max/iphreeqc
1
0
Fork 0
mirror of https://git.gfz-potsdam.de/naaice/iphreeqc.git synced 2025-12-15 16:18:22 +01:00
Code Issues Packages Projects Releases Wiki Activity
iphreeqc/OtherDatabases/PKDLM_BRGM_database_phreeqc_ThermoddemV1.10_06Jun2017.dat
Darth Vader d17a0c7767 Squashed 'database/' changes from 24d2c771..9e8d773e 
9e8d773e Merge pull request #74 from mwtoews/fix-typos
dc8e003f Fix typos

git-subtree-dir: database
git-subtree-split: 9e8d773e18b9bbd8517b340061d6f509515fa019
2024-10-08 20:05:49 +00:00

12845 lines
668 KiB
Plaintext
Raw Blame History

#####PHREEQC database based on the thesis of M. CHERIF
##### (Cherif 2017 )Modélisation dynamique de la (bio)disponibilité des radionucléides dans les sols : approche comparative modèles-expériences appliquée au transfert de césium dans la rhizosphère
#####(Cherif 2017) A robust and parsimonious model for caesium sorption on clay minerals and natural clay materials.
SURFACE_MASTER_SPECIES # master species (like for species in solution)
Illitex IllitexOH+0.5
Montx MontxOH+0.5
Kaolinitex KaolinitexOH+0.5
SURFACE_SPECIES # list of chemical reactions (like for species in solution)
################# illite
IllitexOH+0.5 = IllitexOH+0.5
Log_k 0.0
IllitexOH+0.5 = IllitexO-0.5 + H+
Log_k -3.46
IllitexOH+0.5 + Cs+ = IllitexOCs+0.5 + H+
Log_k 5.2
IllitexOH+0.5 + Na+ = IllitexONa+0.5 + H+
Log_k -1.8
IllitexOH+0.5 + K+ = IllitexOK+0.5 + H+
Log_k 0.6
IllitexOH+0.5 + Ca+2 = IllitexOCa+1.5 + H+
Log_k -5
IllitexOH+0.5 + NH4+ = IllitexONH4+0.5 + H+
Log_k 1.5
################### montmorillonite_SOH
MontxOH+0.5 = MontxOH+0.5
Log_k 0.0
MontxOH+0.5 = MontxO-0.5 + H+
Log_k -3.4
MontxOH+0.5 + Cs+ = MontxOCs+0.5 + H+
Log_k 4.3
MontxOH+0.5 + Na+ = MontxONa+0.5 + H+
Log_k -1.3
MontxOH+0.5 + Ca+2 = MontxOCa+1.5 + H+
Log_k -1.4
MontxOH+0.5 + K+ = MontxOK+0.5 + H+
Log_k 0.1
#MontxOH+0.5 + NH4+ = MontxONH4+0.5 + H+
#Log_k 0.1
############## kaolinite_SOH
KaolinitexOH+0.5 = KaolinitexOH+0.5
Log_k 0.0
KaolinitexOH+0.5 = KaolinitexO-0.5 + H+
Log_k -4.36
KaolinitexOH+0.5 + Cs+ = KaolinitexOCs+0.5 + H+
Log_k 1.8
KaolinitexOH+0.5 + Na+ = KaolinitexONa+0.5 + H+
Log_k -4.15
KaolinitexOH+0.5 + K+ = KaolinitexOK+0.5 + H+
Log_k -1.6
KaolinitexOH+0.5 + NH4+ = KaolinitexONH4+0.5 + H+
Log_k -1.6
KaolinitexOH+0.5 + Ca+2 = KaolinitexOCa+1.5 + H+
Log_k -5.9
EXCHANGE_MASTER_SPECIES
Illi Illi- # Illite
Mont Mont- #Montmorillionite
Kao Kao- # Kaolinite
#M_o M_o- #M.O
EXCHANGE_SPECIES
#### Illite
Illi- = Illi-
Log_k 0
Ca+2 + 2Illi- = CaIlli2
Log_k 0
Cs+ + Illi- = CsIlli
Log_k 2.6
K+ + Illi- = KIlli
Log_k 1.65
Mg+2 + 2Illi- = MgIlli2
Log_k 0
Na+ + Illi- = NaIlli
Log_k 0.15
#### Montmorillionite
Mont- = Mont-
Log_k 0
Ca+2 + 2Mont- = CaMont2
Log_k 0
Cs+ + Mont- = CsMont
Log_k 0.85
K+ + Mont- = KMont
Log_k 0.05
Mg+2 + 2Mont- = MgMont2
Log_k -0.75
Na+ + Mont- = NaMont
Log_k -0.54
#### Kaolinite
Kao- = Kao-
Log_k 0
Ca+2 + 2Kao- = CaKao2
Log_k 0
Cs+ + Kao- = CsKao
Log_k 2.245
K+ + Kao- = KKao
Log_k 0.145
Na+ + Kao- = NaKao
Log_k 0.145
### M.O
#M_o- = M_o-
#Log_k 0
#Ca+2 + 2M_o- = CaM_o2
#Log_k -1
#K+ + M_o- = KM_o
#log_k 2
#Na+ + M_o- = NaM_o
#Log_k 1
#Mg+2 + 2M_o- = MgM_o2
#Log_k 0
# PHREEQC database
# Base de Donnee Thermoddem_MAJ2016_final6d
# Version V1.10
# BDD Date : 6/6/2017 6:13:45 PM
# Converted on 6/6/2017 6:15:22 PM by ThermoBridge 1.0.3.1
# Data from Thermoddem V1.10 Code version 1.07_2.06
# Thermochemical Database
# from the BRGM institute (french geological survey)
# The database is regularly updated. Kindly send comments or
# corrections to the Thermoddem team
LLNL_AQUEOUS_MODEL_PARAMETERS
-temperatures
0.0000 25.0000 60.0000 100.0000
150.0000 200.0000 250.0000 300.0000
#debye huckel a (adh)
-dh_a
0.4901 0.5095 0.5450 0.5986
0.6867 0.8046 0.9710 1.2414
#debye huckel b (bdh)
-dh_b
0.3245 0.3284 0.3343 0.3420
0.3528 0.3647 0.3782 0.3950
#bdot (bdot)
-bdot
0.0374 0.0410 0.0438 0.0460
0.0470 0.0470 0.0340 0.0000
#cco2 (coefficients for the Drummond (1981) polynomial)
-co2_coefs
-1.0312 0.0012806
255.9 0.4445
-0.00161
NAMED_EXPRESSIONS
#
# formation of O2 from H2O
# 2H2O = O2 + 4H+ + 4e-
#
Log_K_O2
log_k -85.989
delta_H 559.524 kJ/mol
#
-analytic 1.663E+2 2.28432E-2 -3.9534E+4 -5.46895E+1 7.84351E+5
SOLUTION_MASTER_SPECIES
#element species alk gfw_formula element_gfw
Alkalinity HCO3- 1 Ca0.5(CO3)0.5 50.05
E e- 0 0 0
Ag Ag+ 0 Ag 107.868
Ag(1) Ag+ 0 Ag 107.868
Ag(2) Ag+2 0 Ag 107.868
Al Al+3 0 Al 26.982
Ar Ar 0 Ar 39.948
As H2AsO4- 0 As 74.922
As(-3) AsH3 0 As 74.922
As(3) H2AsO3- 1 As 74.922
As(5) H2AsO4- 0 As 74.922
Au Au+ -1 Au 196.967
Au(1) Au+ -1 Au 196.967
Au(3) Au+3 0 Au 196.967
B B(OH)3 0 B 10.811
Ba Ba+2 0 Ba 137.34
Be Be+2 0 Be 9.012
Bi Bi+3 -2 Bi 208.98
Br Br- 0 Br 79.904
Br(-1) Br- 0 Br 79.904
Br(-0.3) Br3- 0 Br 79.904
Br(1) BrO- 1 Br 79.904
Br(5) BrO3- 0 Br 79.904
Br(7) BrO4- 0 Br 79.904
C HCO3- 1 C 12.011
C(-4) CH4 0 C 12.011
C(2) CO 0 C 12.011
C(4) HCO3- 1 C 12.011
Ca Ca+2 0 Ca 40.078
Cd Cd+2 0 Cd 112.41
Ce Ce+3 0 Ce 140.12
Ce(2) Ce+2 0 Ce 140.12
Ce(3) Ce+3 0 Ce 140.12
Ce(4) Ce+4 0 Ce 140.12
Cl Cl- 0 Cl 35.452
Cl(-1) Cl- 0 Cl 35.452
Cl(1) ClO- 1 Cl 35.452
Cl(3) ClO2- 0 Cl 35.452
Cl(4) ClO2 0 Cl 35.452
Cl(5) ClO3- 0 Cl 35.452
Cl(7) ClO4- 0 Cl 35.452
Co Co+2 0 Co 58.933
Co(2) Co+2 0 Co 58.933
Cr CrO4-2 1 Cr 51.966
Cr(2) Cr+2 0 Cr 51.966
Cr(3) Cr+3 -1 Cr 51.966
Cr(6) CrO4-2 1 Cr 51.966
Cs Cs+ 0 Cs 132.905
Cu Cu+2 0 Cu 63.546
Cu(1) Cu+ 0 Cu 63.546
Cu(2) Cu+2 0 Cu 63.546
Dy Dy+3 0 Dy 162.5
Dy(2) Dy+2 0 Dy 162.5
Dy(3) Dy+3 0 Dy 162.5
Dy(4) Dy+4 0 Dy 162.5
Er Er+3 0 Er 167.26
Er(2) Er+2 0 Er 167.26
Er(3) Er+3 0 Er 167.26
Er(4) Er+4 0 Er 167.26
Eu Eu+3 0 Eu 151.964
Eu(2) Eu+2 0 Eu 151.964
Eu(3) Eu+3 0 Eu 151.964
Eu(4) Eu+4 0 Eu 151.964
F F- 0 F 18.998
Fe Fe+2 0 Fe 55.847
Fe(2) Fe+2 0 Fe 55.847
Fe(3) Fe+3 -2 Fe 55.847
Fr Fr+ 0 Fr 223.02
Ga Ga+3 -4 Ga 69.723
Gd Gd+3 0 Gd 157.25
Gd(2) Gd+2 0 Gd 157.25
Gd(3) Gd+3 0 Gd 157.25
Gd(4) Gd+4 0 Gd 157.25
Ge Ge(OH)4 0 Ge 72.61
H H+ -1 H 1.008
H(0) H2 0 H 1.008
H(1) H+ -1 H 1.008
He He 0 He 4.003
Hf Hf+4 -3 Hf 178.49
Hg Hg+2 -2 Hg 200.59
Hg(0) Hg 0 Hg 200.59
Hg(1) Hg2+2 0 Hg 200.59
Hg(2) Hg+2 -2 Hg 200.59
Ho Ho+3 0 Ho 164.93
Ho(2) Ho+2 0 Ho 164.93
Ho(3) Ho+3 0 Ho 164.93
Ho(4) Ho+4 0 Ho 164.93
I I- 0 I 126.904
I(-1) I- 0 I 126.904
I(-0.3) I3- 0 I 126.904
I(1) IO- 0 I 126.904
I(5) IO3- 0 I 126.904
I(7) IO4- 0 I 126.904
In In+3 -2 In 114.82
K K+ 0 K 39.098
Kr Kr 0 Kr 83.8
La La+3 0 La 138.906
La(2) La+2 0 La 138.906
La(3) La+3 0 La 138.906
Li Li+ 0 Li 6.941
Lu Lu+3 0 Lu 174.967
Lu(3) Lu+3 0 Lu 174.967
Lu(4) Lu+4 0 Lu 174.967
Mg Mg+2 0 Mg 24.305
Mn Mn+2 0 Mn 54.938
Mn(2) Mn+2 0 Mn 54.938
Mn(3) Mn+3 0 Mn 54.938
Mn(6) MnO4-2 0 Mn 54.938
Mn(7) MnO4- 0 Mn 54.938
Mo MoO4-2 0 Mo 95.94
N NH3 1 N 14.007
N(-5) CN- 1 N 14.007
N(-3) NH3 1 N 14.007
N(0) N2 0 N 14.007
N(3) NO2- 0 N 14.007
N(5) NO3- 0 N 14.007
Na Na+ 0 Na 22.99
Nb NbO3- 1 Nb 92.906
Nd Nd+3 0 Nd 144.24
Nd(2) Nd+2 0 Nd 144.24
Nd(3) Nd+3 0 Nd 144.24
Nd(4) Nd+4 0 Nd 144.24
Ne Ne 0 Ne 20.18
Ni Ni+2 0 Ni 58.693
O H2O 0 O 15.999
O(-2) H2O 0 O 15.999
O(0) O2 0 O 15.999
P H2PO4- 0 P 30.974
P(-3) PH3 0 P 30.974
P(2) H2PO2- 0 P 30.974
P(3) H2PO3- 0 P 30.974
P(5) H2PO4- 0 P 30.974
Pb Pb+2 0 Pb 207.2
Pd Pd+2 -2 Pd 106.42
Pm Pm+3 0 Pm 144.913
Pm(2) Pm+2 0 Pm 144.913
Pm(3) Pm+3 0 Pm 144.913
Pm(4) Pm+4 0 Pm 144.913
Pr Pr+3 0 Pr 140.908
Pr(2) Pr+2 0 Pr 140.908
Pr(3) Pr+3 0 Pr 140.908
Pr(4) Pr+4 0 Pr 140.908
Pt Pt+2 -2 Pt 195.08
Ra Ra+2 0 Ra 226.025
Rb Rb+ 0 Rb 85.468
Re ReO4- 0 Re 186.27
Rh Rh+2 0 Rh 102.906
Rh(2) Rh+2 0 Rh 102.906
Rh(3) Rh+3 -2 Rh 102.906
Rn Rn 0 Rn 222.018
Ru RuO4-2 0 Ru 101.07
Ru(2) Ru+2 0 Ru 101.07
Ru(3) Ru+3 -2 Ru 101.07
Ru(6) RuO4-2 0 Ru 101.07
S SO4-2 0 S 32.066
S(-2) HS- 1 S 32.066
S(2) S2O3-2 0 S 32.066
S(3) S2O4-2 0 S 32.066
S(4) SO3-2 1 S 32.066
S(5) S2O6-2 0 S 32.066
S(6) SO4-2 0 S 32.066
S(7) S2O8-2 0 S 32.066
S(8) HSO5- 0 S 32.066
Sb Sb(OH)3 0 Sb 121.76
Sc Sc+3 0 Sc 44.956
Se SeO3-2 1 Se 78.96
Se(-2) HSe- 0 Se 78.96
Se(4) SeO3-2 1 Se 78.96
Se(6) SeO4-2 0 Se 78.96
Si H4SiO4 0 Si 28.086
Sm Sm+3 0 Sm 150.36
Sm(2) Sm+2 0 Sm 150.36
Sm(3) Sm+3 0 Sm 150.36
Sm(4) Sm+4 0 Sm 150.36
