Augelite Al2PO4(OH)3 + 5.000H+ = 2.000Al+3 + 1.000H2PO4- + 3.000H2O log_k 10.277 #References = LogK/DGf: 79vie/tar; #References = LogK/DGf: 79vie/tar; V°: 63wyc; Austinite CaZnAsO4(OH) + 3.000H+ = 1.000H2AsO4- + 1.000Ca+2 + 1.000Zn+2 + 1.000H2O log_k 6.881 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Azurite Cu3(OH)2(CO3)2 + 4.000H+ = 2.000HCO3- + 3.000Cu+2 + 2.000H2O log_k 3.750 delta_h -83.679 #kJ/mol #Internal calculation -analytic -2.1870066E+3 -3.4835539E-1 1.2025145E+5 7.9413505E+2 -6.5551758E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 78hel/del; B(OH)3 B(OH)3 = 1.000B(OH)3 log_k -0.158 delta_h 22.474 #kJ/mol #89cox/wag -analytic -1.6282655E+2 -2.1070484E-2 8.2789957E+3 5.9514064E+1 -5.4057481E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; B2O3 B2O3 + 3.000H2O = 2.000B(OH)3 log_k 5.565 delta_h -13.662 #kJ/mol #89cox/wag -analytic -2.7605646E+2 -3.5653136E-2 1.7965697E+4 9.8924339E+1 -1.1367477E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Ba3(AsO4)2 Ba3(AsO4)2 + 4.000H+ = 2.000H2AsO4- + 3.000Ba+2 log_k 15.320 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: Default value; BaHAsO4:H2O BaHAsO4:H2O + 1.000H+ = 1.000H2AsO4- + 1.000Ba+2 + 1.000H2O log_k -6.039 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: Default value; BaHPO4 BaHPO4 + 1.000H+ = 1.000Ba+2 + 1.000H2PO4- log_k -7.410 delta_h -25.577 #kJ/mol #71par/wag -analytic -9.1213779E+2 -1.4085955E-1 5.0075968E+4 3.2749001E+2 -2.8075415E+6 #References = LogK/DGf: 66spi/mik; DHf/DHr: 71par/wag; S°: Internal calculation; V°: Default value; Barite BaSO4 = 1.000Ba+2 + 1.000SO4-2 log_k -10.051 delta_h 26.335 #kJ/mol #Internal calculation -analytic -1.5795404E+3 -2.5599158E-1 8.5700701E+4 5.7308569E+2 -5.3061519E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Bassanite CaSO4:0.5H2O = 1.000Ca+2 + 1.000SO4-2 + 0.500H2O log_k -3.919 delta_h -17.357 #kJ/mol #Internal calculation -analytic -1.5834316E+3 -2.5347761E-1 8.8114917E+4 5.7346485E+2 -5.2850565E+6 #References = LogK/DGf: 06bla/las; DHf/DHr: Internal calculation; S°: CODATA87; Cp: 06bla/pia; V°: 93bar; Beidellite(Ca) Ca0.17Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.170Ca+2 + 3.660H4SiO4 log_k 5.788 delta_h -199.096 #kJ/mol #15bla/vie -analytic -2.4532307E+3 -3.3777719E-1 1.5377736E+5 8.6747751E+2 -9.1169893E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Beidellite(K) K0.34Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.340K+ + 3.660H4SiO4 log_k 4.620 delta_h -180.563 #kJ/mol #15bla/vie -analytic -2.4366989E+3 -3.3467927E-1 1.5217638E+5 8.619875E+2 -9.0876414E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Beidellite(Mg) Mg0.17Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.170Mg+2 + 3.660H4SiO4 log_k 5.243 delta_h -200.276 #kJ/mol #15bla/vie -analytic -2.4698191E+3 -3.397414E-1 1.5473238E+5 8.731313E+2 -9.1671514E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Beidellite(Na) Na0.34Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.340Na+ + 3.660H4SiO4 log_k 5.117 delta_h -189.181 #kJ/mol #15bla/vie -analytic -2.4563509E+3 -3.3672371E-1 1.5363066E+5 8.6862698E+2 -9.1362932E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; BeidelliteSBId Ca0.185K0.104(Si3.574Al0.426)(Al1.812Mg0.090Fe0.112)O10(OH)2 + 7.704H+ + 2.296H2O = 2.238Al+3 + 0.185Ca+2 + 0.112Fe+3 + 0.104K+ + 0.090Mg+2 + 3.574H4SiO4 log_k 7.597 delta_h -216.148 #kJ/mol #12gai/bla -analytic -2.4917268E+3 -3.5177889E-1 1.5494595E+5 8.8349303E+2 -9.0342882E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla; Berlinite AlPO4 + 2.000H+ = 1.000Al+3 + 1.000H2PO4- log_k 1.207 delta_h -107.151 #kJ/mol #Internal calculation -analytic -1.0573736E+3 -1.7484841E-1 6.1600673E+4 3.8046565E+2 -3.3188334E+6 #References = LogK/DGf: 82wag/eva; DHf/DHr: Internal calculation; S°: 68wag/eva; Cp: 74nau/ryz, 76wag/eva, 71par/wag; V°: 95rob/hem; Berndtite SnS2 + 0.750H2O = 1.500HS- + 1.000Sn+2 + 0.250S2O3-2 log_k -32.151 delta_h 171.770 #kJ/mol #Internal calculation -analytic -1.5673577E+3 -2.5297031E-1 7.7602812E+4 5.6962368E+2 -5.2578723E+6 #References = LogK/DGf: 85jac/hel; DHf/DHr: Internal calculation; S°: 85jac/hel; Cp: 85jac/hel; V°: 85jac/hel; BerthierineISGS (Si1.332Al0.668)(Al0.976Fe1.622Mg0.157)O5(OH)4 + 8.672H+ = 1.644Al+3 + 1.440Fe+2 + 0.157Mg+2 + 1.332H4SiO4 + 0.182Fe+3 + 3.672H2O log_k 28.891 delta_h -320.787 #kJ/mol #14bla/gai -analytic -1.9377506E+3 -2.8270535E-1 1.2290255E+5 6.9063516E+2 -6.241976E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14bla/gai; S°: 14bla/gai; Cp: 14bla/gai; V°: 14bla/gai; Berthierine(FeII) (Fe2Al)(SiAl)O5(OH)4 + 10.000H+ = 2.000Al+3 + 2.000Fe+2 + 1.000H4SiO4 + 5.000H2O log_k 33.710 delta_h -369.411 #kJ/mol #15bla/vie -analytic -1.973861E+3 -2.9595392E-1 1.2535721E+5 7.0492903E+2 -6.1284403E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Berthierine(FeIII) (Fe2.67Al0.33)(Si1.34Al0.66)O5(OH)4 + 8.640H+ = 0.990Al+3 + 2.340Fe+2 + 1.340H4SiO4 + 0.330Fe+3 + 3.640H2O log_k 28.921 delta_h -297.641 #kJ/mol #15bla/vie -analytic -1.9010637E+3 -2.7605598E-1 1.2010468E+5 6.7840745E+2 -6.1529544E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Berthierite FeSb2S4 + 6.000H2O = 1.000Fe+2 + 4.000HS- + 2.000Sb(OH)3 + 2.000H+ log_k -61.058 delta_h 307.851 #kJ/mol #Internal calculation -analytic -2.7120828E+3 -4.5157008E-1 1.2837625E+5 9.8993258E+2 -8.3950548E+6 #References = LogK/DGf: 92sea/rob; DHf/DHr: Internal calculation; S°: 92sea/rob; Cp: 92sea/rob; V°: 92sea/rob; Beudantite PbFe3(AsO4)2(OH)5:H2O + 9.000H+ = 2.000H2AsO4- + 3.000Fe+3 + 1.000Pb+2 + 6.000H2O log_k -9.342 #References = LogK/DGf: 04gab/vie; #References = LogK/DGf: 04gab/vie; V°: Default value; Bieberite CoSO4:7H2O = 1.000Co+2 + 1.000SO4-2 + 7.000H2O log_k -2.345 delta_h 11.840 #kJ/mol #74nau/ryz -analytic -1.6645723E+3 -2.5502938E-1 9.0786352E+4 6.0374082E+2 -5.347068E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan; Bilinite Fe3(SO4)4:22H2O = 2.000Fe+3 + 4.000SO4-2 + 1.000Fe+2 + 22.000H2O log_k -16.343 delta_h 7.380 #kJ/mol #02hem/sea -analytic -7.1379563E+3 -1.0362887E+0 3.8586546E+5 2.5778164E+3 -2.1534911E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 69bol/ptu; Bischofite MgCl2:6H2O = 2.000Cl- + 1.000Mg+2 + 6.000H2O log_k 4.466 delta_h -8.710 #kJ/mol #74nau/ryz -analytic -1.6137748E+3 -2.4625715E-1 8.8110778E+4 5.8693541E+2 -4.9954494E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; Cp: 74nau/ryz; V°: 63wyc; Bloedite Na2Mg(SO4)2:4H2O = 1.000Mg+2 + 2.000Na+ + 2.000SO4-2 + 4.000H2O log_k -2.346 #References = LogK/DGf: 84har/mol; #References = LogK/DGf: 84har/mol; V°: 63wyc; Bobbierite Mg3(PO4)2:8H2O + 4.000H+ = 3.000Mg+2 + 2.000H2PO4- + 8.000H2O log_k 13.928 #References = LogK/DGf: 63tay/fra, 96bou; #References = LogK/DGf: 63tay/fra, 96bou; V°: 84nri; Boehmite AlO(OH) + 3.000H+ = 1.000Al+3 + 2.000H2O log_k 7.625 delta_h -113.660 #kJ/mol #95rob/hem -analytic -4.7846065E+2 -7.8925715E-2 2.9738634E+4 1.7148206E+2 -1.2842726E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Bornite(alpha) Cu5FeS4 + 4.000H+ = 4.000Cu+ + 1.000Cu+2 + 1.000Fe+2 + 4.000HS- log_k -107.495 delta_h 563.866 #kJ/mol #95rob/hem -analytic -3.6594623E+3 -5.7956556E-1 1.6798484E+5 1.3295872E+3 -1.1434856E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 78hel/del,70pan/kin; V°: 95rob/hem; Brochantite Cu4SO4(OH)6 + 6.000H+ = 4.000Cu+2 + 1.000SO4-2 + 6.000H2O log_k 15.543 delta_h -175.083 #kJ/mol #Internal calculation -analytic -2.7209001E+3 -4.2572542E-1 1.5456015E+5 9.8537993E+2 -8.2921862E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 95rob/hem; V°: 95rob/hem; Bromellite BeO + 2.000H+ = 1.000Be+2 + 1.000H2O log_k 6.292 delta_h -59.205 #kJ/mol #89cox/wag -analytic -3.4398439E+2 -5.3311223E-2 2.063174E+4 1.2421191E+2 -9.2288712E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Brucite Mg(OH)2 + 2.000H+ = 1.000Mg+2 + 2.000H2O log_k 17.112 delta_h -114.518 #kJ/mol #08bla -analytic -3.5641635E+2 -5.3167189E-2 2.4317829E+4 1.2873122E+2 -9.5286882E+5 #References = LogK/DGf: 08bla; DHf/DHr: 08bla; S°: Internal calculation; Cp: 95rob/hem; V°: 95rob/hem; Brushite CaHPO4:2H2O + 1.000H+ = 1.000Ca+2 + 1.000H2PO4- + 2.000H2O log_k 0.602 delta_h -7.375 #kJ/mol #Internal calculation -analytic -9.002507E+2 -1.5102401E-1 4.7493595E+4 3.299399E+2 -2.6515612E+6 #References = LogK/DGf: 84nan; DHf/DHr: Internal calculation; S°: 84nan; Cp: 70gre/mor, after 64aega/wak and bega/wak; V°: 84nri; Bunsenite NiO + 2.000H+ = 1.000Ni+2 + 1.000H2O log_k 12.505 delta_h -106.030 #kJ/mol #90hem -analytic -3.4458754E+2 -5.4041547E-2 2.3408881E+4 1.2361235E+2 -9.9378264E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 90hem; S°: 90hem; Cp: 95rob/hem; V°: 78hel/del; Burkeite Na6CO3(SO4)2 + 1.000H+ = 1.000HCO3- + 6.000Na+ + 2.000SO4-2 log_k -0.770 #References = LogK/DGf: 84har/mol; #References = LogK/DGf: 84har/mol; V°: 63wyc; C(element) C + 1.000O2 + 1.000H2O = 1.000HCO3- + 1.000H+ log_k 64.163 delta_h -391.966 #kJ/mol #By convention -analytic -7.4217625E+2 -1.2227979E-1 6.2957072E+4 2.6790665E+2 -2.7805115E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; C0.7SH Ca1.4Si2O5.9496H1.0992:1.378H2O + 2.800H+ + 0.6724H2O = 1.400Ca+2 + 2.000H4SiO4 log_k 17.796 delta_h -99.315 #kJ/mol #Internal calculation -analytic -1.0799065E+3 -1.389491E-1 7.0714511E+4 3.8364667E+2 -4.2096302E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.8SH Ca1.6Si2O6.1698H1.1396:1.6122H2O + 3.200H+ + 0.218H2O = 1.600Ca+2 + 2.000H4SiO4 log_k 21.184 delta_h -118.525 #kJ/mol #Internal calculation -analytic -1.1396811E+3 -1.4803607E-1 7.4806082E+4 4.0544805E+2 -4.369437E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.9SH Ca1.8Si2O6.4048H1.2096:1.7014H2O + 3.600H+ = 1.800Ca+2 + 2.000H4SiO4 + 0.1062H2O log_k 25.247 delta_h -142.264 #kJ/mol #Internal calculation -analytic -1.1870726E+3 -1.5556596E-1 7.8435929E+4 4.2278161E+2 -4.4908616E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1SH Ca2Si2O6.6436H1.2872:1.7542H2O + 4.000H+ = 2.000Ca+2 + 2.000H4SiO4 + 0.3978H2O log_k 29.474 delta_h -167.108 #kJ/mol #Internal calculation -analytic -1.2759222E+3 -1.687102E-1 8.4531036E+4 4.5493777E+2 -4.7589472E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.1SH Ca2.2Si2O6.8821H1.3642:1.867H2O + 4.400H+ = 2.200Ca+2 + 2.000H4SiO4 + 0.7491H2O log_k 33.758 delta_h -191.888 #kJ/mol #Internal calculation -analytic -1.3444716E+3 -1.7902986E-1 8.9443229E+4 4.7984377E+2 -4.9539663E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.2SH Ca2.4Si2O7.1203H1.4406:2.0692H2O + 4.800H+ = 2.400Ca+2 + 2.000H4SiO4 + 1.1895H2O log_k 38.095 delta_h -216.390 #kJ/mol #Internal calculation -analytic -1.4129647E+3 -1.892025E-1 9.4334986E+4 5.0474601E+2 -5.146218E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.3SH Ca2.6Si2O7.3957H1.5914:2.1702H2O + 5.200H+ = 2.600Ca+2 + 2.000H4SiO4 + 1.5659H2O log_k 42.473 delta_h -241.097 #kJ/mol #Internal calculation -analytic -1.4826299E+3 -1.9955627E-1 9.9299385E+4 5.300773E+2 -5.3418257E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.4SH Ca2.8Si2O7.687H1.774:2.2274H2O + 5.600H+ = 2.800Ca+2 + 2.000H4SiO4 + 1.9144H2O log_k 46.935 delta_h -266.266 #kJ/mol #Internal calculation -analytic -1.5527962E+3 -2.0998834E-1 1.0431442E+5 5.5559198E+2 -5.5388847E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.5SH Ca3Si2O7.9783H1.9566:2.2848H2O + 6.000H+ = 3.000Ca+2 + 2.000H4SiO4 + 2.2631H2O log_k 51.442 delta_h -291.690 #kJ/mol #Internal calculation -analytic -1.6002727E+3 -2.1736724E-1 1.0802648E+5 5.7299087E+2 -5.656187E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.6SH Ca3.2Si2O8.2682H2.1364:2.3446H2O + 6.400H+ = 3.200Ca+2 + 2.000H4SiO4 + 2.6128H2O log_k 55.989 delta_h -317.358 #kJ/mol #Internal calculation -analytic -1.6460458E+3 -2.2451827E-1 1.1165267E+5 5.8977983E+2 -5.7675717E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.7A0.01SH Ca1.4Al0.04Si2O6.0128H1.1056:1.4156H2O + 2.920H+ + 0.5716H2O = 0.040Al+3 + 1.400Ca+2 + 2.000H4SiO4 log_k 17.949 delta_h -103.921 #kJ/mol #Internal calculation -analytic -1.0965647E+3 -1.4190979E-1 7.1801805E+4 3.8955699E+2 -4.2609978E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.8A0.01SH Ca1.6Al0.04Si2O6.2343H1.1486:1.63H2O + 3.320H+ + 0.1357H2O = 0.040Al+3 + 1.600Ca+2 + 2.000H4SiO4 log_k 21.541 delta_h -124.405 #kJ/mol #Internal calculation -analytic -1.1563628E+3 -1.5102639E-1 7.5961503E+4 4.113641E+2 -4.4213297E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.1A0.01SH Ca2.2Al0.04Si2O6.9455H1.371:1.885H2O + 4.520H+ = 0.040Al+3 + 2.200Ca+2 + 2.000H4SiO4 + 0.8305H2O log_k 34.217 delta_h -198.369 #kJ/mol #Internal calculation -analytic -1.3619414E+3 -1.8212281E-1 9.0678169E+4 4.8603839E+2 -5.0089959E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.2A0.01SH Ca2.4Al0.04Si2O7.1845H1.449:2.0794H2O + 4.920H+ = 0.040Al+3 + 2.400Ca+2 + 2.000H4SiO4 + 1.2639H2O log_k 38.539 delta_h -222.821 #kJ/mol #Internal calculation -analytic -1.4304627E+3 -1.9230858E-1 9.5568963E+4 5.1094988E+2 -5.2014938E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.3A0.01SH Ca2.6Al0.04Si2O7.4606H1.6012:2.1732H2O + 5.320H+ = 0.040Al+3 + 2.600Ca+2 + 2.000H4SiO4 + 1.6338H2O log_k 42.904 delta_h -247.485 #kJ/mol #Internal calculation -analytic -1.5001527E+3 -2.0267446E-1 1.0053261E+5 5.3628926E+2 -5.3973284E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.4A0.01SH Ca2.8Al0.04Si2O7.7502H1.7804:2.2294H2O + 5.720H+ = 0.040Al+3 + 2.800Ca+2 + 2.000H4SiO4 + 1.9796H2O log_k 47.302 delta_h -272.330 #kJ/mol #Internal calculation -analytic -1.5698685E+3 -2.1305369E-1 1.0550505E+5 5.6164131E+2 -5.5930024E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.5A0.01SH Ca3Al0.04Si2O8.0399H1.9598:2.2858H2O + 6.120H+ = 0.040Al+3 + 3.000Ca+2 + 2.000H4SiO4 + 2.3257H2O log_k 51.724 delta_h -297.311 #kJ/mol #Internal calculation -analytic -1.6156273E+3 -2.2020888E-1 1.0909469E+5 5.7842436E+2 -5.7044556E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C1.6A0.01SH Ca3.2Al0.04Si2O8.3296H2.1392:2.3446H2O + 6.520H+ = 0.040Al+3 + 3.200Ca+2 + 2.000H4SiO4 + 2.6742H2O log_k 56.220 delta_h -322.694 #kJ/mol #Internal calculation -analytic -1.661392E+3 -2.2736109E-1 1.1270564E+5 5.9521001E+2 -5.8158601E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.7A0.025SH Ca1.4Al0.1Si2O6.1077H1.1154:1.5092H2O + 3.100H+ + 0.3831H2O = 0.100Al+3 + 1.400Ca+2 + 2.000H4SiO4 log_k 18.203 delta_h -110.731 #kJ/mol #Internal calculation -analytic -1.121563E+3 -1.462932E-1 7.3427015E+4 3.9843325E+2 -4.3370047E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.8A0.025SH Ca1.6Al0.1Si2O6.331H1.162:1.6746H2O + 3.500H+ = 0.100Al+3 + 1.600Ca+2 + 2.000H4SiO4 + 0.0056H2O log_k 22.108 delta_h -133.284 #kJ/mol #Internal calculation -analytic -1.1793458E+3 -1.5519884E-1 7.7582015E+4 4.1950822E+2 -4.4918796E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.7A0.05SH Ca1.4Al0.2Si2O6.2658H1.1316:1.6968H2O + 3.400H+ + 0.0374H2O = 0.200Al+3 + 1.400Ca+2 + 2.000H4SiO4 log_k 19.290 delta_h -125.656 #kJ/mol #Internal calculation -analytic -1.1632315E+3 -1.5354988E-1 7.6321758E+4 4.1323449E+2 -4.4627952E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C0.8A0.05SH Ca1.6Al0.2Si2O6.4921H1.1842:1.7636H2O + 3.800H+ = 0.200Al+3 + 1.600Ca+2 + 2.000H4SiO4 + 0.2557H2O log_k 23.173 delta_h -148.678 #kJ/mol #Internal calculation -analytic -1.217671E+3 -1.621328E-1 8.0314689E+4 4.3309156E+2 -4.609113E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; C2AH8 Ca2Al2O5:8H2O + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 13.000H2O log_k 59.723 delta_h -436.130 #kJ/mol #06bla/las -analytic -1.7346637E+3 -2.3804512E-1 1.1041064E+5 6.232244E+2 -4.1857412E+6 #References = LogK/DGf: 06bla/las; DHf/DHr: 06bla/las; S°: Internal calculation; V°: 92wol; C2SHa Ca2(HSiO4)(OH) + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4 + 1.000H2O log_k 35.545 delta_h -195.771 #kJ/mol #10abla/bou -analytic -9.2430752E+2 -1.2731736E-1 6.2844135E+4 3.3224777E+2 -3.1195834E+6 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 10abla/bou; C3AH6 Ca3Al2(OH)12 + 12.000H+ = 2.000Al+3 + 3.000Ca+2 + 12.000H2O log_k 80.332 delta_h -584.260 #kJ/mol #99sch/nav -analytic -1.7858029E+3 -2.8803505E-1 1.1970595E+5 6.4758061E+2 -4.6117004E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: 99sch/nav; S°: Internal calculation; Cp: 79ede/sat; V°: 92wol; C3FH6 Ca3Fe2(OH)12 + 12.000H+ = 3.000Ca+2 + 2.000Fe+3 + 12.000H2O log_k 72.382 delta_h -509.370 #kJ/mol #85bab/mat -analytic -1.9413488E+3 -3.0335333E-1 1.2528639E+5 7.0390811E+2 -5.1390961E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 85bab/mat; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay; C4AH13 Ca4Al2O7:13H2O + 14.000H+ = 2.000Al+3 + 4.000Ca+2 + 20.000H2O log_k 103.670 delta_h -647.400 #kJ/mol #76hou/ste -analytic -2.1674746E+3 -3.2685802E-1 1.4528384E+5 7.8649867E+2 -5.7626461E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: 76hou/ste; S°: Internal calculation; Cp: 10bbla/bou; V°: 92wol; C4FH13 Ca4Fe2O7:13H2O + 14.000H+ = 4.000Ca+2 + 2.000Fe+3 + 20.000H2O log_k 95.142 delta_h -569.205 #kJ/mol #85bab/mat -analytic -2.2790678E+3 -3.4978791E-1 1.4486256E+5 8.3140351E+2 -5.744869E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 85bab/mat; S°: 10bbla/bou; Cp: 85bab/mat; V°: 97tay; Ca(element) Ca + 0.500O2 + 2.000H+ = 1.000Ca+2 + 1.000H2O log_k 139.842 delta_h -822.763 #kJ/mol #89cox/wag -analytic -3.6438219E+2 -5.800883E-2 6.2982687E+4 1.3095262E+2 -1.2230594E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Ca3(AsO4)2:3.66H2O Ca3(AsO4)2:3.66H2O + 4.000H+ = 2.000H2AsO4- + 3.000Ca+2 + 3.660H2O log_k 16.774 #References = LogK/DGf: 99bot/bro; #References = LogK/DGf: 99bot/bro; V°: Default value; Ca4(OH)2(AsO4)2:4H2O Ca4(OH)2(AsO4)2:4H2O + 6.000H+ = 2.000H2AsO4- + 4.000Ca+2 + 6.000H2O log_k 37.096 #References = LogK/DGf: 99bot/bro; #References = LogK/DGf: 99bot/bro; V°: Default value; Ca4H(PO4)3:2.5H2O Ca4H(PO4)3:2.5H2O + 5.000H+ = 4.000Ca+2 + 3.000H2PO4- + 2.500H2O log_k 11.813 #References = LogK/DGf: 84nan; #References = LogK/DGf: 84nan; V°: Default value; Ca4H(PO4)3:3H2O Ca4H(PO4)3:3H2O + 5.000H+ = 4.000Ca+2 + 3.000H2PO4- + 3.000H2O log_k 10.118 #References = LogK/DGf: NIST46.4; #References = LogK/DGf: NIST46.4; V°: Default value; Ca5(AsO4)3OH Ca5(AsO4)3OH + 7.000H+ = 3.000H2AsO4- + 5.000Ca+2 + 1.000H2O log_k 31.611 #References = LogK/DGf: 99bot/bro; #References = LogK/DGf: 99bot/bro; V°: Default value; CaAlH(PO4)2:6H2O CaAlH(PO4)2:6H2O + 3.000H+ = 1.000Al+3 + 1.000Ca+2 + 2.000H2PO4- + 6.000H2O log_k -14.304 #References = LogK/DGf: 64atay/gur; #References = LogK/DGf: 64atay/gur; V°: Default value; CaCl2:2H2O CaCl2:2H2O = 1.000Ca+2 + 2.000Cl- + 2.000H2O log_k 7.952 delta_h -44.790 #kJ/mol #87gar/par -analytic -1.555851E+3 -2.4235408E-1 8.6627587E+4 5.6580889E+2 -4.848861E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 63wyc; CaCl2:4H2O CaCl2:4H2O = 1.000Ca+2 + 2.000Cl- + 4.000H2O log_k 5.359 delta_h -11.310 #kJ/mol #87gar/par -analytic -1.6007547E+3 -2.4169682E-1 8.6973605E+4 5.8229303E+2 -4.8341793E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 03dea; CaCl2:H2O CaCl2:H2O = 1.000Ca+2 + 2.000Cl- + 1.000H2O log_k 7.849 delta_h -52.160 #kJ/mol #87gar/par -analytic -1.5551146E+3 -2.462483E-1 8.7102469E+4 5.6560817E+2 -4.9176973E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 03dea; CaCrO4(s) CaCrO4 = 1.000Ca+2 + 1.000CrO4-2 log_k -3.150 delta_h -22.807 #kJ/mol #Internal calculation -analytic -1.6003839E+3 -2.5327245E-1 8.8679287E+4 5.7948408E+2 -5.2073984E+6 #References = LogK/DGf: 04wan/li; DHf/DHr: Internal calculation; S°: 03dea; V°: 90rob/cam; CaHAsO3 CaHAsO3 + 1.000H+ = 1.000H2AsO3- + 1.000Ca+2 log_k 34.250 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: Default value; CaHAsO4:H2O CaHAsO4:H2O + 1.000H+ = 1.000H2AsO4- + 1.000Ca+2 + 1.000H2O log_k 2.021 #References = LogK/DGf: 99bot/bro; #References = LogK/DGf: 99bot/bro; V°: Default value; Calcite CaCO3 + 1.000H+ = 1.000HCO3- + 1.000Ca+2 log_k 1.847 delta_h -25.325 #kJ/mol #Internal calculation -analytic -8.5009769E+2 -1.3947083E-1 4.6880816E+4 3.0964755E+2 -2.6591399E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 82plu/bus; Cp: 95rob/hem; V°: 78hel/del,82plu/bus; Calomel Hg2Cl2 = 2.000Cl- + 1.000Hg2+2 log_k -17.844 delta_h 98.080 #kJ/mol #89cox/wag -analytic -1.4752305E+3 -2.4016648E-1 7.5071959E+4 5.377565E+2 -4.7508137E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 85cha/dav; V°: 95rob/hem; Carbonate(K) K2CO3:1.5H2O + 1.000H+ = 1.000HCO3- + 2.000K+ + 1.500H2O log_k 13.359 delta_h -15.889 #kJ/mol #Internal calculation -analytic -8.4310854E+2 -1.2193778E-1 4.6997675E+4 3.0865172E+2 -2.5376147E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; Carnallite KMgCl3:6H2O = 3.000Cl- + 1.000K+ + 1.000Mg+2 + 6.000H2O log_k 4.336 delta_h 9.340 #kJ/mol #74nau/ryz -analytic -2.4013581E+3 -3.5694639E-1 1.2977001E+5 8.7250899E+2 -7.2981156E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 63wyc; Cassiterite SnO2 + 2.000H+ = 1.000Sn+2 + 0.500O2 + 1.000H2O log_k -45.456 delta_h 276.957 #kJ/mol #89cox/wag -analytic -1.9555862E+2 -3.0314741E-2 -4.8823113E+3 7.2858703E+1 -4.2383267E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Cattierite CoS2 + 0.750H2O = 1.000Co+2 + 1.500HS- + 0.250S2O3-2 log_k -27.183 delta_h 120.151 #kJ/mol #95rob/hem -analytic -1.5956797E+3 -2.5849685E-1 8.0777162E+4 5.7925091E+2 -5.2161779E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 87pan/mah; V°: 95rob/hem; Cd(element) Cd + 0.500O2 + 2.000H+ = 1.000Cd+2 + 1.000H2O log_k 56.614 delta_h -355.683 #kJ/mol #By convention -analytic -3.971198E+2 -6.0896205E-2 4.039564E+4 1.4194817E+2 -1.31913E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Cd(OH)2 Cd(OH)2 + 2.000H+ = 1.000Cd+2 + 2.000H2O log_k 13.862 delta_h -87.730 #kJ/mol #Internal calculation -analytic -3.0555379E+2 -4.5670879E-2 2.0230697E+4 1.1079785E+2 -7.9857844E+5 #References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 99yun/glu; V°: 01mer/vie; Cd3(PO4)2 Cd3(PO4)2 + 4.000H+ = 3.000Cd+2 + 2.000H2PO4- log_k 8.970 delta_h -206.960 #kJ/mol #01ben/jem -analytic -2.2188201E+3 -3.4072542E-1 1.2852108E+5 7.974586E+2 -6.6619766E+6 #References = LogK/DGf: 82wag/eva; DHf/DHr: 01ben/jem; S°: Internal calculation; V°: Default value; Cd5(PO4)3Cl Cd5(PO4)3Cl + 6.000H+ = 5.000Cd+2 + 1.000Cl- + 3.000H2PO4- log_k 12.673 #References = LogK/DGf: 84vie/tar; #References = LogK/DGf: 84vie/tar; V°: Default value; Cd5(PO4)3OH Cd5(PO4)3OH + 7.000H+ = 5.000Cd+2 + 3.000H2PO4- + 1.000H2O log_k 19.843 #References = LogK/DGf: 84vie/tar; #References = LogK/DGf: 84vie/tar; V°: Default value; CdCl2 CdCl2 = 1.000Cd+2 + 2.000Cl- log_k -0.656 delta_h -18.580 #kJ/mol #82wag/eva -analytic -1.5398285E+3 -2.5000429E-1 8.4903052E+4 5.5985763E+2 -5.012328E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 84pan; CdCl2:2.5H2O CdCl2:2.5H2O = 1.000Cd+2 + 2.000Cl- + 2.500H2O log_k -1.897 delta_h 7.285 #kJ/mol #82wag/eva -analytic -1.5982554E+3 -2.4479563E-1 8.6152936E+4 5.8030142E+2 -4.936406E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; V°: 01mer/vie; CdCl2:H2O CdCl2:H2O = 1.000Cd+2 + 2.000Cl- + 1.000H2O log_k -1.691 delta_h -7.470 #kJ/mol #82wag/eva -analytic -1.5752675E+3 -2.470366E-1 8.5910114E+4 5.7188057E+2 -4.9775653E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; V°: 01mer/vie; CdSiO3 CdSiO3 + 2.000H+ + 1.000H2O = 1.000Cd+2 + 1.000H4SiO4 log_k 7.793 delta_h -59.861 #kJ/mol #77bar/kna -analytic -6.9406813E+2 -9.3870006E-2 4.3858156E+4 2.4709479E+2 -2.5487506E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 77bar/kna; S°: 77bar/kna; Cp: 77bar/kna; V°: Default value; CdSO4 CdSO4 = 1.000Cd+2 + 1.000SO4-2 log_k -0.157 delta_h -51.980 #kJ/mol #82wag/eva -analytic -1.6519282E+3 -2.6396402E-1 9.341426E+4 5.9762565E+2 -5.4781603E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 74nau/ryz; V°: 94pan; CdSO4:8/3H2O CdSO4:2.67H2O = 1.000Cd+2 + 1.000SO4-2 + 2.670H2O log_k -1.723 delta_h -19.126 #kJ/mol #89cox/wag -analytic -1.6718458E+3 -2.6791743E-1 9.1743077E+4 6.0721101E+2 -5.3522102E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 82dek; V°: 95rob/hem; Celadonite K(MgAl)Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.000Al+3 + 1.000K+ + 1.000Mg+2 + 4.000H4SiO4 log_k 10.218 delta_h -114.928 #kJ/mol #02par/vid -analytic -2.2951597E+3 -3.0749038E-1 1.4288441E+5 8.1489322E+2 -8.7631954E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 02par/vid; S°: 02par/vid; Cp: 98hol/pow; V°: 02par/vid; Celadonite(Fe) KFeAlSi4O10(OH)2 + 6.000H+ + 4.000H2O = 1.000Al+3 + 1.000Fe+2 + 1.000K+ + 4.000H4SiO4 log_k 6.448 delta_h -94.529 #kJ/mol #02par/vid -analytic -2.263818E+3 -3.0410611E-1 1.4008687E+5 8.0369207E+2 -8.6761644E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 02par/vid; S°: 02par/vid; Cp: 98hol/pow; V°: 02par/vid; Celestite SrSO4 = 1.000SO4-2 + 1.000Sr+2 log_k -6.620 delta_h -2.451 #kJ/mol #Internal calculation -analytic -1.6382597E+3 -2.6134201E-1 9.0847992E+4 5.929224E+2 -5.5375878E+6 #References = LogK/DGf: 06bla/ign; DHf/DHr: Internal calculation; S°: 06bla/ign; Cp: 06bla/ign; V°: 78hel/del; Cerussite PbCO3 + 1.000H+ = 1.000HCO3- + 1.000Pb+2 log_k -2.963 delta_h 12.709 #kJ/mol #Internal calculation -analytic -8.8003392E+2 -1.4186278E-1 4.7401035E+4 3.2029657E+2 -2.8596598E+6 #References = LogK/DGf: 84tay/lop; DHf/DHr: Internal calculation; S°: 60kel; Cp: 78hel/del; V°: 78hel/del; Chabazite Ca(Al2Si4)O12:6H2O + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 4.000H4SiO4 + 2.000H2O log_k 11.541 delta_h -200.464 #kJ/mol #08bla -analytic -2.5875779E+3 -3.5298441E-1 1.6180839E+5 9.1700928E+2 -9.5494778E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 08bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Chalcanthite CuSO4:5H2O = 1.000Cu+2 + 1.000SO4-2 + 5.000H2O log_k -2.681 delta_h 6.384 #kJ/mol #Internal calculation -analytic -1.757937E+3 -2.5797348E-1 9.5315507E+4 6.3579287E+2 -5.4000291E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 95rob/hem; V°: 95rob/hem; Chalcedony SiO2 + 2.000H2O = 1.000H4SiO4 log_k -3.450 delta_h 21.907 #kJ/mol #78hel/del -analytic -3.5123163E+2 -4.1614757E-2 2.1730112E+4 1.2331201E+2 -1.5842401E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Chalcocite(alpha) Cu2S + 1.000H+ = 2.000Cu+ + 1.000HS- log_k -34.020 delta_h 203.728 #kJ/mol #Internal calculation -analytic -8.6799465E+2 -1.364481E-1 3.6090718E+4 3.1664576E+2 -2.6589355E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 78hel/del; V°: 84pan/stu; Chalcocyanite CuSO4 = 1.000Cu+2 + 1.000SO4-2 log_k 2.940 delta_h -72.762 #kJ/mol #89cox/wag -analytic -1.6722166E+3 -2.6806438E-1 9.5236736E+4 6.0518365E+2 -5.4965898E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem; Chalcopyrite(alpha) CuFeS2 + 2.000H+ = 1.000Cu+2 + 1.000Fe+2 + 2.000HS- log_k -33.986 delta_h 137.477 #kJ/mol #95rob/hem -analytic -1.924317E+3 -3.081148E-1 9.6811265E+4 6.976372E+2 -6.1130764E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 78hel/del,70pan/kin; V°: 95rob/hem; Chamosite(Daphnite) Fe5Al(AlSi3)O10(OH)8 + 16.000H+ = 2.000Al+3 + 5.000Fe+2 + 3.000H4SiO4 + 6.000H2O log_k 47.603 delta_h -497.518 #kJ/mol #01vid/par -analytic -3.7422355E+3 -5.4789298E-1 2.3185338E+5 1.338448E+3 -1.2120616E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 01vid/par; S°: 01vid/par; Cp: 05vid/par; V°: 05vid/par; Chlorapatite(Pp) Ca5(PO4)3Cl + 6.000H+ = 5.000Ca+2 + 1.000Cl- + 3.000H2PO4- log_k 14.533 #References = LogK/DGf: 84vie/tar,after 72bduf; #References = LogK/DGf: 84vie/tar,after 72bduf; Cp: 68val/kog; V°: 74nau/ryz; Chlorapatite(Synth) Ca5(PO4)3Cl + 6.000H+ = 5.000Ca+2 + 1.000Cl- + 3.000H2PO4- log_k 5.210 delta_h -132.541 #kJ/mol #Internal calculation -analytic -3.7341077E+3 -6.1239758E-1 2.0792342E+5 1.357092E+3 -1.1868188E+7 #References = LogK/DGf: 68val/kog; DHf/DHr: Internal calculation; S°: 71par/wag; Cp: 68val/kog; V°: 74nau/ryz; Chlorargyrite AgCl = 1.000Ag+ + 1.000Cl- log_k -9.749 delta_h 65.704 #kJ/mol #89cox/wag -analytic -7.3805154E+2 -1.15886E-1 3.7595198E+4 2.6854595E+2 -2.4658989E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 78rob/hem,70pan; V°: 95rob/hem; Chlorite(Cca-2) (Mg2.964Fe1.927Al1.116Ca0.011)(Si2.633Al1.367)O10(OH)8 + 17.468H+ = 2.483Al+3 + 0.011Ca+2 + 1.712Fe+2 + 2.964Mg+2 + 2.633H4SiO4 + 0.215Fe+3 + 7.468H2O log_k 61.339 delta_h -627.242 #kJ/mol #14bla/gai -analytic -3.9196735E+3 -5.7906678E-1 2.4546019E+5 1.4019542E+3 -1.232598E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 14bla/gai; S°: 14bla/gai; Cp: 09gai/rog; V°: 14bla/gai; Chloritoid FeAl2SiO5(OH)2 + 8.000H+ = 2.000Al+3 + 1.000Fe+2 + 1.000H4SiO4 + 3.000H2O log_k 21.787 delta_h -289.851 #kJ/mol #87woo/gar -analytic -1.6643862E+3 -2.5448941E-1 1.0438177E+5 5.9428858E+2 -5.2071617E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87woo/gar; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Chloromagnesite MgCl2 = 2.000Cl- + 1.000Mg+2 log_k 22.025 delta_h -159.540 #kJ/mol #98cha -analytic -1.5873819E+3 -2.5606599E-1 9.4920387E+4 5.761318E+2 -5.1746597E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem; Chromite FeCr2O4 + 8.000H+ = 2.000Cr+3 + 1.000Fe+2 + 4.000H2O log_k 15.126 delta_h -268.820 #kJ/mol #95rob/hem -analytic -1.3655056E+3 -2.161256E-1 8.3517093E+4 4.8806529E+2 -3.7987696E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Chrysotile Mg3Si2O5(OH)4 + 6.000H+ = 3.000Mg+2 + 2.000H4SiO4 + 1.000H2O log_k 33.182 delta_h -244.552 #kJ/mol #04eva -analytic -1.8039877E+3 -2.4743291E-1 1.1552931E+5 6.4375706E+2 -6.1763163E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04eva; S°: 04eva; Cp: 95rob/hem; V°: 78hel/del; Cinnabar(alpha) HgS + 1.000H+ = 1.000HS- + 1.000Hg+2 log_k -39.005 delta_h 207.256 #kJ/mol #78hel/del -analytic -9.1508706E+2 -1.4584062E-1 3.8659747E+4 3.3236538E+2 -2.8906305E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 87pan/mah; V°: 78hel/del; Cinnabar(beta) HgS + 1.000H+ = 1.000HS- + 1.000Hg+2 log_k -38.620 #delta_h 0.000 #kJ/mol -analytic -9.1312565E+2 -1.4554446E-1 3.8723194E+4 3.3154914E+2 -2.8779424E+6 #References = LogK/DGf: Internal calculation; Cp: 87pan/mah; V°: Default value; Claudetite As2O3 + 3.000H2O = 2.000H2AsO3- + 2.000H+ log_k -19.930 delta_h 94.727 #kJ/mol #Internal calculation -analytic -4.9288445E+2 -9.1503089E-2 1.7342083E+4 1.8317982E+2 -9.9527093E+5 #References = LogK/DGf: 96pok/gou; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou; Clinochlore Mg5Al(AlSi3)O10(OH)8 + 16.000H+ = 2.000Al+3 + 5.000Mg+2 + 3.000H4SiO4 + 6.000H2O log_k 61.706 delta_h -593.773 #kJ/mol #05vid/par -analytic -3.933293E+3 -5.6860144E-1 2.4698841E+5 1.4055516E+3 -1.2607E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par; Clinoclase Cu3AsO4(OH)3 + 5.000H+ = 1.000H2AsO4- + 3.000Cu+2 + 3.000H2O log_k 10.103 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Clinoptilolite(Ca) Ca0.55(Si4.9Al1.1)O12:3.9H2O + 4.400H+ + 3.700H2O = 1.100Al+3 + 0.550Ca+2 + 4.900H4SiO4 log_k -2.085 delta_h -58.407 #kJ/mol #09bla -analytic -2.3815518E+3 -3.0085981E-1 1.4942318E+5 8.390927E+2 -9.6254008E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Clinoptilolite(K) K1.1(Si4.9Al1.1)O12:2.7H2O + 4.400H+ + 4.900H2O = 1.100Al+3 + 1.100K+ + 4.900H4SiO4 log_k -1.142 delta_h -49.035 #kJ/mol #09bla -analytic -2.3148616E+3 -2.905299E-1 1.4612903E+5 8.1530832E+2 -9.5298429E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Clinoptilolite(Na) Na1.1(Si4.9Al1.1)O12:3.5H2O + 4.400H+ + 4.100H2O = 1.100Al+3 + 1.100Na+ + 4.900H4SiO4 log_k -0.113 delta_h -50.769 #kJ/mol #09bla -analytic -2.3846087E+3 -2.9645291E-1 1.4988094E+5 8.401942E+2 -9.6738611E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Clinozoisite Ca2Al3Si3O12(OH) + 13.000H+ = 3.000Al+3 + 2.000Ca+2 + 3.000H4SiO4 + 1.000H2O log_k 41.904 delta_h -473.273 #kJ/mol #04got -analytic -3.1715578E+3 -4.6903394E-1 2.0085705E+5 1.1313077E+3 -1.0642395E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 04got; S°: 04got; Cp: 04got; V°: 04got; Co(element) Co + 0.500O2 + 2.000H+ = 1.000Co+2 + 1.000H2O log_k 52.733 delta_h -337.363 #kJ/mol #By convention -analytic -4.2222181E+2 -6.5911962E-2 4.0708492E+4 1.5106804E+2 -1.3990067E+6 #References = S°: 87fer, 91din; Cp: 87fer, 91din; V°: 87fer; Co(FeO2)2(alpha) Co(FeO2)2 + 8.000H+ = 1.000Co+2 + 2.000Fe+3 + 4.000H2O log_k 0.775 delta_h -159.200 #kJ/mol #74nau/ryz -analytic -1.3609059E+3 -2.1592327E-1 7.7662036E+4 4.8820401E+2 -3.7735897E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan; Co(OH)2(blue) Co(OH)2 + 2.000H+ = 1.000Co+2 + 2.000H2O log_k 13.801 #References = LogK/DGf: 98ply/zha; #References = LogK/DGf: 98ply/zha; V°: 01mer/vie; Co(OH)2(pink-pc) Co(OH)2 + 2.000H+ = 1.000Co+2 + 2.000H2O log_k 13.205 delta_h -93.560 #kJ/mol #98ply/zha -analytic -3.6762496E+2 -5.0273126E-2 2.3802884E+4 1.3196506E+2 -9.3826672E+5 #References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: 01mer/vie; Co(OH)2(pink-wc) Co(OH)2 + 2.000H+ = 1.000Co+2 + 2.000H2O log_k 12.207 delta_h -88.460 #kJ/mol #98ply/zha -analytic -3.6773008E+2 -5.0273126E-2 2.3536494E+4 1.3196506E+2 -9.3826672E+5 #References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: 01mer/vie; Co2SiO4 Co2SiO4 + 4.000H+ = 2.000Co+2 + 1.000H4SiO4 log_k 7.358 delta_h -97.061 #kJ/mol #82wag/eva -analytic -1.038818E+3 -1.4608633E-1 6.3991738E+4 3.6993709E+2 -3.5808584E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 61kel/kin; V°: 82pan; Co3(PO4)2 Co3(PO4)2 + 4.000H+ = 3.000Co+2 + 2.000H2PO4- log_k 4.360 #References = LogK/DGf: 84vie/tar; #References = LogK/DGf: 84vie/tar; V°: Default value; CoCl2 CoCl2 = 2.000Cl- + 1.000Co+2 log_k 8.474 delta_h -79.220 #kJ/mol #98cha -analytic -1.5576853E+3 -2.5385016E-1 8.897969E+4 5.6601013E+2 -5.0802322E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan; CoCl2:6H2O CoCl2:6H2O = 2.000Cl- + 1.000Co+2 + 6.000H2O log_k -2.534 delta_h 8.060 #kJ/mol #97smi/mar -analytic -1.6775899E+3 -2.4368585E-1 8.9533977E+4 6.0727459E+2 -4.9112606E+6 #References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: 94pan; Coesite(alpha) SiO2 + 2.000H2O = 1.000H4SiO4 log_k -2.910 delta_h 19.112 #kJ/mol #78hel/del -analytic -3.527031E+2 -4.1818062E-2 2.195059E+4 1.2386474E+2 -1.5873687E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; CoF2 CoF2 = 1.000Co+2 + 2.000F- log_k -1.391 delta_h -56.770 #kJ/mol #98cha -analytic -1.6903413E+3 -2.7132141E-1 9.4539877E+4 6.1180182E+2 -5.4319926E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan; CoHPO4 CoHPO4 + 1.000H+ = 1.000Co+2 + 1.000H2PO4- log_k 0.490 #References = LogK/DGf: 84vie/tar; #References = LogK/DGf: 84vie/tar; V°: Default value; Conichalcite CaCuAsO4(OH) + 3.000H+ = 1.000H2AsO4- + 1.000Ca+2 + 1.000Cu+2 + 1.000H2O log_k 1.291 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Connellite Cu37Cl8(SO4)2(OH)62:8H2O + 62.000H+ = 8.000Cl- + 37.000Cu+2 + 2.000SO4-2 + 70.000H2O log_k 188.071 delta_h -1554.399 #kJ/mol #Internal calculation -analytic -2.0100792E+4 -3.0717503E+0 1.1510558E+6 7.2803175E+3 -5.9614214E+7 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam; CoO CoO + 2.000H+ = 1.000Co+2 + 1.000H2O log_k 13.775 delta_h -105.530 #kJ/mol #95rob/hem -analytic -3.2438693E+2 -5.0962961E-2 2.2180786E+4 1.1684824E+2 -9.0419208E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Cooperite PtS + 1.000H+ = 1.000Pt+2 + 1.000HS- log_k -60.932 delta_h 321.919 #kJ/mol #Internal calculation -analytic -9.6572844E+2 -1.5547775E-1 3.5270208E+4 3.5048023E+2 -3.0565786E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Copiapite Fe5(SO4)6(OH)2:20H2O + 2.000H+ = 4.000Fe+3 + 6.000SO4-2 + 1.000Fe+2 + 22.000H2O log_k -16.563 delta_h -206.300 #kJ/mol #02hem/sea -analytic -1.0864336E+4 -1.62485E+0 5.9905788E+5 3.9201601E+3 -3.3531377E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam; Coquimbite Fe2(SO4)3:9H2O = 2.000Fe+3 + 3.000SO4-2 + 9.000H2O log_k -8.976 delta_h -110.290 #kJ/mol #02hem/sea -analytic -5.2353491E+3 -7.8891898E-1 2.8976809E+5 1.8886427E+3 -1.6322713E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam; Cordierite Mg2Al3(AlSi5)O18 + 16.000H+ + 2.000H2O = 4.000Al+3 + 2.000Mg+2 + 5.000H4SiO4 log_k 49.433 delta_h -648.745 #kJ/mol #95rob/hem -analytic -4.3696636E+3 -6.2958321E-1 2.8022776E+5 1.5507866E+3 -1.5147654E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Cordierite(hydrated) Mg2Al3(AlSi5)O18:H2O + 16.000H+ + 1.000H2O = 4.000Al+3 + 2.000Mg+2 + 5.000H4SiO4 log_k 51.683 delta_h -658.326 #kJ/mol #78hel/del -analytic -4.3487968E+3 -6.2643937E-1 2.794002E+5 1.5435514E+3 -1.5047659E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Corkite PbFe3(PO4)(OH)6SO4 + 8.000H+ = 3.000Fe+3 + 1.000H2PO4- + 1.000Pb+2 + 1.000SO4-2 + 6.000H2O log_k -1.943 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Cornetite Cu3PO4(OH)3 + 5.000H+ = 3.000Cu+2 + 1.000H2PO4- + 3.000H2O log_k 15.018 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Corundum(alpha) Al2O3 + 6.000H+ = 2.000Al+3 + 3.000H2O log_k 18.301 delta_h -258.590 #kJ/mol #89cox/wag -analytic -9.4860009E+2 -1.5787708E-1 6.0832419E+4 3.3914801E+2 -2.601091E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Corundum(gamma) Al2O3 + 6.000H+ = 2.000Al+3 + 3.000H2O log_k 21.522 delta_h -277.390 #kJ/mol #89cox/wag -analytic -9.4999225E+2 -1.5841591E-1 6.1869865E+4 3.3969343E+2 -2.6059688E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 78hel/del; CoS(alpha) CoS + 1.000H+ = 1.000Co+2 + 1.000HS- log_k -7.441 delta_h 11.840 #kJ/mol #74nau/ryz -analytic -9.8081985E+2 -1.5438024E-1 5.2331559E+4 3.5505659E+2 -3.0826179E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: 03dea; CoS(beta) CoS + 1.000H+ = 1.000Co+2 + 1.000HS- log_k -11.070 #References = LogK/DGf: 61kel/kin; #References = LogK/DGf: 61kel/kin; V°: 03dea; CoSO4 CoSO4 = 1.000Co+2 + 1.000SO4-2 log_k 3.009 delta_h -78.680 #kJ/mol #98cha -analytic -1.665155E+3 -2.6798638E-1 9.5300782E+4 6.0234072E+2 -5.5139462E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan; Cotunnite PbCl2 = 2.000Cl- + 1.000Pb+2 log_k -4.807 delta_h 26.160 #kJ/mol #98cha -analytic -1.5285737E+3 -2.4847531E-1 8.2798391E+4 5.56649E+2 -5.0890471E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan; Covellite CuS + 1.000H+ = 1.000Cu+2 + 1.000HS- log_k -22.060 delta_h 96.859 #kJ/mol #Internal calculation -analytic -9.6590567E+2 -1.5396697E-1 4.7082597E+4 3.5005256E+2 -3.0532321E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 84pan/stu; V°: 84pan/stu; Cr(element) Cr + 0.500O2 + 2.000H+ = 1.000Cr+2 + 1.000H2O log_k 70.927 delta_h -437.463 #kJ/mol #By convention -analytic -4.1918772E+2 -6.5280642E-2 4.5814893E+4 1.5015581E+2 -1.3900134E+6 #References = S°: 98cha; Cp: 98cha; V°: 95rob/hem; Cr(OH)2(s) Cr(OH)2 + 2.000H+ = 1.000Cr+2 + 2.000H2O log_k 11.002 delta_h -75.446 #kJ/mol #Internal calculation -analytic -3.8162222E+2 -5.2499966E-2 2.3647804E+4 1.3740262E+2 -9.8065626E+5 #References = LogK/DGf: 41hum/sto; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: Default value; Cr(OH)3(s) Cr(OH)3 + 3.000H+ = 1.000Cr+3 + 3.000H2O log_k 9.353 delta_h -115.301 #kJ/mol #Internal calculation -analytic -5.4711646E+2 -7.9193855E-2 3.333245E+4 1.9538296E+2 -1.3492986E+6 #References = LogK/DGf: 87rai/sas; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: Default value; Cr2(SO4)3(s) Cr2(SO4)3 = 2.000Cr+3 + 3.000SO4-2 log_k 4.379 delta_h -277.720 #kJ/mol #91kna/kub -analytic -4.9834942E+3 -8.0843973E-1 2.858872E+5 1.8002483E+3 -1.6405967E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 91kna/kub; S°: 91kna/kub; Cp: 91kna/kub; V°: 94pan; Cr2S3(s) Cr2S3 + 1.000H+ + 0.750H2O = 2.000Cr+2 + 2.500HS- + 0.250S2O3-2 log_k -16.704 delta_h 29.851 #kJ/mol #84pan/stu -analytic -2.5536734E+3 -4.1073391E-1 1.3750673E+5 9.2606397E+2 -8.2897942E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 91kna/kub; V°: 87pan/mah; Crandallite CaAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 1.000Ca+2 + 2.000H2PO4- + 6.000H2O log_k 21.051 #References = LogK/DGf: 79vie/tar; #References = LogK/DGf: 79vie/tar; V°: 63wyc; CrCl2(s) CrCl2 = 2.000Cl- + 1.000Cr+2 log_k 12.744 delta_h -103.560 #kJ/mol #98bal/nor -analytic -1.5567584E+3 -2.5305905E-1 9.0178871E+4 5.6558148E+2 -5.0672435E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98bal/nor; S°: 98bal/nor; Cp: 91kna/kub; V°: 84pan; CrCl3(s) CrCl3 + 0.500H2O = 2.500Cl- + 1.000Cr+2 + 0.500ClO- + 1.000H+ log_k -15.227 delta_h 58.083 #kJ/mol #98bal/nor -analytic -2.1812433E+3 -3.5513694E-1 1.1640242E+5 7.9307607E+2 -7.1942121E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98bal/nor; S°: 98bal/nor; Cp: 91kna/kub; V°: 84pan; Cristobalite(alpha) SiO2 + 2.000H2O = 1.000H4SiO4 log_k -3.158 delta_h 18.829 #kJ/mol #04fab/sax -analytic -3.544017E+2 -4.1702635E-2 2.2114271E+4 1.2427357E+2 -1.6001472E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04fab/sax; S°: 04fab/sax; Cp: 04fab/sax; V°: 04fab/sax; Cristobalite(beta) SiO2 + 2.000H2O = 1.000H4SiO4 log_k -3.096 #delta_h 0.000 #kJ/mol -analytic -3.6088361E+2 -4.1957223E-2 2.2873339E+4 1.2628239E+2 -1.6799304E+6 #References = LogK/DGf: Internal calculation; Cp: 04fab/sax; V°: 04fab/sax; CrO2(s) CrO2 + 3.000H+ = 1.000Cr+3 + 0.250O2 + 1.500H2O log_k 0.443 delta_h -74.378 #kJ/mol #04chi -analytic -4.2881145E+2 -7.0876056E-2 2.4921682E+4 1.5330843E+2 -1.1158625E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 93bar; V°: 92wol; CrO3(s) CrO3 + 1.000H2O = 1.000CrO4-2 + 2.000H+ log_k -3.019 delta_h -10.070 #kJ/mol #98bal/nor -analytic -1.2674558E+3 -2.0965617E-1 7.0660776E+4 4.6023827E+2 -4.3451972E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98bal/nor; S°: 98bal/nor; Cp: 91kna/kub; V°: 92wol; Crocoite PbCrO4 = 1.000CrO4-2 + 1.000Pb+2 log_k -12.550 delta_h 48.940 #kJ/mol #76del/hep -analytic -1.5708609E+3 -2.5330557E-1 8.4654283E+4 5.6987411E+2 -5.35265E+6 #References = LogK/DGf: 42kol/per; DHf/DHr: 76del/hep; S°: Internal calculation; Cp: 74nau/ryz; V°: 00lyd; Cronstedtite(Th) Fe3SiAlO5(OH)4 + 10.000H+ = 1.000Al+3 + 2.000Fe+2 + 1.000H4SiO4 + 1.000Fe+3 + 5.000H2O log_k 96.643 delta_h -738.731 #kJ/mol #15bla/vie -analytic -2.0074006E+3 -2.9853864E-1 1.4641628E+5 7.1605734E+2 -6.2107203E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; CrPO4(green) CrPO4 + 2.000H+ = 1.000Cr+3 + 1.000H2PO4- log_k -5.326 #References = LogK/DGf: 51zha; #References = LogK/DGf: 51zha; V°: Default value; CrPO4(purple) CrPO4 + 2.000H+ = 1.000Cr+3 + 1.000H2PO4- log_k 0.298 #References = LogK/DGf: 51zha; #References = LogK/DGf: 51zha; V°: Default value; CrS(s) CrS + 1.000H+ = 1.000Cr+2 + 1.000HS- log_k 1.675 delta_h -38.860 #kJ/mol #84pan/stu -analytic -9.6517921E+2 -1.5487857E-1 5.4210441E+4 3.4989438E+2 -3.0741518E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 91kna/kub; V°: 87pan/mah; Cu(element) Cu + 0.500O2 + 2.000H+ = 1.000Cu+2 + 1.000H2O log_k 31.601 delta_h -214.586 #kJ/mol #By convention -analytic -4.2540758E+2 -6.5327607E-2 3.438206E+4 1.5224054E+2 -1.3815072E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Cu(OH)2 Cu(OH)2 + 2.000H+ = 1.000Cu+2 + 2.000H2O log_k 8.672 delta_h -62.658 #kJ/mol #Internal calculation -analytic -3.3666279E+2 -4.9930343E-2 2.0701537E+4 1.216584E+2 -9.1093669E+5 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 98cha; Cp: 98cha; V°: 84pan/stu; Cu2SO4 Cu2SO4 = 2.000Cu+ + 1.000SO4-2 log_k -1.387 delta_h -16.749 #kJ/mol #00pui -analytic -1.568224E+3 -2.4863101E-1 8.6685802E+4 5.6885969E+2 -5.1011532E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 00pui; S°: 00pui; Cp: 84pan/stu; V°: 84pan/stu; Cu2SO5 Cu2SO5 + 2.000H+ = 2.000Cu+2 + 1.000SO4-2 + 1.000H2O log_k 10.304 delta_h -137.222 #kJ/mol #00pui -analytic -1.9974029E+3 -3.1787668E-1 1.1581856E+5 7.220889E+2 -6.4658431E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 00pui; S°: 00pui; Cp: 98cha; V°: 98cha; Cu3(PO4)2 Cu3(PO4)2 + 4.000H+ = 3.000Cu+2 + 2.000H2PO4- log_k 2.210 delta_h -154.596 #kJ/mol #Internal calculation -analytic -2.2061797E+3 -3.5165658E-1 1.256368E+5 7.9556988E+2 -6.8214649E+6 #References = LogK/DGf: 84vie/tar; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value; Cu3(PO4)2:3H2O Cu3(PO4)2:3H2O + 4.000H+ = 3.000Cu+2 + 2.000H2PO4- + 3.000H2O log_k 3.983 delta_h -142.084 #kJ/mol #Internal calculation -analytic -2.23932E+3 -3.5189206E-1 1.266151E+5 8.0837746E+2 -6.8205072E+6 #References = LogK/DGf: 84vie/tar; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value; Cu4(NO3)2(OH)6 Cu4(NO3)2(OH)6 + 6.000H+ = 4.000Cu+2 + 2.000NO3- + 6.000H2O log_k 14.506 delta_h -104.797 #kJ/mol #Internal calculation -analytic -2.5319236E+3 -3.9091715E-1 1.4171661E+5 9.1929025E+2 -7.7392407E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value; CuCO3 CuCO3 + 1.000H+ = 1.000HCO3- + 1.000Cu+2 log_k -1.120 delta_h -19.417 #kJ/mol #Internal calculation -analytic -9.2672644E+2 -1.4906832E-1 5.0839146E+4 3.363369E+2 -2.9075173E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value; CuF CuF = 1.000Cu+ + 1.000F- log_k -4.712 delta_h 15.552 #kJ/mol #84pan/stu -analytic -7.9465013E+2 -1.2605589E-1 4.2204908E+4 2.8862734E+2 -2.508921E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 09hon; CuF2 CuF2 = 1.000Cu+2 + 2.000F- log_k 1.114 delta_h -66.622 #kJ/mol #84pan/stu -analytic -1.6993335E+3 -2.7172344E-1 9.5414751E+4 6.1527418E+2 -5.4239539E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu; CuF2:2H2O CuF2:2H2O = 1.000Cu+2 + 2.000F- + 2.000H2O log_k -4.548 delta_h -15.030 #kJ/mol #Internal calculation -analytic -1.6994665E+3 -2.6788903E-1 9.2886119E+4 6.158373E+2 -5.3870415E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 07gre/per; Cummingtonite Mg7Si8O22(OH)2 + 14.000H+ + 8.000H2O = 7.000Mg+2 + 8.000H4SiO4 log_k 76.152 delta_h -596.457 #kJ/mol #98hol/pow -analytic -5.2421442E+3 -6.9998733E-1 3.3979766E+5 1.8611863E+3 -1.9385351E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Cuprite Cu2O + 2.000H+ = 2.000Cu+ + 1.000H2O log_k -1.470 delta_h 25.915 #kJ/mol #95rob/hem -analytic -2.0387364E+2 -2.8150991E-2 8.6475258E+3 7.5329242E+1 -4.0932625E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 98cha; V°: 78hel/del; Dawsonite NaAlCO3(OH)2 + 3.000H+ = 1.000Al+3 + 1.000HCO3- + 1.000Na+ + 2.000H2O log_k 4.327 delta_h -76.330 #kJ/mol #76fer/stu -analytic -1.21599E+3 -1.9110794E-1 6.8919359E+4 4.3970018E+2 -3.7220307E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 76fer/stu; S°: 76fer/stu; Cp: 76fer/stu; V°: 95rob/hem; Diaspore AlO(OH) + 3.000H+ = 1.000Al+3 + 2.000H2O log_k 6.866 delta_h -108.760 #kJ/mol #95rob/hem -analytic -4.8201662E+2 -7.7930965E-2 2.9964822E+4 1.7237439E+2 -1.3257386E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del; Dickite Al2Si2O5(OH)4 + 6.000H+ = 2.000Al+3 + 2.000H4SiO4 + 1.000H2O log_k 9.397 delta_h -180.552 #kJ/mol #06bla/pia -analytic -1.6638485E+3 -2.4070345E-1 1.0291406E+5 5.916831E+2 -5.7109981E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 06bla/pia; S°: 06bla/pia; Cp: 06bla/pia; V°: 78hel/del,78rob/hem; Diopside CaMg(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Ca+2 + 1.000Mg+2 + 2.000H4SiO4 log_k 21.743 delta_h -153.574 #kJ/mol #Internal calculation -analytic -1.332806E+3 -1.8198553E-1 8.603858E+4 4.749095E+2 -4.8802351E+6 #References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Djurleite Cu1.934S + 1.000H+ = 1.868Cu+ + 0.066Cu+2 + 1.000HS- log_k -33.330 delta_h 196.825 #kJ/mol #Internal calculation -analytic -8.6915401E+2 -1.3576764E-1 3.6697803E+4 3.1661699E+2 -2.6872489E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 00pui; V°: 95rob/hem; Dolomite CaMg(CO3)2 + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 1.000Mg+2 log_k 3.533 delta_h -65.360 #kJ/mol #95rob/hem -analytic -1.7923552E+3 -2.8963391E-1 9.9594038E+4 6.511419E+2 -5.6008136E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del,92ajoh; Dolomite(disordered) CaMg(CO3)2 + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 1.000Mg+2 log_k 4.299 delta_h -73.162 #kJ/mol #78hel/del,92ajoh -analytic -1.7814432E+3 -2.8852695E-1 9.9263747E+4 6.4714027E+2 -5.5533944E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,92ajoh; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Dolomite(ordered) CaMg(CO3)2 + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 1.000Mg+2 log_k 2.754 delta_h -60.916 #kJ/mol #78hel/del,92ajoh -analytic -1.792373E+3 -2.8963681E-1 9.9362832E+4 6.5114844E+2 -5.6008636E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,92ajoh; S°: 78hel/del,92ajoh; Cp: 95rob/hem; V°: 78hel/del,92ajoh; Doralcharite TlFe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 2.000SO4-2 + 1.000Tl+ + 6.000H2O log_k -2.221 delta_h -230.910 #kJ/mol #09xio -analytic -4.2350425E+3 -6.7654413E-1 2.4158966E+5 1.5269473E+3 -1.3697943E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 09xio; S°: 09xio; Cp: 84pan/stu; V°: 84pan/stu; Duftite PbCuAsO4(OH) + 3.000H+ = 1.000H2AsO4- + 1.000Cu+2 + 1.000Pb+2 + 1.000H2O log_k -1.974 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Eastonite KMg2Al3Si2O10(OH)2 + 14.000H+ = 3.000Al+3 + 1.000K+ + 2.000Mg+2 + 2.000H4SiO4 + 4.000H2O log_k 46.313 delta_h -513.442 #kJ/mol #98hol/pow -analytic -3.0257344E+3 -4.5185951E-1 1.9137182E+5 1.0805094E+3 -9.6667032E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow; Edenite(alpha) Na(Ca2Mg5)(AlSi7)O22(OH)2 + 18.000H+ + 4.000H2O = 1.000Al+3 + 2.000Ca+2 + 5.000Mg+2 + 1.000Na+ + 7.000H4SiO4 log_k 81.946 delta_h -679.296 #kJ/mol #97got -analytic -5.4623009E+3 -7.5241996E-1 3.5051336E+5 1.9444511E+3 -1.942E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 97got; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Enstatite(alpha) MgSiO3 + 2.000H+ + 1.000H2O = 1.000Mg+2 + 1.000H4SiO4 log_k 11.844 delta_h -93.265 #kJ/mol #78hel/del -analytic -7.0139177E+2 -9.4618096E-2 4.5846726E+4 2.4912172E+2 -2.5565294E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Epidote Ca2FeAl2Si3O12(OH) + 13.000H+ = 2.000Al+3 + 2.000Ca+2 + 1.000Fe+3 + 3.000H4SiO4 + 1.000H2O log_k 32.230 delta_h -411.613 #kJ/mol #04got -analytic -3.1567388E+3 -4.6487997E-1 1.9676775E+5 1.1260692E+3 -1.0558252E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 04got; S°: 04got; Cp: 04got; V°: 04got; Epsomite MgSO4:7H2O = 1.000Mg+2 + 1.000SO4-2 + 7.000H2O log_k -1.873 delta_h 10.991 #kJ/mol #Internal calculation -analytic -1.6988081E+3 -2.5721818E-1 9.2712801E+4 6.1577249E+2 -5.4246599E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 95rob/hem; Erdite NaFeS2:2H2O + 0.875H+ = 1.000Fe+2 + 1.000Na+ + 1.875HS- + 0.125SO4-2 + 1.500H2O log_k -5.500 delta_h 27.385 #kJ/mol #14las/pia -analytic -1.8074895E+3 -2.8349252E-1 9.7609895E+4 6.5664586E+2 -5.8402468E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14las/pia; S°: 14las/pia; Cp: 14las/pia; V°: 14las/pia; Eskolaite Cr2O3 + 6.000H+ = 2.000Cr+3 + 3.000H2O log_k 7.756 delta_h -197.990 #kJ/mol #04chi -analytic -9.8817895E+2 -1.5834184E-1 6.0401277E+4 3.5225212E+2 -2.7616883E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 98cha; V°: 82pan; Ettringite Ca6Al2(SO4)3(OH)12:26H2O + 12.000H+ = 2.000Al+3 + 6.000Ca+2 + 3.000SO4-2 + 38.000H2O log_k 57.009 delta_h -379.834 #kJ/mol #63ber/new -analytic -6.6745712E+3 -1.0474291E+0 3.7870629E+5 2.4266186E+3 -2.0518895E+7 #References = LogK/DGf: 10bbla/bou; DHf/DHr: 63ber/new; S°: Internal calculation; Cp: 79ede/sat; V°: 70moo/tay; Ettringite(Cr) Ca6Al2(OH)12(CrO4)3:26H2O + 12.000H+ = 2.000Al+3 + 6.000Ca+2 + 3.000CrO4-2 + 38.000H2O log_k 60.279 delta_h -503.048 #kJ/mol #00per/pal -analytic -6.462794E+3 -1.0029528E+0 3.7372626E+5 2.3408513E+3 -1.9882337E+7 #References = LogK/DGf: 00per/pal; DHf/DHr: 00per/pal; S°: Internal calculation; Cp: 00per/pal; V°: 70moo/tay; Ettringite(Fe) Ca6Fe2(SO4)3(OH)12:26H2O + 12.000H+ = 6.000Ca+2 + 2.000Fe+3 + 3.000SO4-2 + 38.000H2O log_k 54.589 delta_h -344.348 #kJ/mol #Internal calculation -analytic -6.6148727E+3 -1.0245412E+0 3.7573238E+5 2.4027407E+3 -2.0508554E+7 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 98gla/tyr; Farringtonite Mg3(PO4)2 + 4.000H+ = 3.000Mg+2 + 2.000H2PO4- log_k 15.820 delta_h -214.093 #kJ/mol #Internal calculation -analytic -2.1864544E+3 -3.5145069E-1 1.2767723E+5 7.9006079E+2 -6.7671011E+6 #References = LogK/DGf: 68rac/sop; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 63oet/mdo; V°: 84nri; Faustite ZnAl6(PO4)4(OH)8:4H2O + 16.000H+ = 6.000Al+3 + 4.000H2PO4- + 1.000Zn+2 + 12.000H2O log_k 19.627 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Fayalite Fe2SiO4 + 4.000H+ = 2.000Fe+2 + 1.000H4SiO4 log_k 19.030 delta_h -157.157 #kJ/mol #Internal calculation -analytic -1.0258478E+3 -1.4618015E-1 6.6129821E+4 3.6618221E+2 -3.5053712E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Fe(element) Fe + 0.500O2 + 2.000H+ = 1.000Fe+2 + 1.000H2O log_k 58.856 delta_h -369.763 #kJ/mol #By convention -analytic -4.2248325E+2 -6.5961519E-2 4.2457852E+4 1.5130357E+2 -1.4036127E+6 #References = S°: 95par/kho; Cp: 98cha; V°: 04fab/sax; Fe(OH)2 Fe(OH)2 + 2.000H+ = 1.000Fe+2 + 2.000H2O log_k 12.852 delta_h -88.121 #kJ/mol #Internal calculation -analytic -3.3299984E+2 -5.0831539E-2 2.190257E+4 1.2042336E+2 -9.2751796E+5 #References = LogK/DGf: 53leu/kho; DHf/DHr: Internal calculation; S°: 04chi; Cp: 98cha; V°: 01mer/vie; Fe10S11 Fe10S11 + 9.000H+ + 0.750H2O = 10.000Fe+2 + 10.500HS- + 0.250S2O3-2 log_k -59.393 delta_h 28.630 #kJ/mol #05wal/pel -analytic -1.0231691E+4 -1.6418452E+0 5.5394991E+5 3.7077556E+3 -3.2956546E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla; Fe11S12 Fe11S12 + 10.000H+ + 0.750H2O = 11.000Fe+2 + 11.500HS- + 0.250S2O3-2 log_k -64.318 delta_h 21.930 #kJ/mol #05wal/pel -analytic -1.1193273E+4 -1.7956615E+0 6.0638077E+5 4.0558402E+3 -3.6036712E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla; Fe2(SO4)3 Fe2(SO4)3 = 2.000Fe+3 + 3.000SO4-2 log_k 0.038 delta_h -240.820 #kJ/mol #05maj/nav -analytic -5.0254612E+3 -8.1192986E-1 2.8639592E+5 1.8156889E+3 -1.6516778E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05maj/nav; S°: 05maj/nav; Cp: 02hem/sea; V°: 95rob/hem; Fe7.016S8 Fe7.016S8 + 6.032H+ + 0.738H2O = 7.016Fe+2 + 7.508HS- + 0.246S2O3-2 log_k -47.307 delta_h 52.039 #kJ/mol #05wal/pel -analytic -7.4346812E+3 -1.2000209E+0 3.9979108E+5 2.6965143E+3 -2.3831792E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla; Fe9S10 Fe9S10 + 8.000H+ + 0.750H2O = 9.000Fe+2 + 9.500HS- + 0.250S2O3-2 log_k -55.460 delta_h 37.210 #kJ/mol #05wal/pel -analytic -9.2707725E+3 -1.4880288E+0 5.0142086E+5 3.359671E+3 -2.9876381E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla; FeCl2 FeCl2 = 2.000Cl- + 1.000Fe+2 log_k 8.981 delta_h -83.000 #kJ/mol #95par/kho -analytic -1.5585061E+3 -2.5365884E-1 8.9252888E+4 5.661784E+2 -5.085739E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95par/kho; S°: 95par/kho; Cp: 98cha; V°: 95rob/hem; FeCl2:2H2O FeCl2:2H2O = 2.000Cl- + 1.000Fe+2 + 2.000H2O log_k 4.361 delta_h -44.808 #kJ/mol #08bla -analytic -1.6107676E+3 -2.4925728E-1 8.9551087E+4 5.8420437E+2 -5.0213153E+6 #References = LogK/DGf: 08bla; DHf/DHr: 08bla; S°: Internal calculation; V°: 63wyc; FeCl2:4H2O FeCl2:4H2O = 2.000Cl- + 1.000Fe+2 + 4.000H2O log_k 3.034 delta_h -24.776 #kJ/mol #08bla -analytic -1.7163246E+3 -2.582723E-1 9.3684709E+4 6.2250208E+2 -5.1734509E+6 #References = LogK/DGf: 04chr; DHf/DHr: 08bla; S°: Internal calculation; V°: Default value; FeCl2:H2O FeCl2:H2O = 2.000Cl- + 1.000Fe+2 + 1.000H2O log_k 6.114 delta_h -63.904 #kJ/mol #08bla -analytic -1.6403139E+3 -2.5803682E-1 9.219673E+4 5.9502136E+2 -5.1744086E+6 #References = LogK/DGf: 08bla; DHf/DHr: 08bla; S°: Internal calculation; V°: Default value; FeCl3 FeCl3 + 0.500H2O = 2.500Cl- + 1.000Fe+2 + 0.500ClO- + 1.000H+ log_k -2.348 delta_h -22.957 #kJ/mol #95par/kho -analytic -2.1900087E+3 -3.5702059E-1 1.2100306E+5 7.9592707E+2 -7.2189736E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95par/kho; S°: 95par/kho; Cp: 98cha; V°: 95rob/hem; FeCl3:6H2O FeCl3:6H2O = 3.000Cl- + 1.000Fe+3 + 6.000H2O log_k 11.376 delta_h -54.500 #kJ/mol #08bla -analytic -2.4628446E+3 -3.7358238E-1 1.3547843E+5 8.9509667E+2 -7.436022E+6 #References = LogK/DGf: 95par/kho; DHf/DHr: 08bla; S°: Internal calculation; V°: 63wyc; FeO FeO + 2.000H+ = 1.000Fe+2 + 1.000H2O log_k 13.359 delta_h -103.790 #kJ/mol #98cha -analytic -3.3327288E+2 -5.1539534E-2 2.2778307E+4 1.1977513E+2 -9.5795774E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem; Ferricopiapite Fe5(SO4)6O(OH):20H2O + 3.000H+ = 5.000Fe+3 + 6.000SO4-2 + 22.000H2O log_k -20.491 delta_h -222.300 #kJ/mol #02hem/sea -analytic -1.1028378E+4 -1.653793E+0 6.0791316E+5 3.9784177E+3 -3.3985772E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam; Ferrihydrite(2L) Fe(OH)3 + 3.000H+ = 1.000Fe+3 + 3.000H2O log_k 3.403 delta_h -79.390 #kJ/mol #04maj/nav -analytic -4.8305058E+2 -7.3766353E-2 2.8359549E+4 1.7273465E+2 -1.2526817E+6 #References = LogK/DGf: 04maj/nav; DHf/DHr: 04maj/nav; S°: Internal calculation; Cp: 98cha; V°: 92wol; Ferrihydrite(6L) Fe(OH)3 + 3.000H+ = 1.000Fe+3 + 3.000H2O log_k 3.003 delta_h -76.190 #kJ/mol #04maj/nav -analytic -4.8288997E+2 -7.3766353E-2 2.8192403E+4 1.7273465E+2 -1.2526817E+6 #References = LogK/DGf: 04maj/nav; DHf/DHr: 04maj/nav; S°: Internal calculation; Cp: 98cha; V°: 92wol; Ferrite(Mn) MnFe2O4 + 8.000H+ = 2.000Fe+3 + 1.000Mn+2 + 4.000H2O log_k 14.909 delta_h -233.808 #kJ/mol #91kna/kub -analytic -1.3969262E+3 -2.1048378E-1 8.3432651E+4 4.9991008E+2 -3.7546979E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 91kna/kub; S°: 91kna/kub; V°: 63wyc; Ferrohexahydrite FeSO4:6H2O = 1.000Fe+2 + 1.000SO4-2 + 6.000H2O log_k -2.523 delta_h 5.080 #kJ/mol #02hem/sea -analytic -1.7860196E+3 -2.5570246E-1 9.6570679E+4 6.4508358E+2 -5.3676223E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 63wyc; Ferropargasite Na(Ca2Fe4Al)(Al2Si6)O22(OH)2 + 22.000H+ = 3.000Al+3 + 2.000Ca+2 + 4.000Fe+2 + 1.000Na+ + 6.000H4SiO4 log_k 83.843 delta_h -811.949 #kJ/mol #Internal calculation -analytic -5.6904992E+3 -8.1766908E-1 3.6331793E+5 2.0284623E+3 -1.9533576E+7 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Ferrosilite(alpha) FeSiO3 + 2.000H+ + 1.000H2O = 1.000Fe+2 + 1.000H4SiO4 log_k 8.053 delta_h -67.838 #kJ/mol #78hel/del,85hel -analytic -6.6565871E+2 -9.1071991E-2 4.2608236E+4 2.3669255E+2 -2.4644786E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,85hel; S°: 78hel/del,85hel; Cp: 78hel/del,85hel; V°: 78hel/del,85hel; Ferrotremolite (Ca2Fe5)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 2.000Ca+2 + 5.000Fe+2 + 8.000H4SiO4 log_k 53.699 delta_h -412.225 #kJ/mol #Internal calculation -analytic -4.942592E+3 -6.6976495E-1 3.1400258E+5 1.7585882E+3 -1.8552107E+7 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; FeS(am) FeS + 1.000H+ = 1.000Fe+2 + 1.000HS- log_k -2.990 delta_h -13.944 #kJ/mol #Internal calculation -analytic -9.7855105E+2 -1.5384713E-1 5.3595697E+4 3.541519E+2 -3.0806961E+6 #References = LogK/DGf: 08bla; DHf/DHr: Internal calculation; S°: 08bla; V°: 08bla; FeSO4 FeSO4 = 1.000Fe+2 + 1.000SO4-2 log_k 1.105 delta_h -67.140 #kJ/mol #02hem/sea -analytic -1.6664998E+3 -2.6803306E-1 9.4748784E+4 6.0285988E+2 -5.5121092E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; Cp: 98cha; V°: 01mer/vie; Florencite CeAl3(PO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 1.000Ce+3 + 2.000H2PO4- + 6.000H2O log_k 16.579 delta_h -387.869 #kJ/mol #Internal calculation -analytic -3.2764273E+3 -5.1637881E-1 1.9220932E+5 1.1768428E+3 -9.7541791E+6 #References = LogK/DGf: 93sch/got; DHf/DHr: Internal calculation; S°: 93sch/got; Cp: 93sch/got; V°: 93sch/got; Florencite(La) LaAl3(PO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 1.000La+3 + 2.000H2PO4- + 6.000H2O log_k 18.176 #References = LogK/DGf: 93sch/got; #References = LogK/DGf: 93sch/got; V°: Default value; Fluorapatite(Natur) Ca5(PO4)3F + 6.000H+ = 5.000Ca+2 + 1.000F- + 3.000H2PO4- log_k -0.910 delta_h -115.601 #kJ/mol #Internal calculation -analytic -3.7675938E+3 -6.2227437E-1 2.0719593E+5 1.369906E+3 -1.1775417E+7 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 71par/wag; Cp: 60kel; V°: 95rob/hem; Fluorite CaF2 = 1.000Ca+2 + 2.000F- log_k -10.510 delta_h 14.561 #kJ/mol #Internal calculation -analytic -1.6496805E+3 -2.6611418E-1 8.8752676E+4 5.9836725E+2 -5.3146007E+6 #References = LogK/DGf: 04gar/muc; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Fluorphlogopite KMg3(AlSi3)O10(F)2 + 8.000H+ + 2.000H2O = 1.000Al+3 + 2.000F- + 1.000K+ + 3.000Mg+2 + 3.000H4SiO4 log_k 24.017 delta_h -311.663 #kJ/mol #95rob/hem -analytic -3.942573E+3 -5.8323303E-1 2.3765657E+5 1.4124165E+3 -1.3472307E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del,78rob/hem; Cp: 78hel/del,78rob/hem; V°: 78hel/del,78rob/hem; Forsterite Mg2SiO4 + 4.000H+ = 2.000Mg+2 + 1.000H4SiO4 log_k 28.609 delta_h -217.115 #kJ/mol #Internal calculation -analytic -1.0983766E+3 -1.5385695E-1 7.321503E+4 3.91599E+2 -3.7061609E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Foshagite Ca4Si3O9(OH)2:0.5H2O + 8.000H+ + 0.500H2O = 4.000Ca+2 + 3.000H4SiO4 log_k 65.959 delta_h -373.238 #kJ/mol #56new -analytic -2.2772909E+3 -3.0919715E-1 1.5248108E+5 8.1483143E+2 -8.1989745E+6 #References = LogK/DGf: 10abla/bou; DHf/DHr: 56new; S°: Internal calculation; Cp: 10abla/bou; V°: 63wyc; Friedel_Salt Ca4Al2Cl2O6:10H2O + 12.000H+ = 2.000Al+3 + 4.000Ca+2 + 2.000Cl- + 16.000H2O log_k 74.946 delta_h -486.198 #kJ/mol #10bbla/bou -analytic -3.3745929E+3 -5.3105384E-1 2.0377591E+5 1.2270148E+3 -9.9349994E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: 10bbla/bou; S°: Internal calculation; Cp: 10bbla/bou; V°: 97tay; Galena PbS + 1.000H+ = 1.000Pb+2 + 1.000HS- log_k -14.835 delta_h 82.940 #kJ/mol #98cha -analytic -9.2559024E+2 -1.4783405E-1 4.6673721E+4 3.3654235E+2 -3.0637176E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 78hel/del; Gallobeudantite PbGa3(AsO4)(SO4)(OH)6 + 8.000H+ = 1.000H2AsO4- + 3.000Ga+3 + 1.000Pb+2 + 1.000SO4-2 + 6.000H2O log_k -8.694 #References = LogK/DGf: 04gab/vie; #References = LogK/DGf: 04gab/vie; V°: Default value; GaOOH GaOOH + 3.000H+ = 1.000Ga+3 + 2.000H2O log_k 1.487 delta_h -42.093 #kJ/mol #Internal calculation -analytic 9.5782754E+2 1.7552134E-1 -4.6284848E+4 -3.5697837E+2 2.6568082E+6 #References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia; Gaylussite CaNa2(CO3)2:5H2O + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 2.000Na+ + 5.000H2O log_k 11.229 delta_h 1.696 #kJ/mol #Internal calculation -analytic -1.8466947E+3 -2.5990269E-1 9.946122E+4 6.7151642E+2 -5.3162171E+6 #References = LogK/DGf: 99kon/kon; DHf/DHr: Internal calculation; S°: 99kon/kon; V°: 63wyc; Gehlenite Ca2(Al2Si)O7 + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 1.000H4SiO4 + 3.000H2O log_k 55.240 delta_h -494.151 #kJ/mol #95rob/hem -analytic -1.8832924E+3 -2.9157019E-1 1.2620693E+5 6.7395732E+2 -5.8224906E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Gibbsite Al(OH)3 + 3.000H+ = 1.000Al+3 + 3.000H2O log_k 7.738 delta_h -102.759 #kJ/mol #Internal calculation -analytic -4.9375037E+2 -8.0899785E-2 2.9713754E+4 1.779027E+2 -1.2676533E+6 #References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 78hel/del; Gibbsite(am) Al(OH)3 + 3.000H+ = 1.000Al+3 + 3.000H2O log_k 10.578 delta_h -119.770 #kJ/mol #93bar -analytic -5.1603622E+2 -7.6452847E-2 3.2063453E+4 1.8448125E+2 -1.2995608E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 93bar; S°: 93bar; V°: 78hel/del; Gibbsite(mc) Al(OH)3 + 3.000H+ = 1.000Al+3 + 3.000H2O log_k 9.353 delta_h -102.510 #kJ/mol #90nor/plu -analytic -5.1423761E+2 -7.6452847E-2 3.1161906E+4 1.8448125E+2 -1.2995608E+6 #References = LogK/DGf: 90nor/plu; DHf/DHr: 90nor/plu; S°: Internal calculation; V°: 78hel/del; Gismondine Ca2Al4Si4O16:9H2O + 16.000H+ = 4.000Al+3 + 2.000Ca+2 + 4.000H4SiO4 + 9.000H2O log_k 39.004 delta_h -467.714 #kJ/mol #08bla -analytic -4.0017219E+3 -5.8056754E-1 2.4734497E+5 1.428423E+3 -1.3362172E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 08bla; S°: 10vie; Cp: 10vie; V°: 97coo/alb; Glaserite Na2K6(SO4)4 = 6.000K+ + 2.000Na+ + 4.000SO4-2 log_k -7.610 delta_h 78.360 #kJ/mol #82wag/eva -analytic -6.2606413E+3 -9.6072249E-1 3.4398961E+5 2.2709666E+3 -2.0768609E+7 #References = LogK/DGf: 80har/wea; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: 63wyc; Glauberite Na2Ca(SO4)2 = 1.000Ca+2 + 2.000Na+ + 2.000SO4-2 log_k 1.970 delta_h -13.160 #kJ/mol #82wag/eva -analytic -3.3021161E+3 -5.1053089E-1 1.8312273E+5 1.1978285E+3 -1.0831151E+7 #References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: 63wyc; Glauconite (K0.75Mg0.25Fe1.5Al0.25)(Al0.25Si3.75)O10(OH)2 + 7.000H+ + 3.000H2O = 0.500Al+3 + 1.250Fe+3 + 0.750K+ + 0.250Mg+2 + 3.750H4SiO4 + 0.250Fe+2 log_k 1.873 delta_h -120.903 #kJ/mol #15bla/vie -analytic -2.3976207E+3 -3.2091227E-1 1.4807364E+5 8.4865741E+2 -9.0151175E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Glaucophane Na2(Mg3Al2)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 2.000Al+3 + 3.000Mg+2 + 2.000Na+ + 8.000H4SiO4 log_k 37.026 delta_h -378.727 #kJ/mol #95rob/hem -analytic -5.095188E+3 -6.8518568E-1 3.2040873E+5 1.8087612E+3 -1.9006796E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Goethite FeOOH + 3.000H+ = 1.000Fe+3 + 2.000H2O log_k 0.362 delta_h -60.660 #kJ/mol #03maj/gre -analytic -4.9687107E+2 -8.1269723E-2 2.7746417E+4 1.789779E+2 -1.2860575E+6 #References = LogK/DGf: 95par/kho; DHf/DHr: 03maj/gre; S°: Internal calculation; Cp: 03maj/gre; V°: 95rob/hem; Gorceixite BaAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 1.000Ba+2 + 2.000H2PO4- + 6.000H2O log_k 13.706 #References = LogK/DGf: 89sch/her; #References = LogK/DGf: 89sch/her; V°: Default value; Goyazite SrAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2PO4- + 1.000Sr+2 + 6.000H2O log_k 16.848 delta_h -334.188 #kJ/mol #Internal calculation -analytic -3.0527103E+3 -4.7785773E-1 1.7704657E+5 1.0986155E+3 -8.9105125E+6 #References = LogK/DGf: 89sch/her; DHf/DHr: Internal calculation; S°: 04gab/vie; Cp: 04gab/vie; V°: 04gab/vie; Greenalite Fe3Si2O5(OH)4 + 6.000H+ = 3.000Fe+2 + 2.000H4SiO4 + 1.000H2O log_k 21.774 delta_h -172.552 #kJ/mol #83miy/kle -analytic -1.7299665E+3 -2.4007877E-1 1.0801798E+5 6.1781495E+2 -6.0195713E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 83miy/kle; S°: 83miy/kle; Cp: 83miy/kle; V°: 78hel/del; Greenockite CdS + 1.000H+ = 1.000Cd+2 + 1.000HS- log_k -14.820 delta_h 56.570 #kJ/mol #06deo/nav -analytic -9.3406918E+2 -1.4889926E-1 4.7625641E+4 3.3842223E+2 -2.9776997E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 06deo/nav; S°: 06bla/pia; Cp: 99yun/glu; V°: 95rob/hem; Greenrust(Cl) Fe4(OH)8Cl + 8.000H+ = 1.000Cl- + 3.000Fe+2 + 1.000Fe+3 + 8.000H2O log_k 32.324 #References = LogK/DGf: 04chi; #References = LogK/DGf: 04chi; V°: Default value; Greenrust(CO3) Fe6(OH)12CO3:2H2O + 13.000H+ = 1.000HCO3- + 4.000Fe+2 + 2.000Fe+3 + 14.000H2O log_k 45.336 #References = LogK/DGf: 04chi; #References = LogK/DGf: 04chi; V°: Default value; Greenrust(OH) Fe3O2(OH)4 + 8.000H+ = 2.000Fe+3 + 1.000Fe+2 + 6.000H2O log_k 17.177 #References = LogK/DGf: 04chi; #References = LogK/DGf: 04chi; V°: Default value; Greenrust(SO3) Fe8(OH)16SO3:4H2O + 14.000H+ = 8.000Fe+2 + 1.000SO4-2 + 19.000H2O log_k 89.176 #References = LogK/DGf: 04chi; #References = LogK/DGf: 04chi; V°: Default value; Greenrust2(SO4) Fe6(OH)12SO4:2H2O + 12.000H+ = 4.000Fe+2 + 1.000SO4-2 + 2.000Fe+3 + 14.000H2O log_k 37.501 #References = LogK/DGf: 04chi; #References = LogK/DGf: 04chi; V°: Default value; Greigite Fe3S4 + 2.000H+ + 0.750H2O = 3.000Fe+2 + 3.500HS- + 0.250S2O3-2 log_k -21.889 delta_h 35.262 #kJ/mol #08bla -analytic -3.5543818E+3 -5.6187424E-1 1.9110521E+5 1.2878114E+3 -1.1339225E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 08bla; S°: 08bla; V°: 90rob/cam; Grossular Ca3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Ca+2 + 3.000H4SiO4 log_k 49.372 delta_h -442.383 #kJ/mol #95rob/hem -analytic -2.9566754E+3 -4.3410622E-1 1.8868769E+5 1.057027E+3 -1.0038715E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Grunerite Fe7Si8O22(OH)2 + 14.000H+ + 8.000H2O = 7.000Fe+2 + 8.000H4SiO4 log_k 48.038 delta_h -391.247 #kJ/mol #95rob/hem -analytic -5.050855E+3 -6.8320226E-1 3.187714E+5 1.7966553E+3 -1.8870364E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Guerinite Ca5H2(AsO4)4:9H2O + 6.000H+ = 4.000H2AsO4- + 5.000Ca+2 + 9.000H2O log_k 19.689 #References = LogK/DGf: 99bot/bro; #References = LogK/DGf: 99bot/bro; V°: 00bla/bid; Gypsum CaSO4:2H2O = 1.000Ca+2 + 1.000SO4-2 + 2.000H2O log_k -4.605 delta_h -1.054 #kJ/mol #CODATA87 -analytic -1.620207E+3 -2.5723367E-1 8.9150211E+4 5.8738246E+2 -5.3473276E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: CODATA87; S°: CODATA87; Cp: 74nau/ryz; V°: 95rob/hem; Gyrolite Ca2Si3O7.5(OH):2H2O + 4.000H+ + 1.500H2O = 2.000Ca+2 + 3.000H4SiO4 log_k 22.338 delta_h -115.848 #kJ/mol #10abla/bou -analytic -1.6006301E+3 -2.0524823E-1 1.0339525E+5 5.6892558E+2 -6.2576818E+6 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 10abla/bou; Halite NaCl = 1.000Cl- + 1.000Na+ log_k 1.594 delta_h 3.700 #kJ/mol #78hel/del, 98cha -analytic -7.522461E+2 -1.1904903E-1 4.1385514E+4 2.7417807E+2 -2.4808996E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del, 98cha; S°: 98cha; Cp: 78hel/del; V°: 78hel/del; Halloysite Al2Si2O5(OH)4 + 6.000H+ = 2.000Al+3 + 2.000H4SiO4 + 1.000H2O log_k 10.334 delta_h -187.752 #kJ/mol #06bla/pia -analytic -1.67629E+3 -2.3686038E-1 1.0512453E+5 5.9440364E+2 -5.8810176E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 06bla/pia; S°: 06bla/pia; Cp: 06bla/pia; V°: 78hel/del,78rob/hem; Halotrichite FeAl2(SO4)4:22H2O = 2.000Al+3 + 1.000Fe+2 + 4.000SO4-2 + 22.000H2O log_k -8.239 delta_h -51.420 #kJ/mol #02hem/sea -analytic -7.0608605E+3 -1.0302679E+0 3.8495138E+5 2.5498444E+3 -2.1402056E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam; Hbeidellite(Ca) Ca0.17Al2.34Si3.66O10(OH)2:4.24H2O + 7.360H+ = 2.340Al+3 + 0.170Ca+2 + 3.660H4SiO4 + 1.600H2O log_k 3.936 delta_h -176.294 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4027162E+3 -3.2987816E-1 1.5008099E+5 8.4975426E+2 -8.9808844E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hbeidellite(K) K0.34Al2.34Si3.66O10(OH)2:1.627H2O + 7.360H+ + 1.013H2O = 2.340Al+3 + 0.340K+ + 3.660H4SiO4 log_k 4.321 delta_h -173.017 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4171154E+3 -3.316485E-1 1.5082088E+5 8.5518702E+2 -9.0354191E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hbeidellite(Mg) Mg0.17Al2.34Si3.66O10(OH)2:4.098H2O + 7.360H+ = 2.340Al+3 + 0.170Mg+2 + 3.660H4SiO4 + 1.458H2O log_k 3.203 delta_h -174.536 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4206016E+3 -3.321074E-1 1.5096664E+5 8.56003E+2 -9.0356122E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hbeidellite(Na) Na0.34Al2.34Si3.66O10(OH)2:2.756H2O + 7.360H+ = 2.340Al+3 + 0.340Na+ + 3.660H4SiO4 + 0.116H2O log_k 4.407 delta_h -177.111 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4235063E+3 -3.3158969E-1 1.5137177E+5 8.5710749E+2 -9.0478304E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hedenbergite CaFe(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Ca+2 + 1.000Fe+2 + 2.000H4SiO4 log_k 19.970 