Sn Sn+2 -2 Sn 118.71
Sr Sr+2 0 Sr 87.62
Tb Tb+3 0 Tb 158.925
Tb(2) Tb+2 0 Tb 158.925
Tb(3) Tb+3 0 Tb 158.925
Tb(4) Tb+4 0 Tb 158.925
Tc TcO4- 0 Tc 97.907
Th Th+4 0 Th 232.038
Ti Ti(OH)4 0 Ti 47.87
Tl Tl+ -1 Tl 204.383
Tl(1) Tl+ -1 Tl 204.383
Tl(3) Tl+3 -3 Tl 204.383
Tm Tm+3 0 Tm 168.934
Tm(2) Tm+2 0 Tm 168.934
Tm(3) Tm+3 0 Tm 168.934
Tm(4) Tm+4 0 Tm 168.934
U UO2+2 0 U 238.029
U(3) U+3 0 U 238.029
U(4) U+4 -4 U 238.029
U(5) UO2+ 0 U 238.029
U(6) UO2+2 0 U 238.029
V VO+2 0 V 50.942
V(2) V+2 0 V 50.942
V(3) V+3 -2 V 50.942
V(4) VO+2 0 V 50.942
V(5) VO2+ -2 V 50.942
W WO4-2 0 W 183.84
Xe Xe 0 Xe 131.29
Y Y+3 0 Y 88.906
Yb Yb+3 0 Yb 173.04
Yb(2) Yb+2 0 Yb 173.04
Yb(3) Yb+3 0 Yb 173.04
Yb(4) Yb+4 0 Yb 173.04
Zn Zn+2 0 Zn 65.39
Zr ZrO+2 -1 Zr 91.224
SOLUTION_SPECIES
1.000H2O = H2O
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; V°: Default value;
1.000H+ = H+
-llnl_gamma 9.0
log_k 0.000
1.000e- = e-
-llnl_gamma 3.6
log_k 0.000
#References = S°: 89cox/wag; V°: Default value;
1.000Al+3 = Al+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 06bla/pia; DHf/DHr: 89cox/wag; S°: Internal calculation; Cp: 95pok/hel; V°: 95pok/hel;
1.000Ar = Ar
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000B(OH)3 = B(OH)3
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch;
1.000Ba+2 = Ba+2
-llnl_gamma 5.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Be+2 = Be+2
-llnl_gamma 8.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Bi+3 = Bi+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ca+2 = Ca+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cd+2 = Cd+2
-llnl_gamma 5.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cs+ = Cs+
-llnl_gamma 2.5
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000F- = F-
-llnl_gamma 3.5
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Fr+ = Fr+
-llnl_gamma 4.1
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ga+3 = Ga+3
-llnl_gamma 4.5
log_k 0.000
#References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia;
1.000Ge(OH)4 = Ge(OH)4
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 05pok/rou; DHf/DHr: Internal calculation; S°: 05pok/rou; Cp: 05pok/rou; V°: 05pok/rou;
1.000H4SiO4 = H4SiO4
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 06bla/pia; V°: Default value;
1.000He = He
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000Hf+4 = Hf+4
-llnl_gamma 11.6
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000In+3 = In+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000K+ = K+
-llnl_gamma 3.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Kr = Kr
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000Li+ = Li+
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Mg+2 = Mg+2
-llnl_gamma 6.5
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000MoO4-2 = MoO4-2
-llnl_gamma 4.5
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Na+ = Na+
-llnl_gamma 4.2
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000NbO3- = NbO3-
-llnl_gamma 3.6
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ne = Ne
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000Ni+2 = Ni+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 10pal/gam; S°: 10pal/gam; Cp: 97asho/sas; V°: 97asho/sas;
1.000Pb+2 = Pb+2
-llnl_gamma 4.5
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Pd+2 = Pd+2
-llnl_gamma 5.7
log_k 0.000
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pt+2 = Pt+2
-llnl_gamma 5.7
log_k 0.000
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ra+2 = Ra+2
-llnl_gamma 5.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Rb+ = Rb+
-llnl_gamma 2.5
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000ReO4- = ReO4-
-llnl_gamma 3.6
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Rn = Rn
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000Sb(OH)3 = Sb(OH)3
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi;
1.000Sc+3 = Sc+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Sn+2 = Sn+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Sr+2 = Sr+2
-llnl_gamma 5.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000TcO4- = TcO4-
-llnl_gamma 3.6
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Th+4 = Th+4
-llnl_gamma 11.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ti(OH)4 = Ti(OH)4
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 01ste; DHf/DHr: Internal calculation; S°: 01ste; Cp: 01ste; V°: 01ste;
1.000WO4-2 = WO4-2
-llnl_gamma 5.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Xe = Xe
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000Y+3 = Y+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Zn+2 = Zn+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000ZrO+2 = ZrO+2
-llnl_gamma 5.7
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ag+ = Ag+
-llnl_gamma 2.5
log_k 0.000
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Au+ = Au+
-llnl_gamma 4.1
log_k 0.000
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Br- = Br-
-llnl_gamma 3.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ce+3 = Ce+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- = Cl-
-llnl_gamma 3.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Co+2 = Co+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 98ply/zha; S°: 98ply/zha; Cp: 97asho/sas; V°: 97asho/sas;
1.000CrO4-2 = CrO4-2
-llnl_gamma 4.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cu+2 = Cu+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: 89cox/wag; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Dy+3 = Dy+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Er+3 = Er+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Eu+3 = Eu+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Fe+2 = Fe+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: 95par/kho; DHf/DHr: 95par/kho; S°: Internal calculation; Cp: 88sho/hel,85hel,89bsho/hel,97asho/sas; V°: 88sho/hel,85hel,89bsho/hel,97asho/sas;
1.000Gd+3 = Gd+3
-llnl_gamma 4.5
log_k 0.000
#References = LogK/DGf: 00deb/cas; DHf/DHr: Internal calculation; S°: 00deb/cas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2AsO4- = H2AsO4-
-llnl_gamma 3.6
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2PO4- = H2PO4-
-llnl_gamma 4.2
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000HCO3- = HCO3-
-llnl_gamma 4.2
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hg+2 = Hg+2
-llnl_gamma 5.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 88sho/hel; V°: 88sho/hel;
1.000Ho+3 = Ho+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000I- = I-
-llnl_gamma 3.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000La+3 = La+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Lu+3 = Lu+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Mn+2 = Mn+2
-llnl_gamma 6.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Nd+3 = Nd+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000NH3 = NH3
-llnl_gamma 3.4
log_k 0.000
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000Pm+3 = Pm+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Pr+3 = Pr+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Rh+2 = Rh+2
-llnl_gamma 5.7
log_k 0.000
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000RuO4-2 = RuO4-2
-llnl_gamma 4.7
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000SeO3-2 = SeO3-2
-llnl_gamma 4.7
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Sm+3 = Sm+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000SO4-2 = SO4-2
-llnl_gamma 4.0
log_k 0.000
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Tb+3 = Tb+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Tl+ = Tl+
-llnl_gamma 2.5
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Tm+3 = Tm+3
-llnl_gamma 8.2
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000UO2+2 = UO2+2
-llnl_gamma 5.7
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000VO+2 = VO+2
-llnl_gamma 5.7
log_k 0.000
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Yb+3 = Yb+3
-llnl_gamma 9.0
log_k 0.000
#References = LogK/DGf: 00deb/cas; DHf/DHr: Internal calculation; S°: 00deb/cas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000Ag+ + 1.000H+ = Ag+2 + 0.500H2O