delta_h -141.006 #kJ/mol #Internal calculation -analytic -1.3059182E+3 -1.7957547E-1 8.3977294E+4 4.6555296E+2 -4.8191744E+6 #References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Hellyerite NiCO3:6H2O + 1.000H+ = 1.000HCO3- + 1.000Ni+2 + 6.000H2O log_k 2.819 delta_h -8.036 #kJ/mol #Internal calculation -analytic -8.5139433E+2 -1.3673168E-1 4.6900758E+4 3.1058787E+2 -2.7428402E+6 #References = LogK/DGf: 02wal/pre; DHf/DHr: Internal calculation; S°: 02wal/pre; Cp: 13bla/gab; V°: 02wal/pre; Hematite Fe2O3 + 6.000H+ = 2.000Fe+3 + 3.000H2O log_k -0.044 delta_h -129.260 #kJ/mol #90hem -analytic -9.4281016E+2 -1.528255E-1 5.3792156E+4 3.3793499E+2 -2.5145091E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 90hem; S°: 90hem; Cp: 90hem; V°: 78hel/del; Hemicarboaluminate Ca8Al4CO16:22H2O + 27.000H+ = 4.000Al+3 + 1.000HCO3- + 8.000Ca+2 + 35.000H2O log_k 183.696 delta_h -1204.546 #kJ/mol #Internal calculation -analytic -4.8335447E+3 -7.4530291E-1 3.1368398E+5 1.7531972E+3 -1.3406998E+7 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay; Hemihydroxichloride(Ca) Ca2(OH)2Cl2:H2O + 2.000H+ = 2.000Ca+2 + 2.000Cl- + 3.000H2O log_k 26.533 #References = LogK/DGf: 84har/mol; #References = LogK/DGf: 84har/mol; V°: Default value; Heulandite(Ca) Ca1.07Al2.14Si6.86O18:6.17H2O + 8.560H+ + 3.270H2O = 2.140Al+3 + 1.070Ca+2 + 6.860H4SiO4 log_k 2.457 delta_h -139.108 #kJ/mol #09bla -analytic -3.7607701E+3 -5.0483789E-1 2.3083824E+5 1.3337643E+3 -1.4294418E+7 #References = LogK/DGf: 09bla; DHf/DHr: 09bla; S°: Internal calculation; Cp: 10vie; V°: 97coo/alb; Heulandite(Na) Na2.14Al2.14Si6.86O18:6.17H2O + 8.560H+ + 3.270H2O = 2.140Al+3 + 2.140Na+ + 6.860H4SiO4 log_k 2.797 delta_h -126.775 #kJ/mol #09bla -analytic -3.7890714E+3 -4.9720069E-1 2.3269508E+5 1.3423841E+3 -1.4400431E+7 #References = LogK/DGf: 09bla; DHf/DHr: 09bla; S°: Internal calculation; Cp: 10vie; V°: 97coo/alb; Hexahydrite MgSO4:6H2O = 1.000Mg+2 + 1.000SO4-2 + 6.000H2O log_k -1.634 delta_h -4.625 #kJ/mol #Internal calculation -analytic -1.6899917E+3 -2.5875891E-1 9.3104084E+4 6.1208974E+2 -5.4529058E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 63wyc; Hg(l) Hg = 1.000Hg log_k -6.502 delta_h 12.503 #kJ/mol #By convention -analytic 1.6301788E+2 2.9252674E-2 -1.3987847E+4 -5.8730554E+1 1.2443643E+6 #References = S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem; Hg2SO4 Hg2SO4 = 1.000Hg2+2 + 1.000SO4-2 log_k -6.192 delta_h 0.620 #kJ/mol #89cox/wag -analytic -1.565348E+3 -2.5198577E-1 8.5551995E+4 5.6783449E+2 -5.131496E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 77bar/kna; V°: 95rob/hem; Hg3(OH)3PO4 Hg3(OH)3PO4 + 5.000H+ = 3.000Hg+2 + 1.000H2PO4- + 3.000H2O log_k -2.185 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; Hg3(PO4)2 Hg3(PO4)2 + 4.000H+ = 3.000Hg+2 + 2.000H2PO4- log_k -10.175 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; HgCO3.2HgO HgCO3(HgO)2 + 5.000H+ = 1.000HCO3- + 3.000Hg+2 + 2.000H2O log_k -0.868 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; HgHPO4 HgHPO4 + 1.000H+ = 1.000Hg+2 + 1.000H2PO4- log_k -5.887 #References = LogK/DGf: 05pow/bro; #References = LogK/DGf: 05pow/bro; V°: Default value; HgO(cr) HgO + 2.000H+ = 1.000Hg+2 + 1.000H2O log_k 2.445 delta_h -24.830 #kJ/mol #89cox/wag -analytic -2.9025869E+2 -4.3816549E-2 1.6223576E+4 1.0510834E+2 -7.7606166E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem; Hilgenstockite Ca4O(PO4)2 + 6.000H+ = 4.000Ca+2 + 2.000H2PO4- + 1.000H2O log_k 23.594 #References = LogK/DGf: 84vie/tar,after 71bduf; #References = LogK/DGf: 84vie/tar,after 71bduf; V°: Default value; Hillebrandite Ca2SiO3(OH)2:0.17H2O + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4 + 1.170H2O log_k 36.951 delta_h -216.802 #kJ/mol #56new -analytic -9.0735648E+2 -1.2719296E-1 6.3081089E+4 3.2561964E+2 -3.117433E+6 #References = LogK/DGf: 10abla/bou; DHf/DHr: 56new; S°: Internal calculation; Cp: 10abla/bou; V°: 95dai/pos; Hinsdalite PbAl3(PO4)(SO4)(OH)6 + 8.000H+ = 3.000Al+3 + 1.000H2PO4- + 1.000Pb+2 + 1.000SO4-2 + 6.000H2O log_k 6.691 #References = LogK/DGf: 78ric/nri; #References = LogK/DGf: 78ric/nri; V°: 63wyc; Hmontmorillonite(HcCa) Ca0.3Mg0.6Al1.4Si4O10(OH)2:4.288H2O + 6.000H+ = 1.400Al+3 + 0.300Ca+2 + 0.600Mg+2 + 4.000H4SiO4 + 0.288H2O log_k 4.334 delta_h -120.986 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.3094231E+3 -3.0580588E-1 1.4471075E+5 8.1639059E+2 -8.9368523E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hmontmorillonite(HcK) K0.6Mg0.6Al1.4Si4O10(OH)2:2.513H2O + 6.000H+ + 1.487H2O = 1.400Al+3 + 0.600K+ + 0.600Mg+2 + 4.000H4SiO4 log_k 3.654 delta_h -108.272 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.3026227E+3 -3.0364656E-1 1.4397869E+5 8.1412322E+2 -8.9420525E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hmontmorillonite(HcMg) Mg0.3Mg0.6Al1.4Si4O10(OH)2:5.129H2O + 6.000H+ = 1.400Al+3 + 0.900Mg+2 + 4.000H4SiO4 + 1.129H2O log_k 2.761 delta_h -115.778 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.3284436E+3 -3.0770632E-1 1.455187E+5 8.2285518E+2 -8.9983921E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hmontmorillonite(HcNa) Na0.6Mg0.6Al1.4Si4O10(OH)2:3.006H2O + 6.000H+ + 0.994H2O = 1.400Al+3 + 0.600Mg+2 + 0.600Na+ + 4.000H4SiO4 log_k 4.188 delta_h -118.065 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.3310741E+3 -3.0633588E-1 1.4597088E+5 8.2377926E+2 -9.0120819E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hmontmorillonite(MgCa) Ca0.17Mg0.34Al1.66Si4O10(OH)2:4.265H2O + 6.000H+ = 1.660Al+3 + 0.170Ca+2 + 0.340Mg+2 + 4.000H4SiO4 + 0.265H2O log_k 1.859 delta_h -115.428 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.3130675E+3 -3.0785671E-1 1.4446533E+5 8.1750003E+2 -8.9493788E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hmontmorillonite(MgK) K0.34Mg0.34Al1.66Si4O10(OH)2:2.517H2O + 6.000H+ + 1.483H2O = 1.660Al+3 + 0.340K+ + 0.340Mg+2 + 4.000H4SiO4 log_k 2.068 delta_h -116.222 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.318488E+3 -3.0801566E-1 1.449068E+5 8.1931728E+2 -8.9761481E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hmontmorillonite(MgMg) Mg0.17Mg0.34Al1.66Si4O10(OH)2:5.093H2O + 6.000H+ = 1.660Al+3 + 0.510Mg+2 + 4.000H4SiO4 + 1.093H2O log_k 0.730 delta_h -109.751 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.3195967E+3 -3.0827895E-1 1.4457311E+5 8.1969438E+2 -8.9729708E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hmontmorillonite(MgNa) Na0.34Mg0.34Al1.66Si4O10(OH)2:3.003H2O + 6.000H+ + 0.997H2O = 1.660Al+3 + 0.340Mg+2 + 0.340Na+ + 4.000H4SiO4 log_k 2.190 delta_h -119.524 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.3320394E+3 -3.0915468E-1 1.4579619E+5 8.2392535E+2 -9.0091988E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hnontronite(Ca) Ca0.17Fe1.67Al0.67Si3.66O10(OH)2:4.24H2O + 7.360H+ = 0.670Al+3 + 0.170Ca+2 + 1.670Fe+3 + 3.660H4SiO4 + 1.600H2O log_k -4.661 delta_h -114.584 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4190674E+3 -3.2865025E-1 1.4773689E+5 8.5589721E+2 -8.9764584E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hnontronite(K) K0.34Fe1.67Al0.67Si3.66O10(OH)2:1.627H2O + 7.360H+ + 1.013H2O = 0.670Al+3 + 1.670Fe+3 + 0.340K+ + 3.660H4SiO4 log_k -4.276 delta_h -111.307 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4331472E+3 -3.3037598E-1 1.4845875E+5 8.6121518E+2 -9.0299317E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hnontronite(Mg) Mg0.17Fe1.67Al0.67Si3.66O10(OH)2:4.098H2O + 7.360H+ = 0.670Al+3 + 1.670Fe+3 + 0.170Mg+2 + 3.660H4SiO4 + 1.458H2O log_k -5.394 delta_h -112.827 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4356476E+3 -3.3069713E-1 1.4854883E+5 8.6167672E+2 -9.0268481E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hnontronite(Na) Na0.34Fe1.67Al0.67Si3.66O10(OH)2:2.756H2O + 7.360H+ = 0.670Al+3 + 1.670Fe+3 + 0.340Na+ + 3.660H4SiO4 + 0.116H2O log_k -4.190 delta_h -115.401 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4395943E+3 -3.3032501E-1 1.4901281E+5 8.6315584E+2 -9.0425297E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hopeite(alpha) Zn3(PO4)2:4H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 4.000H2O log_k 3.824 delta_h -106.676 #kJ/mol #84vie/tar, after 78yag -analytic -2.3065362E+3 -3.3859157E-1 1.2821301E+5 8.3124159E+2 -6.7177085E+6 #References = LogK/DGf: 73bnri,76smi/mar; DHf/DHr: 84vie/tar, after 78yag; S°: Internal calculation; V°: 63wyc; Hopeite(beta) Zn3(PO4)2:4H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 4.000H2O log_k 8.439 delta_h -117.176 #kJ/mol #79vol -analytic -2.3037611E+3 -3.3859157E-1 1.2876146E+5 8.3124159E+2 -6.7177085E+6 #References = LogK/DGf: 84vie/tar; DHf/DHr: 79vol; S°: Internal calculation; V°: 63wyc; Hsaponite(Ca) Ca0.17Mg3Al0.34Si3.66O10(OH)2:4.799H2O + 7.360H+ = 0.340Al+3 + 0.170Ca+2 + 3.000Mg+2 + 3.660H4SiO4 + 2.159H2O log_k 26.450 delta_h -241.776 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.5060268E+3 -3.3073338E-1 1.6052946E+5 8.8800109E+2 -9.3012824E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hsaponite(FeCa) Ca0.17Mg2FeAl0.34Si3.66O10(OH)2:4.799H2O + 7.360H+ = 0.340Al+3 + 0.170Ca+2 + 1.000Fe+2 + 2.000Mg+2 + 3.660H4SiO4 + 2.159H2O log_k 23.663 delta_h -229.642 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4749203E+3 -3.277182E-1 1.5813824E+5 8.7679134E+2 -9.2154974E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hsaponite(FeK) K0.34Mg2FeAl0.34Si3.66O10(OH)2:4.061H2O + 7.360H+ = 0.340Al+3 + 1.000Fe+2 + 0.340K+ + 2.000Mg+2 + 3.660H4SiO4 + 1.421H2O log_k 23.914 delta_h -222.075 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4649624E+3 -3.2566748E-1 1.5741356E+5 8.7354256E+2 -9.2020401E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hsaponite(FeMg) Mg0.17Mg2FeAl0.34Si3.66O10(OH)2:5.039H2O + 7.360H+ = 0.340Al+3 + 1.000Fe+2 + 2.170Mg+2 + 3.660H4SiO4 + 2.399H2O log_k 22.899 delta_h -228.943 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4869452E+3 -3.2899569E-1 1.5875646E+5 8.8082551E+2 -9.252251E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hsaponite(FeNa) Na0.34Mg2FeAl0.34Si3.66O10(OH)2:4.297H2O + 7.360H+ = 0.340Al+3 + 1.000Fe+2 + 2.000Mg+2 + 0.340Na+ + 3.660H4SiO4 + 1.657H2O log_k 23.900 delta_h -227.112 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4828296E+3 -3.2741511E-1 1.5859911E+5 8.7956328E+2 -9.2465149E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hsaponite(K) K0.34Mg3Al0.34Si3.66O10(OH)2:4.061H2O + 7.360H+ = 0.340Al+3 + 0.340K+ + 3.000Mg+2 + 3.660H4SiO4 + 1.421H2O log_k 26.701 delta_h -234.210 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.4960689E+3 -3.2868265E-1 1.5980478E+5 8.8475231E+2 -9.2878251E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hsaponite(Mg) Mg3.17Al0.34Si3.66O10(OH)2:5.039H2O + 7.360H+ = 0.340Al+3 + 3.170Mg+2 + 3.660H4SiO4 + 2.399H2O log_k 25.687 delta_h -241.078 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.5180517E+3 -3.3201086E-1 1.6114769E+5 8.9203526E+2 -9.338036E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hsaponite(Na) Na0.34Mg3Al0.34Si3.66O10(OH)2:4.297H2O + 7.360H+ = 0.340Al+3 + 3.000Mg+2 + 0.340Na+ + 3.660H4SiO4 + 1.657H2O log_k 26.687 delta_h -239.247 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.5139361E+3 -3.3043028E-1 1.6099033E+5 8.9077303E+2 -9.3322999E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Huntite CaMg3(CO3)4 + 4.000H+ = 4.000HCO3- + 1.000Ca+2 + 3.000Mg+2 log_k 11.014 delta_h -174.120 #kJ/mol #73hem/rob -analytic -3.6441403E+3 -5.8648344E-1 2.0445197E+5 1.3223404E+3 -1.1357533E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 73hem/rob; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Hvermiculite(Ca) Ca0.43Mg3.00Si3.14Al0.86O10(OH)2:4.12H2O + 9.440H+ = 0.860Al+3 + 0.430Ca+2 + 3.000Mg+2 + 3.140H4SiO4 + 3.560H2O log_k 37.372 delta_h -354.086 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.6984797E+3 -3.6909505E-1 1.7371045E+5 9.5805743E+2 -9.545486E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hvermiculite(K) K0.86Mg3.00Si3.14Al0.86O10(OH)2:3.319H2O + 9.440H+ = 0.860Al+3 + 0.860K+ + 3.000Mg+2 + 3.140H4SiO4 + 2.759H2O log_k 36.577 delta_h -326.110 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.6520265E+3 -3.6077621E-1 1.7024583E+5 9.4219214E+2 -9.4433014E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hvermiculite(Mg) Mg0.43Mg3.00Si3.14Al0.86O10(OH)2:4.55H2O + 9.440H+ = 0.860Al+3 + 3.430Mg+2 + 3.140H4SiO4 + 3.990H2O log_k 35.859 delta_h -353.588 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.7266776E+3 -3.7215075E-1 1.7519919E+5 9.6756954E+2 -9.6285103E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hvermiculite(Na) Na0.86Mg3.00Si3.14Al0.86O10(OH)2:3.58H2O + 9.440H+ = 0.860Al+3 + 3.000Mg+2 + 0.860Na+ + 3.140H4SiO4 + 3.020H2O log_k 37.036 delta_h -341.580 #kJ/mol #15bla/vie, 11vie/bla -analytic -2.7035941E+3 -3.6614932E-1 1.7373928E+5 9.5973431E+2 -9.5762214E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie, 11vie/bla; S°: 15bla/vie, 11vie/bla; Cp: 15bla/vie, 11vie/bla; V°: 15bla/vie, 11vie/bla; Hydrocalumnite(Cr) (CaCrO4)Al2O3(CaO)3:15H2O + 12.000H+ = 2.000Al+3 + 4.000Ca+2 + 1.000CrO4-2 + 21.000H2O log_k 71.341 delta_h -541.448 #kJ/mol #01per/pal -analytic -4.020784E+3 -5.6965144E-1 2.3754631E+5 1.449328E+3 -1.0759208E+7 #References = LogK/DGf: 01per/pal; DHf/DHr: 01per/pal; S°: Internal calculation; V°: Default value; Hydrocerussite Pb3(CO3)2(OH)2 + 4.000H+ = 2.000HCO3- + 3.000Pb+2 + 2.000H2O log_k 2.750 delta_h -34.559 #kJ/mol #83san/bar -analytic -2.1379559E+3 -3.2181267E-1 1.1810256E+5 7.7407054E+2 -6.6537723E+6 #References = LogK/DGf: 84tay/lop; DHf/DHr: 83san/bar; S°: Internal calculation; V°: 63wyc; Hydromagnesite Mg5(OH)2(CO3)4:4H2O + 6.000H+ = 4.000HCO3- + 5.000Mg+2 + 6.000H2O log_k 31.000 delta_h -293.700 #kJ/mol #99kon/kon -analytic -4.0797202E+3 -6.4286834E-1 2.3339952E+5 1.479039E+3 -1.2464629E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 99kon/kon; S°: 99kon/kon; Cp: 78hel/del; V°: 78hel/del; Hydrophilite CaCl2 = 1.000Ca+2 + 2.000Cl- log_k 11.642 delta_h -81.770 #kJ/mol #87gar/par -analytic -1.5067232E+3 -2.4695162E-1 8.6377781E+4 5.4864355E+2 -4.9159099E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; Cp: 95rob/hem; V°: 95rob/hem; Hydrotalcite Mg4Al2O7:10H2O + 14.000H+ = 2.000Al+3 + 4.000Mg+2 + 17.000H2O log_k 73.757 delta_h -584.223 #kJ/mol #Internal calculation -analytic -2.490177E+3 -3.632725E-1 1.5928839E+5 8.9467068E+2 -6.7395607E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay; Hydrotalcite(CO3) Mg4Al2(OH)12(CO3):2H2O + 13.000H+ = 2.000Al+3 + 1.000HCO3- + 4.000Mg+2 + 14.000H2O log_k 61.203 delta_h -557.470 #kJ/mol #Internal calculation -analytic -3.0209635E+3 -4.5809237E-1 1.8727771E+5 1.0863848E+3 -8.6736802E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay; Hydroxichloride(Ca) CaOHCl + 1.000H+ = 1.000Ca+2 + 1.000Cl- + 1.000H2O log_k 13.195 delta_h -82.086 #kJ/mol #Internal calculation -analytic -9.2891866E+2 -1.5120323E-1 5.4580853E+4 3.3845178E+2 -2.9643626E+6 #References = LogK/DGf: 97all/dol,06bod/las; DHf/DHr: Internal calculation; S°: 97all/dol,06bod/las; Cp: 97all/dol; V°: Default value; Hydroxichloride(Ca:13H2O) Ca4Cl2(OH)6:13H2O + 6.000H+ = 4.000Ca+2 + 2.000Cl- + 19.000H2O log_k 68.749 delta_h -271.930 #kJ/mol #82wag/eva -analytic -2.9147407E+3 -3.9689822E-1 1.672024E+5 1.0613318E+3 -7.5711313E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value; Hydroxichloride(Ca:H2O) CaCl(OH):H2O + 1.000H+ = 1.000Ca+2 + 1.000Cl- + 2.000H2O log_k 11.353 delta_h -63.609 #kJ/mol #Internal calculation -analytic -9.453468E+2 -1.5269202E-1 5.4384447E+4 3.4484186E+2 -2.9752984E+6 #References = LogK/DGf: 06bod/las; DHf/DHr: Internal calculation; S°: 06bod/las; Cp: 06bod/las; V°: Default value; Hydroxichloride(Mg:4H2O) Mg2Cl(OH)3:4H2O + 3.000H+ = 1.000Cl- + 2.000Mg+2 + 7.000H2O log_k 26.037 delta_h -154.690 #kJ/mol #82wag/eva -analytic -1.5369282E+3 -2.1415308E-1 8.9390619E+4 5.555252E+2 -4.2325222E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value; Hydroxyapatite(Natur) Ca5(PO4)3(OH) + 7.000H+ = 5.000Ca+2 + 3.000H2PO4- + 1.000H2O log_k 14.336 delta_h -178.396 #kJ/mol #Internal calculation -analytic -3.0901586E+3 -5.1247394E-1 1.732823E+5 1.1247363E+3 -9.5106697E+6 #References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 71par/wag; Cp: 60kel; V°: 95rob/hem; I/S(ISCz-1) (Ca0.092K0.439)(Si3.562Al0.438)(Al1.732Fe0.04Mg0.255)O10(OH)2 + 7.752H+ + 2.248H2O = 2.170Al+3 + 0.092Ca+2 + 0.029Fe+3 + 0.439K+ + 0.255Mg+2 + 3.562H4SiO4 + 0.011Fe+2 log_k 10.949 delta_h -217.166 #kJ/mol #19gai/bla -analytic -2.494898E+3 -3.5122636E-1 1.5520818E+5 8.8562811E+2 -9.0168998E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 19gai/bla; S°: 19gai/bla; Cp: 19gai/bla; V°: 14bla/gai; Illite(Al) K0.85Al2.85Si3.15O10(OH)2 + 9.400H+ + 0.600H2O = 2.850Al+3 + 0.850K+ + 3.150H4SiO4 log_k 13.037 delta_h -259.023 #kJ/mol #15bla/vie -analytic -2.5573928E+3 -3.6178396E-1 1.6000104E+5 9.0702444E+2 -9.1314491E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Illite(FeII) K0.85Fe0.25Al2.35Si3.4O10(OH)2 + 8.400H+ + 1.600H2O = 2.350Al+3 + 0.250Fe+2 + 0.850K+ + 3.400H4SiO4 log_k 9.472 delta_h -208.568 #kJ/mol #15bla/vie -analytic -2.4766309E+3 -3.437332E-1 1.5468507E+5 8.7765237E+2 -9.0602985E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Illite(FeIII) K0.85Fe0.25Al2.6Si3.15O10(OH)2 + 9.400H+ + 0.600H2O = 2.600Al+3 + 0.250Fe+3 + 0.850K+ + 3.150H4SiO4 log_k 12.382 delta_h -254.933 #kJ/mol #15bla/vie -analytic -2.5612909E+3 -3.617655E-1 1.5998574E+5 9.0836875E+2 -9.1347162E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Illite(IMt2) (Na0.044K0.762)(Si3.387Al0.613)(Al1.427Fe0.376Mg0.241)O10(OH)2 + 8.452H+ + 1.548H2O = 2.040Al+3 + 0.292Fe+3 + 0.762K+ + 0.241Mg+2 + 0.044Na+ + 3.387H4SiO4 + 0.084Fe+2 log_k 11.538 delta_h -222.904 #kJ/mol #12gai/bla -analytic -2.498976E+3 -3.5351343E-1 1.5505023E+5 8.8765243E+2 -8.939547E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla; Illite(Mg) K0.85Mg0.25Al2.35Si3.4O10(OH)2 + 8.400H+ + 1.600H2O = 2.350Al+3 + 0.850K+ + 0.250Mg+2 + 3.400H4SiO4 log_k 11.027 delta_h -217.718 #kJ/mol #15bla/vie -analytic -2.4845922E+3 -3.4448304E-1 1.5560095E+5 8.8044462E+2 -9.08168E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Ilmenite FeTiO3 + 2.000H+ + 1.000H2O = 1.000Fe+2 + 1.000Ti(OH)4 log_k 1.816 delta_h -87.445 #kJ/mol #Internal calculation -analytic -7.7719505E+2 -8.1479565E-2 4.34898E+4 2.7302259E+2 -1.612373E+6 #References = LogK/DGf: 95rob/hem; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Imogolite Al2SiO3(OH)4 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 3.000H2O log_k 13.083 delta_h -203.551 #kJ/mol #82far/fra -analytic -1.4344023E+3 -2.0160715E-1 8.8284887E+4 5.0966175E+2 -4.4126001E+6 #References = LogK/DGf: 96su/har; DHf/DHr: 82far/fra; S°: Internal calculation; V°: 90rob/cam; Jacobsite Mn(FeO2)2 + 8.000H+ = 2.000Fe+3 + 1.000Mn+2 + 4.000H2O log_k 15.742 delta_h -236.318 #kJ/mol #73bar/kna -analytic -1.3488025E+3 -2.1350724E-1 8.1033524E+4 4.8425566E+2 -3.719726E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 73bar/kna; S°: 73bar/kna; Cp: 73bar/kna; V°: 73bar/kna; Jadeite NaAl(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Al+3 + 1.000Na+ + 2.000H4SiO4 log_k 7.561 delta_h -95.502 #kJ/mol #95rob/hem -analytic -1.3237509E+3 -1.8118316E-1 8.2628986E+4 4.7016122E+2 -4.9060741E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del; Jaffeite Ca6(Si2O7)(OH)6 + 12.000H+ = 6.000Ca+2 + 2.000H4SiO4 + 5.000H2O log_k 114.074 delta_h -632.100 #kJ/mol #10abla/bou -analytic -2.4008904E+3 -3.4132185E-1 1.6681355E+5 8.6659708E+2 -7.7429258E+6 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 95ant/bid; Jarosite(Ag) AgFe3(SO4)2(OH)6 + 6.000H+ = 1.000Ag+ + 3.000Fe+3 + 2.000SO4-2 + 6.000H2O log_k -11.577 #References = LogK/DGf: 75kas/bor; #References = LogK/DGf: 75kas/bor; V°: Default value; Jarosite(Cr) KFe3(CrO4)2(OH)6 + 6.000H+ = 2.000CrO4-2 + 3.000Fe+3 + 1.000K+ + 6.000H2O log_k -17.945 delta_h -109.620 #kJ/mol #96bbar/pal -analytic -4.4406545E+3 -6.8309073E-1 2.4349472E+5 1.6013376E+3 -1.3575565E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 96bbar/pal; S°: 96bbar/pal; V°: Default value; Jarosite(H) (H3O)Fe3(SO4)2(OH)6 + 5.000H+ = 3.000Fe+3 + 2.000SO4-2 + 7.000H2O log_k -5.139 delta_h -196.290 #kJ/mol #04maj/ste -analytic -4.2610817E+3 -6.8268613E-1 2.3808458E+5 1.5398661E+3 -1.3276429E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 04maj/ste; S°: 04maj/ste; Cp: 04maj/ste; V°: 90rob/cam; Jarosite(K) KFe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 1.000K+ + 2.000SO4-2 + 6.000H2O log_k -10.994 delta_h -103.200 #kJ/mol #03dro/nav -analytic -4.1989081E+3 -6.8049573E-1 2.3005389E+5 1.5222608E+3 -1.3114957E+7 #References = LogK/DGf: 96abar/pal; DHf/DHr: 03dro/nav; S°: Internal calculation; Cp: 03dro/nav; V°: 76men/sab; Jarosite(Na) NaFe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 1.000Na+ + 2.000SO4-2 + 6.000H2O log_k 6.738 delta_h -247.900 #kJ/mol #93sto -analytic -4.2650991E+3 -6.8697004E-1 2.4071922E+5 1.5431623E+3 -1.3260549E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 93sto; S°: 93sto; Cp: 93sto; V°: 08bas/pet; Jarosite(NH4) NH4Fe3(SO4)2(OH)6 + 5.000H+ = 3.000Fe+3 + 1.000NH3 + 2.000SO4-2 + 6.000H2O log_k -19.022 #References = LogK/DGf: 75kas/bor; #References = LogK/DGf: 75kas/bor; V°: Default value; Jarosite(Pb) Pb0.5Fe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 0.500Pb+2 + 2.000SO4-2 + 6.000H2O log_k -11.448 #References = LogK/DGf: 75kas/bor; #References = LogK/DGf: 75kas/bor; V°: Default value; Jennite Ca9Si6H22O32 + 18.000H+ = 9.000Ca+2 + 6.000H4SiO4 + 8.000H2O log_k 147.338 delta_h -737.766 #kJ/mol #10abla/bou -analytic -4.8419783E+3 -6.4881272E-1 3.1938387E+5 1.7385166E+3 -1.6916851E+7 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 92tay; K(element) K + 0.250O2 + 1.000H+ = 1.000K+ + 0.500H2O log_k 70.991 delta_h -392.022 #kJ/mol #By convention -analytic -1.03379E+2 -1.4987856E-2 2.6916111E+4 3.7746555E+1 -4.302278E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; K2CO3 K2CO3 + 1.000H+ = 1.000HCO3- + 2.000K+ log_k 15.735 delta_h -46.500 #kJ/mol #74nau/ryz -analytic -7.255422E+2 -1.1522261E-1 4.2944247E+4 2.6626971E+2 -2.4243081E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan; K2O K2O + 2.000H+ = 2.000K+ + 1.000H2O log_k 84.106 delta_h -426.940 #kJ/mol #98cha -analytic -1.5056958E+2 -2.16898E-2 3.1266668E+4 5.7417117E+1 -5.1573238E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem; K2SO4.FeSO4:6H2O K2Fe(SO4)2:6H2O = 1.000Fe+2 + 2.000K+ + 2.000SO4-2 + 6.000H2O log_k -4.604 delta_h 152.806 #kJ/mol #Internal calculation -analytic -3.4430373E+3 -5.1582216E-1 1.817216E+5 1.2548949E+3 -1.0882961E+7 #References = LogK/DGf: 04chr; DHf/DHr: Internal calculation; S°: 78hel/del; V°: Default value; Kainite KMgClSO4:3H2O = 1.000Cl- + 1.000K+ + 1.000Mg+2 + 1.000SO4-2 + 3.000H2O log_k -0.187 delta_h -12.950 #kJ/mol #82wag/eva -analytic -2.5347833E+3 -3.8461077E-1 1.3926246E+5 9.183606E+2 -8.0220997E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: 95rob/hem; Kalicinite KHCO3 = 1.000HCO3- + 1.000K+ log_k 0.267 delta_h 20.250 #kJ/mol #74nau/ryz -analytic -6.4282153E+2 -1.0327296E-1 3.462817E+4 2.351581E+2 -2.1465517E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; Cp: 74nau/ryz; V°: 90rob/cam; Kalsilite(alpha) K(AlSi)O4 + 4.000H+ = 1.000Al+3 + 1.000K+ + 1.000H4SiO4 log_k 11.208 delta_h -118.038 #kJ/mol #78hel/del -analytic -9.1768479E+2 -1.3338074E-1 5.8042569E+4 3.2728043E+2 -3.1868141E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Kalsilite(beta) K(AlSi)O4 + 4.000H+ = 1.000Al+3 + 1.000K+ + 1.000H4SiO4 log_k 10.639 #delta_h 0.000 #kJ/mol -analytic -8.9890404E+2 -1.3148378E-1 5.715201E+4 3.2070339E+2 -3.2449468E+6 #References = LogK/DGf: Internal calculation; V°: Default value; Kaolinite Al2Si2O5(OH)4 + 6.000H+ = 2.000Al+3 + 2.000H4SiO4 + 1.000H2O log_k 6.483 delta_h -165.052 #kJ/mol #01fia/nav -analytic -1.6614047E+3 -2.40262E-1 1.0202166E+5 5.9067962E+2 -5.7121776E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 01fia/nav; S°: 91rob/hem; Cp: 91rob/hem; V°: 95rob/hem; KatoiteSi1 Ca3Al2(SiO4)1(OH)8 + 12.000H+ = 2.000Al+3 + 3.000Ca+2 + 1.000H4SiO4 + 8.000H2O log_k 71.168 delta_h -543.405 #kJ/mol #Internal calculation -analytic -2.1445204E+3 -3.249761E-1 1.4263205E+5 7.7064419E+2 -6.4642286E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 10bbla/bou; KCl.MgCl2:6H2O KMgCl3:6H2O = 3.000Cl- + 1.000K+ + 1.000Mg+2 + 6.000H2O log_k 4.396 #References = LogK/DGf: 93bal/chr; #References = LogK/DGf: 93bal/chr; V°: 78hel/del; KH2PO4 KH2PO4 = 1.000K+ + 1.000H2PO4- log_k 0.278 delta_h 15.960 #kJ/mol #74nau/ryz -analytic -6.8356114E+2 -1.1018854E-1 3.6862322E+4 2.4991456E+2 -2.2527724E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: Default value; Kieserite MgSO4:H2O = 1.000Mg+2 + 1.000SO4-2 + 1.000H2O log_k -0.119 delta_h -51.464 #kJ/mol #Internal calculation -analytic -1.6964548E+3 -2.6749876E-1 9.5983219E+4 6.1318774E+2 -5.6120063E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 63wyc; Kornelite Fe2(SO4)3:7H2O = 2.000Fe+3 + 3.000SO4-2 + 7.000H2O log_k -7.869 delta_h -134.630 #kJ/mol #02hem/sea -analytic -5.2076569E+3 -7.9238988E-1 2.8984213E+5 1.8785041E+3 -1.6385922E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam; Krausite(Cr) KFe(CrO4)2:2H2O = 2.000CrO4-2 + 1.000Fe+3 + 1.000K+ + 2.000H2O log_k -19.388 delta_h 27.540 #kJ/mol #98bar/pal -analytic -3.1373224E+3 -5.184778E-1 1.7153076E+5 1.1385318E+3 -1.0669098E+7 #References = LogK/DGf: 98bar/pal; DHf/DHr: 98bar/pal; S°: Internal calculation; Cp: 98bar/pal; V°: Default value; Kyanite Al2SiO5 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 1.000H2O log_k 15.936 delta_h -240.322 #kJ/mol #Internal calculation -analytic -1.3447799E+3 -2.0581745E-1 8.5324148E+4 4.7877192E+2 -4.3369481E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; La2O3glass La2O3 + 6.000H+ = 2.000La+3 + 3.000H2O log_k 78.618 #References = LogK/DGf: 92plo/wic; #References = LogK/DGf: 92plo/wic; V°: Default value; Lammuchangite TlAl(SO4)2:12H2O = 1.000Al+3 + 2.000SO4-2 + 1.000Tl+ + 12.000H2O log_k -16.486 delta_h 37.510 #kJ/mol #09xio -analytic -3.1907615E+3 -5.0111308E-1 1.7407477E+5 1.1553265E+3 -1.057366E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 09xio; S°: 09xio; Cp: 84pan/stu; V°: 84pan/stu; Lanarkite Pb2SO5 + 2.000H+ = 2.000Pb+2 + 1.000SO4-2 + 1.000H2O log_k 2.631 delta_h -39.234 #kJ/mol #Internal calculation -analytic -1.9815301E+3 -3.0530151E-1 1.1138299E+5 7.1720646E+2 -6.4958171E+6 #References = LogK/DGf: 74nau/ryz; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: 74nau/ryz; Langite Cu4SO4(OH)6:H2O + 6.000H+ = 4.000Cu+2 + 1.000SO4-2 + 7.000H2O log_k 17.496 delta_h -163.966 #kJ/mol #Internal calculation -analytic -2.6805273E+3 -4.1268217E-1 1.5291727E+5 9.7032402E+2 -8.2516388E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam; Lansfordite MgCO3:5H2O + 1.000H+ = 1.000HCO3- + 1.000Mg+2 + 5.000H2O log_k 5.293 delta_h -11.810 #kJ/mol #99kon/kon -analytic -1.0339782E+3 -1.3957008E-1 5.5526821E+4 3.7431693E+2 -2.8069366E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 99kon/kon; S°: 99kon/kon; V°: 63wyc; Larnite(alpha) Ca2SiO4 + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4 log_k 39.044 delta_h -238.161 #kJ/mol #95rob/hem -analytic -8.9908942E+2 -1.301379E-1 6.3335055E+4 3.2296168E+2 -3.0793446E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del,60kel; Cp: 78hel/del,60kel; V°: 78hel/del,60kel; Larnite(beta) Ca2SiO4 + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4 log_k 39.322 #delta_h 0.000 #kJ/mol -analytic -9.0365527E+2 -1.3027777E-1 6.4015139E+4 3.243254E+2 -3.1477489E+6 #References = LogK/DGf: Internal calculation; V°: Default value; Larnite(gamma) Ca2SiO4 + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4 log_k 41.444 #delta_h 0.000 #kJ/mol -analytic -8.7896206E+2 -1.2907359E-1 6.3430487E+4 3.1585123E+2 -3.1477489E+6 #References = LogK/DGf: Internal calculation; V°: Default value; Laumontite Ca(Al2Si4)O12:4H2O + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 4.000H4SiO4 log_k 11.695 delta_h -204.244 #kJ/mol #96kis/nav -analytic -2.6447429E+3 -3.6684244E-1 1.6419074E+5 9.3900001E+2 -9.6343473E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 96kis/nav; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Laurelite PbF2 = 2.000F- + 1.000Pb+2 log_k -7.522 delta_h 6.530 #kJ/mol #98cha -analytic -1.6567757E+3 -2.6526991E-1 9.0348124E+4 6.0072066E+2 -5.4339707E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan; Laurionite PbClOH + 1.000H+ = 1.000Cl- + 1.000Pb+2 + 1.000H2O log_k 0.621 delta_h 6.285 #kJ/mol #Internal calculation -analytic -9.4122516E+2 -1.4578714E-1 5.1245015E+4 3.4241021E+2 -3.0077762E+6 #References = LogK/DGf: 99lot/och; DHf/DHr: Internal calculation; S°: 78ric/nri; V°: 90rob/cam; Laurite RuS2 + 0.750H2O = 1.000Ru+2 + 1.500HS- + 0.250S2O3-2 log_k -70.817 delta_h 373.889 #kJ/mol #Internal calculation -analytic -1.5922392E+3 -2.5764375E-1 6.7489717E+4 5.7815639E+2 -5.2209877E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Leonhardtite MgSO4:4H2O = 1.000Mg+2 + 1.000SO4-2 + 4.000H2O log_k -0.886 delta_h -24.030 #kJ/mol #74nau/ryz -analytic -1.8009396E+3 -2.6450971E-1 9.9216758E+4 6.5010323E+2 -5.5554353E+6 #References = LogK/DGf: 80har/wea; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 95rob/hem; Leonite K2Mg(SO4)2:4H2O = 2.000K+ + 1.000Mg+2 + 2.000SO4-2 + 4.000H2O log_k -3.976 delta_h 15.290 #kJ/mol #74nau/ryz -analytic -3.3213159E+3 -4.9919289E-1 1.8191661E+5 1.2025484E+3 -1.0632072E+7 #References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 63wyc; Lepidocrocite FeOOH + 3.000H+ = 1.000Fe+3 + 2.000H2O log_k 1.849 delta_h -71.260 #kJ/mol #03maj/gre -analytic -4.7832566E+2 -7.6621598E-2 2.7558432E+4 1.7164011E+2 -1.2555405E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 03maj/gre; S°: 03maj/gre; Cp: 03maj/gre; V°: 63wyc; Libenthenite Cu2PO4OH + 3.000H+ = 2.000Cu+2 + 1.000H2PO4- + 1.000H2O log_k 6.872 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Lime CaO + 2.000H+ = 1.000Ca+2 + 1.000H2O log_k 32.701 delta_h -193.910 #kJ/mol #89cox/wag -analytic -2.8484757E+2 -4.5719864E-2 2.4808995E+4 1.0380296E+2 -7.8972712E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Linnaeite Co3S4 + 2.000H+ + 0.750H2O = 3.000Co+2 + 3.500HS- + 0.250S2O3-2 log_k -49.969 delta_h 195.951 #kJ/mol #95rob/hem -analytic -3.5226763E+3 -5.6829546E-1 1.8101478E+5 1.2781825E+3 -1.1357129E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 87pan/mah; V°: 95rob/hem; Litharge PbO + 2.000H+ = 1.000Pb+2 + 1.000H2O log_k 12.632 delta_h -65.501 #kJ/mol #98cha -analytic -3.7745355E+2 -6.0261596E-2 2.3503756E+4 1.3816402E+2 -1.1251442E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 97asho/sas; Lizardite Mg3Si2O5(OH)4 + 6.000H+ = 3.000Mg+2 + 2.000H4SiO4 + 1.000H2O log_k 33.093 delta_h -242.552 #kJ/mol #04eva -analytic -1.8045338E+3 -2.475614E-1 1.1546724E+5 6.4405193E+2 -6.1786442E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 04eva; S°: 04eva; Cp: 95rob/hem; V°: 95rob/hem; Loellingite FeAs2 + 2.000H+ + 2.000H2O = 2.000AsH3 + 1.000Fe+2 + 1.000O2 log_k -119.078 delta_h 691.640 #kJ/mol #Internal calculation -analytic 1.8913297E+2 2.9442437E-2 -5.0784902E+4 -6.5254355E+1 1.3166945E+6 #References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok; Mackinawite FeS + 1.000H+ = 1.000Fe+2 + 1.000HS- log_k -3.540 delta_h -10.805 #kJ/mol #Internal calculation -analytic -9.7649376E+2 -1.5351306E-1 5.3325155E+4 3.5339847E+2 -3.0749343E+6 #References = LogK/DGf: 08bla; DHf/DHr: Internal calculation; S°: 08bla; V°: 63wyc; Maghemite(disordered) Fe2O3 + 6.000H+ = 2.000Fe+3 + 3.000H2O log_k 2.840 delta_h -147.390 #kJ/mol #03maj/gre -analytic -9.4710744E+2 -1.5337346E-1 5.4980194E+4 3.3936381E+2 -2.5301239E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 03maj/gre; S°: 03maj/gre; Cp: 03maj/gre; V°: 63wyc; Magnesiochromite MgCr2O4 + 8.000H+ = 2.000Cr+3 + 1.000Mg+2 + 4.000H2O log_k 22.180 delta_h -307.720 #kJ/mol #95rob/hem -analytic -1.3851604E+3 -2.1817938E-1 8.6553199E+4 4.9517316E+2 -3.8387458E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Magnesioferrite MgFe2O4 + 8.000H+ = 2.000Fe+3 + 1.000Mg+2 + 4.000H2O log_k 19.257 delta_h -270.279 #kJ/mol #73bar/kna -analytic -1.3893653E+3 -2.1583905E-1 8.541145E+4 4.9718785E+2 -3.8896199E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 73bar/kna; S°: 73bar/kna; Cp: 73bar/kna; V°: 73bar/kna; Magnesite(Natur) MgCO3 + 1.000H+ = 1.000HCO3- + 1.000Mg+2 log_k 1.415 delta_h -38.990 #kJ/mol #99kon/kon -analytic -9.327102E+2 -1.4911589E-1 5.208943E+4 3.380952E+2 -2.9085567E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 99kon/kon; S°: 99kon/kon; Cp: 95rob/hem; V°: 78hel/del; Magnesite(Synth) MgCO3 + 1.000H+ = 1.000HCO3- + 1.000Mg+2 log_k 2.227 delta_h -43.630 #kJ/mol #95rob/hem -analytic -9.3271072E+2 -1.4911589E-1 5.2331793E+4 3.380952E+2 -2.9085567E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del; Magnetite Fe3O4 + 8.000H+ = 2.000Fe+3 + 1.000Fe+2 + 4.000H2O log_k 10.362 delta_h -215.594 #kJ/mol #90hem -analytic -1.3520774E+3 -2.1498134E-1 8.0017747E+4 4.8502632E+2 -3.7344997E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 90hem; S°: 90hem; Cp: 90hem; V°: 78hel/del; Magnetite(am) Fe3O4 + 8.000H+ = 2.000Fe+3 + 1.000Fe+2 + 4.000H2O log_k 14.594 delta_h -239.752 #kJ/mol #Internal calculation -analytic -1.3520774E+3 -2.1498134E-1 8.127961E+4 4.8502632E+2 -3.7344997E+6 #References = LogK/DGf: 98bre/lin; DHf/DHr: Internal calculation; S°: 90hem; Cp: 90hem; V°: 78hel/del; Malachite Cu2(OH)2(CO3) + 3.000H+ = 1.000HCO3- + 2.000Cu+2 + 2.000H2O log_k 5.172 delta_h -65.926 #kJ/mol #Internal calculation -analytic -1.2854962E+3 -2.0294982E-1 7.1071353E+4 4.6679919E+2 -3.7567222E+6 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 78hel/del; Manganosite MnO + 2.000H+ = 1.000Mn+2 + 1.000H2O log_k 18.357 delta_h -121.934 #kJ/mol #Internal calculation -analytic -3.2766336E+2 -5.056928E-2 2.3347901E+4 1.1844095E+2 -9.1431959E+5 #References = LogK/DGf: 78hel/del,82wag/eva; DHf/DHr: Internal calculation; S°: 78hel/del,82wag/eva; Cp: 78hel/del,82wag/eva; V°: 78hel/del,82wag/eva; Mansfieldite AlAsO4:2H2O + 2.000H+ = 1.000Al+3 + 1.000H2AsO4- + 2.000H2O log_k -2.738 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Marcassite FeS2 + 0.750H2O = 1.000Fe+2 + 1.500HS- + 0.250S2O3-2 log_k -22.862 delta_h 103.451 #kJ/mol #76gro/wes -analytic -1.5907157E+3 -2.5758554E-1 8.1459617E+4 5.7789197E+2 -5.2020274E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 76gro/wes; S°: 76gro/wes; Cp: 95rob/hem; V°: 95rob/hem; Margarite CaAl2(Al2Si2)O10(OH)2 + 14.000H+ = 4.000Al+3 + 1.000Ca+2 + 2.000H4SiO4 + 4.000H2O log_k 37.000 delta_h -513.642 #kJ/mol #95rob/hem -analytic -2.9900115E+3 -4.5742401E-1 1.8786785E+5 1.0668773E+3 -9.4793863E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Massicot PbO + 2.000H+ = 1.000Pb+2 + 1.000H2O log_k 12.744 delta_h -66.848 #kJ/mol #98cha -analytic -3.6351679E+2 -5.7235197E-2 2.2991772E+4 1.327999E+2 -1.1017698E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 97asho/sas; Melanothallite CuCl2 = 1.000Cu+2 + 2.000Cl- log_k 3.730 delta_h -48.709 #kJ/mol #Internal calculation -analytic -1.5642954E+3 -2.5355582E-1 8.7639599E+4 5.6848225E+2 -5.0663809E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 98cha; Cp: 98cha; V°: 84pan/stu; Melanterite FeSO4:7H2O = 1.000Fe+2 + 1.000SO4-2 + 7.000H2O log_k -2.312 delta_h 12.450 #kJ/mol #95par/kho -analytic -1.8027011E+3 -2.5441513E-1 9.6927317E+4 6.5116352E+2 -5.3437468E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95par/kho; S°: 95par/kho; V°: 95rob/hem; Mercallite KHSO4 = 1.000K+ + 1.000SO4-2 + 1.000H+ log_k -1.400 delta_h -0.590 #kJ/mol #74nau/ryz -analytic -1.38445E+3 -2.2459036E-1 7.7601709E+4 5.0277305E+2 -4.8309052E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; Cp: 74nau/ryz; V°: 63wyc; Merlinoite(K) K1.04Al1.04Si1.96O6:1.69H2O + 4.160H+ + 0.150H2O = 1.040Al+3 + 1.040K+ + 1.960H4SiO4 log_k 9.484 delta_h -101.054 #kJ/mol #09bla -analytic -1.2577118E+3 -1.6847568E-1 7.978458E+4 4.4582039E+2 -4.74026E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 09bla; V°: 97coo/alb; Merlinoite(Na) Na1.04Al1.04Si1.96O6:2.27H2O + 4.160H+ = 1.040Al+3 + 1.040Na+ + 1.960H4SiO4 + 0.430H2O log_k 10.301 delta_h -110.734 #kJ/mol #09bla -analytic -1.3169697E+3 -1.7554408E-1 8.3524532E+4 4.6666888E+2 -4.9135999E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 09bla; V°: 97coo/alb; Merwinite Ca3Mg(SiO4)2 + 8.000H+ = 3.000Ca+2 + 1.000Mg+2 + 2.000H4SiO4 log_k 69.285 delta_h -449.547 #kJ/mol #Internal calculation -analytic -1.8969057E+3 -2.7166913E-1 1.3072527E+5 6.7957207E+2 -6.4734374E+6 #References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Metacinnabar HgS + 0.375H2O = 0.500Hg2+2 + 0.750HS- + 0.125S2O3-2 log_k -26.850 delta_h 146.269 #kJ/mol #Internal calculation -analytic -7.4104658E+2 -1.1971387E-1 3.278079E+4 2.6955896E+2 -2.405793E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Mg(element) Mg + 0.500O2 + 2.000H+ = 1.000Mg+2 + 1.000H2O log_k 122.773 delta_h -746.763 #kJ/mol #89cox/wag -analytic -4.3311436E+2 -6.6018737E-2 6.2651382E+4 1.5416155E+2 -1.4245392E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Mg3(PO4)2:22H2O Mg3(PO4)2:22H2O + 4.000H+ = 3.000Mg+2 + 2.000H2PO4- + 22.000H2O log_k 16.022 #References = LogK/DGf: 63tay/fra; #References = LogK/DGf: 63tay/fra; V°: 63wyc; MgCl2.FeCl2:8H2O MgFeCl4:8H2O = 4.000Cl- + 1.000Fe+2 + 1.000Mg+2 + 8.000H2O log_k 8.598 #References = LogK/DGf: 04chr; #References = LogK/DGf: 04chr; V°: Default value; MgHPO4 MgHPO4 + 1.000H+ = 1.000Mg+2 + 1.000H2PO4- log_k -5.815 #References = LogK/DGf: 70web/rac; #References = LogK/DGf: 70web/rac; V°: Default value; MgSO4 MgSO4 = 1.000Mg+2 + 1.000SO4-2 log_k 9.104 delta_h -114.550 #kJ/mol #98cha -analytic -1.6958699E+3 -2.6892242E-1 9.9244946E+4 6.1254845E+2 -5.6382331E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan; Microcline K(AlSi3)O8 + 4.000H+ + 4.000H2O = 1.000Al+3 + 1.000K+ + 3.000H4SiO4 log_k 0.015 delta_h -49.203 #kJ/mol #95rob/hem -analytic -1.6018728E+3 -2.1339241E-1 9.9207574E+4 5.6723025E+2 -6.2943433E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Mimetite Pb5(AsO4)3Cl + 6.000H+ = 3.000H2AsO4- + 1.000Cl- + 5.000Pb+2 log_k -19.800 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Minium Pb3O4 + 6.000H+ = 3.000Pb+2 + 0.500O2 + 3.000H2O log_k 30.534 delta_h -142.109 #kJ/mol #98cha -analytic -8.015252E+2 -1.2285091E-1 5.0264712E+4 2.9359866E+2 -2.3461313E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 82pan; Minnesotaite Fe3Si4O10(OH)2 + 6.000H+ + 4.000H2O = 3.000Fe+2 + 4.000H4SiO4 log_k 14.940 delta_h -139.134 #kJ/mol #83miy/kle -analytic -2.3397027E+3 -3.1209647E-1 1.4691034E+5 8.3066215E+2 -8.9306193E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 83miy/kle; S°: 83miy/kle; Cp: 83miy/kle; V°: 83miy/kle; Mirabilite Na2SO4:10H2O = 2.000Na+ + 1.000SO4-2 + 10.000H2O log_k -1.220 delta_h 79.471 #kJ/mol #Internal calculation -analytic -1.5883646E+3 -2.3177636E-1 8.4305192E+4 5.7822353E+2 -5.0925784E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 74nau/ryz; V°: 63wyc; Mn3(PO4)2 Mn3(PO4)2 + 4.000H+ = 3.000Mn+2 + 2.000H2PO4- log_k 0.817 #References = LogK/DGf: 76plu/jon; #References = LogK/DGf: 76plu/jon; V°: Default value; MnHPO4 MnHPO4 + 1.000H+ = 1.000Mn+2 + 1.000H2PO4- log_k -4.119 #References = LogK/DGf: 69wag/eva; #References = LogK/DGf: 69wag/eva; V°: Default value; Monetite CaHPO4 + 1.000H+ = 1.000Ca+2 + 1.000H2PO4- log_k 0.300 delta_h -24.098 #kJ/mol #Internal calculation -analytic -8.7069488E+2 -1.4527553E-1 4.7592522E+4 3.1728589E+2 -2.7041882E+6 #References = LogK/DGf: 84nan; DHf/DHr: Internal calculation; S°: 84nan; Cp: 70gre/mor, after 64a,bega/wak; V°: 84nri; Monocarboaluminate Ca4Al2CO9:10.68H2O + 13.000H+ = 2.000Al+3 + 1.000HCO3- + 4.000Ca+2 + 16.680H2O log_k 80.567 delta_h -530.628 #kJ/mol #61ber/new -analytic -2.7332194E+3 -4.22965E-1 1.7042075E+5 9.9220207E+2 -7.7194996E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: 61ber/new; S°: Internal calculation; Cp: 10bbla/bou; V°: 97tay; Monohydrocalcite CaCO3:H2O + 1.000H+ = 1.000HCO3- + 1.000Ca+2 + 1.000H2O log_k 2.728 delta_h -20.470 #kJ/mol #73hul/tur -analytic -9.0250204E+2 -1.374825E-1 4.9363013E+4 3.2772564E+2 -2.6916597E+6 #References = LogK/DGf: 73hul/tur; DHf/DHr: 73hul/tur; S°: Internal calculation; V°: 95rob/hem; Monosulfate(Fe) Ca4Fe2SO10:12H2O + 12.000H+ = 4.000Ca+2 + 2.000Fe+3 + 1.000SO4-2 + 18.000H2O log_k 66.068 delta_h -477.608 #kJ/mol #Internal calculation -analytic -3.4469231E+3 -5.3737284E-1 2.0816052E+5 1.2491877E+3 -1.031149E+7 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay; Monosulfoaluminate Ca4Al2SO10:12H2O + 12.000H+ = 2.000Al+3 + 4.000Ca+2 + 1.000SO4-2 + 18.000H2O log_k 73.088 delta_h -539.403 #kJ/mol #10bbla/bou -analytic -3.5426334E+3 -5.7054376E-1 2.1351144E+5 1.2875254E+3 -1.0328468E+7 #References = LogK/DGf: 10bbla/bou; DHf/DHr: 10bbla/bou; S°: Internal calculation; Cp: 79ede/sat; V°: 97tay; Monteponite CdO + 2.000H+ = 1.000Cd+2 + 1.000H2O log_k 15.105 delta_h -103.400 #kJ/mol #89cox/wag -analytic -3.1106128E+2 -4.7317585E-2 2.1589627E+4 1.1222264E+2 -8.7346579E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 77bar/kna; V°: 95rob/hem; Monticellite CaMgSiO4 + 4.000H+ = 1.000Ca+2 + 1.000Mg+2 + 1.000H4SiO4 log_k 30.091 delta_h -206.036 #kJ/mol #Internal calculation -analytic -9.9945187E+2 -1.4199681E-1 6.7213519E+4 3.5752371E+2 -3.3979475E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Montmorillonite(HcCa) Ca0.3Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.300Ca+2 + 0.600Mg+2 + 4.000H4SiO4 log_k 6.903 delta_h -154.564 #kJ/mol #15bla/vie -analytic -2.3616529E+3 -3.1379357E-1 1.4899818E+5 8.3431323E+2 -9.0744862E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Montmorillonite(HcK) K0.6Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.600K+ + 0.600Mg+2 + 4.000H4SiO4 log_k 4.449 delta_h -119.628 #kJ/mol #15bla/vie -analytic -2.3324885E+3 -3.0832834E-1 1.4605682E+5 8.2462838E+2 -9.022722E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Montmorillonite(HcMg) Mg0.3Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.900Mg+2 + 4.000H4SiO4 log_k 5.996 delta_h -156.964 #kJ/mol #15bla/vie -analytic -2.3909331E+3 -3.1726069E-1 1.5070041E+5 8.4429278E+2 -9.163021E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Montmorillonite(HcNa) Na0.6Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.600Mg+2 + 0.600Na+ + 4.000H4SiO4 log_k 5.472 delta_h -135.658 #kJ/mol #15bla/vie -analytic -2.3671642E+3 -3.1193536E-1 1.486659E+5 8.3634354E+2 -9.1085654E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Montmorillonite(MgCa) Ca0.17Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.170Ca+2 + 0.340Mg+2 + 4.000H4SiO4 log_k 4.222 delta_h -146.668 #kJ/mol #15bla/vie -analytic -2.3648299E+3 -3.1580182E-1 1.4861699E+5 8.3532612E+2 -9.0862785E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Montmorillonite(MgK) K0.34Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.340K+ + 0.340Mg+2 + 4.000H4SiO4 log_k 2.830 delta_h -126.865 #kJ/mol #15bla/vie -analytic -2.3483045E+3 -3.1270489E-1 1.4694997E+5 8.2983827E+2 -9.056946E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Montmorillonite(MgMg) Mg0.17Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.510Mg+2 + 4.000H4SiO4 log_k 3.708 delta_h -148.028 #kJ/mol #15bla/vie -analytic -2.3814282E+3 -3.1776702E-1 1.4958186E+5 8.4098328E+2 -9.1364559E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Montmorillonite(MgNa) Na0.34Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.340Mg+2 + 0.340Na+ + 4.000H4SiO4 log_k 3.411 delta_h -135.953 #kJ/mol #15bla/vie -analytic -2.3679565E+3 -3.1474933E-1 1.4842879E+5 8.3647775E+2 -9.1055977E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Moorhouseite CoSO4:6H2O = 1.000Co+2 + 1.000SO4-2 + 6.000H2O log_k -2.192 delta_h 1.570 #kJ/mol #74nau/ryz -analytic -1.7907128E+3 -2.5657242E-1 9.6944118E+4 6.4674796E+2 -5.3753538E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: 94pan; MordeniteB(Ca) Ca0.515Al1.03Si4.97O12:3.1H2O + 4.120H+ + 4.780H2O = 1.030Al+3 + 0.515Ca+2 + 4.970H4SiO4 log_k -2.898 delta_h -56.278 #kJ/mol #09bla -analytic -2.3577543E+3 -2.9682032E-1 1.4847577E+5 8.2993876E+2 -9.6241393E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 95rob/hem; MordeniteJ Ca0.289Na0.362Al0.94Si5.06O12:3.468H2O + 3.760H+ + 4.772H2O = 0.940Al+3 + 0.289Ca+2 + 0.362Na+ + 5.060H4SiO4 log_k -4.160 delta_h -29.442 #kJ/mol #92joh/tas -analytic -2.3112502E+3 -2.9430315E-1 1.4403365E+5 8.1541676E+2 -9.418252E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 92joh/tas; S°: 92joh/tas; Cp: 92joh/tas; V°: 92joh/tas; MSH06 Mg0.82SiO2.385(OH)0.87 + 1.640H+ + 0.745H2O = 0.820Mg+2 + 1.000H4SiO4 log_k 9.119 delta_h -68.719 #kJ/mol #Internal calculation -analytic -6.5663083E+2 -8.4167939E-2 4.2529241E+4 2.3260872E+2 -2.4333819E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; MSH12 Mg1.07SiO2.075(OH)1.99 + 2.140H+ = 1.070Mg+2 + 1.000H4SiO4 + 0.065H2O log_k 12.730 delta_h -81.218 #kJ/mol #Internal calculation -analytic -7.6313186E+2 -9.8017026E-2 4.8779471E+4 2.7151823E+2 -2.7001912E+6 #References = LogK/DGf: 18roo/vie; DHf/DHr: Internal calculation; S°: 18roo/vie; Cp: 18roo/vie; V°: 18roo/vie; Mullite Al6Si2O13 + 18.000H+ = 6.000Al+3 + 2.000H4SiO4 + 5.000H2O log_k 50.510 delta_h -758.072 #kJ/mol #95rob/hem -analytic -3.6870561E+3 -5.7421808E-1 2.3549563E+5 1.3126483E+3 -1.1480522E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Muscovite(disordered) KAl2(AlSi3)O10(OH)2 + 10.000H+ = 3.000Al+3 + 1.000K+ + 3.000H4SiO4 log_k 14.016 delta_h -269.123 #kJ/mol #95has/cyg -analytic -2.5862792E+3 -3.7607072E-1 1.5986956E+5 9.2024545E+2 -8.9668534E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95has/cyg; S°: 76rob/hem; Cp: 76rob/hem; V°: 95rob/hem; Muscovite(ordered) KAl2(AlSi3)O10(OH)2 + 10.000H+ = 3.000Al+3 + 1.000K+ + 3.000H4SiO4 log_k 11.353 delta_h -253.923 #kJ/mol #06bla/pia -analytic -2.5862792E+3 -3.7607072E-1 1.5907562E+5 9.2024545E+2 -8.9668534E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 06bla/pia; S°: 76rob/hem; Cp: 76rob/hem; V°: 95rob/hem; Na(element) Na + 0.250O2 + 1.000H+ = 1.000Na+ + 0.500H2O log_k 67.390 delta_h -380.222 #kJ/mol #By convention -analytic -1.7220031E+2 -2.3093547E-2 2.9895625E+4 6.1852278E+1 -6.0843298E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Na2CO3 Na2CO3 + 1.000H+ = 1.000HCO3- + 2.000Na+ log_k 11.449 delta_h -41.410 #kJ/mol #95rob/hem -analytic -8.4894024E+2 -1.2888909E-1 4.9144859E+4 3.0909685E+2 -2.7428181E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 98cha; V°: 95rob/hem; Na2CO3:7H2O Na2CO3:7H2O + 1.000H+ = 1.000HCO3- + 2.000Na+ + 7.000H2O log_k 9.874 delta_h 27.981 #kJ/mol #Internal calculation -analytic -1.0930495E+3 -1.3426028E-1 5.7027772E+4 3.9744299E+2 -2.8237438E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; Na2HPO4 Na2HPO4 + 1.000H+ = 2.000Na+ + 1.000H2PO4- log_k 9.240 delta_h -35.180 #kJ/mol #82wag/eva -analytic -8.4128991E+2 -1.2884794E-1 4.834671E+4 3.0612661E+2 -2.7290563E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 67and/cou; Cp: 67and/cou; V°: 84nri; Na2O Na2O + 2.000H+ = 2.000Na+ + 1.000H2O log_k 67.458 delta_h -351.710 #kJ/mol #95rob/hem -analytic -2.7083762E+2 -3.4494312E-2 3.3535999E+4 9.9078094E+1 -8.0561224E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Na2SO4.FeSO4:4H2O Na2Fe(SO4)2:4H2O = 1.000Fe+2 + 2.000Na+ + 2.000SO4-2 + 4.000H2O log_k -3.206 #References = LogK/DGf: 04chr; #References = LogK/DGf: 04chr; V°: Default value; Na3PO4 Na3PO4 + 2.000H+ = 3.000Na+ + 1.000H2PO4- log_k 23.521 delta_h -106.220 #kJ/mol #74nau/ryz -analytic -1.0219976E+3 -1.5431636E-1 6.2024517E+4 3.7196804E+2 -3.2813724E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 67and/cou; Cp: 67and/cou; V°: Default value; NaFeS2 NaFeS2 + 0.875H+ + 0.500H2O = 1.000Fe+2 + 1.000Na+ + 1.875HS- + 0.125SO4-2 log_k -1.228 delta_h -13.555 #kJ/mol #14las/pia -analytic -1.8421177E+3 -2.9269387E-1 1.0159357E+5 6.688121E+2 -6.0022879E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14las/pia; S°: 14las/pia; Cp: 14las/pia; V°: Default value; NaH2PO4 NaH2PO4 = 1.000Na+ + 1.000H2PO4- log_k 2.301 delta_h -6.140 #kJ/mol #82wag/eva -analytic -7.3924322E+2 -1.1613394E-1 4.0935497E+4 2.6908466E+2 -2.3967148E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 67and/cou; Cp: 67and/cou; V°: Default value; Nahcolite NaHCO3 = 1.000HCO3- + 1.000Na+ log_k -0.413 delta_h 18.730 #kJ/mol #82van -analytic -7.1133666E+2 -1.1020588E-1 3.828212E+4 2.5918687E+2 -2.3075259E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 82van; S°: Internal calculation; Cp: 74nau/ryz; V°: 95rob/hem; Nantokite CuCl = 1.000Cl- + 1.000Cu+ log_k -6.800 delta_h 41.847 #kJ/mol #Internal calculation -analytic -7.2286429E+2 -1.1683546E-1 3.6968085E+4 2.637667E+2 -2.290454E+6 #References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu; Natrolite Na2(Al2Si3)O10:2H2O + 8.000H+ = 2.000Al+3 + 2.000Na+ + 3.000H4SiO4 log_k 19.326 delta_h -215.463 #kJ/mol #83joh/flo -analytic -2.303612E+3 -3.1993458E-1 1.4352482E+5 8.1980235E+2 -8.1431211E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 83joh/flo; S°: 83joh/flo; Cp: 83joh/flo; V°: 95rob/hem; Natron Na2CO3:10H2O + 1.000H+ = 1.000HCO3- + 2.000Na+ + 10.000H2O log_k 9.507 delta_h 50.170 #kJ/mol #Internal calculation -analytic -9.7679183E+2 -1.3449576E-1 5.0830177E+4 3.5873581E+2 -2.8227861E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: Default value; Nepheline Na(AlSi)O4 + 4.000H+ = 1.000Al+3 + 1.000Na+ + 1.000H4SiO4 log_k 14.077 delta_h -144.506 #kJ/mol #Internal calculation -analytic -9.7409139E+2 -1.3955693E-1 6.2423687E+4 3.467383E+2 -3.3400695E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Nesquehonite(alpha) MgCO3:3H2O + 1.000H+ = 1.000HCO3- + 1.000Mg+2 + 3.000H2O log_k 5.234 delta_h -37.120 #kJ/mol #73rob/hem -analytic -3.106996E+3 -5.6863644E-1 1.5082727E+5 1.1555717E+3 -7.4221439E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 73rob/hem; S°: 72rob/hem; Cp: 78hel/del; V°: 78hel/del; Nesquehonite(beta) MgCO3:3H2O + 1.000H+ = 1.000HCO3- + 1.000Mg+2 + 3.000H2O log_k 5.238 #delta_h 0.000 #kJ/mol -analytic -9.6246266E+2 -1.5254091E-1 5.3323715E+4 3.504019E+2 -2.9080803E+6 #References = LogK/DGf: Internal calculation; V°: Default value; Newberyite MgHPO4:3H2O + 1.000H+ = 1.000Mg+2 + 1.000H2PO4- + 3.000H2O log_k 1.413 #References = LogK/DGf: 01wen/mus; #References = LogK/DGf: 01wen/mus; V°: 84nri; Ni(alpha) Ni + 0.500O2 + 2.000H+ = 1.000Ni+2 + 1.000H2O log_k 50.944 delta_h -339.263 #kJ/mol #By convention -analytic -4.174024E+2 -6.5506473E-2 4.0498606E+4 1.486164E+2 -1.395407E+6 #References = LogK/DGf: Internal calculation; S°: 78hel/del; Cp: 98cha; V°: 78hel/del; Ni(OH)2 Ni(OH)2 + 2.000H+ = 1.000Ni+2 + 2.000H2O log_k 11.672 delta_h -82.100 #kJ/mol #10pal/gam -analytic -3.2916428E+2 -5.110766E-2 2.1713318E+4 1.189204E+2 -9.7903196E+5 #References = LogK/DGf: 10pal/gam; DHf/DHr: 10pal/gam; S°: Internal calculation; Cp: 10pal/gam; V°: 04roi; Ni11As8 Ni11As8 + 22.000H+ + 1.000H2O = 11.000Ni+2 + 8.000AsH3 + 0.500O2 log_k -220.274 delta_h 913.615 #kJ/mol #05gam/bug -analytic -2.4033234E+3 -3.7939392E-1 6.5947045E+4 8.6274011E+2 -5.3172488E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value; Ni2SiO4 Ni2SiO4 + 4.000H+ = 2.000Ni+2 + 1.000H4SiO4 log_k 19.544 delta_h -181.861 #kJ/mol #05gam/bug -analytic -1.0540534E+3 -1.5033032E-1 6.8937158E+4 3.7498951E+2 -3.6166446E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; Ni3(AsO3)2 Ni3(AsO3)2 + 4.000H+ = 2.000H2AsO3- + 3.000Ni+2 log_k 9.884 #References = LogK/DGf: 05gam/bug; #References = LogK/DGf: 05gam/bug; V°: Default value; Ni3(AsO4)2:8H2O Ni3(AsO4)2:8H2O + 4.000H+ = 2.000H2AsO4- + 3.000Ni+2 + 8.000H2O log_k 8.479 delta_h -105.439 #kJ/mol #05gam/bug -analytic -2.4131791E+3 -3.4422466E-1 1.3257814E+5 8.7084587E+2 -6.6876022E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value; Ni3S2 Ni3S2 + 0.500O2 + 4.000H+ = 3.000Ni+2 + 2.000HS- + 1.000H2O log_k 25.556 delta_h -273.663 #kJ/mol #05gam/bug -analytic -2.3714699E+3 -3.7830592E-1 1.4299917E+5 8.5539557E+2 -7.6825603E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; Ni5As2 Ni5As2 + 1.000O2 + 10.000H+ = 5.000Ni+2 + 2.000AsH3 + 2.000H2O log_k 49.272 delta_h -476.089 #kJ/mol #05gam/bug -analytic -1.5917824E+3 -2.5006838E-1 1.0794148E+5 5.6849757E+2 -4.7233651E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value; Ni9S8 Ni9S8 + 0.94444O2 + 10.000H+ = 9.000Ni+2 + 7.55556HS- + 0.22222S2O3-2 + 1.22222H2O log_k -1.647 delta_h -381.495 #kJ/mol #05gam/bug -analytic -8.4080802E+3 -1.3465873E+0 4.7613878E+5 3.0378034E+3 -2.7192974E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value; NiAs NiAs + 2.000H+ + 0.500H2O = 1.000Ni+2 + 1.000AsH3 + 0.250O2 log_k -42.629 delta_h 219.371 #kJ/mol #05gam/bug -analytic -1.3859649E+2 -2.1691118E-2 -5.9999667E+3 5.0134625E+1 -1.3298174E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; NiCl2 NiCl2 = 2.000Cl- + 1.000Ni+2 log_k 8.596 delta_h -88.760 #kJ/mol #05gam/bug -analytic -1.5673181E+3 -2.5504198E-1 9.0038499E+4 5.6886271E+2 -5.1246883E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; NiCl2:2H2O NiCl2:2H2O = 2.000Cl- + 1.000Ni+2 + 2.000H2O log_k 4.857 delta_h -51.950 #kJ/mol #05gam/bug -analytic -1.5891861E+3 -2.5905294E-1 8.9486365E+4 5.7780587E+2 -5.20936E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value; NiCl2:4H2O NiCl2:4H2O = 2.000Cl- + 1.000Ni+2 + 4.000H2O log_k 3.757 delta_h -22.930 #kJ/mol #05gam/bug -analytic -1.7188548E+3 -2.5920992E-1 9.3906938E+4 6.2378883E+2 -5.2087215E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value; NiCl2:6H2O NiCl2:6H2O = 2.000Cl- + 1.000Ni+2 + 6.000H2O log_k 2.981 delta_h -3.940 #kJ/mol #05gam/bug -analytic -1.769494E+3 -2.5936691E-1 9.5269537E+4 6.4210932E+2 -5.2080831E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value; NiCO3 NiCO3 + 1.000H+ = 1.000HCO3- + 1.000Ni+2 log_k -0.736 delta_h -36.110 #kJ/mol #05gam/bug -analytic -9.0949728E+2 -1.4698499E-1 5.0789653E+4 3.2922115E+2 -2.8801945E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; NiF2 NiF2 = 2.000F- + 1.000Ni+2 log_k -0.251 delta_h -72.900 #kJ/mol #05gam/bug -analytic -1.6994596E+3 -2.7222932E-1 9.5943104E+4 6.1436514E+2 -5.4783063E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; NiFe2O4 NiFe2O4 + 8.000H+ = 2.000Fe+3 + 1.000Ni+2 + 4.000H2O log_k 10.780 delta_h -230.320 #kJ/mol #95rob/hem -analytic -1.3772254E+3 -2.176043E-1 8.2334916E+4 4.9303863E+2 -3.8455402E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 04roi; NiS2 NiS2 + 0.750H2O = 1.000Ni+2 + 1.500HS- + 0.250S2O3-2 log_k -25.241 delta_h 95.351 #kJ/mol #05gam/bug -analytic -1.6103276E+3 -2.6122591E-1 8.3081707E+4 5.8362549E+2 -5.3184534E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value; NiSO4 NiSO4 = 1.000Ni+2 + 1.000SO4-2 log_k 4.675 delta_h -95.560 #kJ/mol #05gam/bug -analytic -1.665992E+3 -2.6825807E-1 9.6194818E+4 6.0221013E+2 -5.5220764E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; NiSO4:6H2O NiSO4:6H2O = 1.000Ni+2 + 1.000SO4-2 + 6.000H2O log_k -2.316 #delta_h 0.000 #kJ/mol #05gam/bug -analytic -1.6823835E+3 -2.5774702E-1 9.2401248E+4 6.0942968E+2 -5.4219841E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; NiSO4:7H2O NiSO4:7H2O = 1.000Ni+2 + 1.000SO4-2 + 7.000H2O log_k -2.331 delta_h 7.680 #kJ/mol #05gam/bug -analytic -1.6839128E+3 -2.5605608E-1 9.2041413E+4 6.1018541E+2 -5.3911476E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi; Nontronite(Ca) Ca0.17Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 0.170Ca+2 + 1.670Fe+3 + 3.660H4SiO4 log_k -2.807 delta_h -137.388 #kJ/mol #15bla/vie -analytic -2.4741658E+3 -3.3718972E-1 1.5169235E+5 8.7526886E+2 -9.1278051E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Nontronite(K) K0.34Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 1.670Fe+3 + 0.340K+ + 3.660H4SiO4 log_k -3.976 delta_h -118.855 #kJ/mol #15bla/vie -analytic -2.4544931E+3 -3.3365307E-1 1.4991391E+5 8.6864952E+2 -9.0880119E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Nontronite(Mg) Mg0.17Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 1.670Fe+3 + 0.170Mg+2 + 3.660H4SiO4 log_k -3.353 delta_h -138.568 #kJ/mol #15bla/vie -analytic -2.4893022E+3 -3.3895116E-1 1.525653E+5 8.804005E+2 -9.1731351E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Nontronite(Na) Na0.34Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 1.670Fe+3 + 0.340Na+ + 3.660H4SiO4 log_k -3.478 delta_h -127.473 #kJ/mol #15bla/vie -analytic -2.4754229E+3 -3.3587611E-1 1.5144038E+5 8.7574857E+2 -9.1409123E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Nontronite(Nau2) Ca0.247K0.02(Si3.458Al0.542)(Fe1.688Al0.276Mg0.068)O10(OH)2 + 8.168H+ + 1.832H2O = 0.818Al+3 + 0.247Ca+2 + 1.688Fe+3 + 0.020K+ + 0.068Mg+2 + 3.458H4SiO4 log_k 1.349 delta_h -179.453 #kJ/mol #13gai/bla -analytic -2.5155355E+3 -3.5487839E-1 1.5340261E+5 8.9268474E+2 -8.9527335E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 13gai/bla; S°: 13gai/bla; Cp: 09gai; V°: 13gai/bla; Okenite CaSi2O4(OH)2:H2O + 2.000H+ + 1.000H2O = 1.000Ca+2 + 2.000H4SiO4 log_k 9.190 delta_h -39.192 #kJ/mol #10abla/bou -analytic -9.6754502E+2 -1.2011494E-1 6.1769903E+4 3.4310498E+2 -3.8776397E+6 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 92wol; Olivenite Cu2AsO4(OH) + 3.000H+ = 1.000H2AsO4- + 2.000Cu+2 + 1.000H2O log_k 2.391 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Orpiment As2S3 + 6.000H2O = 2.000H2AsO3- + 3.000HS- + 5.000H+ log_k -65.110 delta_h 334.975 #kJ/mol #Internal calculation -analytic -2.5599772E+3 -4.2267991E-1 1.1988784E+5 9.3328822E+2 -8.0517057E+6 #References = LogK/DGf: 96pok/gou; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou; Otavite CdCO3 + 1.000H+ = 1.000HCO3- + 1.000Cd+2 log_k -1.773 delta_h -13.219 #kJ/mol #Internal calculation -analytic -8.8925402E+2 -1.4348661E-1 4.8437632E+4 3.2294259E+2 -2.7823139E+6 #References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 96arc; Cp: 96arc; V°: 95rob/hem; P(element) P + 1.500H2O = 1.000PH3 + 0.750O2 log_k -68.935 delta_h 408.486 #kJ/mol #89cox/wag -analytic 3.3404985E+2 5.1313372E-2 -4.2306256E+4 -1.1859734E+2 1.5176804E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Paragonite NaAl2(AlSi3)O10(OH)2 + 10.000H+ = 3.000Al+3 + 1.000Na+ + 3.000H4SiO4 log_k 16.804 delta_h -294.623 #kJ/mol #96rou/hov -analytic -2.6452559E+3 -3.8247258E-1 1.64246E+5 9.4070011E+2 -9.1107641E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 96rou/hov; S°: 84rob/hem; Cp: 84rob/hem; V°: 78hel/del; Pargasite Na(Ca2Mg4Al)(Al2Si6)O22(OH)2 + 22.000H+ = 3.000Al+3 + 2.000Ca+2 + 4.000Mg+2 + 1.000Na+ + 6.000H4SiO4 log_k 104.557 delta_h -940.614 #kJ/mol #Internal calculation -analytic -5.7962939E+3 -8.2700886E-1 3.7555969E+5 2.0652064E+3 -1.9772394E+7 #References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Pb(element) Pb + 0.500O2 + 2.000H+ = 1.000Pb+2 + 1.000H2O log_k 47.242 delta_h -278.843 #kJ/mol #By convention -analytic -3.7331236E+2 -5.7965165E-2 3.5805889E+4 1.344975E+2 -1.3389494E+6 #References = S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem; Pb(H2PO4)2 Pb(H2PO4)2 = 2.000H2PO4- + 1.000Pb+2 log_k -9.840 #References = LogK/DGf: 74nri; #References = LogK/DGf: 74nri; V°: Default value; Pb(OH)2 Pb(OH)2 + 2.000H+ = 1.000Pb+2 + 2.000H2O log_k 13.514 delta_h -56.140 #kJ/mol #52lat -analytic -3.5536959E+2 -4.807084E-2 2.2120649E+4 1.2942742E+2 -9.9884185E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 52lat; S°: 52lat; V°: Default value; Pb2SiO4 Pb2SiO4 + 4.000H+ = 2.000Pb+2 + 1.000H4SiO4 log_k 15.895 delta_h -79.140 #kJ/mol #98cha -analytic -9.8551984E+2 -1.3794931E-1 6.181618E+4 3.5389453E+2 -3.5981442E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan; Pb3(PO4)2 Pb3(PO4)2 + 4.000H+ = 2.000H2PO4- + 3.000Pb+2 log_k -5.480 delta_h -2.292 #kJ/mol #Internal calculation -analytic -2.0146212E+3 -3.2440847E-1 1.1078767E+5 7.3122905E+2 -6.6757837E+6 #References = LogK/DGf: 74nri; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz, 68,69,71,76wag/eva, 71par/wag, 60kel; V°: 82wag/eva,60kel; Pb4O(PO4)2 Pb4O(PO4)2 + 6.000H+ = 2.000H2PO4- + 4.000Pb+2 + 1.000H2O log_k 4.488 #References = LogK/DGf: 78ric/nri; #References = LogK/DGf: 78ric/nri; V°: Default value; PbHPO4 PbHPO4 + 1.000H+ = 1.000H2PO4- + 1.000Pb+2 log_k -4.225 delta_h 16.293 #kJ/mol #Internal calculation -analytic -9.3895452E+2 -1.4495658E-1 5.0201609E+4 3.4060327E+2 -2.9538662E+6 #References = LogK/DGf: 74nri; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: Default value; Pd(element) Pd + 0.500O2 + 2.000H+ = 1.000Pd+2 + 1.000H2O log_k 12.063 delta_h -101.834 #kJ/mol #By convention -analytic -4.2361301E+2 -6.6488438E-2 2.8339235E+4 1.5194195E+2 -1.379754E+6 #References = LogK/DGf: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Pd(OH)2(s) Pd(OH)2 + 2.000H+ = 1.000Pd+2 + 2.000H2O log_k -0.617 delta_h -8.148 #kJ/mol #Internal calculation -analytic -3.4050715E+2 -5.1805384E-2 1.7918515E+4 1.2345499E+2 -9.1063928E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Pd4S(s) Pd4S + 1.500O2 + 7.000H+ = 4.000Pd+2 + 1.000HS- + 3.000H2O log_k -8.837 delta_h -74.876 #kJ/mol #Internal calculation -analytic -2.2432047E+3 -3.5541282E-1 1.2538029E+5 8.086155E+2 -7.2056652E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; PdO(s) PdO + 2.000H+ = 1.000Pd+2 + 1.000H2O log_k 0.109 delta_h -22.551 #kJ/mol #Internal calculation -analytic -3.3626615E+2 -5.2414852E-2 1.8536004E+4 1.2139695E+2 -9.3834536E+5 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; PdS2 PdS2 + 0.750H2O = 1.000Pd+2 + 1.500HS- + 0.250S2O3-2 log_k -55.402 delta_h 283.030 #kJ/mol #Internal calculation -analytic -1.5914637E+3 -2.5792846E-1 7.1900011E+4 5.779375E+2 -5.1788755E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Pentahydrite MgSO4:5H2O = 1.000Mg+2 + 1.000SO4-2 + 5.000H2O log_k -1.275 delta_h -14.187 #kJ/mol #Internal calculation -analytic -1.8063993E+3 -2.6137294E-1 9.8854326E+4 6.520122E+2 -5.4996627E+6 #References = LogK/DGf: 80har/wea; DHf/DHr: Internal calculation; S°: 99yun/glu; V°: 63wyc; Periclase MgO + 2.000H+ = 1.000Mg+2 + 1.000H2O log_k 21.585 delta_h -151.230 #kJ/mol #89cox/wag -analytic -3.613142E+2 -5.4384296E-2 2.6720862E+4 1.2972311E+2 -1.0222234E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Philipsbornite PbAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Pb+2 + 6.000H2O log_k 8.943 #References = LogK/DGf: 93sch/got; #References = LogK/DGf: 93sch/got; V°: Default value; Phillipsite(Ca) Ca0.5AlSi3O8:3H2O + 4.000H+ + 1.000H2O = 1.000Al+3 + 0.500Ca+2 + 3.000H4SiO4 log_k 2.319 delta_h -76.540 #kJ/mol #Internal calculation -analytic -1.6547191E+3 -2.1495941E-1 1.0353289E+5 5.8439479E+2 -6.4154021E+6 #References = LogK/DGf: 09bla; DHf/DHr: Internal calculation; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Phillipsite(K) KAlSi3O8:3H2O + 4.000H+ + 1.000H2O = 1.000Al+3 + 1.000K+ + 3.000H4SiO4 log_k 0.039 delta_h -39.343 #kJ/mol #Internal calculation -analytic -1.5999198E+3 -2.0580731E-1 9.9368527E+4 5.6547382E+2 -6.3284609E+6 #References = LogK/DGf: 09bla; DHf/DHr: Internal calculation; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Phillipsite(Na) NaAlSi3O8:3H2O + 4.000H+ + 1.000H2O = 1.000Al+3 + 1.000Na+ + 3.000H4SiO4 log_k 1.449 delta_h -57.740 #kJ/mol #Internal calculation -analytic -1.664361E+3 -2.1153563E-1 1.0362077E+5 5.876435E+2 -6.4671724E+6 #References = LogK/DGf: 09bla; DHf/DHr: Internal calculation; S°: 09bla; Cp: 10vie; V°: 97coo/alb; Phlogopite KMg3(AlSi3)O10(OH)2 + 10.000H+ = 1.000Al+3 + 1.000K+ + 3.000Mg+2 + 3.000H4SiO4 log_k 41.098 delta_h -353.123 #kJ/mol #92cir/nav -analytic -2.7194067E+3 -3.8106546E-1 1.7318081E+5 9.69566E+2 -9.4102646E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 92cir/nav; S°: 84rob/hem; Cp: 84rob/hem; V°: 78hel/del; Phlogopite(Na) NaMg3AlSi3O10(OH)2 + 10.000H+ = 1.000Al+3 + 3.000Mg+2 + 1.000Na+ + 3.000H4SiO4 log_k 44.196 delta_h -384.183 #kJ/mol #98hol/pow -analytic -2.7791087E+3 -3.8785207E-1 1.7786448E+5 9.9009687E+2 -9.5602456E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow; Phosgenite Pb2(CO3)Cl2 + 1.000H+ = 1.000HCO3- + 2.000Cl- + 2.000Pb+2 log_k -9.573 delta_h 49.187 #kJ/mol #Internal calculation -analytic -2.4536433E+3 -3.8655162E-1 1.3191406E+5 8.9164594E+2 -7.9507146E+6 #References = LogK/DGf: 78ric/nri; DHf/DHr: Internal calculation; S°: 78ric/nri; V°: 90rob/cam; Picromerite K2Mg(SO4)2:6H2O = 2.000K+ + 1.000Mg+2 + 2.000SO4-2 + 6.000H2O log_k -4.324 delta_h 33.490 #kJ/mol #74nau/ryz -analytic -3.3496813E+3 -4.9577994E-1 1.8218177E+5 1.2128178E+3 -1.0569863E+7 #References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 63wyc; Pirssonite Na2Ca(CO3)2:2H2O + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 2.000Na+ + 2.000H2O log_k 11.746 delta_h -19.823 #kJ/mol #Internal calculation -analytic -1.803153E+3 -2.6502443E-1 9.8762262E+4 6.5611765E+2 -5.4095705E+6 #References = LogK/DGf: 99kon/kon; DHf/DHr: Internal calculation; S°: 99kon/kon; V°: 63wyc; Plattnerite PbO2 + 2.000H+ = 1.000Pb+2 + 0.500O2 + 1.000H2O log_k 6.561 delta_h -16.236 #kJ/mol #98cha -analytic -1.9048846E+2 -2.9141125E-2 1.0244404E+4 7.1138759E+1 -4.1340982E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 82pan; Plumbogummite PbAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2PO4- + 1.000Pb+2 + 6.000H2O log_k 9.651 #References = LogK/DGf: 04gab/vie; #References = LogK/DGf: 04gab/vie; V°: 63wyc; Plumbonacrite Pb10O(OH)6(CO3)6 + 14.000H+ = 6.000HCO3- + 10.000Pb+2 + 7.000H2O log_k 19.879 #References = LogK/DGf: 84tay/lop; #References = LogK/DGf: 84tay/lop; V°: 90rob/cam; Polyhalite K2MgCa2(SO4)4:2H2O = 2.000Ca+2 + 2.000K+ + 1.000Mg+2 + 4.000SO4-2 + 2.000H2O log_k -13.738 #References = LogK/DGf: 84har/mol; #References = LogK/DGf: 84har/mol; V°: 63wyc; Portlandite Ca(OH)2 + 2.000H+ = 1.000Ca+2 + 2.000H2O log_k 22.812 delta_h -130.108 #kJ/mol #Internal calculation -analytic -2.8492926E+2 -4.4710612E-2 2.1380115E+4 1.0420455E+2 -7.5424917E+5 #References = LogK/DGf: 10abla/bou; DHf/DHr: Internal calculation; S°: 98cha; Cp: 99aki/zot; V°: 95rob/hem; Prehnite Ca2Al2Si3O10(OH)2 + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 3.000H4SiO4 log_k 32.596 delta_h -339.617 #kJ/mol #98cha/kru -analytic -2.6255465E+3 -3.8041883E-1 1.6586587E+5 9.3642007E+2 -9.0549681E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha/kru; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; Pseudomalachite Cu5(PO4)2(OH)4 + 8.000H+ = 5.000Cu+2 + 2.000H2PO4- + 4.000H2O log_k 22.037 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Pt(element) Pt + 0.500O2 + 2.000H+ = 1.000Pt+2 + 1.000H2O log_k -2.157 delta_h -24.919 #kJ/mol #By convention -analytic -4.2540447E+2 -6.6879597E-2 2.4409294E+4 1.5234139E+2 -1.3903575E+6 #References = S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; PtS2 PtS2 + 0.750H2O = 1.000Pt+2 + 1.500HS- + 0.250S2O3-2 log_k -74.387 delta_h 392.207 #kJ/mol #Internal calculation -analytic -1.5937696E+3 -2.5854409E-1 6.6351027E+4 5.7885384E+2 -5.1923221E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Pyrite FeS2 + 0.750H2O = 1.000Fe+2 + 1.500HS- + 0.250S2O3-2 log_k -23.591 delta_h 107.901 #kJ/mol #05wal/pel -analytic -1.5918872E+3 -2.5774873E-1 8.1293961E+4 5.7833155E+2 -5.2056586E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 95rob/hem; Cp: 05wal/pel; V°: 78hel/del; Pyromorphite Pb5(PO4)3OH + 7.000H+ = 3.000H2PO4- + 5.000Pb+2 + 1.000H2O log_k -18.119 #References = LogK/DGf: 74nri; #References = LogK/DGf: 74nri; V°: 90rob/cam; Pyromorphite(Br) Pb5(PO4)3Br + 6.000H+ = 1.000Br- + 3.000H2PO4- + 5.000Pb+2 log_k -19.420 #References = LogK/DGf: 74nri; #References = LogK/DGf: 74nri; V°: 90rob/cam; Pyromorphite(Cl) Pb5(PO4)3Cl + 6.000H+ = 1.000Cl- + 3.000H2PO4- + 5.000Pb+2 log_k -25.720 #References = LogK/DGf: 74nri; #References = LogK/DGf: 74nri; V°: 63wyc; Pyromorphite(F) Pb5(PO4)3F + 6.000H+ = 1.000F- + 3.000H2PO4- + 5.000Pb+2 log_k -12.920 #References = LogK/DGf: 74nri; #References = LogK/DGf: 74nri; V°: 90rob/cam; Pyrope(alpha) Mg3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Mg+2 + 3.000H4SiO4 log_k 58.930 delta_h -569.383 #kJ/mol #95rob/hem -analytic -3.1632192E+3 -4.564587E-1 2.0653485E+5 1.1257864E+3 -1.0681752E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del,78rob/hem; Cp: 78hel/del,78rob/hem; V°: 78hel/del,78rob/hem; Pyrophyllite Al2Si4O10(OH)2 + 6.000H+ + 4.000H2O = 2.000Al+3 + 4.000H4SiO4 log_k -0.418 delta_h -128.924 #kJ/mol #95rob/hem -analytic -2.3595061E+3 -3.237303E-1 1.4585394E+5 8.3524091E+2 -8.9193526E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 76rob/hem; V°: 95rob/hem; Pyroxene(CaAl) CaAl(AlSi)O6 + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 1.000H4SiO4 + 2.000H2O log_k 36.234 delta_h -370.792 #kJ/mol #Internal calculation -analytic -1.5908243E+3 -2.4603865E-1 1.0453251E+5 5.681931E+2 -4.9909659E+6 #References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Pyrrhotite FeS + 1.000H+ = 1.000Fe+2 + 1.000HS- log_k -3.679 delta_h -10.009 #kJ/mol #05wal/pel -analytic -1.1321823E+3 -1.8235764E-1 6.1304821E+4 4.1103628E+2 -3.5403537E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 78hel/del; Quartz(alpha) SiO2 + 2.000H2O = 1.000H4SiO4 log_k -3.734 delta_h 23.499 #kJ/mol #82ric/bot -analytic -3.5374911E+2 -4.1888083E-2 2.18041E+4 1.2419287E+2 -1.5942862E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82ric/bot; S°: 82ric/bot; Cp: 82ric/bot; V°: 95rob/hem; Quartz(beta) SiO2 + 2.000H2O = 1.000H4SiO4 log_k -3.502 #delta_h 0.000 #kJ/mol -analytic -3.4680063E+2 -4.1000884E-2 2.1497205E+4 1.2167536E+2 -1.5695706E+6 #References = LogK/DGf: Internal calculation; Cp: 89cox/wag; V°: Default value; Realgar AsS + 0.250O2 + 2.500H2O = 1.000H2AsO3- + 1.000HS- + 2.000H+ log_k -7.800 delta_h 24.594 #kJ/mol #Internal calculation -analytic -1.0034543E+3 -1.6631516E-1 5.2749124E+4 3.654584E+2 -3.1986476E+6 #References = LogK/DGf: 13bla/las; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou; Rh(element) Rh + 0.500O2 + 2.000H+ = 1.000Rh+2 + 1.000H2O log_k 22.694 delta_h -169.367 #kJ/mol #98sas/sho -analytic -4.2198365E+2 -6.5807108E-2 3.1965536E+4 1.5071669E+2 -1.409249E+6 #References = LogK/DGf: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Rh2O(s) Rh2O + 0.6666675O2 + 4.66667H+ = 1.33333Rh+2 + 0.66667Rh+3 + 2.333335H2O log_k 32.170 delta_h -297.073 #kJ/mol #Internal calculation -analytic -9.2880217E+2 -1.4590429E-1 6.5217476E+4 3.3096914E+2 -2.9537693E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: Default value; Rh2O3(s) Rh2O3 + 6.000H+ = 2.000Rh+3 + 3.000H2O log_k 12.342 delta_h -213.359 #kJ/mol #Internal calculation -analytic -1.0500191E+3 -1.6722402E-1 6.5471364E+4 3.7474604E+2 -3.0808349E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Rhodochrosite MnCO3 + 1.000H+ = 1.000HCO3- + 1.000Mn+2 log_k 0.230 delta_h -22.001 #kJ/mol #Internal calculation -analytic -8.9448089E+2 -1.4475403E-1 4.9047875E+4 3.2517342E+2 -2.7786359E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Riebeckite Na2(Fe3Fe2)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 3.000Fe+2 + 2.000Na+ + 8.000H4SiO4 + 2.000Fe+3 log_k 9.199 delta_h -197.377 #kJ/mol #98hol/pow -analytic -5.0079102E+3 -6.7170777E-1 3.0608951E+5 1.7785742E+3 -1.8686839E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 95rob/hem; V°: 78hel/del; Rockbridgite(Zn) ZnFe4(PO4)3(OH)5 + 11.000H+ = 4.000Fe+3 + 3.000H2PO4- + 1.000Zn+2 + 5.000H2O log_k 1.837 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: Default value; Romarchite SnO + 2.000H+ = 1.000Sn+2 + 1.000H2O log_k 2.229 delta_h -13.896 #kJ/mol #89cox/wag -analytic -3.110607E+2 -4.7538033E-2 1.782514E+4 1.1273586E+2 -1.0027505E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Romerite Fe3(SO4)4:14H2O = 2.000Fe+3 + 4.000SO4-2 + 1.000Fe+2 + 14.000H2O log_k -11.628 delta_h -96.980 #kJ/mol #02hem/sea -analytic -7.0143861E+3 -1.0479409E+0 3.8581548E+5 2.5322294E+3 -2.1749259E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam; Rozenite FeSO4:4H2O = 1.000Fe+2 + 1.000SO4-2 + 4.000H2O log_k -1.696 delta_h -14.960 #kJ/mol #02cho/sea -analytic -1.7627909E+3 -2.59975E-1 9.6675812E+4 6.3675286E+2 -5.4446565E+6 #References = LogK/DGf: 02cho/sea; DHf/DHr: 02cho/sea; S°: Internal calculation; V°: 90rob/cam; Ru(element) Ru + 0.500O2 + 2.000H+ = 1.000Ru+2 + 1.000H2O log_k 16.681 delta_h -132.285 #kJ/mol #Internal calculation -analytic -4.2170452E+2 -6.5535745E-2 3.0046781E+4 1.5073586E+2 -1.4079513E+6 #References = DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; RuO2(s) RuO2 + 3.000H+ = 1.000Ru+3 + 0.250O2 + 1.500H2O log_k -13.121 delta_h 10.393 #kJ/mol #Internal calculation -analytic -4.3559843E+2 -7.045936E-2 2.0658276E+4 1.5613632E+2 -1.080241E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Rutile TiO2 + 2.000H2O = 1.000Ti(OH)4 log_k -8.861 delta_h 0.300 #kJ/mol #89cox/wag -analytic -4.6738595E+2 -3.2546139E-2 2.3089926E+4 1.6138804E+2 -7.6089683E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; S(alpha) S + 1.000H2O = 1.000HS- + 0.500O2 + 1.000H+ log_k -45.140 delta_h 263.463 #kJ/mol #By convention -analytic -5.3915576E+2 -8.8467883E-2 1.5130512E+4 1.9737497E+2 -1.6665249E+6 #References = S°: 89cox/wag; Cp: 11par/cor; V°: 11par/cor; S(beta) S + 1.000H2O = 1.000HS- + 0.500O2 + 1.000H+ log_k -45.128 #delta_h 0.000 #kJ/mol -analytic -5.3856231E+2 -8.8389178E-2 1.5118745E+4 1.9714171E+2 -1.6654188E+6 #References = LogK/DGf: Internal calculation; Cp: 11par/cor; V°: Default value; S(gamma) S + 1.000H2O = 1.000HS- + 0.500O2 + 1.000H+ log_k -45.089 #delta_h 0.000 #kJ/mol -analytic -5.2201078E+2 -8.6900678E-2 1.4085028E+4 1.9135181E+2 -1.5909958E+6 #References = LogK/DGf: Internal calculation; Cp: 11par/cor; V°: Default value; Sanidine K(AlSi3)O8 + 4.000H+ + 4.000H2O = 1.000Al+3 + 1.000K+ + 3.000H4SiO4 log_k 0.620 delta_h -58.203 #kJ/mol #95rob/hem -analytic -1.6040776E+3 -2.1368942E-1 9.9754212E+4 5.6769011E+2 -6.3008126E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 06bla/pia; V°: 78hel/del; Saponite(Ca) Ca0.17Mg3Al0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 0.170Ca+2 + 3.000Mg+2 + 3.660H4SiO4 log_k 29.355 delta_h -262.766 #kJ/mol #15bla/vie -analytic -2.5667428E+3 -3.4039957E-1 1.6475488E+5 9.099285E+2 -9.472597E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(FeCa) Ca0.17Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 0.170Ca+2 + 1.000Fe+2 + 2.000Mg+2 + 3.660H4SiO4 log_k 26.569 delta_h -250.636 #kJ/mol #15bla/vie -analytic -2.5356344E+3 -3.373844E-1 1.6236385E+5 8.9871835E+2 -9.386812E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(FeK) K0.34Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 1.000Fe+2 + 0.340K+ + 2.000Mg+2 + 3.660H4SiO4 log_k 25.398 delta_h -232.093 #kJ/mol #15bla/vie -analytic -2.515955E+3 -3.3384661E-1 1.6058454E+5 8.9209651E+2 -9.3470003E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(FeMg) Mg0.17Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 1.000Fe+2 + 2.170Mg+2 + 3.660H4SiO4 log_k 26.022 delta_h -251.806 #kJ/mol #15bla/vie -analytic -2.5507675E+3 -3.3914471E-1 1.6323608E+5 9.0384868E+2 -9.4321235E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(FeNa) Na0.34Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 1.000Fe+2 + 2.000Mg+2 + 0.340Na+ + 3.660H4SiO4 log_k 25.896 delta_h -240.711 #kJ/mol #15bla/vie -analytic -2.5368817E+3 -3.3606965E-1 1.6211086E+5 8.9919435E+2 -9.3999007E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(K) K0.33Mg3Al0.33Si3.67O10(OH)2 + 7.320H+ + 2.680H2O = 0.330Al+3 + 0.330K+ + 3.000Mg+2 + 3.670H4SiO4 log_k 27.430 delta_h -239.483 #kJ/mol #15bla/vie -analytic -2.544416E+3 -3.3629993E-1 1.6263915E+5 9.0231366E+2 -9.4312976E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(Mg) Mg0.17Mg3Al0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 3.170Mg+2 + 3.660H4SiO4 log_k 28.810 delta_h -263.946 #kJ/mol #15bla/vie -analytic -2.5818719E+3 -3.4215988E-1 1.6562747E+5 9.1505763E+2 -9.5179085E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(Na) Na0.33Mg3Al0.33Si3.67O10(OH)2 + 7.320H+ + 2.680H2O = 0.330Al+3 + 3.000Mg+2 + 0.330Na+ + 3.670H4SiO4 log_k 27.971 delta_h -248.219 #kJ/mol #15bla/vie -analytic -2.5647603E+3 -3.3846001E-1 1.6414122E+5 9.0921188E+2 -9.482682E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Saponite(SapCa) (Na0.394K0.021Ca0.038)(Si3.569Al0.397)(Mg2.949Fe0.055)O10(OH)2 + 7.724H+ + 2.276H2O = 0.397Al+3 + 0.038Ca+2 + 0.034Fe+3 + 0.021K+ + 2.949Mg+2 + 0.394Na+ + 3.569H4SiO4 + 0.021Fe+2 log_k 31.473 delta_h -277.172 #kJ/mol #13gai/bla -analytic -2.5790231E+3 -3.508959E-1 1.6429225E+5 9.168404E+2 -9.2969386E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 13gai/bla; S°: 13gai/bla; Cp: 09gai; V°: 13gai/bla; Sb(element) Sb + 0.750O2 + 1.500H2O = 1.000Sb(OH)3 log_k 52.745 delta_h -316.199 #kJ/mol #Internal calculation -analytic -3.9870715E+1 -1.2316823E-2 1.7752813E+4 1.5100207E+1 -5.509819E+4 #References = DHf/DHr: Internal calculation; S°: 94aki/zot; Cp: 94aki/zot; V°: 94aki/zot; Scholzite CaZn2(PO4)2:2H2O + 4.000H+ = 1.000Ca+2 + 2.000H2PO4- + 2.000Zn+2 + 2.000H2O log_k 7.425 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Schultenite PbHAsO4 + 1.000H+ = 1.000H2AsO4- + 1.000Pb+2 log_k -5.410 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Schwertmannite Fe8O8(OH)6SO4:8H2O + 22.000H+ = 8.000Fe+3 + 1.000SO4-2 + 22.000H2O log_k 8.982 #References = LogK/DGf: 04maj/nav; #References = LogK/DGf: 04maj/nav; V°: 90rob/cam; Scolecite CaAl2Si3O10:3H2O + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 3.000H4SiO4 + 1.000H2O log_k 16.647 delta_h -233.213 #kJ/mol #83joh/flo -analytic -2.3692738E+3 -3.4026162E-1 1.4623007E+5 8.4431312E+2 -8.2035956E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 83joh/flo; S°: 83joh/flo; Cp: 83joh/flo; V°: 95rob/hem; Scorodite FeAsO4:2H2O + 2.000H+ = 1.000H2AsO4- + 1.000Fe+3 + 2.000H2O log_k -7.368 delta_h -21.409 #kJ/mol #11maj/dra -analytic -1.0365332E+3 -1.6539267E-1 5.5820815E+4 3.7435481E+2 -3.1169074E+6 #References = LogK/DGf: 06lan/mah; DHf/DHr: 11maj/dra; S°: Internal calculation; Cp: 90pap/ber; V°: 00bla/bid; Scorodite(am) FeAsO4:2H2O + 2.000H+ = 1.000H2AsO4- + 1.000Fe+3 + 2.000H2O log_k -4.538 #References = LogK/DGf: 06lan/mah; #References = LogK/DGf: 06lan/mah; V°: 00bla/bid; Sellaite MgF2 = 2.000F- + 1.000Mg+2 log_k -9.220 delta_h -13.500 #kJ/mol #89cox/wag -analytic -1.7205734E+3 -2.7422476E-1 9.3940935E+4 6.2238979E+2 -5.5139817E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Senarmontite Sb2O3 + 3.000H2O = 2.000Sb(OH)3 log_k -9.835 delta_h 67.343 #kJ/mol #Internal calculation -analytic 1.8477675E+2 1.7342449E-2 -1.8040472E+4 -6.1767774E+1 1.2058989E+6 #References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi; Sepiolite Mg4Si6O15(OH)2:6H2O + 8.000H+ + 1.000H2O = 4.000Mg+2 + 6.000H4SiO4 log_k 31.419 delta_h -225.784 #kJ/mol #Internal calculation -analytic -3.4714843E+3 -4.4714531E-1 2.1930423E+5 1.2318165E+3 -1.3101111E+7 #References = LogK/DGf: 88sto; DHf/DHr: Internal calculation; S°: 88sto; Cp: 88sto; V°: 88sto; Siderite FeCO3 + 1.000H+ = 1.000HCO3- + 1.000Fe+2 log_k -0.273 delta_h -27.862 #kJ/mol #Internal calculation -analytic -9.0290711E+2 -1.4586154E-1 4.9930776E+4 3.2756069E+2 -2.8333705E+6 #References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 04chi; V°: 78hel/del,85hel; Siderophyllite KFe2Al3Si2O10(OH)2 + 14.000H+ = 3.000Al+3 + 2.000Fe+2 + 1.000K+ + 2.000H4SiO4 + 4.000H2O log_k 40.570 delta_h -480.112 #kJ/mol #90hol/pow -analytic -2.9500852E+3 -4.434036E-1 1.8546339E+5 1.0536299E+3 -9.4520282E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 90hol/pow; S°: 90hol/pow; Cp: 90hol/pow; V°: 90hol/pow; Siderotil FeSO4:5H2O = 1.000Fe+2 + 1.000SO4-2 + 5.000H2O log_k -2.235 delta_h -4.190 #kJ/mol #02hem/sea -analytic -1.7787588E+3 -2.585467E-1 9.6809893E+4 6.4251488E+2 -5.4183498E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam; Sillimanite Al2SiO5 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 1.000H2O log_k 16.570 delta_h -247.845 #kJ/mol #Internal calculation -analytic -1.3428885E+3 -2.0513363E-1 8.5642987E+4 4.7774773E+2 -4.3366238E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Smectite(MX80) Na0.409K0.024Ca0.009(Si3.738Al0.262)(Al1.598Mg0.214Fe0.208)O10(OH)2 + 7.048H+ + 2.952H2O = 1.860Al+3 + 0.009Ca+2 + 0.173Fe+3 + 0.024K+ + 0.214Mg+2 + 0.409Na+ + 3.738H4SiO4 + 0.035Fe+2 log_k 5.278 delta_h -175.308 #kJ/mol #12gai/bla -analytic -2.4267042E+3 -3.3712249E-1 1.5038583E+5 8.6021197E+2 -8.9284687E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla; Smectite(MX80:3.989H2O) Na0.409K0.024Ca0.009(Si3.738Al0.262)(Al1.598Mg0.214Fe0.208)O10(OH)2:3.989H2O + 7.048H+ = 1.860Al+3 + 0.009Ca+2 + 0.173Fe+3 + 0.024K+ + 0.214Mg+2 + 0.409Na+ + 3.738H4SiO4 + 0.035Fe+2 + 1.037H2O log_k 1.774 delta_h -148.524 #kJ/mol #12gai/bla -analytic -2.3838609E+3 -3.2232449E-1 1.4844358E+5 8.4261556E+2 -8.9910004E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla; Smectite(MX80:5.189H2O) Na0.409K0.024Ca0.009(Si3.738Al0.262)(Al1.598Mg0.214Fe0.208)O10(OH)2:5.189H2O + 7.048H+ = 1.860Al+3 + 0.009Ca+2 + 0.173Fe+3 + 0.024K+ + 0.214Mg+2 + 0.409Na+ + 3.738H4SiO4 + 0.035Fe+2 + 2.237H2O log_k 1.435 delta_h -140.430 #kJ/mol #12gai/bla -analytic -2.3706061E+3 -3.2008903E-1 1.4737914E+5 8.3812012E+2 -8.9524821E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla; Smithsonite ZnCO3 + 1.000H+ = 1.000HCO3- + 1.000Zn+2 log_k -0.620 delta_h -24.415 #kJ/mol #13pow/bro -analytic -9.2301285E+2 -1.4773149E-1 5.0911225E+4 3.3471433E+2 -2.8932044E+6 #References = LogK/DGf: 13pow/bro; DHf/DHr: 13pow/bro; S°: Internal calculation; Cp: 18las/bla; V°: 78hel/del; Sn(alpha) Sn + 0.500O2 + 2.000H+ = 1.000Sn+2 + 1.000H2O log_k 47.810 delta_h -288.539 #kJ/mol #By convention -analytic -3.9316687E+2 -6.1216051E-2 3.7388231E+4 1.4132387E+2 -1.4106793E+6 #References = LogK/DGf: Internal calculation; S°: 85jac/hel; Cp: 85jac/hel; V°: 85jac/hel; Sn(beta) Sn + 0.500O2 + 2.000H+ = 1.000Sn+2 + 1.000H2O log_k 48.308 #delta_h 0.000 #kJ/mol -analytic -3.9004193E+2 -6.0527637E-2 3.7613102E+4 1.3987461E+2 -1.4106793E+6 #References = LogK/DGf: Internal calculation; V°: Default value; Spencerite Zn4(PO4)2(OH)2:3H2O + 6.000H+ = 2.000H2PO4- + 4.000Zn+2 + 5.000H2O log_k 16.800 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Spessartine(alpha) Mn3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Mn+2 + 3.000H4SiO4 log_k 49.887 delta_h -471.069 #kJ/mol #98hol/pow -analytic -3.0782231E+3 -4.4800236E-1 1.9682378E+5 1.0986866E+3 -1.0409112E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Sphaerocobaltite CoCO3 + 1.000H+ = 1.000HCO3- + 1.000Co+2 log_k -0.873 delta_h -24.122 #kJ/mol #Internal calculation -analytic -9.0848908E+2 -1.4524556E-1 5.0272924E+4 3.2921793E+2 -2.8733445E+6 #References = LogK/DGf: 99gra; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 90rob/cam; Sphalerite ZnS + 1.000H+ = 1.000HS- + 1.000Zn+2 log_k -11.145 delta_h 33.421 #kJ/mol #14aki/tag -analytic -9.721935E+2 -1.5451455E-1 5.0956629E+4 3.5205735E+2 -3.1055331E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 14aki/tag; S°: 78hel/del; Cp: 14aki/tag; V°: 78hel/del; Spinel MgAl2O4 + 8.000H+ = 2.000Al+3 + 1.000Mg+2 + 4.000H2O log_k 37.856 delta_h -399.057 #kJ/mol #Internal calculation -analytic -1.3571269E+3 -2.1829196E-1 8.9808713E+4 4.8560142E+2 -3.7994678E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Spingcreekite BaV3(PO4)2(OH)5:H2O + 9.000H+ = 1.000Ba+2 + 2.000H2PO4- + 3.000V+3 + 6.000H2O log_k 7.607 #References = LogK/DGf: 04gab/vie; #References = LogK/DGf: 04gab/vie; V°: Default value; Sr(element) Sr + 0.500O2 + 2.000H+ = 1.000Sr+2 + 1.000H2O log_k 141.780 delta_h -830.663 #kJ/mol #By convention -analytic -3.7926603E+2 -5.8081797E-2 6.4803064E+4 1.3582543E+2 -1.3403758E+6 #References = S°: 98cha; Cp: 98cha; V°: 95rob/hem; Sr(OH)2 Sr(OH)2 + 2.000H+ = 1.000Sr+2 + 2.000H2O log_k 27.516 delta_h -153.670 #kJ/mol #98cha -analytic -3.1110535E+2 -4.4757502E-2 2.478162E+4 1.1280107E+2 -9.1307436E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan; Sr(OH)2:8H2O Sr(OH)2:8H2O + 2.000H+ = 1.000Sr+2 + 10.000H2O log_k 24.330 delta_h -57.000 #kJ/mol #82wag/eva -analytic -5.3417288E+2 -4.5999427E-2 2.9973392E+4 1.9461183E+2 -8.7717847E+5 #References = LogK/DGf: 98fel/dix; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value; Sr2SiO4 Sr2SiO4 + 4.000H+ = 1.000H4SiO4 + 2.000Sr+2 log_k 43.253 #References = LogK/DGf: 82wag/eva; #References = LogK/DGf: 82wag/eva; V°: Default value; Sr3(AsO4)2 Sr3(AsO4)2 + 4.000H+ = 2.000H2AsO4- + 3.000Sr+2 log_k 20.630 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: Default value; Sr3(PO4)2 Sr3(PO4)2 + 4.000H+ = 2.000H2PO4- + 3.000Sr+2 log_k 10.530 delta_h -147.900 #kJ/mol #06bla/ign -analytic -2.2047977E+3 -3.3955304E-1 1.2658427E+5 7.9576591E+2 -6.8511138E+6 #References = LogK/DGf: 06bla/ign; DHf/DHr: 06bla/ign; S°: Internal calculation; V°: Default value; Sr5(PO4)3(OH) Sr5(PO4)3(OH) + 7.000H+ = 3.000H2PO4- + 5.000Sr+2 + 1.000H2O log_k 7.171 delta_h -261.630 #kJ/mol #95jem/che -analytic -3.5037126E+3 -5.3365266E-1 2.0153503E+5 1.258938E+3 -1.0766742E+7 #References = LogK/DGf: 05kin/par; DHf/DHr: 95jem/che; S°: Internal calculation; V°: Default value; SrCl2 SrCl2 = 2.000Cl- + 1.000Sr+2 log_k 8.644 delta_h -59.210 #kJ/mol #98cha -analytic -1.5278114E+3 -2.4779477E-1 8.7032436E+4 5.55833E+2 -5.0621001E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 01mer/vie; SrCl2:2H2O SrCl2:2H2O = 2.000Cl- + 1.000Sr+2 + 2.000H2O log_k 3.470 delta_h -18.720 #kJ/mol #82wag/eva -analytic -1.535214E+3 -2.4563477E-1 8.5215308E+4 5.5875189E+2 -5.0215008E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: 01mer/vie; SrCl2:6H2O SrCl2:6H2O = 2.000Cl- + 1.000Sr+2 + 6.000H2O log_k 1.621 delta_h 23.760 #kJ/mol #82wag/eva -analytic -1.6486766E+3 -2.3890624E-1 8.7953959E+4 5.9877764E+2 -4.8987622E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; V°: 01mer/vie; SrCl2:H2O SrCl2:H2O = 2.000Cl- + 1.000Sr+2 + 1.000H2O log_k 4.910 delta_h -34.090 #kJ/mol #82wag/eva -analytic -1.5321006E+3 -2.4688805E-1 8.5890167E+4 5.5741804E+2 -5.044789E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: 01mer/vie; SrCrO4 SrCrO4 = 1.000CrO4-2 + 1.000Sr+2 log_k -4.650 delta_h -10.124 #kJ/mol #Internal calculation -analytic -1.6563926E+3 -2.6000196E-1 9.1561204E+4 5.9947259E+2 -5.4395197E+6 #References = LogK/DGf: 97smi/mar; DHf/DHr: Internal calculation; S°: 97smi/mar; V°: Default value; SrHPO4 SrHPO4 + 1.000H+ = 1.000H2PO4- + 1.000Sr+2 log_k 0.280 delta_h -19.487 #kJ/mol #Internal calculation -analytic -9.4351476E+2 -1.4553192E-1 5.2043824E+4 3.4175408E+2 -2.9351666E+6 #References = LogK/DGf: 97smi/mar; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value; SrO SrO + 2.000H+ = 1.000Sr+2 + 1.000H2O log_k 41.977 delta_h -244.690 #kJ/mol #98cha -analytic -3.0548702E+2 -4.6169573E-2 2.929319E+4 1.1054806E+2 -9.3910125E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem; SrS SrS + 1.000H+ = 1.000HS- + 1.000Sr+2 log_k 14.685 delta_h -93.570 #kJ/mol #74nau/ryz -analytic -9.4569551E+2 -1.4806485E-1 5.6587654E+4 3.4309608E+2 -3.0436321E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 82wag/eva; V°: 87pan/mah; SrSiO3 SrSiO3 + 2.000H+ + 1.000H2O = 1.000H4SiO4 + 1.000Sr+2 log_k 13.163 delta_h -77.941 #kJ/mol #82wag/eva -analytic -6.4877499E+2 -8.5691266E-2 4.3155067E+4 2.307548E+2 -2.5107164E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan; Staurolite Fe2Al9Si4O23(OH) + 31.000H+ = 9.000Al+3 + 2.000Fe+2 + 4.000H4SiO4 + 8.000H2O log_k 216.340 delta_h -1956.484 #kJ/mol #87woo/gar -analytic -6.5297334E+3 -1.0061427E+0 4.5225123E+5 2.3281295E+3 -2.0588442E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 87woo/gar; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Stellerite Ca2Al4Si14O36:14H2O + 16.000H+ + 6.000H2O = 4.000Al+3 + 2.000Ca+2 + 14.000H4SiO4 log_k 6.989 delta_h -292.435 #kJ/mol #01fri/neu -analytic -7.2181141E+3 -9.5602824E-1 4.4808837E+5 2.5546613E+3 -2.7921039E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 01fri/neu; S°: 01fri/neu; Cp: 01fri/neu; V°: 01fri/neu; Sterlinghillite Mn3(AsO4)2:8H2O + 4.000H+ = 2.000H2AsO4- + 3.000Mn+2 + 8.000H2O log_k 7.428 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Stibnite Sb2S3 + 6.000H2O = 3.000HS- + 2.000Sb(OH)3 + 3.000H+ log_k -56.207 delta_h 309.255 #kJ/mol #Internal calculation -analytic -1.3680519E+3 -2.5017937E-1 5.4369104E+4 5.0512051E+2 -4.0718841E+6 #References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi; Stilbite NaCa2(Al5Si13)O36:16H2O + 20.000H+ = 5.000Al+3 + 2.000Ca+2 + 1.000Na+ + 13.000H4SiO4 log_k 23.044 delta_h -403.823 #kJ/mol #01fri/neu -analytic -7.4700792E+3 -1.0099722E+0 4.6170528E+5 2.6510812E+3 -2.7934606E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 01fri/neu; S°: 01fri/neu; Cp: 01fri/neu; V°: 01fri/neu; Straetlingite Ca2Al2SiO2(OH)10:2.5H2O + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 1.000H4SiO4 + 10.500H2O log_k 49.671 delta_h -406.014 #kJ/mol #Internal calculation -analytic -1.8830104E+3 -2.7529055E-1 1.2215595E+5 6.7447093E+2 -5.6792627E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 90rin/sac; Strengite FePO4:2H2O + 2.000H+ = 1.000Fe+3 + 1.000H2PO4- + 2.000H2O log_k -5.251 delta_h -34.799 #kJ/mol #Internal calculation -analytic -1.0756044E+3 -1.7187319E-1 5.8848892E+4 3.8841198E+2 -3.2786811E+6 #References = LogK/DGf: 69wag/eva; DHf/DHr: Internal calculation; S°: 69wag/eva; Cp: 74nau/ryz,76wag/eva, 71par/wag; V°: 95rob/hem; Strontianite SrCO3 + 1.000H+ = 1.000HCO3- + 1.000Sr+2 log_k 1.057 delta_h -15.067 #kJ/mol #Internal calculation -analytic -8.6448147E+2 -1.3949607E-1 4.8173734E+4 3.1423274E+2 -2.8441186E+6 #References = LogK/DGf: 84bus/plu; DHf/DHr: Internal calculation; S°: 84bus/plu; Cp: 06bla/ign; V°: 78hel/del; Sudoite Mg2Al4Si3O10(OH)8 + 16.000H+ = 4.000Al+3 + 2.000Mg+2 + 3.000H4SiO4 + 6.000H2O log_k 37.957 delta_h -523.893 #kJ/mol #05vid/par -analytic -3.8039833E+3 -5.6366499E-1 2.3506768E+5 1.3575717E+3 -1.2235862E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par; Sudoite(Fe) Fe2Al4Si3O10(OH)8 + 16.000H+ = 4.000Al+3 + 2.000Fe+2 + 3.000H4SiO4 + 6.000H2O log_k 36.169 delta_h -512.393 #kJ/mol #98hol/pow -analytic -3.7175132E+3 -5.5966294E-1 2.2968738E+5 1.32784E+3 -1.204357E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow; Svanbergite SrAl3(PO4)(SO4)(OH)6 + 8.000H+ = 3.000Al+3 + 1.000H2PO4- + 1.000SO4-2 + 1.000Sr+2 + 6.000H2O log_k 7.747 delta_h -301.843 #kJ/mol #Internal calculation -analytic -3.8171949E+3 -5.9863034E-1 2.1835867E+5 1.3746361E+3 -1.1591927E+7 #References = LogK/DGf: 04gab/vie; DHf/DHr: Internal calculation; S°: 04gab/vie; Cp: 04gab/vie; V°: 04gab/vie; Sylvite KCl = 1.000Cl- + 1.000K+ log_k 0.872 delta_h 17.460 #kJ/mol #98cha -analytic -6.8750501E+2 -1.1145941E-1 3.7309485E+4 2.5158262E+2 -2.3159492E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 78hel/del, 98cha; Cp: 98cha; V°: 78hel/del; Symplesite Fe3(AsO4)2:8H2O + 4.000H+ = 2.000H2AsO4- + 3.000Fe+2 + 8.000H2O log_k -1.562 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Syngenite K2Ca(SO4)2:6H2O = 1.000Ca+2 + 2.000K+ + 2.000SO4-2 + 6.000H2O log_k -7.444 #References = LogK/DGf: 84har/mol; #References = LogK/DGf: 84har/mol; V°: 63wyc; Szomolnokite FeSO4:H2O = 1.000Fe+2 + 1.000SO4-2 + 1.000H2O log_k -1.657 delta_h -41.470 #kJ/mol #02hem/sea -analytic -1.71659E+3 -2.6444535E-1 9.6029771E+4 6.1988501E+2 -5.5267753E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 95rob/hem; Tachyhydrite Mg2CaCl6:12H2O = 1.000Ca+2 + 6.000Cl- + 2.000Mg+2 + 12.000H2O log_k 17.392 #References = LogK/DGf: 84har/mol; #References = LogK/DGf: 84har/mol; V°: 63wyc; Talc Mg3Si4O10(OH)2 + 6.000H+ + 4.000H2O = 3.000Mg+2 + 4.000H4SiO4 log_k 24.932 delta_h -201.024 #kJ/mol #01kal/mar -analytic -2.4241826E+3 -3.2073548E-1 1.5435753E+5 8.6054525E+2 -9.0972202E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 01kal/mar; S°: 63rob/sto; Cp: 79kru/rob; V°: 78hel/del; Tarbuttite Zn2(PO4)OH + 3.000H+ = 1.000H2PO4- + 2.000Zn+2 + 1.000H2O log_k 8.240 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: 63wyc; Tenorite CuO + 2.000H+ = 1.000Cu+2 + 1.000H2O log_k 7.641 delta_h -64.396 #kJ/mol #Internal calculation -analytic -3.3656488E+2 -5.1335422E-2 2.073181E+4 1.2139698E+2 -9.25576E+5 #References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 98cha; Cp: 98cha; V°: 84pan; Thaumasite CaSiO3CaSO4CaCO3:15H2O + 3.000H+ = 1.000HCO3- + 3.000Ca+2 + 1.000SO4-2 + 1.000H4SiO4 + 14.000H2O log_k 10.314 delta_h -6.676 #kJ/mol #Internal calculation -analytic -3.0528975E+3 -4.6537E-1 1.6935031E+5 1.1096389E+3 -9.9357013E+6 #References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 08sch/lot; Cp: 08sch/lot; V°: 10bbla/bou; Thenardite Na2SO4 = 2.000Na+ + 1.000SO4-2 log_k -0.340 delta_h -2.461 #kJ/mol #98cha -analytic -1.6163229E+3 -2.5323852E-1 8.9802804E+4 5.8641201E+2 -5.4004694E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem; Thermonatrite Na2CO3:H2O + 1.000H+ = 1.000HCO3- + 2.000Na+ + 1.000H2O log_k 10.808 delta_h -26.740 #kJ/mol #82van -analytic -8.5085649E+2 -1.2741559E-1 4.8473539E+4 3.1022149E+2 -2.7157318E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 82van; S°: Internal calculation; Cp: 82van; V°: 95rob/hem; Thorianite ThO2 + 4.000H+ = 1.000Th+4 + 2.000H2O log_k 1.762 delta_h -113.777 #kJ/mol #89cox/wag -analytic -5.6583558E+2 -9.2404587E-2 3.2187789E+4 2.0247106E+2 -1.2277684E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 91kna/kub; V°: 95rob/hem; Titanite CaTiSiO5 + 2.000H+ + 3.000H2O = 1.000Ca+2 + 1.000H4SiO4 + 1.000Ti(OH)4 log_k 0.987 delta_h -60.702 #kJ/mol #Internal calculation -analytic -1.1182222E+3 -1.2215084E-1 6.4584624E+4 3.9390971E+2 -3.1728605E+6 #References = LogK/DGf: 78rob/hem,92cjoh; DHf/DHr: Internal calculation; S°: 78rob/hem,92cjoh; Cp: 78rob/hem,92cjoh; V°: 78rob/hem,92cjoh; Tl(OH)3 Tl(OH)3 + 3.000H+ = 1.000Tl+3 + 3.000H2O log_k -1.817 #References = LogK/DGf: 52lat; #References = LogK/DGf: 52lat; V°: Default value; Tl2CO3 Tl2CO3 + 1.000H+ = 1.000HCO3- + 2.000Tl+ log_k 6.531 delta_h 20.627 #kJ/mol #84pan/stu -analytic -7.2445801E+2 -1.1510541E-1 3.9838967E+4 2.6655188E+2 -2.4782051E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu; Tl2O Tl2O + 2.000H+ = 2.000Tl+ + 1.000H2O log_k 27.771 delta_h -106.097 #kJ/mol #84pan/stu -analytic -1.5896535E+2 -2.1453453E-2 1.5819395E+4 5.9637349E+1 -6.6619937E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu; Tl2O3 Tl2O3 + 6.000H+ = 2.000Tl+3 + 3.000H2O log_k -5.204 delta_h -69.882 #kJ/mol #84pan/stu -analytic -8.4542229E+2 -1.3480133E-1 4.4570052E+4 3.0451378E+2 -2.0070973E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu; Tl2S Tl2S + 1.000H+ = 1.000HS- + 2.000Tl+ log_k -7.145 delta_h 86.447 #kJ/mol #84pan/stu -analytic -7.7798985E+2 -1.2228106E-1 3.9977646E+4 2.8460764E+2 -2.758022E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu; Tl2SO4 Tl2SO4 = 1.000SO4-2 + 2.000Tl+ log_k -3.841 delta_h 33.555 #kJ/mol #84pan/stu -analytic -1.4949765E+3 -2.3643296E-1 8.253568E+4 5.4293922E+2 -5.2150211E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu; TlOH TlOH + 1.000H+ = 1.000Tl+ + 1.000H2O log_k 12.899 delta_h -41.580 #kJ/mol #82wag/eva -analytic -8.6203605E+1 -9.6627866E-3 7.6975327E+3 3.2277779E+1 -3.2919952E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: 17abla; Tobermorite(11A) Ca5Si6H11O22.5 + 10.000H+ + 1.500H2O = 5.000Ca+2 + 6.000H4SiO4 log_k 65.578 delta_h -358.501 #kJ/mol #00zue/feh -analytic -3.473201E+3 -4.5588943E-1 2.2749211E+5 1.2371653E+3 -1.3297952E+7 #References = LogK/DGf: 10abla/bou; DHf/DHr: 00zue/feh; S°: Internal calculation; Cp: 10abla/bou; V°: 00mer/bon; Tobermorite(14A) Ca5Si6H21O27.5 + 10.000H+ = 5.000Ca+2 + 6.000H4SiO4 + 3.500H2O log_k 62.944 delta_h -293.421 #kJ/mol #10abla/bou -analytic -3.4830146E+3 -4.4941621E-1 2.246166E+5 1.2426661E+3 -1.3183989E+7 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 10abla/bou; Tremolite (Ca2Mg5)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 2.000Ca+2 + 5.000Mg+2 + 8.000H4SiO4 log_k 67.281 delta_h -502.247 #kJ/mol #95rob/hem -analytic -5.0977019E+3 -6.8545317E-1 3.2680746E+5 1.8129659E+3 -1.8919407E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del,92ajoh; Troilite FeS + 1.000H+ = 1.000Fe+2 + 1.000HS- log_k -3.874 delta_h -6.179 #kJ/mol #05wal/pel -analytic -1.1310855E+3 -1.8225687E-1 6.1072624E+4 4.1080902E+2 -3.5386157E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 63wyc; Trona(K) K2NaH(CO3)2:2H2O + 1.000H+ = 2.000HCO3- + 2.000K+ + 1.000Na+ + 2.000H2O log_k 11.556 #References = LogK/DGf: 84har/mol; #References = LogK/DGf: 84har/mol; V°: Default value; Trona(Na) Na3H(CO3)2:2H2O + 1.000H+ = 2.000HCO3- + 3.000Na+ + 2.000H2O log_k 9.276 delta_h 9.560 #kJ/mol #82van -analytic -1.5651037E+3 -2.3608538E-1 8.5975659E+4 5.7087653E+2 -4.9950918E+6 #References = LogK/DGf: 84har/mol; DHf/DHr: 82van; S°: Internal calculation; Cp: 82van; V°: 95rob/hem; Truscottite Ca7Si12O29(OH)4:H2O + 14.000H+ + 14.000H2O = 7.000Ca+2 + 12.000H4SiO4 log_k 77.134 delta_h -451.092 #kJ/mol #10abla/bou -analytic -6.0499789E+3 -7.7969416E-1 3.9492302E+5 2.1453496E+3 -2.4314793E+7 #References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 95ant/bid; Tsumebite Pb2Cu(PO4)(SO4)OH + 3.000H+ = 1.000Cu+2 + 1.000H2PO4- + 2.000Pb+2 + 1.000SO4-2 + 1.000H2O log_k -66.023 #References = LogK/DGf: 78ric/nri; #References = LogK/DGf: 78ric/nri; V°: 63wyc; U3O8 U3O8 + 4.000H+ = 2.000UO2+ + 1.000UO2+2 + 2.000H2O log_k -3.596 delta_h -66.279 #kJ/mol #89cox/wag -analytic -6.3791854E+2 -1.064687E-1 3.7678137E+4 2.2772712E+2 -2.115901E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89bar/sau; V°: 95rob/hem; Ulvospinel Fe2TiO4 + 4.000H+ = 2.000Fe+2 + 1.000Ti(OH)4 log_k 16.405 delta_h -201.464 #kJ/mol #Internal calculation -analytic -1.1197988E+3 -1.3358889E-1 6.8782645E+4 3.9491461E+2 -2.8317245E+6 #References = LogK/DGf: 95rob/hem; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem; UO3(gamma) UO3 + 2.000H+ = 1.000UO2+2 + 1.000H2O log_k 7.712 delta_h -81.129 #kJ/mol #89cox/wag -analytic -2.269251E+2 -3.9352914E-2 1.4461672E+4 8.2058913E+1 -4.6082093E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem; Uraninite UO2 + 4.000H+ = 1.000U+4 + 2.000H2O log_k -4.839 delta_h -77.857 #kJ/mol #Internal calculation -analytic -5.6919348E+2 -9.2992713E-2 3.0455139E+4 2.0361233E+2 -1.2349132E+6 #References = LogK/DGf: 97csho/sas; DHf/DHr: Internal calculation; S°: 97csho/sas; Cp: 97csho/sas; V°: 95rob/hem; Valentinite Sb2O3 + 3.000H2O = 2.000Sb(OH)3 log_k -8.516 delta_h 57.242 #kJ/mol #Internal calculation -analytic 1.8630582E+2 1.7323698E-2 -1.7580045E+4 -6.245816E+1 1.2023398E+6 #References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi; Variscite AlPO4:2H2O + 2.000H+ = 1.000Al+3 + 1.000H2PO4- + 2.000H2O log_k -2.158 delta_h -59.250 #kJ/mol #Internal calculation -analytic -1.069096E+3 -1.7322356E-1 5.9751042E+4 3.8601185E+2 -3.2874639E+6 #References = LogK/DGf: 74nau/ryz; DHf/DHr: Internal calculation; S°: 66ega/wak; Cp: 74nau/ryz; V°: 63wyc; Vaterite CaCO3 + 1.000H+ = 1.000HCO3- + 1.000Ca+2 log_k 2.427 delta_h -29.630 #kJ/mol #87gar/par -analytic -8.8571443E+2 -1.3868709E-1 4.9073483E+4 3.2145911E+2 -2.7141083E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 95rob/hem; VermiculiteSO Ca0.445(Si2.778Al1.222)(Al0.216Mg2.475Fe0.254)O10(OH)2 + 10.888H+ = 1.438Al+3 + 0.445Ca+2 + 0.226Fe+3 + 2.475Mg+2 + 2.778H4SiO4 + 0.028Fe+2 + 0.888H2O log_k 45.904 delta_h -457.396 #kJ/mol #13gai/bla -analytic -2.8715623E+3 -4.1270713E-1 1.8439849E+5 1.0227505E+3 -9.6618206E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 13gai/bla; S°: 13gai/bla; Cp: 13gai/bla; V°: 13gai/bla; Vermiculite(Ca) Ca0.43Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 0.430Ca+2 + 3.000Mg+2 + 3.140H4SiO4 log_k 39.563 delta_h -370.212 #kJ/mol #15bla/vie -analytic -2.7557327E+3 -3.7804175E-1 1.7755183E+5 9.7871075E+2 -9.7123719E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Vermiculite(K) K0.86Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 0.860K+ + 3.000Mg+2 + 3.140H4SiO4 log_k 37.461 delta_h -328.213 #kJ/mol #15bla/vie -analytic -2.6971221E+3 -3.6798347E-1 1.7277164E+5 9.5883004E+2 -9.5777409E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Vermiculite(Mg) Mg0.43Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 3.430Mg+2 + 3.140H4SiO4 log_k 38.058 delta_h -372.482 #kJ/mol #15bla/vie -analytic -2.7903207E+3 -3.8203185E-1 1.7949836E+5 9.9037974E+2 -9.8128256E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Vermiculite(Na) Na0.86Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 3.000Mg+2 + 0.860Na+ + 3.140H4SiO4 log_k 38.405 delta_h -348.215 #kJ/mol #15bla/vie -analytic -2.7525898E+3 -3.7392402E-1 1.7669205E+5 9.7768226E+2 -9.7212455E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie; Vivianite Fe3(PO4)2:8H2O + 4.000H+ = 3.000Fe+2 + 2.000H2PO4- + 8.000H2O log_k -3.272 #References = LogK/DGf: 94alb/tom; #References = LogK/DGf: 94alb/tom; V°: 63wyc; Voltaite K2Fe9(SO4)12:18H2O = 5.000Fe+2 + 2.000K+ + 12.000SO4-2 + 4.000Fe+3 + 18.000H2O log_k -38.234 delta_h -347.300 #kJ/mol #02hem/sea -analytic -2.1081148E+4 -3.2380273E+0 1.1674091E+6 7.6171622E+3 -6.7145558E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: Default value; Vysotskite PdS + 1.000H+ = 1.000Pd+2 + 1.000HS- log_k -44.806 delta_h 232.566 #kJ/mol #Internal calculation -analytic -9.6498826E+2 -1.552161E-1 3.9896683E+4 3.5036221E+2 -3.0492371E+6 #References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho; Wairakite Ca(Al2Si4)O12:2H2O + 8.000H+ + 2.000H2O = 2.000Al+3 + 1.000Ca+2 + 4.000H4SiO4 log_k 14.444 delta_h -236.884 #kJ/mol #96kis/nav -analytic -2.659569E+3 -3.7206038E-1 1.6652132E+5 9.4388262E+2 -9.7025546E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 96kis/nav; S°: 96kis/nav; Cp: 07neu/wan; V°: 97coo/alb; Wavellite Al3(PO4)2(OH)3:5H2O + 7.000H+ = 3.000Al+3 + 2.000H2PO4- + 8.000H2O log_k 12.157 #References = LogK/DGf: 79vie/tar; #References = LogK/DGf: 79vie/tar; V°: 63wyc; Waylandite BiAl3(PO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 1.000Bi+3 + 2.000H2PO4- + 6.000H2O log_k 10.927 #References = LogK/DGf: 04gab/vie; #References = LogK/DGf: 04gab/vie; V°: Default value; Weillite CaHAsO4 + 1.000H+ = 1.000H2AsO4- + 1.000Ca+2 log_k 2.360 #References = LogK/DGf: 01gas/aza; #References = LogK/DGf: 01gas/aza; V°: 00bla/bid; Westerveldite FeAs + 2.000H+ + 0.500H2O = 1.000AsH3 + 1.000Fe+2 + 0.250O2 log_k -30.680 delta_h 161.563 #kJ/mol #Internal calculation -analytic -1.3332249E+2 -2.0499916E-2 -3.2509983E+3 4.8822128E+1 -1.0207523E+5 #References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok; Whitlockite(high) Ca3(PO4)2 + 4.000H+ = 3.000Ca+2 + 2.000H2PO4- log_k 10.120 delta_h -124.730 #kJ/mol #Internal calculation -analytic -1.9939171E+3 -3.2961925E-1 1.1275179E+5 7.2498167E+2 -6.2028155E+6 #References = LogK/DGf: 84nan; DHf/DHr: Internal calculation; S°: 84nan; Cp: 60kel; V°: 95rob/hem; Whitlockite(low) Ca3(PO4)2 + 4.000H+ = 3.000Ca+2 + 2.000H2PO4- log_k 8.393 delta_h -113.380 #kJ/mol #71par/wag -analytic -1.987741E+3 -3.2533142E-1 1.1250341E+5 7.2185701E+2 -6.2576605E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 71par/wag; S°: 71par/wag; Cp: 60kel; V°: 95rob/hem; Wollastonite CaSiO3 + 2.000H+ + 1.000H2O = 1.000Ca+2 + 1.000H4SiO4 log_k 14.047 delta_h -85.986 #kJ/mol #78hel/del,92ajoh -analytic -6.3184784E+2 -8.6944016E-2 4.1722732E+4 2.2563038E+2 -2.3494013E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,92ajoh; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh; Woodhouseite CaAl3(PO4)(SO4)(OH)6 + 8.000H+ = 3.000Al+3 + 1.000Ca+2 + 1.000H2PO4- + 1.000SO4-2 + 6.000H2O log_k 8.893 #References = LogK/DGf: 04gab/vie; #References = LogK/DGf: 04gab/vie; V°: Default value; Wurtzite ZnS + 1.000H+ = 1.000HS- + 1.000Zn+2 log_k -9.198 delta_h 22.250 #kJ/mol #Internal calculation -analytic -9.7140397E+2 -1.5442373E-1 5.1494768E+4 3.5177355E+2 -3.1030426E+6 #References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del; Wustite Fe0.947O + 2.000H+ = 0.841Fe+2 + 0.106Fe+3 + 1.000H2O log_k 12.240 delta_h -100.444 #kJ/mol #98cha -analytic -3.339745E+2 -5.2002139E-2 2.2588799E+4 1.1992389E+2 -9.5903287E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem; Xonotlite Ca6Si6O17(OH)2 + 12.000H+ + 5.000H2O = 6.000Ca+2 + 6.000H4SiO4 log_k 91.335 delta_h -559.866 #kJ/mol #56new -analytic -3.8251338E+3 -5.1722865E-1 2.5680809E+5 1.3628531E+3 -1.448512E+7 #References = LogK/DGf: 10abla/bou; DHf/DHr: 56new; S°: Internal calculation; Cp: 10abla/bou; V°: 56den/tay; Yavapaiite KFe(SO4)2 = 1.000Fe+3 + 1.000K+ + 2.000SO4-2 log_k -5.569 delta_h -77.020 #kJ/mol #05for/dro -analytic -3.3189727E+3 -5.2021275E-1 1.8590158E+5 1.19909E+3 -1.0852279E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 05for/dro; S°: 05for/dro; V°: 90rob/cam; Zairite BiFe3(PO4)2(OH)6 + 10.000H+ = 1.000Bi+3 + 3.000Fe+3 + 2.000H2PO4- + 6.000H2O log_k -3.680 #References = LogK/DGf: 04gab/vie; #References = LogK/DGf: 04gab/vie; V°: Default value; ZeoliteP(Ca) Ca2Al4Si4O16:9H2O + 16.000H+ = 4.000Al+3 + 2.000Ca+2 + 4.000H4SiO4 + 9.000H2O log_k 45.159 delta_h -527.740 #kJ/mol #10bbla/bou -analytic -3.9631092E+3 -5.6691115E-1 2.5021425E+5 1.4103537E+3 -1.349029E+7 #References = LogK/DGf: 08bla; DHf/DHr: 10bbla/bou; S°: Internal calculation; Cp: 10vie; V°: 97coo/alb; Zincite ZnO + 2.000H+ = 1.000Zn+2 + 1.000H2O log_k 11.193 delta_h -88.728 #kJ/mol #13pow/bro -analytic -3.4633277E+2 -5.231005E-2 2.2726463E+4 1.2447389E+2 -9.8716955E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 13pow/bro; S°: 89cox/wag; Cp: 95rob/hem; V°: 95rob/hem; Zn3(PO4)2 Zn3(PO4)2 + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 log_k 14.468 delta_h -165.756 #kJ/mol #84vie/tar, after 74avol/yag -analytic -2.3046635E+3 -3.5529587E-1 1.3201826E+5 8.3298135E+2 -7.0124985E+6 #References = LogK/DGf: 84vie/tar,after 78yag; DHf/DHr: 84vie/tar, after 74avol/yag; S°: Internal calculation; V°: Default value; Zn3(PO4)2:2H2O Zn3(PO4)2:2H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 2.000H2O log_k 8.230 delta_h -120.716 #kJ/mol #84vie/tar, after 78yag -analytic -2.3562013E+3 -3.5545285E-1 1.3202018E+5 8.5130184E+2 -7.0118601E+6 #References = LogK/DGf: 84vie/tar,after 78yag; DHf/DHr: 84vie/tar, after 78yag; S°: Internal