-llnl_gamma 5.7
log_k -12.128
delta_h 23.455 #kJ/mol #88sho/hel
-analytic -1.9545242E+2 -3.567574E-2 8.4215763E+3 6.9552741E+1 -5.67903E+5
#References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel;
1.000H2AsO4- + 1.000H+ = AsH3 + 2.000O2
-llnl_gamma 3.4
log_k -155.192
delta_h 953.551 #kJ/mol #Internal calculation
-analytic 1.0159238E+3 1.6805983E-1 -1.0965093E+5 -3.6367194E+2 4.1273705E+6
#References = LogK/DGf: 92wol; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
0.500O2 + 1.000Au+ + 2.000H+ = Au+3 + 1.000H2O
-llnl_gamma 8.2
log_k -4.358
delta_h -59.461 #kJ/mol #97asho/sas
-analytic -4.5876162E+2 -7.4638795E-2 2.6557937E+4 1.6273978E+2 -1.342931E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500O2 + 3.000Br- + 2.000H+ = Br3- + 1.000H2O
-llnl_gamma 3.6
log_k 7.063
delta_h -45.557 #kJ/mol #88sho/hel
-analytic 1.3830453E+3 2.2559836E-1 -7.4051421E+4 -5.0402367E+2 4.6489958E+6
#References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel;
0.500O2 + 1.000Br- = BrO-
-llnl_gamma 3.6
log_k -10.916
delta_h 33.468 #kJ/mol #97asho/sas
-analytic -1.2104679E+2 -1.7516604E-2 5.9244002E+3 4.1227992E+1 -5.8077025E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.500O2 + 1.000Br- = BrO3-
-llnl_gamma 3.5
log_k -17.143
delta_h 72.640 #kJ/mol #97asho/sas
-analytic -1.8193567E+2 -2.9510373E-2 9.4047169E+3 6.263996E+1 -1.1512394E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000O2 + 1.000Br- = BrO4-
-llnl_gamma 3.6
log_k -33.102
delta_h 158.659 #kJ/mol #97asho/sas
-analytic -1.9678394E+2 -3.302956E-2 6.1026295E+3 6.766923E+1 -1.2784539E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ce+3 + 0.500H2O = Ce+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -85.049
delta_h 546.025 #kJ/mol #97asho/sas
-analytic 2.8079839E+2 4.6296401E-2 -4.4215047E+4 -9.8299823E+1 1.0564236E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000Ce+3 + 1.000H+ = Ce+4 + 0.500H2O
-llnl_gamma 11.0
log_k -8.043
delta_h -15.531 #kJ/mol #97asho/sas
-analytic -9.12074E+1 -1.6510454E-2 1.8397086E+3 3.1983392E+1 2.467589E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000HCO3- + 1.000H+ + 1.000H2O = CH4 + 2.000O2
-llnl_gamma 3.4
log_k -144.118
delta_h 863.586 #kJ/mol #01sch/sho
-analytic 1.1089192E+3 1.7911561E-1 -1.1128796E+5 -3.9785644E+2 4.5594397E+6
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
0.500O2 + 1.000Cl- = ClO-
-llnl_gamma 3.6
log_k -15.088
delta_h 65.482 #kJ/mol #97asho/sas
-analytic -1.2718224E+2 -1.75488E-2 4.9174306E+3 4.363286E+1 -6.3414787E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.250O2 + 1.000Cl- + 1.000H+ = ClO2 + 0.500H2O
-llnl_gamma 3.4
log_k -19.629
delta_h 114.140 #kJ/mol #01sch/sho
-analytic 1.8317231E+2 4.4104676E-2 -1.0240138E+4 -7.2560388E+1 -1.831063E+5
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
1.000O2 + 1.000Cl- = ClO2-
-llnl_gamma 4.2
log_k -23.095
delta_h 112.653 #kJ/mol #97asho/sas
-analytic -1.6180803E+2 -2.4105525E-2 5.1854867E+3 5.5981597E+1 -8.9022279E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.500O2 + 1.000Cl- = ClO3-
-llnl_gamma 3.5
log_k -17.247
delta_h 81.246 #kJ/mol #97asho/sas
-analytic -1.7354285E+2 -2.7188036E-2 8.414888E+3 5.9993829E+1 -1.090942E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000O2 + 1.000Cl- = ClO4-
-llnl_gamma 3.5
log_k -15.695
delta_h 62.602 #kJ/mol #89cox/wag
-analytic -2.6467008E+2 -4.0305028E-2 1.5479728E+4 9.1600645E+1 -1.56335E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000HCO3- + 1.000NH3 = CN- + 0.500O2 + 2.000H2O
-llnl_gamma 3.0
log_k -56.049
delta_h 344.462 #kJ/mol #97asho/sas
-analytic 1.6302091E+2 2.3952878E-2 -2.8712128E+4 -5.6276591E+1 8.3044551E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000HCO3- + 1.000H+ = CO + 0.500O2 + 1.000H2O
-llnl_gamma 3.4
log_k -41.718
delta_h 277.073 #kJ/mol #93sho/mck, 01sch/sho
-analytic 8.746106E+2 1.4252797E-1 -6.5750756E+4 -3.1413793E+2 3.4685499E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 93sho/mck, 01sch/sho; S°: 82wag/eva; Cp: 93sho/mck, 01sch/sho; V°: 93sho/mck, 01sch/sho;
1.000CrO4-2 + 4.000H+ = Cr+2 + 1.000O2 + 2.000H2O
-llnl_gamma 5.7
log_k -18.752
delta_h 137.506 #kJ/mol #04chi
-analytic 1.1571011E+3 1.9229541E-1 -7.4152807E+4 -4.1812509E+2 4.4577016E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000CrO4-2 + 5.000H+ = Cr+3 + 0.750O2 + 2.500H2O
-llnl_gamma 9.0
log_k 9.124
delta_h -85.176 #kJ/mol #04chi
-analytic 9.417606E+2 1.5606615E-1 -5.1484286E+4 -3.4311234E+2 3.7798299E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cu+2 + 0.500H2O = Cu+ + 0.250O2 + 1.000H+
-llnl_gamma 4.1
log_k -18.664
delta_h 145.276 #kJ/mol #Internal calculation
-analytic 2.5350816E+2 4.0507587E-2 -2.1379261E+4 -8.9803E+1 8.5944041E+5
#References = LogK/DGf: 95bev/pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97asho/sas; V°: 97asho/sas;
1.000Dy+3 + 0.500H2O = Dy+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -62.472
delta_h 418.654 #kJ/mol #97asho/sas
-analytic 2.4185668E+2 4.0042984E-2 -3.4676181E+4 -8.4491811E+1 8.0949201E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000Dy+3 + 1.000H+ = Dy+4 + 0.500H2O
-llnl_gamma 11.6
log_k -54.002
delta_h 249.675 #kJ/mol #97asho/sas
-analytic -1.1901749E+2 -2.1139467E-2 -9.5987444E+3 4.1769656E+1 1.3871274E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Er+3 + 0.500H2O = Er+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -71.561
delta_h 472.033 #kJ/mol #97asho/sas
-analytic 2.4851675E+2 4.1004154E-2 -3.7974416E+4 -8.6710913E+1 8.5549067E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000Er+3 + 1.000H+ = Er+4 + 0.500H2O
-llnl_gamma 11.6
log_k -75.113
delta_h 373.168 #kJ/mol #97asho/sas
-analytic -1.1417897E+2 -2.0370401E-2 -1.6385901E+4 4.0248554E+1 4.4963541E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Eu+3 + 0.500H2O = Eu+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -27.435
delta_h 217.412 #kJ/mol #97asho/sas
-analytic 2.5415948E+2 4.1772209E-2 -2.5139226E+4 -8.8824245E+1 8.9415907E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000Eu+3 + 1.000H+ = Eu+4 + 0.500H2O
-llnl_gamma 11.6
log_k -82.809
delta_h 412.235 #kJ/mol #97asho/sas
-analytic -1.127134E+2 -2.0259799E-2 -1.8757949E+4 3.9575168E+1 8.2924517E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000Fe+2 + 1.000H+ = Fe+3 + 0.500H2O
-llnl_gamma 9.0
log_k 8.489
delta_h -98.882 #kJ/mol #95par/kho
-analytic -2.0405398E+2 -3.4037294E-2 1.5615559E+4 7.1674877E+1 -6.2565545E+5
#References = LogK/DGf: 95par/kho; DHf/DHr: 95par/kho; S°: Internal calculation; Cp: 88sho/hel,89bsho/hel,97asho/sas; V°: 88sho/hel,89bsho/hel,97asho/sas;
1.000Gd+3 + 0.500H2O = Gd+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -86.376
delta_h 547.321 #kJ/mol #97asho/sas
-analytic 2.5024202E+2 4.1272782E-2 -4.2216249E+4 -8.7807587E+1 8.8400708E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000Gd+3 + 1.000H+ = Gd+4 + 0.500H2O
-llnl_gamma 11.6
log_k -104.368
delta_h 525.766 #kJ/mol #97asho/sas
-analytic -1.1663602E+2 -2.0890525E-2 -2.4510331E+4 4.0407056E+1 6.4033712E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2O = H2 + 0.500O2
-CO2_llnl_gamma
log_k -46.071
delta_h 275.563 #kJ/mol #82wag/eva
-analytic 1.678481E+2 3.0016048E-2 -2.5153589E+4 -5.9825997E+1 8.4742769E+5
#References = LogK/DGf: 82wag/eva; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000H2AsO4- = H2AsO3- + 0.500O2
-llnl_gamma 3.6
log_k -30.565
delta_h 194.451 #kJ/mol #Internal calculation
-analytic 2.9326992E+2 4.8837651E-2 -2.8918197E+4 -1.0408672E+2 1.4357887E+6
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000H2PO4- = H2PO2- + 1.000O2
-llnl_gamma 3.6
log_k -112.400
delta_h 676.548 #kJ/mol #97asho/sas
-analytic 1.8769966E+2 3.1944258E-2 -4.7396437E+4 -6.5257379E+1 9.6182614E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2PO4- = H2PO3- + 0.500O2
-llnl_gamma 3.6
log_k -52.346
delta_h 327.001 #kJ/mol #97asho/sas
-analytic 1.6598506E+2 2.7516765E-2 -2.7411253E+4 -5.7969715E+1 7.8621384E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hg+2 + 1.000H2O = Hg + 0.500O2 + 2.000H+
-llnl_gamma 3.4
log_k -20.648
delta_h 122.056 #kJ/mol #Internal calculation
-analytic 5.3682508E+2 8.594179E-2 -4.018447E+4 -1.9239623E+2 2.467169E+6
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
2.000Hg+2 + 1.000H2O = Hg2+2 + 0.500O2 + 2.000H+
-llnl_gamma 5.7
log_k -12.201
delta_h 106.213 #kJ/mol #89cox/wag
-analytic 4.1563065E+2 6.3166454E-2 -2.8380355E+4 -1.4830773E+2 1.3779442E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ho+3 + 0.500H2O = Ho+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -68.776
delta_h 452.641 #kJ/mol #97asho/sas
-analytic 2.4568932E+2 4.0689948E-2 -3.6770012E+4 -8.5954791E+1 8.3735341E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Ho+3 = Ho+4 + 0.500H2O
-llnl_gamma 11.6
log_k -74.453
delta_h 365.036 #kJ/mol #97asho/sas
-analytic -1.1652943E+2 -2.0653226E-2 -1.5839935E+4 4.0809201E+1 3.3943026E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H+ + 1.000SO4-2 = HS- + 2.000O2
-llnl_gamma 3.5
log_k -138.287
delta_h 868.772 #kJ/mol #89cox/wag
-analytic 1.0441996E+3 1.6867288E-1 -1.0699902E+5 -3.724144E+2 4.2326691E+6
#References = LogK/DGf: 89cox/wag; DHf/DHr: Internal calculation; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000H+ + 1.000SeO3-2 = HSe- + 1.500O2
-llnl_gamma 3.6
log_k -76.843
delta_h 507.180 #kJ/mol #97asho/sas
-analytic 9.3741229E+2 1.5397729E-1 -8.0713204E+4 -3.3561018E+2 3.6442211E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500O2 + 1.000H+ + 1.000SO4-2 = HSO5-
-llnl_gamma 3.6
log_k -17.206
delta_h 139.702 #kJ/mol #97asho/sas
-analytic 8.9276681E+2 1.4042347E-1 -5.7825399E+4 -3.2083393E+2 3.1992361E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500O2 + 2.000H+ + 3.000I- = I3- + 1.000H2O
-llnl_gamma 3.6
log_k 24.721
delta_h -160.570 #kJ/mol #88sho/hel
-analytic 1.3179538E+3 2.1952817E-1 -6.4111456E+4 -4.8220423E+2 4.4027398E+6
#References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel;
0.500O2 + 1.000I- = IO-
-llnl_gamma 3.6
log_k -0.903
delta_h -44.643 #kJ/mol #97asho/sas
-analytic -1.92196E+2 -2.7455327E-2 1.4161844E+4 6.5360502E+1 -8.6679125E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.500O2 + 1.000I- = IO3-
-llnl_gamma 4.2
log_k 17.682
delta_h -146.163 #kJ/mol #97asho/sas
-analytic -2.516545E+2 -3.9000377E-2 2.4364223E+4 8.6616101E+1 -1.3404516E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000O2 + 1.000I- = IO4-
-llnl_gamma 3.5
log_k 6.964
delta_h -70.413 #kJ/mol #97asho/sas
-analytic -1.9590197E+2 -3.1524516E-2 1.8212346E+4 6.697838E+1 -1.2936913E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000La+3 + 0.500H2O = La+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -84.755
delta_h 547.220 #kJ/mol #97asho/sas
-analytic 2.5090096E+2 4.0755619E-2 -4.2260481E+4 -8.7340105E+1 8.9355822E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Lu+3 = Lu+4 + 0.500H2O
-llnl_gamma 11.6
log_k -115.135
delta_h 603.486 #kJ/mol #97asho/sas
-analytic -1.178367E+2 -2.1093167E-2 -2.8087009E+4 4.1644657E+1 1.3168582E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Mn+2 = Mn+3 + 0.500H2O
-llnl_gamma 8.2
log_k -4.011
delta_h -46.901 #kJ/mol #97asho/sas
-analytic -2.2234346E+2 -3.720933E-2 1.4113871E+4 7.6981715E+1 -7.465544E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.250O2 + 1.000Mn+2 + 1.500H2O = MnO4- + 3.000H+
-llnl_gamma 3.5
log_k -20.211
delta_h 121.692 #kJ/mol #97asho/sas
-analytic -3.597212E+2 -6.3529128E-2 1.6759082E+4 1.3021059E+2 -1.7739534E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000O2 + 1.000Mn+2 + 2.000H2O = MnO4-2 + 4.000H+
-llnl_gamma 4.7
log_k -32.325
delta_h 149.866 #kJ/mol #97asho/sas
-analytic -1.1624501E+3 -1.9323874E-1 5.9725768E+4 4.1963486E+2 -4.5283485E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.500O2 + 2.000NH3 = N2 + 3.000H2O
-llnl_gamma 3.4
log_k 116.439
delta_h -686.530 #kJ/mol #89bsho/hel, 01sch/sho
-analytic 1.3732258E+2 1.1139858E-2 2.6639639E+4 -4.8557772E+1 5.865786E+5
#References = LogK/DGf: 89bsho/hel, 01sch/sho; DHf/DHr: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000Nd+3 + 0.500H2O = Nd+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -65.771
delta_h 434.239 #kJ/mol #97asho/sas
-analytic 2.7277403E+2 4.4517707E-2 -3.7862697E+4 -9.5455702E+1 1.011018E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Nd+3 = Nd+4 + 0.500H2O
-llnl_gamma 11.6
log_k -61.772
delta_h 293.526 #kJ/mol #97asho/sas
-analytic -1.0028691E+2 -1.8225153E-2 -1.3620816E+4 3.5371087E+1 1.8753434E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.500O2 + 1.000NH3 = NO2- + 1.000H+ + 1.000H2O
-llnl_gamma 3.0
log_k 46.859
delta_h -290.816 #kJ/mol #97asho/sas
-analytic -7.5927886E+2 -1.2805697E-1 5.9191879E+4 2.7442778E+2 -2.9571437E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000O2 + 1.000NH3 = NO3- + 1.000H+ + 1.000H2O
-llnl_gamma 3.0
log_k 62.094
delta_h -386.885 #kJ/mol #97asho/sas
-analytic -8.0875831E+2 -1.3670731E-1 6.7677903E+4 2.9149633E+2 -3.2596944E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H2O = O2 + 4.000e- + 4.000H+
-CO2_llnl_gamma
log_k -85.989
delta_h 559.524 #kJ/mol #By convention
-analytic 1.6630014E+2 2.2843205E-2 -3.9533953E+4 -5.4689515E+1 7.8435072E+5
#References = LogK/DGf: Internal calculation; S°: 89bsho/hel, 01sch/sho; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000H+ + 1.000H2PO4- = PH3 + 2.000O2
-llnl_gamma 3.4
log_k -209.461
delta_h 1267.173 #kJ/mol #01sch/sho
-analytic 1.0769588E+3 1.7678148E-1 -1.3003333E+5 -3.8505604E+2 4.427175E+6
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
0.500H2O + 1.000Pm+3 = Pm+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -69.362
delta_h 453.618 #kJ/mol #97asho/sas
-analytic 2.7293959E+2 4.4959869E-2 -3.8905151E+4 -9.5645441E+1 1.0178437E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Pm+3 = Pm+4 + 0.500H2O
-llnl_gamma 11.6
log_k -69.249
delta_h 335.579 #kJ/mol #97asho/sas
-analytic -9.5148213E+1 -1.7093712E-2 -1.6091167E+4 3.3403725E+1 2.0540448E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500H2O + 1.000Pr+3 = Pr+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -72.734
delta_h 476.108 #kJ/mol #97asho/sas
-analytic 2.7112131E+2 4.4675819E-2 -3.9680137E+4 -9.4959911E+1 9.6754566E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Pr+3 = Pr+4 + 0.500H2O
-llnl_gamma 11.6
log_k -44.400
delta_h 195.239 #kJ/mol #97asho/sas
-analytic -1.0071753E+2 -1.7983179E-2 -8.2411833E+3 3.5394915E+1 1.5449648E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Rh+2 = Rh+3 + 0.500H2O
-llnl_gamma 8.2
log_k 3.355
delta_h -71.111 #kJ/mol #97asho/sas,98sas/sho
-analytic -2.1919534E+2 -3.6687252E-2 1.5449654E+4 7.6841782E+1 -7.5287215E+5
#References = LogK/DGf: 97asho/sas,98sas/sho; DHf/DHr: Internal calculation; S°: 97asho/sas,98sas/sho; Cp: 97asho/sas,98sas/sho; V°: 97asho/sas,98sas/sho;
4.000H+ + 1.000RuO4-2 = Ru+2 + 1.000O2 + 2.000H2O
-llnl_gamma 5.7
log_k 1.392
delta_h 24.827 #kJ/mol #98sas/sho
-analytic 1.1618269E+3 1.92855E-1 -6.7651355E+4 -4.2020415E+2 4.3324314E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
5.000H+ + 1.000RuO4-2 = Ru+3 + 0.750O2 + 2.500H2O
-llnl_gamma 8.2
log_k 18.829
delta_h -127.532 #kJ/mol #98sas/sho
-analytic 9.4866694E+2 1.5727663E-1 -4.8624208E+4 -3.4543173E+2 3.653927E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
2.000H+ + 2.000SO4-2 = S2O3-2 + 2.000O2 + 1.000H2O
-llnl_gamma 4.7
log_k -133.414
delta_h 856.296 #kJ/mol #04chi
-analytic 1.7543425E+3 2.8241381E-1 -1.4584847E+5 -6.2953346E+2 6.6633819E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H+ + 2.000SO4-2 = S2O4-2 + 1.500O2 + 1.000H2O
-llnl_gamma 5.0
log_k -118.282
delta_h 761.149 #kJ/mol #04chi
-analytic 1.7105368E+3 2.7439703E-1 -1.3774623E+5 -6.1444789E+2 6.3811047E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H+ + 2.000SO4-2 = S2O6-2 + 0.500O2 + 1.000H2O
-llnl_gamma 4.7
log_k -50.824
delta_h 353.589 #kJ/mol #97asho/sas
-analytic 1.581889E+3 2.5151708E-1 -1.0765268E+5 -5.6979731E+2 5.6263157E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500O2 + 2.000H+ + 2.000SO4-2 = S2O8-2 + 1.000H2O