calculation; V°: Default value; Zn3(PO4)2:H2O Zn3(PO4)2:H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 1.000H2O log_k 10.902 delta_h -139.486 #kJ/mol #84vie/tar, after 78yag -analytic -2.3302222E+3 -3.5537436E-1 1.3182335E+5 8.4214159E+2 -7.0121793E+6 #References = LogK/DGf: 84vie/tar,after 78yag; DHf/DHr: 84vie/tar, after 78yag; S°: Internal calculation; V°: Default value; Zn5(PO4)3Cl Zn5(PO4)3Cl + 6.000H+ = 1.000Cl- + 3.000H2PO4- + 5.000Zn+2 log_k 24.843 #References = LogK/DGf: 76nri; #References = LogK/DGf: 76nri; V°: Default value; Zn5(PO4)3OH Zn5(PO4)3OH + 7.000H+ = 3.000H2PO4- + 5.000Zn+2 + 1.000H2O log_k 13.177 #References = LogK/DGf: 84nri; #References = LogK/DGf: 84nri; V°: Default value; ZnHPO4 ZnHPO4 + 1.000H+ = 1.000H2PO4- + 1.000Zn+2 log_k -2.333 delta_h -80.033 #kJ/mol #Internal calculation -analytic -9.9029332E+2 -1.5077953E-1 5.670674E+4 3.5415923E+2 -2.9889615E+6 #References = LogK/DGf: 06pia/bod; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; V°: Default value; ZnSiO3glass ZnSiO3 + 2.000H+ + 1.000H2O = 1.000H4SiO4 + 1.000Zn+2 log_k 1.758 delta_h -89.311 #kJ/mol #Internal calculation -analytic -7.6264982E+2 -9.6666895E-2 4.8514609E+4 2.6693933E+2 -2.668003E+6 #References = LogK/DGf: 92plo/wic; DHf/DHr: Internal calculation; S°: 95rob/hem; V°: Default value; Zoisite Ca2Al3Si3O12(OH) + 13.000H+ = 3.000Al+3 + 2.000Ca+2 + 3.000H4SiO4 + 1.000H2O log_k 43.848 delta_h -485.113 #kJ/mol #01sme/fra -analytic -3.1722373E+3 -4.6912132E-1 2.0150433E+5 1.1315082E+3 -1.0643978E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 01sme/fra; S°: 04got; Cp: 04got; V°: 04got; Actinolite Ca2(Mg2.25Fe2.5Al0.25)(Si7.75Al0.25)O22(OH)2 + 15.000H+ + 7.000H2O = 0.500Al+3 + 2.000Ca+2 + 2.500Fe+2 + 2.250Mg+2 + 7.750H4SiO4 log_k 7.128 delta_h -181.662 #kJ/mol #19bla/lac -analytic -5.0954182E+3 -6.949504E-1 3.0825312E+5 1.8133351E+3 -1.8767155E+7 #References = LogK/DGf: Internal calculation; DHf/DHr: 19bla/lac; S°: 19bla/lac; Cp: 19bla/lac; V°: 19bla/lac; Zn(OH)2_e Zn(OH)2 + 2.000H+ = 1.000Zn+2 + 2.000H2O log_k 11.382 delta_h -100.000 #kJ/mol #13pow/bro -analytic -4.0154128E+2 -5.3893789E-2 2.5885353E+4 1.4298338E+2 -1.0339371E+6 #References = LogK/DGf: 13pow/bro; DHf/DHr: 13pow/bro; S°: Internal calculation; V°: Default value; Zn(OH)2_b1 Zn(OH)2 + 2.000H+ = 1.000Zn+2 + 2.000H2O log_k 11.722 #References = LogK/DGf: 13pow/bro; #References = LogK/DGf: 13pow/bro; V°: Default value; Zn(OH)2_b2 Zn(OH)2 + 2.000H+ = 1.000Zn+2 + 2.000H2O log_k 11.762 #References = LogK/DGf: 13pow/bro; #References = LogK/DGf: 13pow/bro; V°: Default value; Zn(OH)2_g Zn(OH)2 + 2.000H+ = 1.000Zn+2 + 2.000H2O log_k 11.702 #References = LogK/DGf: 13pow/bro; #References = LogK/DGf: 13pow/bro; V°: Default value; Zn(OH)2_d Zn(OH)2 + 2.000H+ = 1.000Zn+2 + 2.000H2O log_k 11.812 #References = LogK/DGf: 13pow/bro; #References = LogK/DGf: 13pow/bro; V°: Default value; Hydrozincite Zn5(OH)6(CO3)2 + 8.000H+ = 2.000HCO3- + 5.000Zn+2 + 6.000H2O log_k 26.856 delta_h -277.767 #kJ/mol #13pow/bro -analytic -2.9831904E+3 -4.658426E-1 1.7180254E+5 1.0796095E+3 -8.7750572E+6 #References = LogK/DGf: 13pow/bro; DHf/DHr: 13pow/bro; S°: Internal calculation; Cp: 01pre/gam; V°: 63wyc; Hydrozincite(mc) Zn5(OH)6(CO3)2 + 8.000H+ = 2.000HCO3- + 5.000Zn+2 + 6.000H2O log_k 29.706 delta_h -277.767 #kJ/mol #13pow/bro -analytic -2.9803404E+3 -4.658426E-1 1.7180254E+5 1.0796095E+3 -8.7750572E+6 #References = LogK/DGf: 13pow/bro; DHf/DHr: 13pow/bro; S°: Internal calculation; Cp: 01pre/gam; V°: 63wyc; Hopeite(para) Zn3(PO4)2:4H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 4.000H2O log_k 10.208 delta_h -130.926 #kJ/mol #84vie/tar -analytic -2.3043984E+3 -3.3859121E-1 1.2947956E+5 8.3124079E+2 -6.7177024E+6 #References = LogK/DGf: 84vie/tar; DHf/DHr: 84vie/tar; S°: Internal calculation; V°: 63wyc; # PMATCH GASES Ar(g) Ar = 1.000Ar log_k -2.853 delta_h -12.011 #kJ/mol #Internal calculation -analytic 1.0247144E+2 2.1560163E-2 -6.0959431E+3 -3.9305133E+1 5.2903083E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; Br2(g) Br2 + 2.500O2 + 1.000H2O = 2.000BrO3- + 2.000H+ log_k -40.272 delta_h 151.078 #kJ/mol #89cox/wag -analytic -1.4934932E+3 -2.4330708E-1 7.9796062E+4 5.3553448E+2 -5.9575741E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; CH4(g) CH4 = 1.000CH4 log_k -2.852 delta_h -13.033 #kJ/mol #98cha -analytic 2.1637472E+2 3.7708343E-2 -1.3407085E+4 -7.9787987E+1 1.0603213E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 18sig; Cl2(g) Cl2 + 1.500O2 + 1.000H2O = 2.000ClO2- + 2.000H+ log_k -43.202 delta_h 170.910 #kJ/mol #By convention -analytic -1.4601846E+3 -2.3497967E-1 7.4365808E+4 5.2470839E+2 -5.3993088E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; CO(g) CO = 1.000CO log_k -3.028 delta_h -10.429 #kJ/mol #89cox/wag -analytic 2.0392287E+2 3.3602805E-2 -1.3511248E+4 -7.4398193E+1 1.1059156E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; CO2(g) CO2 + 1.000H2O = 1.000HCO3- + 1.000H+ log_k -7.821 delta_h -10.590 #kJ/mol #89cox/wag -analytic -5.7507055E+2 -9.3141147E-2 3.1611113E+4 2.061746E+2 -1.8818659E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; F2(g) F2 + 1.000H2O = 2.000F- + 0.500O2 + 2.000H+ log_k 55.651 delta_h -390.937 #kJ/mol #By convention -analytic -1.2945503E+3 -2.073214E-1 8.9896765E+4 4.6733048E+2 -4.0784041E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; H2(g) H2 + 0.500O2 = 1.000H2O log_k 43.001 delta_h -279.763 #kJ/mol #By convention -analytic -9.7000832E+1 -1.3278572E-2 2.0554694E+4 3.2310915E+1 -4.3832674E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; H2O(g) H2O = 1.000H2O log_k 1.506 delta_h -44.004 #kJ/mol #89cox/wag -analytic -2.3213898E+1 -4.7007593E-4 3.0569287E+3 5.9253123E+0 -4.8803037E+3 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; H2S(g) H2S = 1.000HS- + 1.000H+ log_k -7.998 delta_h 4.300 #kJ/mol #89cox/wag -analytic -7.7127715E+2 -1.2255518E-1 4.1397856E+4 2.7827756E+2 -2.4543375E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; HCl(g) HCl = 1.000Cl- + 1.000H+ log_k 6.299 delta_h -74.770 #kJ/mol #89cox/wag -analytic -6.3720253E+2 -1.0269569E-1 3.8570655E+4 2.2966638E+2 -2.0926463E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; He(g) He = 1.000He log_k -3.409 delta_h -0.634 #kJ/mol #By convention -analytic 1.0815628E+2 2.2564863E-2 -6.7331757E+3 -4.1022233E+1 5.1535315E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; Hg(CH3)2(g) Hg(CH3)2 + 2.000H+ = 1.000Hg+2 + 2.000CH4 log_k 8.824 delta_h -99.993 #kJ/mol #82wag/eva -analytic 1.1863116E+2 2.4722443E-2 -6.5144924E+3 -4.4108004E+1 1.2279784E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: Default value; Hg(g) Hg = 1.000Hg log_k -0.918 delta_h -48.877 #kJ/mol #89cox/wag -analytic 1.4728083E+2 2.7804157E-2 -1.0282255E+4 -5.4874827E+1 1.2251378E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; I2(g) I2 + 2.500O2 + 1.000H2O = 2.000IO3- + 2.000H+ log_k 13.953 delta_h -188.798 #kJ/mol #89cox/wag -analytic -1.574445E+3 -2.5535266E-1 1.0104771E+5 5.6345195E+2 -6.0989611E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; Kr(g) Kr = 1.000Kr log_k -2.599 delta_h -15.265 #kJ/mol #By convention -analytic 1.5418658E+2 2.7181652E-2 -1.0135989E+4 -5.6952629E+1 8.9175105E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; N2(g) N2 = 1.000N2 log_k -3.181 delta_h -10.374 #kJ/mol #By convention -analytic 1.9129523E+2 3.2723886E-2 -1.2195873E+4 -7.0432157E+1 9.7360057E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; Ne(g) Ne = 1.000Ne log_k -3.340 delta_h -3.645 #kJ/mol #By convention -analytic 1.0930207E+2 2.2477932E-2 -6.8539283E+3 -4.1431746E+1 5.4794274E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; NH3(g) NH3 = 1.000NH3 log_k 1.810 delta_h -35.627 #kJ/mol #89cox/wag -analytic -1.0678705E+2 -7.8888089E-3 8.4083244E+3 3.5264156E+1 -4.0102535E+5 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; O2(g) O2 = 1.000O2 log_k -2.893 delta_h -12.134 #kJ/mol #By convention -analytic 1.7801783E+2 3.0292392E-2 -1.1471729E+4 -6.5497059E+1 9.4241338E+5 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; S2(g) S2 + 2.000H2O = 2.000HS- + 1.000O2 + 2.000H+ log_k -76.315 delta_h 398.326 #kJ/mol #89cox/wag -analytic -1.1105401E+3 -1.797198E-1 3.8238562E+4 4.0321915E+2 -3.3942654E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; SO2(g) SO2 + 1.000H2O = 1.000SO3-2 + 2.000H+ log_k -8.936 delta_h -48.420 #kJ/mol #89cox/wag -analytic -9.4894252E+2 -1.528595E-1 5.5815518E+4 3.3827315E+2 -3.4365885E+6 #References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig; Xe(g) Xe = 1.000Xe log_k -2.358 delta_h -18.860 #kJ/mol #By convention -analytic 2.4653496E+2 3.8234446E-2 -1.6842452E+4 -8.8953639E+1 1.4495917E+6 #References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value; References # 00bru/dur Bruno J. and Duro L. (2000) Reply to W. Hummel's comment on and correction to 'On the influence of carbonate in mineral dissolution: 1. The thermodynamics and kinetics of hematite dissolution in bicarbonate solutions at T = 25C' by J. Bruno, W. Stumm, P. Wersin, and F. Brandberg. Geochimica et Cosmochimica Acta 64(12), 2173-2176. # 00bla/bid Bladh K.W., Bideaux R.A., Anthony-Morton E., Nichols B.G. (2000) The Handbook of Mineralogy Volume IV, Mineralogical Society of America. # 00cou Courault, A. C., 2000, Simulation experimentale des C-S-H dans les betons modernes : etude de la composition et des proprietes a l'equilibre dans des milieux complexes : Ph.D. thesis, Universite de Bourgogne, Dijon, 201 p. # 00cra/eig Crannell B.S., Eighmy T.T., Krzanowski J.E., Eusden J.D. Jr., Shaw E.L., Francis C.A., 2000, Heavy metal stabilization in municipal solid waste combustion bottom ash using soluble phosphate. Waste Manag., 20, 135-148 # 00deb/cas Deberdt S., Castet S., Dandurand J.L. and Harrichoury J.C., 2000. Potentiometric study of Gd- and Yb-acetate complexing in the temperature range 25-80C. Chemical Geology, Volume 167, Issues 1-2, 5 June 2000, Pages 75-88 # 00gun/arn Gunnarson I., and Arnorsson S., 2000. Amorphous silica solubility and the thermodynamic properties of H4SiO4 in the range of 0 to 350C at Psat. Geochimica et Cosmochimica Acta, 64, p. 2295-2307. # 00lyd Lyde D.R., 2000. CRC Handbook of Chemistry and Physics, 2000-200. CRC Press # 00mer/bon Merlino, S., Bonaccorsi, E., and Armbruster, T., 2000, The real structure of clinotobermorite and tobermorite 9 A: OD character, polytypes, and structural relationships: European Journal of Mineralogy, v. 12, p. 411-429. # 00per/pal Perkins R.B. and Palmer C.D., 2000. Solubility of Ca6[Al(OH)6]2(CrO4)3.26 H2O, the chromate analog of ettringite; 5-75C. Applied Geochem., 15, p. 1203-1218. # 00pui Puigdomenech, I., 2000. Thermodynamic data for copper: implications for the corrosion of copper under repository conditions, SKB report. SKB/Swedish Nuclear Fuel and Waste Management, p. 96. # 00rea/fag Reardon E.J., and Fagan R., 2000. The calcite/portlandite phase boundary: enhanced calcite solubility at high pH. Applied Geochemistry, 15, p. 327 335. # 00sto/alp Stoffregen R. E., Alpers C. N., and Jambor J. L. (2000) Alunite-jarosite crystallography, thermodynamics, and geochronology. Rev. Mineral. Geochem. 40, 453-479. # 00tag/dia Tagirov B. R., Diakonov I. I., Devina O. A., and Zotov A. V. (2000) Standard ferric-ferrous potential and stability of FeCl2+ to 90C. Thermodynamic properties of Fe(aq)3+ and ferric-chloride species. Chemical Geology 162(3-4), 193-219. # 00vie Vieillard P., 2000. A new method for the prediction of Gibbs free energies of formation of hydrated clay minerals based on the electronegativity scale. Clays and Clay Minerals, 48, p. 459-473. # 00zue/feh Zuern, S.G., and Fehr, K.T., 2000. Phase relations and thermodynamic properties of 1.13 nm tobermorite and xonotlite. In: Sixth International Symposium on Hydrothermal reactions/Fourth International Conference on Solvo-thermal Reactions, Kochi, Japan, pp. 286-289. # 01aki/zot Akinfiev N. N. and Zotov A. V., 2001. Thermodynamic Description of Chloride, Hydrosulfide, and Hydroxo Complexes of Ag(I), Cu(I), and Au(I) at Temperatures of 25-500oC and Pressures of 1-2000 bar. Geochem. Intern., v. 39, No 10, p. 990-1006. Abstract # 01aya/mad Ayati M., and Madsen H.E.L., 2001. Solubility Product of the Cadmium Phosphate Cd5H2(PO4)4.4H2O at 37 C. J. Chem. Eng. Data, 46, p. 113 116. # 01ben/jem Ben Cherifa A., and Jemal M., 2001. Synthese et thermochimie de phosphates au cadmium: Partie I: Cas du phosphate tricadmique et de la chlorapatite cadmiee. Thermochimica Acta, 366, p. 1 6. # 01ben/pal Benezeth P., Palmer D.A., and Wesolowski D.J., 2001. Aqueous high-temperature solubility studies. II. The solubility of boehmite at 0.03 m ionic strength as a function of temperature and pH as determined by in situ measurements. Geochimica et Cosmochimica Acta, 65, p. 2097-2111 # 01fel/cho Felmy A. R., Cho H., Rustad J. R., and Mason M. J. (2001) An aqueous thermodynamic model for polymerized silica species to high ionic strength. Journal of Solution Chemistry 30(6), 509-525. # 01fia/nav Fialips C.-I., Navrotsky A. and Petit S. (2001) - Crystal properties and energetics of synthetic kaolinite. American Mineralogist, 86, p. 304.311. # 01fri/neu Fridriksson, T., Neuhoff, P. S., Arnorsson, S., and Bird, D. K., 2001, Geological constraints on the thermodynamic properties of the stilbite-stellerite solid solution in low-grade metabasalts. Geochimica Cosochimica Acta, v. 65, p. 3993-4008. # 01gas/aza Gaskova O., Azaroual M., Piantone, P., Lassin A. (2001) - Arsenic behaviour in subsurface hydrogeochemical systems - A critical review of thermodynamic data forarsenic minerals and aqueous species - A compilation of arsenic surface complexation reactions. BRGM Report RP-51356-FR, 78 p. # 01kal/mar Kahl W.A. and Maresch W.V., 2001. Enthalpies of formation of tremolite and talc by high-temperature solution calorimetry-a consistent picture. American Mineralogist, 86, p. 1345-1357 # 01mer/vie Lionel Mercury, Philippe Vieillard, Yves Tardy, 2001. Thermodynamics of ice polymorphs and 'ice-like' water in hydrates and hydroxides. Applied Geochemistry, Volume 16, Issue 2, February 2001, Pages 161-181 # 01per/hef Pererra N.W., Hefter G., and Sipos P.M., 2001. An Investigation of the Lead(II)-Hydroxide System. Inorg. Chem., 40, p. 3974-3978. # 01per/pal Perkins R.B. and Palmer C.D., 2001. Solubility of chromate hydrocalumite (3CaO.Al2O3.CaCrO4.nH2O) at 5-75C. Cement and Concrete Research, 31, pp. 983-992. # 01pre/gam Preis W., and Gamsjager H., 2001. Invited Review Thermodynamic Investigation of Phase Equilibria in Metal Carbonate Water Carbon Dioxide Systems. Monatshefte fur Chemie, 132, p. 1327 1346. # 01sch/sho Schulte M.D., Shock E.L. and Wood R.H., 2001. The temperature dependence of the standard-state thermodynamic properties of aqueous nonelectrolytes. Geochimica et Cosmochimica Acta, 65, 3919-3930 # 01sme/fra Smelik, E.A., Franz, G., Navrotsky, A., 2001. A calorimetric study of zoisite and clinozoisite solid solutions. American Mineralogist 86, 80-91. # 01ste A. Stefansson, 2001Dissolution of primary minerals of basalt in natural waters: I. Calculation of mineral solubilities from 0C to 350C. Chemical Geology, Volume 172, Issues 3-4, 225-250 # 01tag/sch Tagirov B., and Schott J., 2001. Aluminum speciation in crustal fluids revisited Geochim. Cosmochim. Acta (Helgeson's special issue), 65, p. 3965 3992. # 01vid/par Vidal, O., Parra, T. and Trotet, F (2001): A thermodynamic model for Fe-Mg aluminous chlorite using data from phase equilibrium experiments and natural pelitic assemblages in the 100-600C, 1-25 kbar P-T range. Am. J. Sci., 301, 557-592. # 01wen/mus Wentzel M.C., Musvoto E.V. and Ekama G.A., 2001. Application of integrated chemical - physical processes modelling to aeration treatment of anaerobic digester liquors. Environmental Technology, 22, 1287-1293 # 02cho/sea Chou, I.M., Seal, R.R., Hemingway, B.S. (2002) Determination of melanterite-rozenite and chalcanthite-bonattite equilibria by humidity measurements at 0.1 MPa, Am. Mineral. 87, 108-114. # 02dut Dutrizac J.E., 2002. Calcium sulphate solubilities in simulated zinc processing solutions. Hydrometallurgy, 65, p. 109-135. # 02hem/sea Hemingway, B.S., Seal, R.R., II, and Chou, I-M. (2002) Thermodynamic data for modeling acid mine drainage problems. Part I. Selected soluble iron-sulfate minerals. U.S. Geological Survey Open File Report 02 - 161, 13 p. # 02hum/ber NAGRA Hummel W., Berner U., Curti E., Pearson F.J., and Thoenen T., 2002. Nagra/PSI Chemical Thermodynamic Data Base 01/01. Universal Publishers (uPUBL.com), 600 pp. # 02mig/will Migdisov Art A. and Williams-Jones A. E. 2002. A spectrophotometric study of neodymium(III) complexation in chloride solutions. Geochimica et Cosmochimica Acta, 66, 4311-4323 # 02ogo/mel Ogorodova L.P., Melchakova L.V., Kiseleva I.A. 2002 Enthalpies of formation of formation of natural zeolites - gismondine, garronite and amicite. Experimental mineralogy, petrology and geochemistry annual seminar 2002, April 16-17, 2002, Moscow # 02par/vid Parra, T., Vidal, O., and Agard, P., 2002, A thermodynamic model for fe-mg dioctahedral k white micas using data from phase-equilibrium experiments and natural pelitic assemblages: Contribution to Mineralogy and Petrology, v. 143, p. 706-732. # 02wal/pre Wallner, H., Preis, W., Gamsjager, H., 2002. Solid-solute phase equilibria in aqueous solutions: XV [1]. Thermodynamic analysis of the solubility of nickel carbonates. Thermochimica acta 382, 289-296. # 03ald/gan Alderighi, L., Gans, P., Midollini, S., Vacca, A., 2003. Co-ordination chemistry of the methylmercury(II) ion in aqueous solution: a thermodynamic investigation. Inorganica Chimica Acta 356, 8-18. # 03alt/met Altamaier M., Metz V., Neck V., Muller R.and Fanghanel Th., 2003. Solid liquid equilibria of Mg(OH)2(cr) and Mg2(OH)3Cl.4H2O(cr) in the system Mg Na H OH Cl H2O at 25C. Geochimica et Cosmochimica Acta, 67, p. 3595-3601. # 03bou Bourbon X., 2003. Chemical conceptual model for cement based materials ~ mineral phases and thermodynamic data. Technical report C.NT.ASCM.03.026, 14 p. # 03chr Christov C., 2003. Thermodynamic study of the aqueous sodium, potassium, and chromium chloride systems at the temperature 298.15K. J. Chem. Thermodynamics, 35, p. 909-917. # 03dea Dean J.A. 2003. Lange's Handbook of chemistry, 2nd edition. Science and technology press: Beijing (in Chinese). # 03dro/bar Drouet C. , Baron D. , Navrotsky A. (2003) On the thermochemistry of the solid solution between jarosite and its chromate analog. American Mineralogist, 88, 1949-1954 # 03dro/nav Drouet C, Navrotsky A (2003) Synthesis, characterization and thermochemistry of K-Na-H3O jarosites. Geochim Cosmochim Acta 67:2063-2076 # 03fre/voi Freyer D., and Voigt W., 2003. Invited Review : Crystallization and Phase Stability of CaSO4 and CaSO4 - Based Salts. Monatshefte fur Chemie, 134, p. 693-719. # 03maj/gre Majzlan., J., Grevel, K.-D., Navrotsky, A., (2003) Thermodynamics of iron oxides. H. Enthalpies of formation and relative stability of goethite (a-FeOOH), lepidocrocite (y-FeOOH), and maghemite (y-Fe2O3). American Mineralogist 88, 855-859. # 03web/hun Weber C.F., and Hunt R.D., 2003. Modeling Alkaline Silicate Solutions at 25 C. Ind. Eng. Chem. Res., 42, p. 6970 6976. # 03wil/wal Wilkin, R. T., D. Wallschlager, and R. G. Ford. 2003. Speciation of arsenic in sulfidic waters. Geochem. Trans. 4:1-7. # 03zot/shi Zotov A. V., Shikina N. D. and Akinfiev N. N., 2003. Thermodynamic properties of the Sb(III) hydroxide complex Sb(OH)3(aq) at hydrothermal conditions. Geochimica et Cosmochimica Acta, Volume 67, 1821-1836 # 04chi Chivot J., 2004. Thermodynamique des produits de corrosion. Fonctions thermodynamiques de solubilite, diagrammes E-pH des systemes Fe-H2O, Fe-CO2-H2O, Fe-S-H2O, Cr-H2O et Ni-H2O en fonction de la temperature. Document ANDRA, Collection Sciences et Techniques. # 04chr Christov C., 2004. 'Pitzer ion-interaction parameters for Fe(II) and Fe(III) in the quinary {Na + K + Mg + Cl + SO4 + H2O} system at T = 298.15 K.' J. Chem. Thermod. 36: 223-235. # 04ess/fos Essington M.E., Foss J.E. and Roh Y., 2004. The soil mineralogy of lead at Horace's Villa. Soil Sci. Soc. Am. J., 68, p. 979 993. # 04eva Evans B. (2004) The serpentine multisystem revisited: Chrysotile is metastable, International Geology Review, 46, 479-506 # 04fab/sax Fabrichnaya O., Saxena S.K., Richet P. and Westrum E.F. (Eds), 2004. Thermodynamic data, models, and phase diagrams in multicomponent oxide systems. ISBN 3-540-14018-2 Springer Verlag Berlin Heidelberg New York, 198 p. # 04gab/vie Gaboreau S. and Vieillard Ph. (2004). Prediction of Gibbs free energies of formation of minerals of the alunite supergroup. Geochimica and Cosmochimica Acta, 68, 3307-3316 # 04gar/muc Alain Garand, Alfonso Mucci. The solubility of fluorite as a function of ionic strength and solution composition at 25C and 1 atm total pressure. Marine Chemistry, Volume 91, Issues 1-4, 15 November 2004, Pages 27-35 # 04got Gottschalk, M., 2004. Thermodynamic Properties of Zoisite, Clinozoisite and Epidote. Reviews in Mineralogy and Geochemistry 56, 83-124. # 04loo/pas Loos D., Pasel C., Luckas M., Schmidt Klaus G., and Herbell J.D., 2004. Experimental investigation and modelling of the solubility of calcite and gypsum in aqueous systems at higher ionic strength. Fluid Phase Equilibria, 219, p. 219-229. # 04maj/nav Majzlan, J., Navrotsky, A., Schwertmann, U. (2004) Thermodynamics of iron oxides: Part III. Enthalpies of formation and stability of ferrihydrite (~Fe(OH)3), schwertmannite (~FeO(OH)3/4(SO4)1/8), and e-Fe2O3. Geochimica et Cosmochimica Acta 68, 1049-1059 # 04maj/ste Majzlan, J., Stevens, R., Boerio-Goates, J., Woodfield, B.F., Navrotsky, A., Burns, P.C., Crawford, M.K., Amos, T.G. (2004) Thermodynamic properties, low-temperature heat capacity anomalies, and single crystal X-ray refinement of hydronium jarosite, (H3O)Fe3(SO4)2(OH)6. Physics and Chemistry of Minerals 31, 518-531 # 04neu/hov Neuhoff, P.S., Hovis, G.L., Balassone, G., and Stebbins, J.F., 2004, Thermodynamic properties of analcime solid solutions. American Journal of Science, v. 304, p. 21-66. # 04roi Roine A., 2004. HSC Chemistry: v5.0, Outokompu Research Oy: Pori. # 04smi/mar Smith R.M., and Martell A.E., 2004. NIST Critically Selected Stability Constants of Metals Complexes Database, V 8.0. National Institute of Standards and Technology (NIST); Texas A and M University. # 04wan/li Wang T. and Li Z., 2004. Some thermodynamic properties of calcium chromate. J. Chem. Eng. Data, 49, p. 1300-1302. # 04xu/app Xu, T, J. A. Apps, and K. Pruess, Numerical simulation of CO2 disposal by mineral trapping in deep aquifers, Applied Geochemistry, 19, 917-936, 2004 # 05bes/app Bessinger, B. and Apps, J.A., 2005. The Hydrothermal Chemistry of Gold, Arsenic, Antimony, Mercury and Silver. Report LBNL-57395, 52 p. # 05for/dro Forray, F.L., Drouet, C, Navrotsky, A. (2005) Thermochemistry of yavapaiite KFe(SO4)2: Formation and decomposition. Geochimica et Cosmochimica Acta 69(8), 2133-2140 # 05gam/bug Gamsjager, H., Bugajski, J., Gajda, T., Lemire, R., 2005. Chemical Thermodynamics of Nickel. Elsevier Science. # 05kin/par Kim T.G. and Park B., 2005. Synthesis and Growth Mechanisms of One-Dimensional Strontium Hydroxyapatite Nanostructures. Inorganic chemistry, 44, p. 9895-9901 # 05las/aza Lassin A., Azaroual M., Mercury L. (2005) 'Geochemistry of Unsaturated Soil Systems: Aqueous Speciation and Solubility of Minerals and Gases in Capillary Solutions'. Geochim. Cosmochim. Acta 69, 5187-5201. # 05liu/mcp Liu W. and McPhail D.C., 2005. Thermodynamic properties of copper chloride complexes and copper transport in magmatic-hydrothermal solutions. Chemical Geology, 221, 21-39 # 05maj/nav Majzlan, J., Navrotsky, A., Stevens, R., Donaldson, M., Woodfield, B.F., Boerio-Goates, J. (2005) Thermodynamics of monoclinic Fe2(SO4)3. Journal of Chemical Thermodynamics 37, 802-809 # 05pok/rou Pokrovski G.S., Roux J., Hazemann J.L. and Testemale D. , 2005. An X-ray absorption spectroscopy study of argutite solubility and aqueous Ge(IV) speciation in hydrothermal fluids to 500 C and 400 bar. Chemical Geology, 217, 127-145 # 05pow/bro Powell, K.J., Brown, P.L., Byrne, R.H., Gajda, T., Hefter, G., Sjoberg, S., Wanner, H., 2005. Chemical speciation of environmentally significant heavy metals with inorganic ligands. Part 1: The Hg2+- Cl-, OH-, CO32-, SO42-, and PO43- aqueous systems (IUPAC Technical Report). Pure and Applied Chemistry 77, 739-800. # 05vid/par Vidal O., Parra T., Vieillard, P., 2005. Thermodynamic properties of the Tschermak solid solution in Fe-chlorite: Application to natural examples and possible role of oxidation. American Mineralogist 90, 347-358. # 05wal/pel Waldner, P., Pelton, A.D. (2005) Thermodynamic modeling of the Fe-S system. Journal of Phase Equilibria and Diffusion 26, 23-38. # 06bla/ign Blanc P., Ignatadis I., Lassin A. et Burnol A., 2006. Thermochimie : Selection de constantes thermodynamiques pour le chrome, le cobalt et le strontium. Rapport final. Rapport BRGM 55083-FR. # 06bla/las Blanc P., Lassin A., Gaucher E.C. et Jacquot E., 2006. Un modele thermodynamique et mineralogique de beton : prise en compte de l'influence de la temperature. Rapport final. Rapport BRGM 55084-FR. # 06bla/pia Blanc P., Piantone P., Lassin A. et Burnol A., 2006. Thermochimie : Selection de constantes thermodynamiques pour les elements majeurs, le plomb et le cadmium. Rapport final. Rapport BRGM 54902-FR # 06bod/las Bodenan F., Lassin A., Hottier M., Filippov L. et Piantone P., 2006. Projet Decalco - Piegeage et valorisation de dechet alcalin par passivation au CO2 industriel. Rapport BRGM/RP-55015-FR, 140 p. # 06deo/nav Deore S., and Navrotsky A., 2006. Oxide melt solution calorimetry of sulfides: Enthalpy of formation of sphalerite, galena, greenockite, and hawleyite. American Mineralogist, 91, p. 400 403. # 06gai/bla Gailhanou H., et Blanc P., 2006. Thermochimie - Estimation des entropies, capacites calorifiques et volumes molaires des phyllosilicates 2 :1 deshydrates. BRGM/RP-55095-FR # 06gau/bla Gaucher E. C., Blanc P., Bardot F., Braibant G., Buschaert S., Crouzet C., Gautier A., Girard J.-P., Jacquot E., Lassin A., Negrel G., Tournassat C., Vinsot A., Altmann S. (2006) Modelling the porewater chemistry of the Callovian-Oxfordian formation at a at a regional scale, C. R. Geoscience 338 (2006). # 06lan/mah Langmuir D, Mahoney J, Rowson J (2006) Solubility products of amorphous ferric arsenate and crystalline scorodite (Fe- AsO4_2H2O) and their application to arsenic behavior in buried mine tailings. Geochim Cosmochim Acta 70:2942-2956 # 06las/bla Lassin A. et Blanc P., 2006. Considerations sur les contraintes liees a la gestion des donnees thermodynamiques en vue de la creation de la base de donnees THERMODDEM. Rapport BRGM/RP-55118-FR, 120 p. # 06mes/bou Messnaoui B., and Bounahmidi T., 2006. On the modeling of calcium sulfate solubility in aqueous solutions. Fluid Phase Equilibria, 244, p. 117-127. # 06pia/bod Piantone P., Bodenan F. et Lassin A., 2006. Projet NOVOSOL - Evaluation environnementale de sediments phosphates et calcines. Rapport BRGM/RP-54845-FR, 133 p. # 06pia/now Piantone P., Nowak C., Blanc P., Lassin A. et Burnol A., 2006. Themoddem : THERmodynamique et MOdelisation de la Degradation DEchets Mineraux. Rapport d'avancement. Rapport BRGM n BRGM/RP- 54547-FR, 52 p. # 07avie Vieillard P., 2007. Estimation des entropies et capacites calorifiques des zeolithes. Rapport CNRS-Hydrasa 2007-2, 30 p. # 07bla/bou Blanc P., Bourbon X. et Lassin A. (2007) Un modele thermodynamique et mineralogique de beton : selection de constantes thermodynamiques. Rapport final. Rapport BRGM/RP-55967-FR # 07bla/gai Blanc P. et Gailhanou H. (2007) Thermochimie : Estimation des entropies, capacites calorifiques et volumes molaires des phyllosilicates deshydrates et hydrates. Rapport final. Rapport BRGM/RP-55966-FR. # 07gai/bla Gailhanou H. et Blanc P., 2007. Thermochimie : Acquisition des proprietes thermodynamiques sur une saponite et revision des donnees sur les mineraux argileux. Rapport final BRGM/RP-55925-FR # 07gre/per Green, D., Perry, R., 2007. Perry's Chemical Engineers' Handbook, Eighth Edition. McGraw-Hill Education. # 07las brgm report in progress # 07mar/acc Marini L, Accornero M (2007) Prediction of the thermodynamic properties of metal-arsenate and metal-arsenite aqueous complexes to high temperatures and pressures and some geological consequences. Environ Geol 52:1343-1363 # 07neu/wan Neuhoff P. S. and Wang J. (2007) Heat capacity of hydration. American Mineralogist 92, 1358-1367 # 07pow/bro Powell, K.J., Brown, P.L., Byrne, R.H., Gadja, T., Hefter, G., Sjoberg, S., Wanner, H., 2007. Chemical speciation of environmentally significant metals with inorganic ligands Part 2 : The Cu[2+]-OH[-], Cl[-], CO[3][2-], SO[4][2-], and PO[4][3-] systems : (IUPAC Technical Report). Pure and applied chemistry, USA. # 07ste Stefansson A. (2007) Iron(III) hydrolysis at 25C. Environ. Sci. Technol. 2007, 41, 6117-6123 # 07vie Vieillard P., 2007. THERMOCHIMIE : Estimation des enthalpies de formation des Phyllosilicates (7, 10 et 14A) anhydres. Rapport final. CNRS-Hydrasa 2007-1, 21 p. # 08aza/and Azaroual M., Andre L., Blanc Ph., Jacquemet N., Crouzet C. (2008) Modelisation thermocinetique des phenomenes d'interaction eaux riches en gaz acides - ciment du casing des forages petroliers. Rapport BRGM/RC-56584-FR, 48 fig., 14 tabl., 124 p # 08bas/pet Basciano L.C., Peterson R.C. (2008) Amer. Mineral., 93, 853-862 # 08bla Blanc P. (2008) : Thermoddem - Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses de fer. Rapport final. Rapport BRGM/RP-56587-FR, 70p. # 08gai Gailhanou H. (2008) : Thermochimie : Acquisition des proprietes thermodynamiques sur une berthierine et revision des donnees sur les mineraux argileux. Rapport final BRGM/RP-56838-FR # 08las Lassin A., 2008, personnal calculations. # 08per/pok Perfetti E., Pokrovski G., Ballerat-Busserolles K., Majer V., Gibert F. (2008) Densities and heat capacities of aqueous arsenious and arsenic acid solutions to 350 C and 300 bar, and revised thermodynamic properties of As(OH)3(aq), AsO(OH)3(aq) and iron sulfarsenide minerals. Geochimica et Cosmochimica Acta 72, 713-731 # 08sch/lot Schmidt, T., Lothenbach, B., Romer, M., Scrivener, K.L., Rentsch, D., Figi, R. (2008), A thermodynamic and experimental study of the conditions of thaumasite formation, Cement and Concrete Research, 38(3), 337-349. # 08vie Vieillard P., 2008. Estimation des entropies et capacites calorifiques des zeolithes. Rapport CNRS-Hydrasa 2008, 29 p. # 09bla Blanc P. (2009) - Thermochimie - Selection de constantes thermodynamiques pour les zeolites : version 2. Rapport final. Rapport BRGM/RP-57796-FR. 55 p. # 09gai Gailhanou H. (2009) : Thermochimie : Acquisition des proprietes thermodynamiques d'une nontronite, d'une beidellite et revision des donnees de la saponite Sap-Ca-1. Rapport final BRGM/RP-57797-FR # 09gai/rog Gailhanou, H., Rogez, J., van Miltenburg, J.C., van Genderen, A.C.G., Greneche, J.M., Gilles, C., Jalabert, D., Michau, N., Gaucher, E.C., Blanc, P., 2009. Thermodynamic properties of chlorite CCa-2. Heat capacities, heat contents and entropies. Geochimica et Cosmochimica Acta 73, 4738-4749. # 09hon Honerlage, B., 2009. CuF: lattice constants, in: Roessler, U. (Ed.), New Data and Updates for I-VII, III-V, III-VI and IV-VI Compounds. Springer Berlin Heidelberg, Berlin, Heidelberg, pp. 149-149. # 09xio Xiong, Y., 2009. The aqueous geochemistry of thallium: speciation and solubility of thallium in low temperature systems. Environmental Chemistry 6, 441-451. # 10abla/bou Blanc, Ph.; Bourbon, X.; Lassin, A.; Gaucher, E.C. 2010 - Chemical model for cement-based materials: Temperature dependence of thermodynamic functions for nanocrystalline and crystalline C-S-H phases. Cement and Concrete Research, 40, p. 851-867 # 10bbla/bou Blanc, Ph.; Bourbon, X.; Lassin, A.; Gaucher, E.C. 2010 - Chemical model for cement-based materials: Thermodynamic data assessment for phases other than C-S-H. Cement and Concrete Research, 40, p. 1360-1374. # 10bla/vie Blanc P. and Vieillard P. (2010) - Thermochimie: Estimation of the thermodynamic properties of dehydrated phyllosilicates. Final Report. BRGM/RP-57798-FR. # 10pal/gam Palmer, D.A., Gamsjager, H., 2010. Solubility measurements of crystalline beta-Ni(OH)2 in aqueous solution as a function of temperature and pH. Journal of Coordination Chemistry 63, 2888-2908. # 10vie Vieillard P., 2010 - A predictive model for the entropies and heat capacities of zeolites. Eur. J. Mineral. 22, 823-836 # 11bla/las Blanc P., Lassin A. 2011. Thermoddem report 2011 # 11maj/dra Majzlan J, Drahota P, Filippi M, Novak M, Loun J and Grevel K-D 2011. Thermodynamics of Crystalline iron(III) Arsenates Scorodite, Kankite, and Bukovskyite. Goldschmidt 2011 Conference Abstract 1391 # 11pal/ben Palmer, D.A., Benezeth, P., Wesolowski, D.J., 2011. Solubility of Nickel Oxide and Hydroxide in Water, 14th International Conference on the Properties of Water and Steam, pp. 264-269. # 11par/cor Parmentier M., Corvisier J., Chiquet P., Parra T. et Sterpenich J. 2011. La modelisation geochimique de la reactivite des gaz annexes co-injectes avec le CO2 : possibilites et limites des codes de calcul via une application. BRGM/RP-60605-FR # 11sky Skyllberg, U., 2011. Chemical Speciation of Mercury in Soil and Sediment, Environmental Chemistry and Toxicology of Mercury. John Wiley and Sons, Inc., pp. 219-258. # 11vie/bla Vieillard, P., Blanc, P., Fialips, C.I., Gailhanou, H., Gaboreau, S., 2011. Hydration thermodynamics of the SWy-1 montmorillonite saturated with alkali and alkaline-earth cations: A predictive model. Geochimica et Cosmochimica Acta 75, 5664-5685. doi:10.1016/j.gca.2011.07.014 # 12bla Blanc P., 2012, Mercury associated physical and chemical constants: updating of the THERMODDEM database, IMaHg project, rapport BRGM RP-61299-FR, 32p # 12coo/oli Cook, W.G., Olive, R.P., 2012. Pourbaix diagrams for the nickel-water system extended to high-subcritical and low-supercritical conditions. Corrosion Science 58, 284-290. # 12gai/bla Gailhanou, H., Blanc, P., Rogez, J., Mikaelian, G., Kawaji, H., Olives, J., Amouric, M., Denoyel, R., S., B., Montouillout, V., Vieillard, P., Fialips, C. I., Giffaut, E., Michau, N., and Gaucher, E. C., 2012, Thermodynamic properties of illite IMt-2, smectite MX-80 and beidellite SBld-1 by calorimetric methods: Enthalpies of formation, heat capacities , entropies and Gibbs free energies of formation. : Geochimica Cosmochimica Acta, v. 89, p. 279-301. # 13bla/gab Blanc P., Gaboreau S. (2013) - Thermoddem : Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses de nickel. Rapport final. BRGM/RP-61871-FR. 35 p., 12 fig., 4 tabl. # 13bla/las Blanc P., Lassin A. (2013) - Thermoddem : Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses d'arsenic. Rapport final. BRGM/RP-62585-FR. 29 p., 5 fig., 3 tabl. # 13gai/bla Gailhanou, H., Blanc, P., Rogez, J., Mikaelian, G., Horiuchi, K., Yamamura, Y., Saito, K., Kawaji, H., Warmont, F., Greneche, J.-M., Vieillard, P., Fialips, C.I., Giffaut, E., Gaucher, E.C., 2013. Thermodynamic properties of saponite, nontronite, and vermiculite derived from calorimetric measurements. American Mineralogist 98, 1834-1847. # 13ste/ben Stefansson, A., Benezeth, P., Schott, J., 2013. Carbonic acid ionization and the stability of sodium bicarbonate and carbonate ion pairs to 200 C - A potentiometric and spectrophotometric study. Geochimica et Cosmochimica Acta 120, 600-611. # 14bla/gai Blanc, P., Gailhanou, H., Rogez, J., Mikaelian, G., Kawaji, H., Warmont, F., Grangeon, S., Greneche, J.M., Fialips, C.I., Giffaut, E., Gaucher, E.C., Claret, F., 2014, Thermodynamic properties of a chlorite and a berthierine by calorimetric methods: Physics and Chemistry of Minerals (accdepted) # 14las/pia Lassin, A., Piantone, P., Crouzet, C., Bodenan, F., Blanc, P., 2014. Estimated thermodynamic properties of NaFeS2 and erdite (NaFeS2:2H2O). Applied Geochemistry 45, 14-24. doi:10.1016/j.apgeochem.2014.02.015 # 15bla/vie Blanc, P., Vieillard, P., Gailhanou, H., Gaboreau, S., Gaucher, E.C., Fialips, C.I., Made, B., Giffaut, E., 2015. A generalized model for predicting the thermodynamic properties of clay minerals. American Journal of Science 315, 734-780. # 16bla Blanc P., (2016) Biomore WP1 progress report # 17abla Blanc P. (2017) Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses de thallium. Rapport final. Rapport BRGM 66385-FR. # 17bbla Blanc P. (2017) - Thermoddem : Update for the 2017 version. Report BRGM/RP-66811-FR, 20 p. # 17gai/vie Gailhanou, H., Vieillard, P., Blanc, P., Lassin, A., Denoyel, R., Bloch, E., De Weireld, G., Claret, F., Fialips, C.I., Made, B., Giffaut, E., 2017. Methodology for determining the thermodynamic properties of hydration of Na-smectite considering the energetic contribution of capillary water. Applied Geochemistry. # 18roo/vie Roosz et al., 2017. Thermodynamic properties of C-(A)-S-H and M-S-H phases: results from direct measurements and predictive modelling. Applied Geochemistry, submited # 18nea NEA, 2018. Forthcoming TDB selection on cement minerals # 18sig SIGARRR, 2018. Forthcoming results from the project. # 33dan D'Ans J., 1933. Die Losegleichgewichte der Systeme der Salze ozeanischer Salzablagerungen. Kaliorschungs Anstalt GmbH, Berlin Verlagsgesellschaft fur Ackerbau MBH, Berlin SW11 # 37hil Hill A.E., 1937. J. Am. Chem. Soc., 59, p. 2242. # 37kie Kielland J., 1937. Individual Activity Coefficients of Ions in Aqueous Solutions. Journal of the American Chemical Society, 59, p. 1675 1678. # 40rol/erv Roller P.S., and Ervin G., 1940. The system calcium oxide silicawater at 30C. The association of silicate ion in dilute alkaline solution. J. Amer. Chem. Soc., 62, p. 461 471. # 40sbo/bia Sborgi U., and Bianchi C., 1940. Ga. Chim. Ital., 70, p. 823. # 41cor Correns C.W., 1941. Beitrage zur Petrographie und Genesis der Lydite (Kieselschiefer): Preuss. Geol. Ladesanstalt, Mitt. d. Abt. f. Gesteins , Erz , Kohle und Salz Untersuchungen, 1, p. 18 38. # 41hum/sto Hume D.H. and Stone H.W. 1941. The apparent solubility product of chromous hydroxide. The significance of the solubility products of hydroxides of the metals with form basic salts. J. Am. Chem. Soc., 63 p. 1197-1199. # 42kol/per Koltoff I.M., Perlich R.W. and Weiblen D., 1942. Solubility of lead sulfate and lead oxalate in various media. J. Phys. Chem, 46, p. 561. # 50ken Kennedy G.C., 1950. A portion of the system silica water. Econ. Geol., 45, p. 629 653. # 51den/mon Denney T.O. and Monk C.D. Trans. Faraday Soc., 47, p. 992. # 51sch/mul Schwarz V.R., and Muller W.D., 1951. Die wasserlosliche monokieselsaure. Z. Anorg. Allg. Chemie., 2296, p. 273 279. # 51zha Zharovskii F.G., 1951, The solubility of phosphates. Trudy. Kom. Anal. Khim. Akad. Nauk. SSSR, 3, 101-115 (in russian) # 52lat Latimer W.M., 1952. Oxidation states of the elements and their potentials in aqueous solution, Prentice Hall, New Jersey,.392 pp. # 52meg Megaw D., 1952, The structure of afwillite, Ca3(SiO3OH)2*2H2O, Locality: Scawt Hill, Northern Ireland, Act. Cryst.D60, v. 5, p. 477-495. # 53bell/geo Bell R.P. et George J.H.B., 1953. Trans. Faraday Soc., 49, pp. 619-627 # 53hem Hemley J.J., 1953. A study of lead sulfide solubility and its relation to ore deposition. Econ. Geol., 48, p. 113 138. # 53leu/kho Leussing, D.L., Kholtoff, I.M. (1953) The solubility product of ferrous and the ionization of aquo-ferrous ion. J. Amer. Chem. Soc. 75, 2476-2479. # 53pag Page F.M., 1953. The dissociation constants of thiosulphuric acid. J. Chem. Soc., p. 1719 1724. # 54ale/hes Alexander G.B., Heston W.M. and Iler R.K., 1954. The Solubility of Amorphous Silica in Water. J. Phys. Chem., 58, p. 453. # 54dan D'Ans J., Bredtschneider D., Eick H., and Freund H E., 1954. Kali u Steinsalz, 9, p. 17. # 56den/tay Dent, L. S., and Taylor, H. F. W., 1956, The dehydration of Xonotlite: Acta Crystallographica, v. 9, p. 1002-1004. # 56new Newman, E., 1956., Heats. of Formation of Xonotlite, Hillebrandite, and Foshagite: Journal of Research of the National Bureau of. Standards, v. 57, p. 27-30. # 57gre/pri Greenberg S.A., and Price E.W., 1957. The solubility of silica in solutions of electrolytes. J. Phys. Chem., 61, p. 1539 1541. # 57oka/oku Okamoto G., Okura T., and Goto K., 1957. Properties of silica in water. Geochimica et Cosmochimica Acta, 12, p. 123 132. # 59ing Ingri N., 1959. Equilibrium studies of polyanions IV. Silicate ions in NaC1 medium. Acta Chem. Scand. 13, p. 758 775. # 59lag Lagerstrom G., 1959. Equilibrium studies of polyanions III. Silicate ions in NaCIO4 medium. Acta Chem. Scand., 13, p. 722 736. # 60gar/tho Garrels R.M., Thompson M.E., and Siever R., 1960. Stability of some carbonates at 25 degrees C and one atmosphere total pressure. Am. J. Sci., 258, p. 402 418. # 60kel Kelley, K.K., 1960, Contributions to the Data in Theoretical Metallurgy XIII: High Temperature Heat Content, Heat Capacities and Entropy Data for the Elements and Inorganic Compounds. U.S. Bureau of Mines Bulletin 584, 232 p. # 60kit Kitahara S., 1960. The solubility of quartz in water at high temperatures and high pressures. Rev. Phys. Chem. Japan, 30, p. 109 137. # 60lin/mor Lindsay W.L., Moreno E.C., 1960, Phosphate phase equilibria in soils. Soil Sci. Am. Proc., 24, 177-182 # 60pou Pourbaix M., 1960. Standard free energies of formation at 25C, CEBELCOR Report, 684, Brussels, 57 pp. # 60van/bru Van Lier J.A., de Bruyn P.L., and Overbeek J.T.G., 1960. The solubility of quartz. J. Phys. Chem., 64, p. 1675 1682. # 61bchu/aly Chukhlantsev V.G., Alyamovskaya K.V., 1961b, Solubility product of copper, cobalt, nickel, and cadmium phosphates. Izvest. Vyss. Uch. Zaved. Khim. Khim. Tekh., 4, 706-709 (in russian) # 61ber/new Berman H.A. and Newman E.S., 1961. Heat of formation of calcium aluminate monocarbonate at 25C, Journal of Research of the National Bureau of Standards. A, Physics and Chemistry, 65, pp. 197-207 # 61boc Bock E., 1961. Can. J. Chem., 39, p. 1746. # 61kel/kin Kelley K.K. and King E.G. (1961) U.S. Bureau of Mines Bulletin 500 # 61tru/hos Truesdell A.H., and Hostetler P.B., 1961. Dissociation constants of KSO4 from 10 500C. Geochim. Cosmochim. Acta, 32, p. 1019 1022. # 62gar/tho Garrels R.M., and Thompson M.E., 1962. A chemical model for sea water at 25 degrees C and one atmosphere total pressure. Am. J. Sci., 260, p. 57 66. # 62mor/fou Morey G.W., Foumier R.O., and Rowe J.J., 1962. The solubility of quartz in water in the temperature interval from 25 to 300C. Geochim. Cusmochim. Acta, 26, p. 1029 1043. # 62sie Siever R., 1962. Silica Solubility, 0 200C, and the diagenesis of siliceous sediments. J. Geol., 70, p. 127 150. # 63ber/new Berman H.A. and Newman E.S. 1963 - Heat of formation of calcium aluminate monosulfate at 25 C, Journal of Research of the National Bureau of Standards. A, Physics and Chemistry, 65, pp. 1-13 # 63fis Fischer K. (1963) Amer. Mineral., 48, 664-672 # 63hos Hostetler P.B., 1963. The stability and surface energy of Brucite in water at 25C. Am. J. Sci., 261, p. 238-258. # 63oet/mdo Oetting F.L., Mac Donald R.A., 1963, The thermodynamic properties of magnesium orthophosphate and magnesium pyrophosphate. J. Phys. Chem., 63, 2737-2743 # 63rob/sto Robie, R. A., and J. W. Stout, 1963. Heat capacity from 12 to 305K and entropy of talc and tremolite. J. Phys. Chem., 57, p. 2252-2256 # 63sch/wid Schwarzenbach, G., Widmer, M., 1963. Die loslichkeit von metallsulfiden I. schwarzes quecksilbersulfid. Helvetica chimica acta 46, 2613-2628. # 63tay/fra Taylor A.W., Frazier A.W., Gurney E.L. and Smith J.P., 1963. Solubility product of di- and tri-magnesium phosphates and the dissociation of magnesium phosphate solutions. Trans. Farad. Soc., 59, 1585-1589 # 63wil Willix R. L. S. (1963) Ferrous-ferric redox reaction in the presence of sulphate ion, Trans. Faraday Soc., 59, 1315-1324 # 63wyc Wyckoff, R.W.G., 1963, Crystal Structures, Second edition, tome 4, Interscience Publishers, New York, p. 320-322. # 64aega/wak Egan E.P., Wakefield Z.T., 1964a, Low temperature, heat capacity and entropy of anhydrous dicalcium phosphate 10 to 310K. J. Chem. Eng. Data, 4, 541-544 # 64atay/gur Taylor A.W., Gurney E.L., 1964a, The dissolution of calcium aluminum phosphate CaAlH(PO4)2.6H2O. Soil Sci. Soc. Am. Proc., 28, 63-64 # 64bega/wak Egan E.P., Wakefield Z.T., 1964b, Low temperature, heat capacity and entropy of dicalcium phosphate dihydrate 10 to 310K. J. Chem. Eng. Data, 9, 544-545 # 64sil/mar Sillen LG. and Martell A.E. 1964 - Stability constants of metal-complexes. The chemical society, special publication N17, London. # 65gam/stu Gamsjager H., Stuber H.U., and Schindler P., 1965. Helv. Chim. Acta, 48, p. 723. # 65gre/bas Grezes G., and Bassett M., 1965. Contribution a l'etude de 1s eolubilite du carbonate de calcium. Compt. Rend. Accad. Sci., 260, p. 869 872. # 65lah Lahiri S.C., 1965, Ferric-phosphoric acid system. J. Ind. Chem. Soc., 42, 715-724 # 65wyc Wyckoff R.W.G., 1965. Crystal Structures, v.3 # 66ega/wak Egan E.P., Wakefield Z.T., 1966, Low temperature, heat capacity and entropy of variscite, AlPO4.2H2O, 10 to 310K. J. Chem. Eng. Data, 11, 610-611 # 66lah/adi Lahiri S.C. and Aditya S. 1966. J. Indian Chem. Soc., 43, 513. # 66spi/mik Spitsyn V.I., Mikheev H.B., Khermann A., 1966, Thermodynamic study of the distribution of micro quantities of strontium between barium hydrogen phosphate and a solution. Dokl. Akad. Nauk. SSSR, 166, 658-659 (in russian) # 67and/cou Andon R.J.L., Counsell J.F., Martin J.F., and Mash C.J., 1967. Thermodynamic properties of phosphorus compounds: II. Low temperature heat capacity and entropy of sodium mono-, di-, and triphosphates. J. Appl. Chem., 17, 65-70 # 68chu/mar Chughtai A., Marshall R., Nancollas G.H., 1968, Complexes in calcium phosphate solutions. J. Phys. Chem., 72, 208-211 # 68dan D'Ans J., 1968. Kali Steinsalz, 5, p. 109. # 68mca Mac Cann H.G., 1968, The solubility of fluorapatite and its relationships to that of calcium fluoride. Arch. Oral Biol., 13, 987-1001 # 68nak Nakayama M., 1968. Calcium activity, complex and ion pair in saturated CaCO, solutions. Soil sci., 106, p. 429 434. # 68rac/sop Racz G.J., Soper R.J., 1968, Solubility of dimagnesium phosphate trihydrate and trimagnesium phosphate. Can. J. Soil Sci., 48, 265-269 # 68val/kog Valyashko V.M., Kogarko L.N., Khodakovsky I.L., 1968, Stability of fluorapatite, chlorapatite, and hydroxylapatite in aqueous solutions at different temperature. Geoch. Inter., 5, 21-30 # 68wag/eva Wagman D.D., Evans W.H., Parker V.B., Halow I., Bailey S.M., Schumm R.H., 1968. Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-3, 264 p. # 69bol/ptu Bol'shakov, A.P. and L.I. Ptushko (1969) Alteration products of melanterite from Nikitov mercury ore deposits. Zap. Vses. Mineral. Obshch., 3, 288-294 (in Russian). # 69hel Helgeson, 1969H.C. Helgeson, Thermodynamics of hydrothermal systems at elevated temperatures and pressures, Am. J. Sci. 267 (1969), pp. 729-804. # 69iza/eat Izatt R.M., Eatough D.E., Christensen J.J., Bartholomew C.H. (1969) Calorimetrically determined log K, DeltaH and DeltaS values for the inter-action of sulphate ion with several bi- and ter-valent metal ions. J. Chem. Soc. (A), 47-53. # 69qui/mar Quist A.S., and Marshall W.L., 1969. The electrical conductances of some alkali metal halides in aqueous solutions from 0 to 800 and pressures to 4000 bars. J. Phys. Chem., 73, p. 978 985. # 69wag/eva Wagman D.D., Evans W.H., Parker V.B., Halow I., Bailey S.M., Schumm R.H., 1969. Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-4, 152 p. # 70gre/mor Gregory T.M., Moreno E.C., Brown W.E., 1970, Solubility of CaHPO4.2H2O in the system Ca(OH)2-H3PO4-H2O at 5, 15, 25, and 37C. J. Res. NBS, 74A, 461-475 # 70moo/tay Moore A.E., Taylor H.F.W., 1970. Acta Cryst., B26, 386-393 # 70pan Pankratz, L.B., 1970, Thermodynamic Data for Silver Chloride and Silver Bromide: U.S. Bureau of Mines Report of Investigations #7430, 12 p. # 70pan/kin Pankratz, L.B., and King, E.G., 1970, High-Temperature Enthalpies and entropies of chalcopyrite and bornite: U.S. Bureau of Mines Report of Investigations #7435, 10 p. # 70web/rac Webber M.D., Racz G.J., 1970, Soluble complexes in the systems dicalcium phosphate dihydrate or dimagnesium phosphate trihydrate equilibrated with aqueous salt solutions. Can. J. Soil Sci., 50, 243-253 # 71aduf Duff E.J., 1971a, Orthophosphates. II. The transformation Brushite -> Fluorapatite and Monetite -> Fluorapatite in aqueous potassium fluoride solution. J. Chem. Soc. A, 33-38 # 71bduf Duff E.J., 1971b, Orthophosphates. III. The hydrolysis of secondary calcium orthophosphates. J. Chem. Soc. A, 917-921 # 71cre/and Crerar D.A., and Anderson G.M., 1971. Solubility and solvation reactions of quartz in dilute hydrothermal solutions. Chem. Geol., 8, p. 107 122. # 71ell/gig Ellis A.J., and Giggenbach W., 1971. Hydrogen sulphide ionization and sulphur hydrolysis in high temperature solution. Geochim. Cosmochim. Acta, 35, p. 247 260. # 71mac/gee Mackenzie F.T., and Gees R., 1971. Quartz: Synthesis at earthsurface conditions. Science, 173, p. 533 535. # 71nri Nriagu J.O., 1971. Experimental investigation of a portion of the system PbS NaCl HCl H 2 O at elevated temperatures. American Journal of Science, 271, p.157 169. # 71par/wag Parker V.B., Wagman D.D., Evans W.H., 1971, Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-6 - 270-119 # 71sil/mar Sillen L G and Martell A E 1971 Stability constant of metal ion complexes, Special publications 17 and 25 (London: The Chemical Society) # 71wag/eva Wagman D.D., Evans W.H., Parker V.B., Halow I., Bailey S.M., Schumm R.H., Churney K.L., 1971. Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-5, 49 p. # 72anri Nriagu J.O., 1972a, Lead orthophosphates. I. Solubility and hydrolysis of secondary lead orthophosphates. Inorg. Chem., 11, 2499-2503 # 72bduf Duff E.J., 1972b, Orthophosphates. IX. Chlorapatite: Phase relationships under aqueous conditions along Ca5F(PO4)3-Ca5(OH)(PO4)3-Ca5Cl(PO4)3 joins of the system CaO-CaCl2-CaF2-P2O5-H2O. J. Inorg. Nucl. Chem., 34, 859-871 # 72bnri Nriagu J.O., 1972b, Stability of vivianite and ion-pair formation in the system Fe3(PO4)2-H3PO4-H2O. Geochim. Cosmochim. Acta, 36, 459-470 # 72cnri Nriagu J.O., 1972c, Solubility equilibrium constant of strengite. Am. J. Sci., 272, 476-484 # 72hem/rob Hemingway B.S. and Robie R.A., 1972. The heat capacities at low temperatures and entropies at 298.15 K of huntite, CaMg3(CO3)4, and artinite, Mg2(OH)2CO3 z 3 H2O. Am. Mineral., 57, pp. 1754-1767. # 72mer Mereiter K (1972) Tschermaks Mineralogische und Petrographische Mitteilungen , 18, p.185-202, Die kristallstruktur des voltaits, K2Fe2+5Fe3+3Al[SO4]12*18H2O # 72rob/hem Robie R.A. and Hemingway B.S., 1972. The heat capacities at low-temperatures and entropies at 298.15 K of nesquehonite, MgCO3 :3H2O, and hydromagnesite. Am. Mineral., 57, pp. 1768-1781. # 72vol/kho Volosov A.G., Khodakovskiy I.L., and Ryzhenko B.N., 1972. Equilibria in the system SiO2 H20 at elevated temperatures along the lower three phase curve. Geochem. Intl., 9, p. 362 377. # 73anri Nriagu J.O., 1973a, Lead orthophosphates. II. Stability of chloropyromorphite at 25C. Geochim. Cosmochim. Acta, 37, 367-377 # 73bar/kna Barin I. and Knacke O., 1973, Thermochemical Properties of Inorganic Substances. Berlin: Springer-Verlag. # 73bnri Nriagu J.O., 1973b, Solubility equilibrium constant of a-hopeite. Geochim. Cosmochim. Acta, 37, 2357-2361 # 73hem/rob Hemingway B. S. and Robie R. A., 1973. A calorimetric determination of the standard enthalpies of formation of huntite, CaMg3(CO3)4, and artinite, Mg2(OH)2CO3 z 3 H2O, and their standard Gibbs free energies of formation. J. Res. U.S. Geol. Survey, 1, pp. 535-541. # 73hul/des Hultgren R., Desai P. D., Hawkins D. T., Gleiser M., Kelly K. K. and Wagman D. (1973) Selected Values of the Thermodynamic Properties of the Elements. Metals Park, Ohio, AMS. # 73hul/tur Hull H. and Turnbull A.J., 1973, A thermochemical study of monohydrocalcite. Geochim. Cosmochim. Acta, 37, 685-694 # 73rob/hem Hemingway B. S. and Robie R. A., 1973. A calorimetric determination of the standard enthalpies of formation of huntite, CaMg3(CO3)4, and artinite, Mg2(OH)2CO3 z 3 H2O, and their standard Gibbs free energies of formation. J. Res. U.S. Geol. Survey, 1, pp. 535-541. # 74avol/yag Volkov A.I., Yaglov V.N., Novikov G.I.,1974a, Heat of formation of trizinc diorthophosphate. Russ. J. Phys. Chem., 48, 1697 # 74cat/fer Catti M , Ferraris G , Acta Crystallographica, Section B , 30 (1974) p.1789-1794, Crystal structure of Ca5(HAsO4)2(AsO4)2*9H2O (guerinite), Locality: synthetic # 74ham Hamann S.D., 1974. Electrolyte solutions at high pressure. In Modern Aspects of Electrachemistry, Plenum, No. 9 (ed. Conway B.E. and Bockris J. O.), p. 47 158. # 74jac/lan Jacobson R.L., and Langmuir D., 1974. Dissociation constants of calcite and CaHCO3+ from 0 to 50C. Geochimica et Cosmochimica Acta, 88, p. 301 318. # 74mil Mills K.C., 1974, Thermodynamic data for inorganic sulfides, selenides, and tellurides. Butterworths, London, 845 p. # 74nau/ryz Naumov G.B., Ryzhenko B.N., and Khodakovsky I.L., 1974. Handbook of Thermodynamic Data. U.S. Geol. Surv.WRD 74 001, 328 pp. # 74nri Nriagu J.O., 1974. Lead orthophosphates-IV Formation and stability in the environment. Geochimica et Cosmochimica Acta, 38, p. 887 898. # 74rea/lan Reardon E.J., and Langmuir D., 1974. Thermodynamic properties of the ion pairs CaCO3 and MgCO3 from 10 to 50C. Am. J. Sci., 274, p. 599-612. # 74sew Seward T.M., 1974. Determination of the first ionization constant of silicic acid from quartz soIubility in borate buffer soIutions to 350C. Geochimica et Cosmochimica Acta, 38, p. 1651 1664. # 74tru/jon Truesdell A.H., Jones B.F., 1974, WATEQ, a computer program for calculating chemical equilibria of natural waters. J. Res. US Geol. Surv., 2, 233-248 # 75kas/bor Kashkai C. M., Borovskaya Y. B., and Badazade M. A. (1975) Determination of DGf,298 of synthetic jarosite and its sulfate analogues. Geokhimiya 7, 771-783 (in Russian). # 76ale/mas Aleshchkina A.E., Masalovich V.M., Agasyan P.K., Sereda B.P., 1976, Chromium (III) phosphate-complexes. Russ. J. Inorg. Chem., 21, 973-975 # 76bae/mes Baes Jr. C.F., and Mesmer R.E., 1976. The Hydrolysis of Cations. Wiley Interscience, 489 pp. # 76del/hal Dellien I., Hall F.M. and Hepler L.G. 1976. Chromium, molybdenum and tungsten: Thermodynamic properties, chemical equilibria, and standard potentials. Chemical Reviews, 76, p. 283-310. # 76del/hep Dellien I. and Hepler L.G., 1976b. Enthalpies of formation of Cr3+(aq) and the inner sphere complexes CrF2+(aq), CrCl2+(aq), CrBr2+(aq), and CrSO4+(aq). Can. J. Chem., 54, p.1383-1387. # 76fer/stu Ferrante M.J., Stuve J.M. and Richardson D.W., 1976. Thermodynamic data for synthetic dawsonite. U.S. Bur. Mines Rept. Inv., 5, 577-582 # 76gro/wes Gronvold and Westrum, 1976. F. Gronvold and E.F. Westrum, Heat capacities of iron disulfides. Thermodynamics of marcasite from 5 to 700 K, pyrite from 300 to 780 K, and the transformation of marcasite to pyrite. J. Chem. Therm. 8 (1976), pp. 1039-1048 # 76hou/ste Houtepen, C. J. M., and Stein, H. N., 1976, The enthalpies of formation and of dehydration of some AFm phases with singly charged anions: Cement and Concrete Research, v. 6, p. 651-658 # 76men/sab Menchetti S., Sabelli C. (1976) Neues Jb. Miner., Mh., H.9, 406-417 # 76nri Nriagu J.O., 1976, Phosphate-clay mineral relations in soils and sediments. Can. J. Earth Sci., 13, 717-736 # 76plu/jon Plummer L.N., Jones B.F. and Truesdell A.H., 1976, WATEQF - A FORTRAN IV version of WATEQ, a computer program for calculating chemical equilibrium of natural waters: U.S.G.S. Water Resources Inv. 76-13., 63 p. # 76rob/hem Robie R.A., Hemingway B.S. et Wilson H.W., 1976. The heat capacities of calorimetry conference copper and of muscovite, pyrophylite, and illite between 15 and 375 K and their standard entropies at 298.15 K. J. Research U.S. Geol. Survey., 4, p. 631-644. # 76rob/hem Robie R.A., Hemingway B.S. and Wilson H.W. (1976) - The heat capacities of calorimetry conference copper and of muscovite, pyrophylite, and illite between 15 and 375 K and their standard entropies at 298.15 K. J. Research U.S. Geol. Survey., 4, p. 631-644. # 76smi/mar Smith R.M., Martell A.E., 1976, Critical stability constants, Vol. 4: Inorganic complexes. Plenum, New York, 257 p. # 76tso Tsonopoulos C., Coulson D.M., and Inman L.B., 1976. Ionization constants of water pollutants. J. Chem. Eng. Data, 21, p. 190 193. # 76wag/eva Wagman D.D., Evans W.H., Parker V.B., Schumm R.H., 1976. Chemical thermodynamic properties of compounds of sodium, potassium, and rubidium, an interim tabulation of selected values. Natl. Bur. Stand. Tech. Note, 270, 73 p. # 77bar/kna Barin I., Knacke O., and Kubaschewski I., 1977: Thermochemical properties of inorganic substances. Springer Verlag, Berlin. # 77bus/mes Busey R.H., and Mesmer R.E., 1977. Ionization equilibria of silicic acid and polysilicate formation in aqueous sodium chloride solutions to 300C. Inorg. Chem., 16, p. 2444 2450. # 77fou/row Fournier R.O., and Rowe J.J., 1977. The solubility of amorphous silica in water at high temperatures and high pressures. Amer. Mineral., 62, p. 1052 1056. # 77hem/rob Hemingway B.S., Robie R.A., Fisher J.R., et Wilson W.H., 1977. Heat capacity of gibbsite, Al(OH)3, between 13 and 480 K and magnesite, MgCO3, between 13 and 380 K and their standard entropies at 289.15 K, and the heat capacities of calorimetry conference benzoic acid between 12 and 316 K. J. Res. U. S. Geol. Survey, 5, p. 797-806. # 77mac/hos MacGee K.A., and Hostetler P.B., 1977. Studies in the system MgO SiO2 CO2 H2O (IV): The stability of MgOH+ from 10 to 90C., Am. J. Sci., 275, p. 304 317. # 77rie/gam Riesen W., Gamsjager H., and Schindler P.W., 1977. Complex formation in the ternary system Mg(II) CO2 H2O . Geochimica et Cosmochimica Acta, 41, p. 1193 1200. # 77sre Sretenskaya N.G., 1977. Dissociation of hydrogen sulfide acid under pressure. Geokhimiya, 3, p. 430 438 (in Russian). # 78hel/del Helgeson, H.C., Delany, J.M, Nesbitt, H.W., and Bird, D.K., 1978. Summary and Critique of the Thermodynamic Properties of Rock Forming Minerals: Amer. J. Sci., 278A, 229 pp. # 78kru/sta Kruykov P.A., and Starostina L.I., 1978. The first ionization constants of hydrogen sulfide at temperature to 150C. lzvestija Sibirskogo Otdeleniya AN SSSR, 14, p. 87 93. # 78ric/nri Rickard D.T., Nriagu J.O., 1978, Aqueous environmental chemistry of lead. In: The biochemistry of lead in the environment. Part A. Ecological Cycles, J.O. Nriagu (Ed), Elsevier/North-Holland Biomedical Press, 219-284 # 78rob/hem Robie R.A., Hemingway B.S., and Fisher J.R., 1978. Thermodynamic properties of minerals and related substances at 298.15K and 1 bar 105 Pascals pressure and at higher temperatures. US Geol. Survey Bull., 1452, 456 pp. # 78yag Yaglov V.N., 1978, Some characteristics of dehydration of hydrates of 3d elements orthophosphates. Khim. Khim. Tekhnol. (Minsk), 13, 7-14 (in russian) # 79ede/sat Ederova, J., and Satava, V., 1979, Heat capacities of C3AH6, C4ASH12 and C6AS3H32: Thermochimica Acta, v. 31, p. 126-128 # 79kru/rob Krupka, K.M., Robie, R.A., Hemingway, B.S., 1979. High-temperatur heat capacities of corundum, periclas, anorthite, CaAl2S2O8 glass, muscovite, pyrophyllite, KAlSi3O8 glass, grossular and NaAlSi3O8 glass. Am. Mineral., 64, p. 86-101 # 79lan Langmuir D., 1979, Techniques of estimating thermodynamic properties for some aqueous complexes of geochemical interest, in Jenne, E.A., ed., Chemical Modeling in Aqueous systems: Speciation, Sorption, Solubility, and Kinetics: ACS Symp. Ser. 93, Amer. Ch # 79lle Iler R.K., 1979. The Chemistry of Silica: Solubility, Polymerization, Colloid and Surface Properties, and Biochemistry. Wiley, New York. # 79mat/spo Mattigod S.V., and Sposito G., 1979, Chemical modeling of trace metal equilibria in contaminated soil solutions using the computer program GEOCHEM. In: Chemical Modeling in Aqueous Systems: Speciation, Sorption, Solubility, and Kinetics, E.A. Jenne (Ed), # 79may/hel May H.M., Helmke P.A., and Jackson M.L., 1979. Gibbsite solubility and thermodynamic properties of hydroxy aluminum ions in aqueous solution at 25C. Geochimica et Cosmochimica Acta, 43, 861 868. # 79vie/tar Vieillard P., Tardy Y., Nahon D., 1979, Stability field of clays and aluminum phosphates: Parageneses in lateritic weathering of argillaceous phosphatic sediments. Am. Miner., 64, 626-634 # 79vol Volkov A.I., 1979, Thermochemical study of 3d element orthophosphates. Khim. Khim. Tekhnol. (Minsk), 14, 58-64 (in russian) # 80bal/nor Ball J.W., Nordstrom D.K., Everett A.J., 1980, Additional and revised thermochemical data and computer code for WATEQ 2. A computerized chemical model for trace and major element speciation and mineral equilibria of natural waters. US Geol. Surv. Wat. Res # 80cle/joh Clever H.L. and Johnston F.J., 1980. The solubility of some sparingly soluble lead salts: An evaluation of the solubility in water and aqueous electrolyte solutions, J. Phys. Chem. Ref. Data, 9, p. 751 784. # 80har/wea Harvie C.E., and Weare J.H., 1980. The prediction of mineral soluhilities in natural waters: the Na K Mg Ca Cl SO4 H2O system from zero to high concentration at 25C. Geochimica et Cosmochimica Acta, 44, p. 981 997. # 80hem/mon Hemley J.J., Montoya J.W., Marinenko J.W., and Lute R.W., 1980. Equilibria in the system Al2O3 SiO2 H2O and some general implications for alteration/mineralization processes. Econ. Geol., 75, p. 210 228. # 81bae/mes Baes Jr. C.F., and Mesmer R.E., 1981. The thermodynamics of cation hydrolysis. Am. J. Sci., 281, p. 935-962. # 81tur/whi Turner D.R., Whitfield M. and Dickson A.G., 1981. The equilibrium speciation of dissolved components in freshwater and seawater at 25 C and 1 atm. pressure. Geochim. Cosmochim. Acta, 45, p. 855 881. # 82bar/mcc Barbero J.A., McCurdy K.G., and Tremaine P.R., 1982. Apparent molal heat capacities and volumes of aqueous hydrogen sulphide and sodium hydrogen sulfide near 25C: The temperature dependence of H2S ionization. Canadian J. Chem., 60, p. 1872 1880. # 82bil/sch Bilinski H., and Schindler P., 1982. Solubility and equilibrium constants of lead in carbonate solutions (25C, I = 0.3 mol dm 3). Geochimica et Cosmochimica Acta, 46, p. 921 928. # 82cox/wag Cox J.D., Wagman D.D., et Medvedev V.A., 1989. CODATA Key Values for Thermodynamics.: editors. Hemisphere Publishing Corp.: New York. 279 pp. # 82dek DeKock, C.W., 1982, Thermodynamic properties of selected transition metal sulfates and their hydrates: U.S. Bur. Mines Info. Circ. 8910, 45 p. # 82far/fra V.C. Farmer and A.R. Fraser, Chemical and colloidal stability of sols in the Al2O3-Fe2O3-SiO2-H2O system: Their role in podzolization, J. Soil Sci. 33 (1982), pp. 737-742 # 82joh/flo Johnson G. K., Flotow H. E., O'Hare P. A. G., and Wise W. S. (1982) Thermodynamic studies of zeolites : analcime and dehydrated analcime. American Mineralogist 67, 736-748. # 82pan Pankratz L. B., 1982, Thermodynamic Properties of Elements and Oxides (U. S. Bureau of Mines Bulletin 672, 1982, 509 p). # 82pat/slo Patterson C.S., Slocum G.H., Busey R.H., and Mesmer R.E., 1982. Carbonate equilibria in hydrothermal systems: first ionization of carbonic acid in NaCl media to 300C. Geochimica and Cosmochimica Acta, 46, p. 1653 # 82plu/bus Plummer, L.N. and Busenberg, E., 1982. The Solubilities of Calcite, Aragonite, and Vaterite in CO2-H2O Solutions Between 0 and 90 C and an Evaluation of the Aqueous Model of the System CaCO3-CO2-H2O. Geochimica et Cosmochimica Acta, Vol. 46, p. 1011-1040. # 82ric/bot Richet P., Bottinga Y., Denielon L., Petitet J.P., and Tequi C., 1982. Thermodynamics properties of quartz, cristobalite and amorphous SiO2: Drop calorimetry measurements between 1000 and 1800 K and a review from 0 to 2000 K. Geochimica et Cosmochimica Acta, 46, p. 2639-2658. # 82van Vanderzee C.E., 1982. Thermodynamic relations and equilibria in (Na2CO3 + NaHCO3 + H2O): Standard Gibbs energies of formation and other properties of sodium hydrogen carbonate, sodium carbonate heptahydrate, sodium carbonate decahydrate, trona: (Na2CO3CNaHCO3C2H2O), and Wegscheider's salt: (Na2CO3C3NaHCO3). J. Chem. Thermodynamics, 14, 219-238 # 82wag/eva Wagman D.D., Evans W.H., Parker V.B., Schumm R.H., Halow I., Bailey S.M., Churney K.L., and Nutall R.L., 1982. The NBS Tables of Chemical Thermodynamic Properties. J. Phys. Chem. Ref. Data, 11, Suppl. 2. # 83bow/hel Bowers, T.S., and Helgeson, H.C., 1983, Calculation of the thermodynamic and geochemical consequences of nonideal mixing in the system H2O-CO2-NaCl on phase relations in geologic systems: Equation of state for H2O-CO2-NaCl fluids at high pressures and temperatures: Geochim. Cosmo. Acta, v. 47, pp. 1247-1275. # 83joh/flo Johnson G. K., Flotow H. E., and O'Hare P. A. G. (1983) Thermodynamic studies of zeolites:natrolite mesolite and scolecite. American Mineralogist 68, 1137-1145 # 83mic/deb Micskei K., Debreczeni F. and Nagypal I., 1983. Equilibria in aqueous solutions of some chromium (2+) complexes. J. Chem. Soc. Dalton Trans., p. 1335-1338. # 83miy/kle Miyano T, Klein C (1983 a) Phase relations of orthopyroxene, olivine, and grunerite in high-grade metamorphic iron-formation.Am Mineral 68:699-716 # 83san/bar Sangameshwar S.R., and Barnes H.L., 1983. Supergene processes in zinc lead silver sulfide ores in carbonates, Econ. Geol., 78, p 1379 1397. # 84bus/plu Busenberg E., Plummer L.N. and Parker V.B., 1984. The solubility of strontianite (SrCO3) in CO2-H2O solutions between 2 and 91C, the association constants of SrHCO3+(aq) and SrCO3O(aq) between 5 and 80C, and an evaluation of the thermodynamic properties of Sr++(aq) and SrCO3(cr) at 25C and 1 atm total pressure. Geochim. et Cosmochim. Acta, 48, p. 2021-2035. # 84har/mol Harvie C.E., Moller N., and Weare J.H.. 1984, The prediction of mineral solubilities in natural waters: The Na-K-Mg-Ca-H-Cl-SO4-OH-HCO3-CO3-CO2-H2O system to high ionic strengths at 25 C. Geochimica Cosmochimica Acta, 48, pp. 723-751. # 84mak Makarov, T.I., Sidorov, Y.I., and Naumov, V.B. (1984) Formation conditions for iron minerals in ultrabasic-alkali metasomites. Geochemistry International, 21, 148-160. # 84nan Nancollas G.H., 1984, The nucleation and growth of phosphate minerals, Chap. 2. In: Phosphate Minerals, J.O. Nriagu and P.B. Moore (Eds), Springer-Verlag, ISBN 3-540-12757-7, 318-329 # 84nri Nriagu J.O., 1984, Formation and stability of base metal phosphates in soils and sediments, Chap. 10. In: Phosphate Minerals, J.O. Nriagu and P.B. Moore (Eds), Springer-Verlag, ISBN 3-540-12757-7, 318-329 # 84pan Pankratz L. B., 1984, Thermodynamic Properties of Halides (U. S. Bureau of Mines Bulletin 674, 1984, 826 p). # 84pan/stu L.B. Pankratz, J.M. Stuve, and N.A. Gokcen, 'Thermodynamic Data for Mineral Technology,' Bulletin 677, U.S. Bureau of Mines (1984). # 84rob/hem Robie R. A. and Hemingway B. S., 1984. Heat capacities and entropies of phlogopite KMg3AlSi3O1O(OH)2 and paragonite NaAl2AlSi3O1O(OH)2 between 5 and 9OO K and estimates of the enthalpies and Gibbs free energies of formation. Amer. Miner., 69, p. 858-868. # 84sew Seward T. M., 1984. The formation of lead (II) chloride complexes to 300C. A spectrophotometric study. Geochim. Cosmochim. Acta, 48, p. 121 134. # 84tay/lop Taylor P., and Lopata V.J., 1984. Stability and solubility relationships between some solids in the system PbO CO2 H2O. Can. J. Chem., 62, p. 395 402. # 84vie/tar Vieillard P., Tardy Y., 1984, Thermochemical properties of phosphates, Chap. 4. In: Phosphate Minerals, J.O. Nriagu and P.B. Moore (Eds), Springer-Verlag, New York, ISBN 3-540-12757-7, 171-198 # 85bab/mat Babushkin, V.I., Matveyev, G.M., and Mchedlov-Petrossyan, O.P. 1985. Thermodynamics of Silicates. New York, New York: Springer-Verlag. NNA.19920401.0112 # 85ber/bro Berman, R.G., Brown, T.H., 1985. Heat capacity of minerals in the system Na2O-K2O-CaO-MgO-FeO-Fe2O3-AI2O3-SiO2-TiO2-H2O-CO2: representation, estimation and high temperature extrapolation. Contribution to Mineralogy and Petrolology 89, 168-183. # 85cha/dav Chase, M. W., Jr., C. A. Davies, J. R. Downey, Jr., D. J. Frurip, R. A. McDonald, and A. N. Syverud 1985. JANAF Thermochemical Tables, 3rd. ed., J. Phys. Chem. Ref. Data 14, Suppl. 