-llnl_gamma 4.7
log_k -22.380
delta_h 194.179 #kJ/mol #97asho/sas
-analytic 1.5486009E+3 2.4379827E-1 -9.6001833E+4 -5.5802407E+2 5.2550472E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500O2 + 1.000SeO3-2 = SeO4-2
-llnl_gamma 4.7
log_k 13.984
delta_h -83.838 #kJ/mol #97asho/sas
-analytic -6.007863E+1 -1.0501225E-2 8.5380545E+3 2.1214066E+1 -3.4988989E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500H2O + 1.000Sm+3 = Sm+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -47.959
delta_h 326.954 #kJ/mol #97asho/sas
-analytic 2.6489572E+2 4.333311E-2 -3.1981354E+4 -9.2870498E+1 1.0039474E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Sm+3 = Sm+4 + 0.500H2O
-llnl_gamma 11.6
log_k -65.877
delta_h 315.460 #kJ/mol #97asho/sas
-analytic -1.0011292E+2 -1.8166689E-2 -1.4758201E+4 3.5194252E+1 1.8363484E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000SO4-2 = SO3-2 + 0.500O2
-llnl_gamma 4.5
log_k -46.615
delta_h 272.213 #kJ/mol #04chi
-analytic 9.671919E+1 1.4160755E-2 -2.0794683E+4 -3.3793084E+1 5.1632279E+5
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas;
0.500H2O + 1.000Tb+3 = Tb+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -80.211
delta_h 519.284 #kJ/mol #97asho/sas
-analytic 2.5740756E+2 4.260087E-2 -4.0974481E+4 -9.0086045E+1 8.908254E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Tb+3 = Tb+4 + 0.500H2O
-llnl_gamma 11.6
log_k -30.766
delta_h 115.296 #kJ/mol #97asho/sas
-analytic -1.1010325E+2 -1.9543153E-2 -3.2691106E+3 3.8507867E+1 7.4980676E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500O2 + 2.000H+ + 1.000Tl+ = Tl+3 + 1.000H2O
-llnl_gamma 8.2
log_k -0.282
delta_h -88.585 #kJ/mol #Internal calculation
-analytic -4.0815388E+2 -6.7212309E-2 2.4460175E+4 1.4457796E+2 -1.0558311E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500H2O + 1.000Tm+3 = Tm+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -59.833
delta_h 403.343 #kJ/mol #97asho/sas
-analytic 2.4909332E+2 4.1165999E-2 -3.4445075E+4 -8.7029204E+1 8.6023434E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Tm+3 = Tm+4 + 0.500H2O
-llnl_gamma 11.6
log_k -73.647
delta_h 363.428 #kJ/mol #97asho/sas
-analytic -1.138977E+2 -2.025512E-2 -1.5886523E+4 4.0041464E+1 4.3885574E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H+ + 1.000UO2+2 = U+3 + 0.750O2 + 0.500H2O
-llnl_gamma 8.2
log_k -65.060
delta_h 377.959 #kJ/mol #97asho/sas
-analytic -1.10532E+2 -1.4518639E-2 -1.3646509E+4 4.0112255E+1 -3.2744519E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H+ + 1.000UO2+2 = U+4 + 0.500O2 + 1.000H2O
-llnl_gamma 11.6
log_k -33.960
delta_h 136.009 #kJ/mol #97asho/sas
-analytic -2.20067E+2 -3.4137081E-2 1.5178236E+3 7.8294708E+1 -2.258944E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500H2O + 1.000UO2+2 = UO2+ + 0.250O2 + 1.000H+
-llnl_gamma 4.1
log_k -20.024
delta_h 133.821 #kJ/mol #97asho/sas
-analytic 7.6747052E+1 1.4647725E-2 -8.7698994E+3 -2.8561979E+1 -9.3249141E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000VO+2 = V+2 + 0.500O2
-llnl_gamma 5.7
log_k -41.545
delta_h 254.628 #kJ/mol #97asho/sas
-analytic -1.8041743E+0 6.8849232E-4 -1.1973342E+4 8.7119862E-1 -1.7271697E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H+ + 1.000VO+2 = V+3 + 0.250O2 + 0.500H2O
-llnl_gamma 8.2
log_k -15.723
delta_h 79.603 #kJ/mol #97asho/sas
-analytic -1.7305776E+2 -2.7610019E-2 5.6212935E+3 6.2132739E+1 -6.2497713E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 0.500H2O + 1.000VO+2 = VO2+ + 1.000H+
-llnl_gamma 4.1
log_k 4.581
delta_h -17.379 #kJ/mol #97asho/sas
-analytic -1.2416778E+1 -2.7024561E-3 5.3806338E+3 2.854646E+0 -6.4950201E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.500H2O + 1.000Yb+3 = Yb+2 + 0.250O2 + 1.000H+
-llnl_gamma 5.7
log_k -39.298
delta_h 279.889 #kJ/mol #97asho/sas
-analytic 2.4719715E+2 4.082987E-2 -2.8159224E+4 -8.6573955E+1 8.8891177E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.250O2 + 1.000H+ + 1.000Yb+3 = Yb+4 + 0.500H2O
-llnl_gamma 11.6
log_k -93.280
delta_h 473.623 #kJ/mol #97asho/sas
-analytic -1.1118408E+2 -1.9780747E-2 -2.1903921E+4 3.89954E+1 6.9017559E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ag+ + 1.000HCO3- = Ag(CO3)- + 1.000H+
-llnl_gamma 3.6
log_k -7.625
delta_h -7.695 #kJ/mol #97sve/sho
-analytic 8.4652298E+1 7.6902866E-3 -5.337793E+3 -3.2488587E+1 3.3102063E+5
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ag+ + 2.000HCO3- = Ag(CO3)2-3 + 2.000H+
-llnl_gamma 6.7
log_k -18.473
delta_h 1.186 #kJ/mol #97sve/sho
-analytic -4.5906538E+2 -8.6232054E-2 2.0926781E+4 1.650084E+2 -1.0835058E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ag+ + 2.000HS- = Ag(HS)2-
-llnl_gamma 4.5
log_k 17.586
delta_h -101.091 #kJ/mol #01aki/zot
-analytic 1.0878197E+3 1.6776848E-1 -5.5051823E+4 -3.9447471E+2 3.5995886E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Ag+ + 2.000H2O = Ag(OH)2- + 2.000H+
-llnl_gamma 3.6
log_k -24.209
delta_h 93.954 #kJ/mol #01aki/zot
-analytic -4.5566234E+2 -8.2107414E-2 2.0308393E+4 1.6433477E+2 -1.6726703E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Ag+ + 1.000Cl- = AgCl
-llnl_gamma 3.4
log_k 3.272
delta_h -17.432 #kJ/mol #01aki/zot
-analytic 7.1369537E+2 1.1107372E-1 -3.7903391E+4 -2.5933708E+2 2.249134E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Ag+ + 2.000Cl- = AgCl2-
-llnl_gamma 3.6
log_k 5.170
delta_h -23.043 #kJ/mol #01aki/zot, d'apres 97tag/zot
-analytic 1.0064142E+3 1.5935088E-1 -5.3662908E+4 -3.6576586E+2 3.2264161E+6
#References = LogK/DGf: 01aki/zot, d'apres 97tag/zot; DHf/DHr: Internal calculation; S°: 01aki/zot, d'apres 97tag/zot; Cp: 01aki/zot, d'apres 97tag/zot; V°: 01aki/zot, d'apres 97tag/zot;
1.000Ag+ + 3.000Cl- = AgCl3-2
-llnl_gamma 4.7
log_k 5.169
delta_h -46.497 #kJ/mol #97sve/sho
-analytic 8.7084324E+2 1.3956023E-1 -4.8314277E+4 -3.1622045E+2 3.3094295E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ag+ + 4.000Cl- = AgCl4-3
-llnl_gamma 6.7
log_k 3.855
delta_h -67.726 #kJ/mol #97sve/sho
-analytic 8.4377933E+2 1.3674476E-1 -4.7784012E+4 -3.0721551E+2 3.534257E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ag+ + 1.000F- = AgF
-llnl_gamma 3.4
log_k 0.440
delta_h 0.604 #kJ/mol #97sve/sho
-analytic 8.2473024E+2 1.2774339E-1 -4.5563615E+4 -2.9905499E+2 2.7055851E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ag+ + 1.000H2AsO3- = AgH2AsO3
-llnl_gamma 3.4
log_k 1.220
delta_h -12.252 #kJ/mol #Internal calculation
-analytic 5.3646667E+2 7.763305E-2 -2.7629822E+4 -1.9493049E+2 1.4774453E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Ag+ + 1.000HS- = AgHS
-llnl_gamma 3.4
log_k 13.606
delta_h -74.337 #kJ/mol #01aki/zot
-analytic 7.3850076E+2 1.1292081E-1 -3.6606458E+4 -2.6768226E+2 2.3626982E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Ag+ + 1.000NO3- = AgNO3
-llnl_gamma 3.4
log_k -0.251
delta_h -3.135 #kJ/mol #97sve/sho
-analytic 7.2343138E+2 1.0880051E-1 -4.1228559E+4 -2.6135699E+2 2.5664556E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ag+ + 1.000H2O = AgO- + 2.000H+
-llnl_gamma 3.6
log_k -24.006
delta_h 111.633 #kJ/mol #97asho/sas
-analytic -5.2357464E+2 -8.9983563E-2 2.3207407E+4 1.8971913E+2 -1.8568625E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ag+ + 1.000H2O = AgOH + 1.000H+
-llnl_gamma 3.4
log_k -11.898
delta_h 49.628 #kJ/mol #01aki/zot
-analytic 7.5445166E+1 5.7286823E-3 -6.1926939E+3 -2.7927969E+1 7.3375436E+4
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Al+3 + 2.000H2O = Al(OH)2+ + 2.000H+
-llnl_gamma 4.1
log_k -10.589
delta_h 111.289 #kJ/mol #Internal calculation
-analytic 2.5630181E+2 4.7243422E-2 -1.8938185E+4 -9.1587637E+1 8.1513615E+5
#References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 95pok/hel; V°: 95pok/hel;
1.000Al+3 + 1.000H2AsO4- = AlAsO4 + 2.000H+
-llnl_gamma 3.4
log_k -8.064
delta_h 65.458 #kJ/mol #Internal calculation
-analytic 8.0778909E+2 1.3844179E-1 -4.1721382E+4 -2.9797614E+2 1.7892139E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Al+3 + 1.000F- = AlF+2
-llnl_gamma 5.7
log_k 6.980
delta_h -0.345 #kJ/mol #Internal calculation