1, Am. Chem. Soc. and Am. Inst. of Physics, Washington, D. C. # 85gol/par Goldberg R.N., and Parker V.B., 1985. Thermodynamics of solution of SO2(g) in water and of aqueous sulfur dioxide solutions. J. Res. Natl. Bur. Stand., 90, p. 341 358. # 85hel Helgeson, H.C., 1985, Errata II. Thermodynamics of minerals, reactions, and aqueous solutions at high pressures and temperatures: Amer. Jour. Sci., v. 285, pp. 845-855. # 85jac/hel Jackson, K.J., and Helgeson, H.C., 1985, Chemical and thermodynamic constraints on the hydrothermal transport and deposition of tin: II. Interpretation of phase relations in the Southeast Asian tin belt: Econ. Geol., v. 80, no. 5, pp. 1365-1378. # 87fer Fernandez Guillermet A. (1987) Critical evaluation of the thermodynamic properties of cobalt. Int. J. Thermophys., 8 (4), 481-510 # 87gar/par CODATA87 Garvin D., Parker V.B and White H.J., 1987. CODATA Series on Thermodynamic Properties, Hemisphere, Washington, DC. # 87pan/mah Pankratz L. B., 1987, A. D. Mah, and S. W. Watson, Thermodynamic Properties of Sulfides (U. S. Bureau of Mines Bulletin 689, 1987, 427 p). # 87rai/sas Rai D., Sass B.M. and Moore D.A., 1987. Chromium (III) hydrolysis constants and solubility of chromium (III) hydroxide. Inorg. Chem., 26, p. 345-349. # 87sve Sverjensky, D.A., 1987, Calculations of the thermodynamic properties of aqueous species and the solubilities of minerals in supercritical electrolyte solutions, in Carmichael, I.S.E. and H.P. Eugster, eds., Thermodynamic Modeling of Geologic Materials: Minerals, Fluids and Melts: Mineral. Soc. Amer., Reviews in Mineralogy, v. 17, pp. 177-209. # 87woo/gar Woods T. L. and Garrels R. M. (1987) Thermodynamic values at low temperature for natural inorganic materials. An uncritical summary. Oxford University Press, New York. # 88cha/new Chandratillake M.R., Newton G.W.A. and Robinson V.J., 1988. Chemval project EUR11891 EN. Comparison of thermodynamic databases used in geochemical modelling., 19 p. # 88eva/gug Evans B. and Guggenheim S. (1988) Talc, pyrophyllite, and related minerals, Hydrous Phyllosilicates (exclusive of micas). In: S.W. Bailey, Editor, Reviews in Mineralogy vol. 19 (1988), pp. 225-294. # 88haa Haas J.L., Jr. (1988) Recommended standard electrochemical potentials and fugacities of oxygen for the solid buffers and thermodynamic data in the systems iron-silicon-oxygen, nickel-oxygen, and copper-oxygen. Preliminary report of January 17, 1988 to the CODATA Task Group on Chemical Thermodynamic Tables, U.S. Geological Survey, Reston, Virginia. # 88mer Merlino, S., 1988, Gyrolite: its crystal structure and crystal chemistry. Mineralogical Magazine, v. 52, p. 377-387. # 88mol Moller N., 1988. The prediction of mineral solubilities in natural waters: A chemical equilibrium model for the Na Ca Cl SO4 H2O system, to high temperature and concentration. Geochirmica et Cosmochimica Acta, 52, p. 821 837. # 88phi/hal Phillips, S.L., Hale, F.V., Silvester, L.F., and Siegel, M.D. (1988) Thermodynamic tables for nuclear waste isolation, an aqueous solutions database. vol 1, 181 p. Report NUREG/CR-4864, LBL-22860, SAND87-0323, Lawrence Berkeley Laboratory, Berkeley, California. # 88rea Reardon E. (1988) J. Phys. Chem., 92, 6426-6431 # 88rua Ruaya J.R., 1988. Estimation of instability constants of metal chloride complexes in hydrothermal solutions up to 300C. Geochimica et Cosmochimica Acta, 52, p. 1983 1996. # 88sac/pas Sacerdoti M., Passaglia E. (1988) Neues Jb. Miner., Mh., H.10, 462-475 # 88sho/hel Shock E.L. and Helgeson H.C., 1988. Calculation of the thermodynamic and transport properties of aqueous species at high pressures and temperatures: Correlation algorithms for ionic aqueous species and equation of state predictions to 5 kb and 1000C. Geochim. Cosmochim. Acta, 52, pp. 2009-2036. # 88sto Stoessell, R. K. (1988) 25oC and 1 atm dissolution experiments of sepiolite and kerolite: Geochimica Cosmochimica Acta, 52, 365-374. # 89asho/hel Shock, E.L., and Helgeson, H.C., 1989, Corrections to Shock and Helgeson (1988): Geochim. Cosmo. Acta, v. 53, p. 215. # 89bar/sau Barin, I., F. Sauert, et al. (1989). Thermochemical Data of Pure Substances. Germany, VCH, Verlagsgesellschaft. # 89bsho/hel Shock E.L., Helgeson H.C. and Sverjensky D.A., 1989. Calculation of the thermodynamic and transport properties of aqueous species at high pressures and temperatures: Standard partial molal properties of inorganic neutral species. Geochim. Cosmochim. Acta, 53, pp. 2157-2183. # 89cox/wag Cox J.D., Wagman D.D., and Medvedev V.A., 1989. CODATA Key Values for Thermodynamics. Hemisphere Publishing Corp., New York, 279 p. # 89mar/smi Martell A.E., and Smith R.M., 1989, Critical Stability Constants, Vol. 3: Other Organic Ligands (2nd printing). Plenum, New York, 495 p. # 89pan/sus Pan P. and Susak N.J. (1989) Co(II)-chloride and -bromide complexes in aqueous solutions up to 5 m NaX and 90[deg]C: Spectrophotometric study and geological implications. Geochimica et Cosmochimica Acta 53(2), 327-341. # 89sch/her Schwab R. G., Herold H., Costa M. L. D., and Oliveira N. P. (1989) The formation of aluminous phosphates through lateritic weathering of rocks. Weathering 2, 369-386. # 90hem Hemingway B. S. (1990) Thermodynamic properties for bunsenite, NiO, magnetite, Fe3O4, and hematite, Fe2O3, with comments on selected oxygen buffer reactions. American Mineralogist 75(7-8), 781-790. # 90hol/pow Holland T. J. B. and Powell R. (1990) An enlarged and updated internally consistent thermodynamic dataset with uncertainties and correlations: the system K2O-Na2O-CaO-MgO-MnO-FeO-Fe2O3-Al2O3-TiO2-SiO2-C-H2-O2. Journal of Metamorphic Geology 8(1), 89-124. # 90kun/kih Kuniaki Kihara (1990) Eur. J. Mineral., 2, 63-77 # 90nor/plu Nordstrom D.K., Plummer L.N., Langmuir D., Busenberg E., May H.M., Jones B.F., and Parkhurst D.L., 1990. Revised chemical equilibrium data for major water-mineral reactions and their limitations, in Bassett, R.L. and Melchior, D. eds., Chemical modeling in aqueous systems II: Washington D.C., American Chemical Society Symposium Series 416, p. 398-413. # 90pap/ber V.G. Papangelakis, D. Berk and G.P. Demopoulos, Mathematical modeling of an exothermic leaching reaction system: pressure oxidation of wide size arsenopyrite particulates. Metall. Trans. B, 21B (1990), pp. 827-837. # 90rin/sac Rinaldi R., Sacerdoti M., Passaglia E. (1990) Eur. J. Mineral., 2, 841-849 # 90rob/cam Roberts, Willard L., Campbell, Thomas J., and Rapp, George R.: Encyclopedia of Minerals. (Van Nostrand Reinhold Co., 2nd ed., 1990) # 90sho/hel Shock, E.L., and Helgeson, H.C., 1990, Calculation of the thermodynamic and transport properties of aqueous species at high pressures and temperatures: Standard partial molal properties of organic species: Geochim. Cosmo. Acta, v. 54, pp. 915-945. # 90sto/cyg Stoffregen R. E., Cygan G.L. (1990). An experimental study of Na-K exchange between alunite and aqueous sulfate solutions. Am. Min., 75:209-220 # 91all/bro Allison J.D., Brown D.S., and Novo-Gradac K.J. 1991. Minteqa2/prodefa2, a geochemical assessment model for environmental systems: version 3.0 user's manual, EPA/600/3-91/021, March 1991 by U.s. Environmental Protection Agency Athens, Georgia 30605. # 91atk/gla Atkins, M., Glasser, F.P., Kindness, A., and MacPhee, D.E. 1991. Solubility Data for Cement Hydrate Phases (25C). Washington, District of Columbia: U.S. Department of Energy. (DOE/HMIP/RR/91/032) # 91din Dinsdale A.T., 1991. SGTE Data for Pure Elements, CALPHAD, 15(4), p. 317-425. # 91hem/rob Hemingway B.S., Robie R.A., and Apps J.A., 1991. Revised values for the thermodynamic properties of boehmite, AlO(OH), and related species and phases in the system Al O H. Am. Mineral., 76, p. 445-457. # 91kna/kub O. Knacke, O. Kubaschewski and K. Hesselmann: Thermochemical Properties of Inorganic Substances, Second Edition, (Springer-Verlag, 1991) # 91kon/hau Konigsberger E., Hausner R., and Gamsjager H., 1991. Solid solute phase equilibria in aqueous solution. V: The system CdC03 CaC03 C02 H20. Geochimica and Cosmochimica Acta, 55, p. 3505 3514. # 91nag/las Nagy K.L., and Lasaga A.C., 1991. Dissolution and precipitation kinetics of gibbsite at 80C and pH 3: The dependence on solution saturation state. Geochimica et Cosmochimica Acta, 56, p. 3093 3111. # 91pab/pit Pabalan R., Pitzer K. (1991) in: K. Pitzer (Ed.), Activity Coefficients in Electrolyte Solutions, Chapter 7. CRC Press, Boca Ration, FL # 91rai/fel Rai D., Felmy A.R., and Szelmeczka R.W., 1991. Hydrolysis Constants and Ion Interaction Parameters For Cd(II) in Zero to High Concentrations of NaOH KOH, and the Solubility Product of Crystalline Cd(OH)2. Journal of Solution Chemistry, 20, p. 375 390. # 91rob/hem Robie R.A. and Hemingway B.S. (1991) - Heat capacities of kaolinite from 7 to 380 K and of DSMO-intercalated kaolinite AI2Si20 (OH). Clays and Clay Minerals, 39, p. 362-368 # 91sve/hem Sverjensky, D.A., Hemley, J.J., and D'Angelo, W.M., 1991, Thermodynamic assessment of hydrothermal alkali feldspar- mica-aluminosilicate equilibria: Geochim. Cosmo. Acta, v. 55, pp. 989-1004. # 92ajoh Ref. 1+19 in slop98.dat: GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University. # 92bal/nor Ball J.W., and Nordstrom D.K., 1992. User's manual for WATEQ4F, with revised thermodynamic data base and test cases for calculating speciation of major, trace and redox elements in natural waters. U.S. Geol. Survey Open-File Report 91-183 (revised and reprinted 1992), Menlo Park, California. 189 pp. # 92bjoh Ref. 17 in slop98.dat: GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University. # 92bru/stu Bruno J., Stumm W., Wersin P., and Brandberg F. (1992) On the influence of carbonate in mineral dissolution: I. The thermodynamics and kinetics of hematite dissolution in bicarbonate solutions at T = 25C. Geochimica et Cosmochimica Acta 56(3), 1139-1147. # 92bru/wer Bruno J., Wersin P., and Stumm W. (1992) On the influence of carbonate in mineral dissolution: II. The solubility of FeCO3 (s) at 25C and 1 atm total pressure. Geochimica et Cosmochimica Acta 56(3), 1149-1155. # 92cir/nav Circone S. and Navrotsky A., 1992. Substitution of (6,4)Al in phlogopite : high pressure solution calorimetry , heat capacities and thermodynamic properties of the phlogopite -eastonite join. American Mineralogist, 77, p. 1191-1205. # 92cjoh Ref. 7+9+19 in slop98.dat: GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University. # 92cle/der Clever L.H., Derrick E.M., and Johnson S.A., 1992. The solubility of Some Sparingly Soluble Salts on Zinc and Cadmium In water and in aqueous electrolyte solutions. J. Phys. Chem. Ref. Data, 21, p. 941 966. # 92gre/fug Grenthe I., Fuger J., Konings R.J.M., Lemire R.J., Muller A.B., Nguyen Trung C., and Wanner H., 1992. Chemical Thermodynamics, Volume 1: Chemical Thermodynamics of Uranium. North Holland, Amsterdam, 1, 714 pp. # 92joh/oel Johnson J.W., Oelkers E.H. and Helgeson H.C., 1992. SUPCRT92: A software package for calculating the standard molal thermodynamic properties of minerals, gases, aqueous species, and reactions from 1 to 5000 bar and 0 to 1000'C. Comput.Geosci., 18, p. 899 # 92joh/tas Johnson G. K., Tasker I. R., Flotow H. E., and O'Hare P. A. G. (1992) Thermodynamic studies of mordenite,dehydrated mordenite and gibbsite. American Mineralogist 77(1-2), 85-93 # 92pal/wes Palmer D.A., and Wesolowski D.J., 1992. Aluminum speciation and equilibria in aqueous solution: II. The solubility of gibbsite in acidic sodium chloride solutions from 30 to 70C. Geochimica et Cosmochimica Acta, 56, p. 1093 1111. # 92plo/wic Plodinec M. J. and Wicks G. G. (1992) Applications of hydration thermodynamics to in-situ tests results. In: Proc. Workshop on In Situ Testiong of Radioactive Waste Forms and Engineered Barriers, Corsendonk, Belgium, oct. 13-16, 1992. # 92sea/rob Seal R.R., Robie R.A., Barton P.B., and Hemingway B.S. (1992) Superambient heat capacities of synthetic stibnite, berthierite, and chalcostibnite: Revised thermodynamic properties and implications for phase equilibria. Econ. Geol. 87, 1911-1918. # 92sho Shock, E.L., 1992, Stability of peptides in high-temperature aqueous solutions: Geochim. Cosmo. Acta, v. 56, pp. 3481-3491. # 92sti/par Stipp S.L.S., Parks G.A., Nordstrom K.D., and Leckie J.O., 1992. Solubility product constant and thermodynamic properties for synthetic otavite, CdC03(s) and aqueous association constants for the Cd( II) C02 H20 system. Geochimica et Cosmochimica Acta, 57 # 92tay Taylor, H. F. W., 1992, Cement Chemistry, third edition: London, Thomas Telford, 475 p. # 92wol Wolery T.J., 1992. EQ3/6: A software Package for Geochemical Modelling of Aqueous Systems: Package Overview and Installation Guide. Technical Report UCRL-MA-110662 PT I ed., Lawrence Livermore National Laboratory (USA). # 93bal/chr Balarew C., Christov C., Valyashko V., Petrenko S. (1993) J. Solution Chem., 22, 173-181 # 93bar Barin, I. (1993) Thermochemical Data of Pure Substances, Weinheim, FRG, VCH. # 93pal/wel Palmer D.A., and Wesolowski D.J., 1993. Aluminum speciation and equilibrium in aqueous solution: III. Potentiometric determination of the first hydrolysis constant of aluminum (III) in sodium chloride solutions to 125C. Geochim. Cosmochim. Acta, 57, p. 2 # 93sax/cha Saxena S.K., Chaterjee N., Fei Y., Shen G. (1993) Thermodynamic data on oxides and silicates. Springer. New-York. # 93sch/got Schwab R. G., Gotz C., Herold H., and Oliveira N. P. (1993) Compounds of the crandallite type-Thermodynamic properties of Caphosphates, Sr-phosphates, Ba-phosphates, Pb-phosphates, La-phosphates, Ce-phosphates to Gd-phosphates and Ca-arsenates, Ba-arsenates, Pb-arsenates, La-arsenates, Ce-arsenate.Srarsenates, Neues Jahrb Miner Monatsh. 12, 551-568. # 93sch/sho Schulte, M.D., and Shock, E.L., 1993, Aldehydes in hydrothermal solution: Standard partial molal thermodynamic properties and relative stabilities at high temperatures and pressures: Geochim. Cosmo. Acta, v. 57, pp. 3835-3846. # 93sho Shock, E.L., 1993, Hydrothermal dehydration of aqueous organic compounds: Geochim. Cosmo. Acta, v. 57, pp. 3341-2249. # 93sho/kor Shock, E.L., and Koretsky, C.M., 1993, Metal-organic complexes in geochemical processes: Calculation of standard partial molal thermodynamic properties of aqueous acetate complexes at high pressures and temperatures: Geochim. Cosmo. Acta, v.57, pp. 4899-4 # 93sho/mck Shock, E.L., and McKinnon, W.B., 1993, Hydrothermal Processing of Cometary Volatiles--Applications to Triton: Icarus, v. 106, pp. 464-477. # 93sto Stoffregen R.E. (1993). Stability relations of jaroiste and natrojarosite. Geoch. And Cosmoch. Acta, 57, 2417-2419. # 94aki/zot Akinfiev N.N., Zotov A.V., and Shikina N.D. (1994) Experimental investigation and thermodynamic correlation in the Sb(III)-S(II)-O-H system. Geochem. Intern. 31, 27-40. # 94alb/tom Al-Borno, A., Tomson, M.B. (1994) The temperature dependence of the solubility product constant of vivianite. Geochim. Cosmochim. Acta 58, 5373-5378 # 94dam/str Damidot, D., Stronach, S., Kindness, A., Atkins, M., and Glasser, F.P. 1994. Thermodynamic investigation of the CaO-Al2O3-CaCO3-H2O closed system at 25C and influence of Na2O. Cem. Concr. Res. 24(3):563-572. # 94dia/kho I. Diakonov, I. Khodakovsky, J. Schott, E. Sergeeva (1994) Thermodynamic properties of iron oxides and hydroxides. I. Surface and bulk thermodynamic properties of goethite (alpha-FeOOH) up to 500 K. Eur. J. Mineral., 6(6), 967-983. # 94pan Pankratz L. B., 1994, Thermodynamic Properties of Carbides, Nitrides, and Other Selected Substances (U. S. Bureau of Mines Bulletin 696, 1994, 957 p). # 95ant/bid Anthony J.W., Bideaux R.A., Bladh K.W. and Nichols M.C., 1995. Handbook of Mineralogy, Volume II. Silica, Silicates. Mineral Data Publishing, Tucson, 904 pp., 2 vols. # 95bev/pui Beverskog, B., Puigdomenech, I. (1995) Revised Pourbaix diagrams for iron at 25-300C; Corr. Sci. 38, p. 2121-2135. # 95bou Bourbon X., 1995. Selection de donnees thermodynamiques afferentes aux corrections de Temperature sur les equilibres chimiques. I/II Analyse de bases de donnees. ANDRA Report, C RP O. HEM 95.001. # 95dac/ben Dachs, E. and Benisek, A., 1995. The stability of annite+quartz: reversed experimental data for the reaction 2 annite+3 quartz=2 sanidine+3 fayalite+2 H2O. Contributions to Mineralogy and Petrology, 121, p. 380-387. # 95dai/pos Dai, Y., and Post, J. E,. 1995, Crystal structure of hillebrandite: a natural analogue of calcium silicate hydrate (CSH) phases in Portland cement: American Mineralogist, v. 80, p. 841-844. # 95haa/sho Haas, J.R., Shock, E.L., and Sassani, D.C., 1995, Rare earth elements in hydrothermal systems: Estimates of standard partial molal thermodynamic properties of aqueous complexes of the rare earth elements at high pressures and temperatures: Geochim. Cosmo. Acta, v. 59, no. 21, pp. 4329-4350. # 95has/cyg Haselton H.T., Cygan G.L. and Jenkins D.M., 1995. Experimental study of muscovite stability in pure H 2 O and 1 molal KCl-HCl solutions. Geochimica et Cosmochimica Acta, 59, p. 429-442 # 95jem/che Jemal M., Ben Cherifa A., Kattech I. and Ntahomvukiye I., 1995. Standard enthalpies of formation and mixing of hydroxy- and fluorapatites. Thermochimica Acta, 259, p. 13-21 # 95mar/mac Marani D., Macchi G., and Pagano M., 1995. Lead precipitation in the presence of sulphate and carbonate : testing of thermodynamic predictions. Water Research, 29, p. 1085 1092. # 95mir/kis Mironova V.E., Kiselev V.P., Egizaryan M.B., Golovnev N.N., Pashkov G.L. (1995) Ion association in aqueous solutions of calcium arsenate. Russ. J. Inorg. Chem., 40, 1690-1691 # 95par/kho Parker, V.B., Khodakovsky, I.L. (1995) Thermodynamic properties of aqueous ions (2+ et 3+) of iron and the key compouds of iron. J. Phys. Chem. Ref. Data 24 (5) p. 1699-1745. # 95pok/hel Pokrovskii, V.A., and Helgeson, H.C., 1995, Thermodynamic properties of aqueous species and the solubilities of minerals at high pressures and temperatures: The system Al2O3-H2O-NaCl: Amer. J. Sci., 295, 1255-1342. # 95pok/sch Pokrovski G.S., Schott J. and Sergeyev A.S., 1995. Experimental determination of the stability constants of NaSO4minus and NaB (OH)40 in hydrothermal solutions using a new high-temperature sodium-selective glass electrode - Implications for boron isotopic fractionation. Chemical Geology, 124, p. 253-265. # 95rob/hem Robie R.A., and Hemingway B.S., 1995. Thermodynamic properties of minerals and related substances at 298.15 K and 1 Bar (105 Pascals) pressure and at higher temperatures. U.S. Geol. Survey Bull., 2131, 461 pp. # 95sho Shock, E.L., 1995, Organic acids in hydrothermal solution: Standard molal thermodynamic properties of carboxylic acids and estimates of dissociation constants at high temperatures and pressures: Amer. Jour. Science, v. 295, pp. 496-580. # 95sho/kor Shock, E.L., and Koretsky, C.M., 1995, Metal-organic complexes in geochemical processes: Estimation of standard partial molal thermodynamic properties of aqueous complexes between metal cations and monovalent organic acid ligands at high pressures and temperatures. Geochim. Cosmo. Acta, 59, pp. 1497-1532. # 95sil/bid Silva R.J., Bidoglio G., Rand M.H, Robouch P.B., Wanner H., and Puigdomenech I., 1995. Chemical Thermodynamics Vol.2. Chemical Thermodynamics of Americium. NEA, Elsevier. # 95tro Trotignon L. (1995) Critique et selection de donnees thermodynamiques en vue de modeliser les equilibres mineral-solution. Rapport annuel 1995 SESD95/49 # 96abar/pal Baron D. and Palmer C. D., 1996a. Solubility of KFe3(CrO4)2(OH)6 at 4-35C. Geochim. Cosmochim. Acta, 60, pp. 3815-3824. # 96arc Archer D.G., 1996. Thermodynamic Properties of Synthetic Otavite, CdCO3(cr): Enthalpy Increment Measurements from 4.5 K to 350 K. J. Chem. Eng. Data, 41, p. 852 858. # 96bbar/pal Baron D. and Palmer C. D. (1996b) Solubility of jarosite at 4-35C. Geochim. Cosmochim. Acta 60, 185-195. # 96bev/pui Beverskog, B., Puigdomenech, I., 1996. Revised pourbaix diagrams for iron at 25-300 C. Corros. Sci. 38, 2121-2135. # 96bou Bourbon X., 1996. Selection de donnees thermodynamiques afferentes aux corrections de Temperature sur les equilibres chimiques (Sodium, Potassium, cesium, Magnesium, Calcium, Strontium, Cobalt, Nickel, Paladium). ANDRA Report, CRP OHEM 96.001. # 96dia/sch Diakonov, I.I., Schott, J., Martin, F., Harrichourry, J.-C., Escalier, J., 1999. Iron (III) solubility and speciation in aqueous solutions. experimental study and modelling: part 1. hematite solubility from 60 to 300 C in NaOH-NaCl solutions and thermodynamic properties of Fe (OH) 4minus(aq). Geochimica et Cosmochimica Acta 63, 2247-2261. # 96fal/rea Falck W.E., Read D. and Thomas J.B., 1996. Chemval2: thermodynamic database EUR16897 EN # 96gal/boll Gal J.Y., Bollingerb J.C., Tolosa H., and Gache N., 1996. Calcium carbonate solubility: a reappraisal of scale formation and inhibition. Talanta, 43, p. 1497 1509. # 96gem GEMBOCHS, 1996, THERMODYNAMIC DATABASE: thermo.com.V8.R6.full, generated by GEMBOCHS.V2-Jewel.src.R6 03-dec-1996 16:55:04 # 96hud/str Hudson Lamb D.L., Strydom C.A., and Potgieter J.H., 1996. The thermal dehydration of natural gypsum and pure calcium sulphate dihydrate (gypsum). Thermochimica Acta, 282/283, p. 483 492. # 96kis/nav Kiseleva I., Navrotsky A., Belitskii I. A., and Fursenko B. A. (1996) Thermochemistry and phase equilibria in calcium zeolites. American Mineralogist 81(5-6), 658-667 # 96pok/gou Pokrovski G., Gout R., Schott J., Zotov A. and Harrichoury J.C., 1996. Thermodynamic properties and stoichiometry of As (III) hydroxide complexes at hydrothermal conditions. Geochimica et Cosmochimica Acta, 60, 737-749 # 96rou/hov Roux J. and Hovis G. L., 1996. Thermodynamic mixing models for muscovite-paragonite solutions based on solution calorimetric and phase equilibrium data. Journal of Petrology, 37, p. 1241-1254 # 96stu/mor Stumm, W., Morgan, J.J., 1996. Aquatic chemistry: chemical equilibria and rates in natural waters. Wiley. # 96su/har Su, C., and J.B. Harsh. 1996. Influence of soluble aluminosilicate complex formation on imogolite solubility determination. Geochim. Cosmochim. Acta 60:4275-4277. # 97all/dol Allal K. M., Dolinger J.-C., and Martin G. (1997) Determination of thermodynamical data of calcium hydroxichloride. Revue de l'Institut Francais du Petrole 52(3), 361-368. # 97apok/hel Pokrovskii V.A., and Helgeson H.C., 1997a. Thermodynamic properties of aqueous species and the solubilities of minerals at high pressures and temperatures: the system Al2O3 H2O KOH. Chemical Geology, 137, p. 221 242. # 97asho/sas Shock, E.L., Sassani, D.C., Willis, M., and Sverjensky, D.A., 1997, Inorganic species in geologic fluids: Correlations among standard molal thermodynamic properties of aqueous ions and hydroxide complexes: Geochim. Cosmo. Acta, v. 61, no. 5, pp. 907-950. # 97ben/dia Benezeth P., Diakonov I.I., Pokrovski G.S., Dandurand J.L., Schott J. and Khodakovsky I.L., 1997. Gallium speciation in aqueous solution. Experimental study and modelling: Part 2. Solubility of alpha-GaOOH in acidic solutions from 150 to 250C and hydrolysis constants of gallium (III) to 300oC. Geochim. Cosmochim. Acta, 61, pp. 1345-1357 # 97bon/hea Bond K. A., Heath T. G. and Tweed C. J., 1997. HATCHES: A Referenced Thermodynamic Database for Chemical Equilibrium Studies. Nirex Report NSS/R379 # 97bpok/hel Pokrovskii V., and Helgeson H.C., 1997b. Calculation of the standard partial molal thermodynamic properties of KCl0 and activity coefficients of aqueous KC1 at temperatures and pressures to 1000C and 5 kbar. Geochimica et Cosmochimica Acta, 61, p. 2175-2183. # 97bsho/sas Shock, E.L., Sassani, D.C., and Betz, H., 1997, Uranium in geologic fluids: Estimates of standard partial molal properties, oxidation potentials, and hydrolysis constants at high temperatures and pressures: Geohim. Cosmo. Acta, v. 61, no. 20, pp. 4245-426 # 97coo/alb Coombs, D.S., Alberti, A., Armbruster, T., Artioli, G., Colella, C., Galli, E., Grice, J.D., Liebau, F., Mandarino, J.A., Minato, H., Nickel, E.H., Passaglia, E., Peacor, D.R., Quartieri, S., Rinaldi, R., Ross, M., Sheppard, R.A., Tillmanns, E., Vealini, G., 1997. Recommended nomenclature for zeolite minerals - report of the subcommittee on zeolites of the international mineralogical association, commission on new minerals and mineral names. Canadian Mineralogist, 35, 1571-1606. # 97cro Cromieres L., 1997. Selection de donnees thermodynamiques le cadmium, le mercure et le bore, et evaluation de leur manche. Technical report Andra C.RP.AMAT.97.043 # 97csho/sas Shock, E.L., Sassani, D.C., and Betz, H., 1997, Uranium in geologic fluids: Estimates of standard partial molal properties, oxidation potentials, and hydrolysis constants at high temperatures and pressures: Geohim. Cosmo. Acta, v. 61, no. 20, pp. 4245-4266 # 97dal/sho Dale, J.D., Shock, E.L., MacLeod, G., Aplin, A.C., and Larter, S.R., 1997, Standard partial molal properties of aqueous alkylphenols at high pressures and temperatures: Geochim. Cosmo. Acta, v. 61, no. 19, pp. 4017-4024. # 97got Gottschalk M. (1997) Internally consistent thermodynamic data set for rock forming minerals in the system SiO2-TiO2-Al2O3-Fe2O3-CaO-MgO-FeO-K2O-Na2O-H2O-CO2: an alternative approach. European Journal of Mineralogy, 9, p. 175-223. # 97mcc/sho McCollom, T.M., and Shock, E.L., 1997, Geochemical constraints on chemolithoautotrophic metabolism by microorganisms in seafloor hydrothermal systems: Geochim. Cosmo. Acta, v. 61, no. 20, pp. 4375-4391. # 97pal/wes Palmer D.A., and Wesolowski D.J., 1997. Potentiometric measurements of the first hydrolysis quotient of magnesium(II) to 250C and 5 molal ionic strength. J. Sol. Chem., 26, p. 217-232. # 97ply/wan Plyasunova, N.V., Wang, M., Zhang, Y., Muhammed, M., 1997. Critical evaluation of thermodynamics of complex formation of metal ions in aqueous solutions II. Hydrolysis and hydroxo-complexes of Cu2+ at 298.15 K. Hydrometallurgy 45, 37-51. # 97rim Rimstidt D.J., 1997. Quartz solubility at low temperatures. Geochimica et Cosmochimica Acta, 61, p. 2553 2558. # 97sho/sas Shock E.L., Sassani D.C., Willis M., and Sverjensky D.A., 1997. Inorganic species in geologic fluids: Correlations among standard molal thermodynamic properties of aqueous ions and hydroxide complexes. Geochim. Cosmo. Acta, 61, p. 907 950. # 97smi/mar Smith R. M., Martell A. E., and Motekaitis R. J. (1997) NIST Critically Selected Stability Constants of Metal Complexes Database, Version 4.0. NIST Standard Reference Database 46. U.S. Department of Commerce # 97sul/sew Suleimenov O.M., and Seward T.M., 1997. A spectrophotometric study of hydrogen sulphide ionisation in aqueous solutions to 350C. Geochimica et Cosmochimica Acta, 61, p. 5187 5198. # 97sve/sho Sverjensky, D.A., Shock, E.L., and Helgeson, H.C., 1997 Prediction of the thermodynamic properties of aqueous metal complexes to 1000 C and 5 kb: Geochim. Cosmo. Acta, v. 61, No. 7, pp. 1359-1412. # 97tag/zot Tagirov B. R., Zotov A. V. and Akinfiev N. N., 1997. Experimental study of dissociation of HCl from 350 to 500C and from 500 to 2500 bars: Thermodynamic properties of HCl(aq). Geochimica et Cosmochimica Acta, 61, 4267-4280 # 97tay Taylor H.F.W. , 1997 Cement Chemistry, 2nd. Ed., Thomas Telford, London. # 98adia I.I. Diakonov (1998) Thermodynamic properties of iron oxides and hydroxides. II. Estimation of the surface and bulk thermodynamic properties of ordered and disordered maghemite (gamma-Fe2O3). Eur. J. Mineral., 10(1), 17-29. # 98arc Archer D.G., 1998. Thermodynamic Properties of Import to Environmental Processes and Remediation. I. Previous Thermodynamic Property Values for Cadmium and Some of Its Compounds. Journal of Physical and Chemical Reference Data, 27, p. 915 # 98bal/nor Ball J.W. and Nordstrom D.K., 1998. Critical evaluation and selection of standard state thermodynamic properties for chromium metal and its aqueous ions, hydrolysis species, oxides and hydroxides. J. Chem. Eng. Data 43, p. 895-918. # 98bar/pal Baron D. and Palmer C. D., 1998. Solubility of KFe(CrO4)2-2H2O at 4-75C. Appl. Geochem., 12, pp. 961-973. # 98bdia I.I. Diakonov (1998) Thermodynamic properties of iron oxides and hydroxides. III. Surface and bulk thermodynamic properties of lepidocrocite (gamma-FeOOH) to 500 K. Eur. J. Mineral., 10(1), 31-41. # 98bre/lin Brennan, E.W., Lindsay, W.L. (1998) Reduction and oxidation effect on the solubility and transformation of iron oxides, Soil Sci. Soc. Am. J. 62, 930-937 # 98cha Chase, M.W.J., 1998. NIST-JANAF Thermochemical Tables, Journal of Physical Chemistry Reference Data, Vol. 9, 4th Edition. National Institute of Standards and Technology, Washington DC, 1951 pp. # 98cha/kru Chatterjee, N.D., Kruger, R., Haller, G., Olbricht, W., 1998. The Bayesian approach to an internally consistent thermodynamic database: theory, database, and generation of phase diagrams. Contributions to Mineralogy and Petrology 133, 149-168. # 98fel/dix Felmy A.R., Dixon D.A., Rustad J.R., Mason M.J. and Onishi L.M., 1998. The Hydrolysis and Carbonate Complexation of Strontium and Calcium in Aqueous Electrolytes: Use of Molecular Modeling Calculations in the Development of Aqueous Thermodynamic Models. J. Chem. Thermodynamics, 30, p. 1103-1120 # 98gam/kon Gamsjager H., Konigsberger E., and Preis W., 1998. Solubilities of metal carbonates. Pure and Appl. Chem., 70, p. 1913 1920. # 98gla/tyr Glasser, F. P., Tyrer, M., Quillin, K., Ross, D., Pedersen, J., Goldthorpe, K., Bennett, D., and Atkins, M., 1998, The chemistry of blended cements and backfills intended for use in radioactive waste disposal: Research and development Technical Report P98, UK Environment Agency, 332 p. # 98hol/pow Holland T.J.B., and Powell R., 1998. An internally consistent thermodynamic data set for phases of petrological interest. Journal of Metamorphic Geology, 16, p. 309 343. # 98kin King D. W. (1998) Role of Carbonate Speciation on the Oxidation Rate of Fe(II) in Aquatic Systems. Environ. Sci. Technol. 32(19), 2997-3003. # 98mer/roc Mercy M.A., Rock P.A., Casey W.H., and Mokarram M.M., 1998. Gibbs energies of formation for hydrocerussite [Pb(OH)2.(PbCO3)2(s)] and hydrozincite {[Zn(OH)2]3.(ZnCO3)2(s)} at 298 K and 1 bar from electrochemical cell measurements. American Mineralogist, 83, p. 739-745. # 98ply/zha Plyasunova N. V., Zhang Y., and Muhammed M. (1998) Critical evaluation of thermodynamics of complex formation of metal ions in aqueous solutions. V. hydrolysis and hydroxo-complexes of Co2+ at 298.15 K. Hydrometallurgy 48(2), 153-169. # 98pok/sch Pokrovski G.S. and Schott J., 1998. Thermodynamic properties of aqueous Ge(IV) hydroxide complexes from 25 to 350C: Implications for the behavior of germanium and the Ge/Si ratio in hydrothermal fluids. Geochimica et Cosmochimica Acta, 62, 1631-1642 # 98ras/eva RASMUSSEN G., EVANS B .W. and Kusmmn S.M. (1998): Low-temperature fayalite, greenalite, and minnesotaite from the Overlook gold deposit, Washington: phase relations in the system FeO-SiO2-H2O. Can. Mineral.36, 147-162 # 98sal/pok Salvi S, Pokrovski G.S. and Schott J. 1998. Experimental investigation of aluminum-silica aqueous complexing at 300C. Chemical Geology, 151, 51-67 # 98sas/sho Sassani, D.C., and Shock, E.L., Solubility and Transport of Platinum-Group Elements in Supercritical fluids: Estimates of standard partial molal properties, oxidation potentials, and hydrolysis constants at high temperatures and pressures: Geohim. Cosmo. Acta, v. 61, no. 20, pp. 4245-4266. # 98sav Savage, D., 1998, Zeolite occurrence, stability and behaviour, in Maqarin, analogue study, Phase III, Smellie, J. A. T., editor, SKB Report TR 98-04, v. 1, p. 281-307. # 98zie/jon Ziemniak S.E., Jones M.E. and Combs K.E.S. 1998. Solubility and phase behaviour of Cr(III) oxides in alkaline media at elevated temperatures. J. Solution Chemistry, Vol. 27, N1, p.33-66. # 99aki/zot Akinfiev N. and Zotov A., 1999. Thermodynamic description of equilibria in mixed fluids (H2O-non-polar gas) over a wide range of temperature (25-700C) and pressure (1-5000 bars). Geochimica et Cosmochimica Acta, 63, 2025-2041 # 99all Allison Geoscience Consultants, Inc., HydroGeoLogic, Inc., 1999, MINTEQA2/PRODEFA2, a geochemical assessment model for environmental systems: User manual supplement for version 4.0., U.S. Environmental Protection Agency, 76 p. # 99bot/bro Bothe JV, Brown PW (1999) The stabilities of calcium arsenates at 23 C. J Hazard Mater B 69:197-207 # 99dav/phi Davison W., Phillips N., and Tabner B. J. (1999) Soluble iron sulfide species in natural waters: Reappraisal of their stoichiometry and stability constants. Aquatic Sciences - Research Across Boundaries 61(1), 23-43. # 99dia/sch Diakonov I.I., Schott J., Martin F., Harrichourry J.C. and Escalier J., 1999. Iron(III) solubility and speciation in aqueous solutions. experimental study and modelling: part 1. hematite solubility from 60 to 300C in NaOH-NaCl solutions and thermodynamic properties of Fe(OH)4-(aq) - Revised equation od state for the standard partial properties of ions and electrolytes. Geochimica et Cosmochimica Acta, Volume 63, Number 15, August 1999 , pp. 2247-2261(15) # 99gra Grauer R., 1999. Solubility products of M(II) carbonates. Waste Management laboratory, PSI Bericht Nr. 99-04 January 1999 ISSN 1019-0643. # 99kon/kon Konigsberger E., Konisberger L.C., and Gamsjager H., 1999. Low temperature thermodynamic model for the system Na2CO3 MgCO3 CaCO3 H2O. Geochimica et Cosmochimica Acta, 63, p. 3105-3119. # 99lot/och Lothenbach B., Ochs M., Wanner H., and Yui M., 1999. Thermodynamic data for the speciation and solubility of Pd, Pb, Sn, Sb, Nb and Bi in aqueous solution. JNC TN8400 99 011. # 99par/app Parkhurst D.L., and Appelo C.A.J., 1999. User's guide to Phreeqc (version 2)- a computer program for speciation, batch-reaction, one-dimensional transport, and inverse geochemical calculation. USGS WRI Report 99-4259, 312 pp. # 99sav/sav Savenko V. S. and Savenko A. V. (1999) Solubility of cobalt(III) and the stability constant of the hydroxo complex Co(OH)30 in aqueous solution. Geochemistry International 37(4), 385-387. # 99sch/bar Schoonen M.A.A, and Barnes H.L., 1988. An approximation of the second dissociation constant for H2S. Geochim. Cosmo. Acta, 52, p. 649-654. # 99sch/nav Schoenitz, M., and Navrotsky, A., 1999, Enthalpy of Formation of Katoite Ca3Al2[(OH)4]3: Energetics of the Hydrogarnet Substitution. American Mineralogist, v. 84, p.389-391 # 99wan/tes Wang F., and Tessier A., 1999. Cadmium Complexation with Bisulfide. Environ. Sci. Technol., 33, p. 4270 4277. # 99yun/glu Yungman V.S., and Glusko V.P., 1999. Thermal constants of substances. Wiley, Begell House, New York. # CODATA87 Garvin D., Parker V.B and White H.J., 1987. CODATA Series on Thermodynamic Properties, Hemisphere, Washington, DC. # NIST46.4 NIST (1997) Critical stability constants of metal complexes database, NIST Standard Reference Database 46, v4.0. Website: http://www.nist.gov/srd/nist46.htm # Piantone, pers. Comm.Piantone, pers. Comm., 2005 # slop98 GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University. # unp unpublished data # 18bla/bur Blanc, P., Burnol, A., Marty, N., Hellal, J., Guerin, V., Laperche, V., 2018. Methylmercury complexes: Selection of thermodynamic properties and application to the modelling of a column experiment. Science of The Total Environment 621, 368-375. # 18las/bla Lassin, A., Blanc, P., 2018. Thermoddem : selection des proprietes thermodynamiques des complexes aqueux et des mineraux porteurs de zinc, p. 42. # 14aki/tag Akinfiev, N., Tagirov, B., 2014. Zn in hydrothermal systems: thermodynamic description of hydroxide, chloride, and hydrosulfide complexes. Geochemistry International 52, 197-214. # 12liu/bor Liu, W., Borg, S., Etschmann, B., Mei, Y., Brugger, J., 2012. An XAS study of speciation and thermodynamic properties of aqueous zinc bromide complexes at 25-150 C. Chemical Geology 298, 57-69. # 13pow/bro Powell, K.J., Brown, P.L., Byrne, R.H., Gajda, T., Hefter, G., Leuz, A.-K., Sjoberg, S., Wanner, H., 2013. Chemical speciation of environmentally significant metals with inorganic ligands. Part 5: The Zn2++ OH-, Cl-, CO32-, SO42-, and PO43-systems (IUPAC Technical Report). Pure and Applied Chemistry 85, 2249-2311. # 19gai/bla Gailhanou, H., Blanc, P., Rogez, J., Mikaelian, G., Kawaji, H., Olives, J., Montouillout, V., Greneche, J.M., Vieillard, P., Gaucher, E.C., Fialips, C.I., Made, B., 2019. Thermodynamic properties of mixed-layer illite-smectite by calorimetric methods: Acquisition of the enthalpies of mixing of illite and smectite layers. The Journal of Chemical Thermodynamics 138, 78-97. # 18roo/vie Roosz, C., Vieillard, P., Blanc, P., Gaboreau, S., Gailhanou, H., Braithwaite, D., Montouillout, V., Denoyel, R., Henocq, P., Made, B., 2018. Thermodynamic properties of C-S-H, C-A-S-H and M-S-H phases: Results from direct measurements and predictive modelling. Applied Geochemistry 92, 140-156. # 19bla/lac Blanc, P., Lach, A., Guignot, S., 2019. Mineralogy and suitability of materials for geopolymer production. Brgm, p. 61. # 99lan Europe, C.S.G.T., 1999. Thermodynamic Properties of Compounds, NdBr3 to SnBr4. Pure Substances. Part 2 _ Compounds from BeBr_g to ZrCl2_g, 125-150. # 18sch/kre Scharrer, M., Kreissl, S., Markl, G., 2018. The mineralogical variability of hydrothermal native element bearing arsenide (Ag-Co-Ni-As-Bi ) mineralisations, Geosymposium of Quenstedt-Jahresfeier 2018, Tubingen, Germany END