-analytic 8.4659791E+2 1.3829112E-1 -4.6152597E+4 -3.0616676E+2 2.8034192E+6
#References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch;
1.000Al+3 + 2.000F- = AlF2+
-llnl_gamma 4.1
log_k 12.500
delta_h 0.420 #kJ/mol #Internal calculation
-analytic 1.7120283E+3 2.7760279E-1 -9.3607268E+4 -6.1919505E+2 5.6734062E+6
#References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch;
1.000Al+3 + 3.000F- = AlF3
-llnl_gamma 3.4
log_k 16.550
delta_h 0.615 #kJ/mol #Internal calculation
-analytic 2.5654528E+3 4.1576045E-1 -1.4010996E+5 -9.2872848E+2 8.457982E+6
#References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch;
1.000Al+3 + 4.000F- = AlF4-
-llnl_gamma 3.6
log_k 18.930
delta_h 0.824 #kJ/mol #Internal calculation
-analytic 2.6280395E+3 4.2423282E-1 -1.4521917E+5 -9.4932183E+2 8.9344986E+6
#References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch;
1.000Al+3 + 1.000H2AsO3- = AlH2AsO3+2
-llnl_gamma 5.7
log_k 7.164
delta_h -48.031 #kJ/mol #Internal calculation
-analytic 6.4522251E+2 9.4796064E-2 -3.1633531E+4 -2.3465209E+2 1.8141864E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Al+3 + 1.000H2AsO4- = AlH2AsO4+2
-llnl_gamma 5.7
log_k 2.506
delta_h -19.575 #kJ/mol #Internal calculation
-analytic 8.4061558E+2 1.2760548E-1 -4.602608E+4 -3.0453974E+2 2.825133E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Al+3 + 1.000H2PO4- = AlH2PO4+2
-llnl_gamma 5.7
log_k 3.098
#References = LogK/DGf: 79lan;
#References = LogK/DGf: 79lan; V°: Default value;
1.000Al+3 + 1.000H4SiO4 = AlH3SiO4+2 + 1.000H+
-llnl_gamma 5.7
log_k -2.380
delta_h 77.382 #kJ/mol #Internal calculation
-analytic -3.3132499E+2 -1.8245217E-2 2.6363639E+4 1.1136446E+2 -2.6315445E+6
#References = LogK/DGf: 01tag/sch, d'apres 98sal/pok; DHf/DHr: Internal calculation; S°: 01tag/sch, d'apres 98sal/pok; Cp: 01tag/sch, d'apres 98sal/pok; V°: 01tag/sch, d'apres 98sal/pok;
1.000Al+3 + 1.000H2AsO4- = AlHAsO4+ + 1.000H+
-llnl_gamma 4.1
log_k -0.495
delta_h 11.152 #kJ/mol #Internal calculation
-analytic 7.51768E+2 1.1972157E-1 -3.8060438E+4 -2.7529241E+2 1.857061E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Al+3 + 1.000H2PO4- = AlHPO4+ + 1.000H+
-llnl_gamma 4.1
log_k 0.188
#References = LogK/DGf: 79lan;
#References = LogK/DGf: 79lan; V°: Default value;
1.000Al+3 + 2.000H2O = AlO2- + 4.000H+
-llnl_gamma 3.6
log_k -22.869
delta_h 180.864 #kJ/mol #Internal calculation
-analytic -2.201906E+2 -3.328066E-2 4.1155923E+3 8.2151617E+1 -8.7459815E+5
#References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel;
1.000Al+3 + 1.000H2O = AlOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -4.950
delta_h 49.758 #kJ/mol #Internal calculation
-analytic 1.3920886E+2 2.6837086E-2 -1.0311531E+4 -4.9976575E+1 5.4125401E+5
#References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel;
1.000Al+3 + 1.000SO4-2 = AlSO4+
-llnl_gamma 4.1
log_k 3.170
delta_h 18.869 #kJ/mol #Internal calculation
-analytic 2.319305E+3 3.6143096E-1 -1.3493543E+5 -8.3585849E+2 8.6188682E+6
#References = LogK/DGf: 01tag/sch; DHf/DHr: Internal calculation; S°: 01tag/sch; Cp: 01tag/sch; V°: 01tag/sch;
1.000H2AsO3- + 1.000H+ = As(OH)3
-llnl_gamma 3.4
log_k 9.256
delta_h -28.176 #kJ/mol #Internal calculation
-analytic 1.4914569E+1 1.5860162E-2 4.9992557E+3 -8.7542089E+0 -4.8834429E+5
#References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok;
1.000H2AsO4- + 1.000H+ = AsO(OH)3
-llnl_gamma 3.4
log_k 2.302
delta_h 11.049 #kJ/mol #08per/pok
-analytic 1.6315756E+2 4.0730166E-2 -7.354295E+3 -6.1578557E+1 3.5904024E+5
#References = LogK/DGf: 08per/pok; DHf/DHr: 08per/pok; S°: Internal calculation; Cp: 08per/pok; V°: 08per/pok;
1.000H2AsO4- = AsO4-3 + 2.000H+
-llnl_gamma 6.7
log_k -18.460
delta_h 21.914 #kJ/mol #Internal calculation
-analytic -1.5040938E+3 -2.4299666E-1 8.2186503E+4 5.4182244E+2 -5.1803474E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Au+ + 2.000HS- = Au(HS)2-
-llnl_gamma 3.6
log_k 31.536
delta_h -167.409 #kJ/mol #01aki/zot
-analytic 9.7482705E+2 1.4920336E-1 -4.5421808E+4 -3.5238847E+2 3.2474545E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Au+ + 2.000H2O = Au(OH)2- + 2.000H+
-llnl_gamma 3.6
log_k -5.719
delta_h -13.559 #kJ/mol #01aki/zot
-analytic -3.9162935E+2 -6.8812553E-2 2.3233854E+4 1.3988933E+2 -1.5686842E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Au+ + 1.000Cl- = AuCl
-llnl_gamma 3.4
log_k 7.933
delta_h -30.688 #kJ/mol #01aki/zot
-analytic 6.4840803E+2 1.0323678E-1 -3.2991689E+4 -2.3553665E+2 1.9751493E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Au+ + 2.000Cl- = AuCl2-
-llnl_gamma 3.6
log_k 9.581
delta_h -50.195 #kJ/mol #01aki/zot
-analytic 4.850177E+2 9.8333461E-2 -2.0375966E+4 -1.8189895E+2 1.2163974E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Au+ + 3.000Cl- = AuCl3-2
-llnl_gamma 4.7
log_k 9.328
delta_h -47.873 #kJ/mol #97sve/sho
-analytic 8.3327508E+2 1.3522766E-1 -4.3093387E+4 -3.0328357E+2 2.7313161E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Au+3 + 4.000Cl- = AuCl4-
-llnl_gamma 3.6
log_k -41.913
delta_h 199.282 #kJ/mol #97sve/sho
-analytic 2.3945195E+3 3.9162328E-1 -1.4143708E+5 -8.7562963E+2 7.8115699E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Au+ + 1.000HS- = AuHS
-llnl_gamma 3.4
log_k 26.016
delta_h -134.682 #kJ/mol #01aki/zot
-analytic 8.1512795E+2 1.1760872E-1 -3.8667927E+4 -2.9300531E+2 2.7146552E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Au+ + 1.000H2O = AuOH + 1.000H+
-llnl_gamma 3.4
log_k 11.023
delta_h -77.054 #kJ/mol #01aki/zot
-analytic 3.6025163E+1 9.9488644E-4 2.6883304E+3 -1.3635646E+1 -5.108398E+4
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000B(OH)3 + 1.000H2O = B(OH)4- + 1.000H+
-llnl_gamma 3.6
log_k -9.241
delta_h 14.069 #kJ/mol #95pok/sch
-analytic -5.1942755E+2 -7.8475735E-2 2.9291607E+4 1.8479529E+2 -1.948959E+6
#References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch;
1.000Ba+2 + 1.000HCO3- = Ba(HCO3)+
-llnl_gamma 4.1
log_k 1.034
delta_h 20.309 #kJ/mol #95sho/kor
-analytic 9.2777449E+2 1.4836503E-1 -5.2385571E+4 -3.3565095E+2 3.1355311E+6
#References = LogK/DGf: 95sho/kor; DHf/DHr: Internal calculation; S°: 95sho/kor; Cp: 95sho/kor; V°: 95sho/kor;
1.000Ba+2 + 1.000Cl- = BaCl+
-llnl_gamma 4.1
log_k -0.485
delta_h 12.964 #kJ/mol #97sve/sho
-analytic 8.0870585E+2 1.3328755E-1 -4.4762936E+4 -2.9445868E+2 2.6511313E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ba+2 + 1.000HCO3- = BaCO3 + 1.000H+
-llnl_gamma 3.4
log_k -7.667
delta_h 31.514 #kJ/mol #97sve/sho
-analytic 6.6880501E+2 1.1124394E-1 -3.5057488E+4 -2.4693207E+2 1.685557E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ba+2 + 1.000F- = BaF+
-llnl_gamma 4.1
log_k -0.143
delta_h 8.925 #kJ/mol #97sve/sho
-analytic 8.2520786E+2 1.3421019E-1 -4.5845176E+4 -3.0007594E+2 2.7483851E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Ba+2 = BaH2AsO3+
-llnl_gamma 4.1
log_k 1.463
delta_h 0.131 #kJ/mol #Internal calculation
-analytic 5.5629609E+2 9.1454897E-2 -2.804701E+4 -2.0384441E+2 1.4551449E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Ba+2 + 1.000H2O = BaOH+ + 1.000H+
-llnl_gamma 4.1
log_k -13.493
delta_h 87.599 #kJ/mol #97asho/sas
-analytic 1.0781515E+2 1.7652517E-2 -8.3667656E+3 -3.9933627E+1 2.7062118E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Be+2 + 1.000Cl- = BeCl+
-llnl_gamma 4.1
log_k -4.835
delta_h 165.918 #kJ/mol #97sve/sho
-analytic 1.4310169E+3 2.2804961E-1 -8.534077E+4 -5.1275703E+2 4.5489828E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Be+2 + 2.000Cl- = BeCl2
-llnl_gamma 3.4
log_k -5.683
delta_h 201.449 #kJ/mol #97sve/sho
-analytic 1.6810887E+3 2.6952517E-1 -1.0259965E+5 -6.0096776E+2 5.6932583E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Be+2 + 1.000F- = BeF+
-llnl_gamma 4.1
log_k 0.482
delta_h 115.257 #kJ/mol #97sve/sho
-analytic 1.2125467E+3 1.9395718E-1 -7.1425686E+4 -4.3427761E+2 3.9345435E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Be+2 + 2.000F- = BeF2
-llnl_gamma 3.4
log_k 4.592
delta_h 111.529 #kJ/mol #97sve/sho
-analytic 1.8333684E+3 2.924234E-1 -1.0683969E+5 -6.5781928E+2 6.2323653E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Be+2 + 3.000F- = BeF3-1
-llnl_gamma 3.6
log_k 7.422
delta_h 140.733 #kJ/mol #97sve/sho
-analytic 2.6366207E+3 4.1788361E-1 -1.5336719E+5 -9.4609783E+2 9.0371208E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Be+2 + 4.000F- = BeF4-2
-llnl_gamma 4.7
log_k 8.062
delta_h 247.651 #kJ/mol #97sve/sho
-analytic 3.2813391E+3 5.1722122E-1 -1.9459206E+5 -1.1727283E+3 1.1291049E+7
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Be+2 + 1.000H2O = BeO + 2.000H+
-llnl_gamma 3.4
log_k -13.654
delta_h 65.815 #kJ/mol #97asho/sas
-analytic 2.9000509E+2 4.7787226E-2 -1.8436811E+4 -1.0712824E+2 8.0113952E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Be+2 + 2.000H2O = BeO2-2 + 4.000H+
-llnl_gamma 4.7
log_k -37.387
delta_h 160.594 #kJ/mol #97asho/sas
-analytic -1.0015937E+3 -1.6503403E-1 4.4781085E+4 3.6295197E+2 -3.1011135E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Be+2 + 1.000H2O = BeOH+ + 1.000H+
-llnl_gamma 4.1
log_k -5.371
delta_h 27.518 #kJ/mol #97asho/sas
-analytic 1.9780606E+2 2.9707874E-2 -1.3106122E+4 -7.1362992E+1 7.5618923E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000B(OH)3 + 4.000F- + 3.000H+ = BF4- + 3.000H2O
-llnl_gamma 3.6
log_k 18.142
delta_h -19.282 #kJ/mol #88sho/hel
-analytic 2.4399612E+3 3.8653494E-1 -1.3327937E+5 -8.8156088E+2 8.1178407E+6
#References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel;
1.000Bi+3 + 1.000H2O = BiO+ + 2.000H+
-llnl_gamma 4.1
log_k -3.297
delta_h 77.925 #kJ/mol #97asho/sas
-analytic 1.445759E+2 2.3387314E-2 -4.953225E+3 -5.3188032E+1 -5.8864951E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Bi+3 + 2.000H2O = BiO2- + 4.000H+
-llnl_gamma 3.6
log_k -21.092
delta_h 191.082 #kJ/mol #97asho/sas
-analytic -2.4857743E+2 -4.4493069E-2 1.2352389E+4 9.044737E+1 -2.1765857E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Bi+3 + 1.000H2O = BiOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -1.098
delta_h 17.221 #kJ/mol #97asho/sas
-analytic 9.2143326E+1 1.3281577E-2 -3.8937906E+3 -3.3858426E+1 -3.205222E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000HCO3- + 1.000Ca+2 = Ca(HCO3)+
-llnl_gamma 4.1
log_k 1.103
delta_h -8.895 #kJ/mol #Internal calculation
-analytic 8.6860873E+2 1.45834E-1 -4.8281447E+4 -3.1673255E+2 3.0832388E+6
#References = LogK/DGf: 82plu/bus; DHf/DHr: Internal calculation; S°: 99aki/zot; Cp: 99aki/zot; V°: 99aki/zot;
1.000H2AsO4- + 1.000Ca+2 = CaAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -14.839
delta_h 113.307 #kJ/mol #Internal calculation
-analytic 2.5836744E+2 3.8536457E-2 -1.5534129E+4 -9.4531204E+1 1.1707145E+5
#References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Ca+2 + 1.000Cl- = CaCl+
-llnl_gamma 4.1
log_k -0.290
delta_h 7.149 #kJ/mol #Internal calculation
-analytic 7.8430407E+2 1.2981085E-1 -4.3492573E+4 -2.8572525E+2 2.630012E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ca+2 + 2.000Cl- = CaCl2
-llnl_gamma 3.4
log_k -0.640
delta_h -5.857 #kJ/mol #Internal calculation
-analytic 1.5621171E+3 2.5579554E-1 -8.5801168E+4 -5.6981877E+2 5.2211876E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Ca+2 = CaCO3 + 1.000H+
-llnl_gamma 3.4
log_k -7.107
delta_h 29.530 #kJ/mol #82plu/bus
-analytic 6.9543261E+2 1.1632984E-1 -3.6152513E+4 -2.568442E+2 1.7402671E+6
#References = LogK/DGf: 82plu/bus; DHf/DHr: 82plu/bus; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho;
1.000Ca+2 + 1.000CrO4-2 = CaCrO4
-llnl_gamma 3.4
log_k 2.770
#References = LogK/DGf: 00per/pal;
#References = LogK/DGf: 00per/pal; V°: Default value;
1.000Ca+2 + 1.000F- = CaF+
-llnl_gamma 4.1
log_k 0.719
delta_h 5.541 #kJ/mol #97sve/sho
-analytic 8.511268E+2 1.3865709E-1 -4.774151E+4 -3.0905513E+2 2.9436051E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Ca+2 = CaH2AsO3+
-llnl_gamma 4.1
log_k 1.745
#References = LogK/DGf: 07mar/acc;
#References = LogK/DGf: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Ca+2 = CaH2AsO4+
-llnl_gamma 4.1
log_k 1.398
delta_h -3.075 #kJ/mol #Internal calculation
-analytic 8.1838841E+2 1.309467E-1 -4.5283812E+4 -2.9716999E+2 2.771532E+6
#References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Ca+2 + 1.000H2PO4- = CaH2PO4+
-llnl_gamma 4.1
log_k 1.500
delta_h 7.776 #kJ/mol #Internal calculation
-analytic 9.219915E+2 1.4456366E-1 -4.9725452E+4 -3.3475874E+2 2.8024104E+6
#References = LogK/DGf: 68chu/mar; DHf/DHr: Internal calculation; S°: 68chu/mar; V°: Default value;
1.000H2AsO4- + 1.000Ca+2 = CaHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.080
delta_h 9.480 #kJ/mol #Internal calculation
-analytic 8.5055958E+2 1.3673788E-1 -4.5214171E+4 -3.1174335E+2 2.4561239E+6
#References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Ca+2 + 1.000H2PO4- = CaHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.370
delta_h 17.564 #kJ/mol #Internal calculation
-analytic 9.1783632E+2 1.4456366E-1 -5.0236726E+4 -3.3475874E+2 2.8024104E+6
#References = LogK/DGf: 68chu/mar; DHf/DHr: Internal calculation; S°: 68chu/mar; V°: Default value;
1.000Ca+2 + 1.000H2O = CaOH+ + 1.000H+
-llnl_gamma 4.1
log_k -12.780
delta_h 77.206 #kJ/mol #Internal calculation
-analytic 1.0904956E+2 1.8070217E-2 -8.9956024E+3 -4.0146268E+1 2.0390791E+5
#References = LogK/DGf: 87gar/par; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ca+2 + 2.000H2PO4- = CaP2O7-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -11.010
#References = LogK/DGf: 76smi/mar;
#References = LogK/DGf: 76smi/mar; V°: Default value;
1.000Ca+2 + 1.000H2PO4- = CaPO4- + 2.000H+
-llnl_gamma 3.6
log_k -13.110
delta_h 38.532 #kJ/mol #Internal calculation
-analytic 1.027777E+3 1.6138795E-1 -5.7688683E+4 -3.7631837E+2 3.1698751E+6
#References = LogK/DGf: 68chu/mar; DHf/DHr: Internal calculation; S°: 68chu/mar; V°: Default value;
1.000Ca+2 + 1.000SO4-2 = CaSO4
-llnl_gamma 3.4
log_k 2.310
delta_h 4.292 #kJ/mol #Internal calculation
-analytic 1.7203418E+3 2.6573499E-1 -9.4255356E+4 -6.2356388E+2 5.4972996E+6
#References = LogK/DGf: 53bell/geo; DHf/DHr: Internal calculation; S°: 97sve/sho; V°: Default value;
2.000HCO3- + 1.000Cd+2 = Cd(CO3)2-2 + 2.000H+
-llnl_gamma 4.7
log_k -14.154
#References = LogK/DGf: 91rai/fel;
#References = LogK/DGf: 91rai/fel; V°: Default value;
1.000Cd+2 + 1.000H2PO4- = Cd(H2PO4)+
-llnl_gamma 4.1
log_k 1.800
#References = LogK/DGf: 01aya/mad;
#References = LogK/DGf: 01aya/mad; V°: Default value;
1.000Cd+2 + 2.000HS- = Cd(HS)2
-llnl_gamma 3.4
log_k 14.430
#References = LogK/DGf: 99wan/tes;
#References = LogK/DGf: 99wan/tes; V°: Default value;
1.000Cd+2 + 2.000SO4-2 = Cd(SO4)2-2
-llnl_gamma 4.7
log_k 3.440
#References = LogK/DGf: 76smi/mar;
#References = LogK/DGf: 76smi/mar; V°: Default value;
2.000Cd+2 + 1.000H2O = Cd2OH+3 + 1.000H+
-llnl_gamma 8.2
log_k -9.389
delta_h 49.083 #kJ/mol #06bla/pia
-analytic 6.2345763E+2 9.4643708E-2 -3.5465811E+4 -2.27146E+2 1.7730814E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 06bla/pia; V°: Default value;
4.000Cd+2 + 4.000H2O = Cd4(OH)4+4 + 4.000H+
-llnl_gamma 11.6
log_k -32.071
delta_h 172.135 #kJ/mol #99yun/glu
-analytic 1.2576276E+3 1.8305398E-1 -7.4901342E+4 -4.5729405E+2 3.4213692E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 99yun/glu; S°: 99yun/glu; V°: Default value;
1.000Cd+2 + 1.000Cl- = CdCl+
-llnl_gamma 4.2
log_k 1.970
delta_h -5.521 #kJ/mol #Internal calculation
-analytic 8.0941374E+2 1.3169372E-1 -4.4807639E+4 -2.9412307E+2 2.7882048E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97cro; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cd+2 + 2.000Cl- = CdCl2
-llnl_gamma 3.4
log_k 2.590
delta_h -13.968 #kJ/mol #Internal calculation
-analytic 1.6082242E+3 2.6110472E-1 -8.8757332E+4 -5.8505711E+2 5.5022038E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cd+2 + 3.000Cl- = CdCl3-
-llnl_gamma 3.6
log_k 2.400
delta_h -29.073 #kJ/mol #Internal calculation
-analytic 1.6306008E+3 2.6642831E-1 -9.1424911E+4 -5.9316313E+2 5.9334367E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cd+2 + 4.000Cl- = CdCl4-2
-llnl_gamma 4.7
log_k 1.470
delta_h -44.766 #kJ/mol #Internal calculation
-analytic 1.6152997E+3 2.6481815E-1 -9.1924992E+4 -5.877622E+2 6.2147176E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: Internal calculation; S°: 97cro; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Cd+2 = CdCO3 + 1.000H+
-llnl_gamma 3.4
log_k -5.627
delta_h 19.000 #kJ/mol #Internal calculation
-analytic 9.2947675E+2 1.4440906E-1 -5.1233932E+4 -3.3885829E+2 2.8590686E+6
#References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 97sve/sho; V°: Default value;
1.000Cd+2 + 1.000F- = CdF+
-llnl_gamma 4.1
log_k 1.106
delta_h 3.153 #kJ/mol #97sve/sho
-analytic 8.6861121E+2 1.3907226E-1 -4.8793251E+4 -3.1489979E+2 3.0119464E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cd+2 + 2.000F- = CdF2
-llnl_gamma 3.4
log_k 1.476
delta_h -8.083 #kJ/mol #97sve/sho
-analytic 1.7659009E+3 2.8400307E-1 -9.8001744E+4 -6.4190901E+2 6.0413169E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Cd+2 = CdHCO3+
-llnl_gamma 4.1
log_k 1.503
#References = LogK/DGf: 92sti/par;
#References = LogK/DGf: 92sti/par; V°: Default value;
1.000Cd+2 + 1.000H2PO4- = CdHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -2.380
#References = LogK/DGf: 01aya/mad;
#References = LogK/DGf: 01aya/mad; V°: Default value;
1.000Cd+2 + 1.000HS- = CdHS+
-llnl_gamma 4.1
log_k 7.380
#References = LogK/DGf: 99wan/tes;
#References = LogK/DGf: 99wan/tes; V°: Default value;
1.000Cd+2 + 1.000H2O = CdO + 2.000H+
-llnl_gamma 3.4
log_k -20.900
delta_h 114.907 #kJ/mol #Internal calculation
-analytic 2.3135612E+2 3.6942545E-2 -1.6677979E+4 -8.5723264E+1 4.2532116E+5
#References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cd+2 + 2.000H2O = CdO2-2 + 4.000H+
-llnl_gamma 4.7
log_k -47.479
delta_h 225.687 #kJ/mol #Internal calculation
-analytic -1.0618124E+3 -1.7572641E-1 4.7146387E+4 3.8400479E+2 -3.6978536E+6
#References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cd+2 + 1.000H2O = CdOH+ + 1.000H+
-llnl_gamma 4.1
log_k -10.080
delta_h 54.808 #kJ/mol #Internal calculation
-analytic 1.628427E+2 2.3823902E-2 -1.1685009E+4 -5.9139489E+1 4.8918436E+5
#References = LogK/DGf: 81bae/mes; DHf/DHr: Internal calculation; S°: 81bae/mes; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cd+2 + 2.000H2PO4- = CdP2O7-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -9.110
#References = LogK/DGf: 06bla/pia;
#References = LogK/DGf: 06bla/pia; V°: Default value;
1.000Cd+2 + 1.000S2O3-2 = CdS2O3
-llnl_gamma 3.4
log_k 2.459
delta_h 5.405 #kJ/mol #74nau/ryz
-analytic 1.6514935E+3 2.5979507E-1 -9.0543449E+4 -5.992176E+2 5.3262174E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: Default value;
1.000Cd+2 + 1.000SO4-2 = CdSO4
-llnl_gamma 3.4
log_k 3.440
delta_h 8.700 #kJ/mol #97smi/mar
-analytic 1.7076121E+3 2.6709472E-1 -9.4180843E+4 -6.1854455E+2 5.5670231E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value;
1.000Br- + 1.000Ce+3 = CeBr+2
-llnl_gamma 5.7
log_k 0.380
delta_h 3.059 #kJ/mol #95haa/sho
-analytic 8.2693636E+2 1.3442496E-1 -4.6674351E+4 -3.0023838E+2 2.9184929E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000Cl- = CeCl+2
-llnl_gamma 5.7
log_k 0.321
delta_h 14.848 #kJ/mol #95haa/sho
-analytic 8.3468922E+2 1.3664559E-1 -4.7387513E+4 -3.0268064E+2 2.9150813E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 2.000Cl- = CeCl2+
-llnl_gamma 4.1
log_k 0.056
delta_h 20.694 #kJ/mol #95haa/sho
-analytic 1.5937584E+3 2.5971342E-1 -8.8187389E+4 -5.7961729E+2 5.2332427E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 3.000Cl- = CeCl3
-llnl_gamma 3.4
log_k -0.356
delta_h 15.775 #kJ/mol #95haa/sho
-analytic 2.2998676E+3 3.7318479E-1 -1.2390763E+5 -8.3884602E+2 7.0909611E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 4.000Cl- = CeCl4-
-llnl_gamma 3.6
log_k -0.695
delta_h -2.036 #kJ/mol #95haa/sho
-analytic 1.7735343E+3 2.9974977E-1 -9.0032573E+4 -6.5292579E+2 4.7996758E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000ClO4- = CeClO4+2
-llnl_gamma 5.7
log_k 1.910
delta_h -49.621 #kJ/mol #95haa/sho
-analytic 7.9640266E+2 1.2548206E-1 -4.4858634E+4 -2.8969731E+2 3.1458296E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Ce+3 = CeCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.912
delta_h -2.239 #kJ/mol #95haa/sho
-analytic 8.900406E+2 1.3994824E-1 -4.6675453E+4 -3.2598063E+2 2.5325842E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000F- = CeF+2
-llnl_gamma 5.7
log_k 4.262
delta_h 23.074 #kJ/mol #95haa/sho
-analytic 9.2556754E+2 1.495782E-1 -5.2486689E+4 -3.3368596E+2 3.1844299E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 2.000F- = CeF2+
-llnl_gamma 4.1
log_k 7.351
delta_h 14.795 #kJ/mol #95haa/sho
-analytic 1.7515384E+3 2.8132984E-1 -9.6528041E+4 -6.3411697E+2 5.7577969E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 3.000F- = CeF3
-llnl_gamma 3.4
log_k 9.634
delta_h -6.097 #kJ/mol #95haa/sho
-analytic 2.5476562E+3 4.0837596E-1 -1.3652068E+5 -9.2590071E+2 7.9287519E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 4.000F- = CeF4-
-llnl_gamma 3.6
log_k 11.550
delta_h -45.853 #kJ/mol #95haa/sho
-analytic 2.5036212E+3 3.9604127E-1 -1.3084986E+5 -9.1159773E+2 7.5035754E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000H2PO4- = CeH2PO4+2
-llnl_gamma 5.7
log_k 1.256
delta_h -5.935 #kJ/mol #95haa/sho
-analytic 8.6782366E+2 1.3880304E-1 -4.9895403E+4 -3.1412249E+2 3.2600989E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Ce+3 = CeHCO3+2
-llnl_gamma 5.7
log_k 1.936
delta_h 8.888 #kJ/mol #95haa/sho
-analytic 8.8257868E+2 1.4152151E-1 -5.1013523E+4 -3.1862458E+2 3.2604524E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000IO3- = CeIO3+2
-llnl_gamma 5.7
log_k 1.900
delta_h -21.162 #kJ/mol #95haa/sho
-analytic 8.2463979E+2 1.3171152E-1 -4.6619856E+4 -2.9919678E+2 3.0843409E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000NO3- = CeNO3+2
-llnl_gamma 5.7
log_k 0.655
delta_h -26.590 #kJ/mol #95haa/sho
-analytic 7.961294E+2 1.2675899E-1 -4.5076893E+4 -2.8938314E+2 3.0206291E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000H2O = CeO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.403
delta_h 150.615 #kJ/mol #95haa/sho
-analytic 2.2624881E+2 3.6751286E-2 -1.6043729E+4 -8.1353512E+1 1.3386529E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 2.000H2O = CeO2- + 4.000H+
-llnl_gamma 3.6
log_k -38.743
delta_h 288.714 #kJ/mol #95haa/sho
-analytic -1.9736395E+2 -3.5045743E-2 1.3767915E+3 7.3297946E+1 -1.5039715E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 2.000H2O = CeO2H + 3.000H+
-llnl_gamma 3.4
log_k -26.135
delta_h 229.099 #kJ/mol #95haa/sho
-analytic 2.0342286E+2 2.9017729E-2 -1.5131397E+4 -7.3209053E+1 -5.6071551E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000H2O = CeOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -8.413
delta_h 84.925 #kJ/mol #95haa/sho
-analytic 1.6731019E+2 2.5871778E-2 -1.2481279E+4 -5.9044799E+1 4.0251243E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ce+3 + 1.000SO4-2 = CeSO4+
-llnl_gamma 4.1
log_k 3.723
delta_h 18.642 #kJ/mol #95haa/sho
-analytic 1.647675E+3 2.6134652E-1 -8.9772115E+4 -5.9763452E+2 5.1586651E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 4.000F- + 5.000H+ = CF4 + 3.000H2O
-llnl_gamma 3.4
log_k -26.879
delta_h 243.525 #kJ/mol #01sch/sho
-analytic 3.822632E+3 6.0844151E-1 -2.2748636E+5 -1.3816038E+3 1.3401898E+7
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
1.000Co+2 + 2.000HS- = Co(HS)2
-llnl_gamma 3.4
log_k 8.770
#References = LogK/DGf: 74nau/ryz;
#References = LogK/DGf: 74nau/ryz; V°: Default value;
1.000HCO3- + 1.000H+ = CO2 + 1.000H2O
-CO2_llnl_gamma
log_k 6.353
delta_h -9.160 #kJ/mol #89cox/wag
-analytic 7.0323452E+2 1.1751607E-1 -3.9289514E+4 -2.5424663E+2 2.5757273E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
2.000Co+2 + 1.000H2O = Co2OH+3 + 1.000H+
-llnl_gamma 8.2
log_k -9.830
delta_h 30.030 #kJ/mol #98ply/zha
-analytic 6.5887348E+2 1.0286735E-1 -3.6579148E+4 -2.41762E+2 1.914615E+6
#References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: Default value;
1.000HCO3- = CO3-2 + 1.000H+
-llnl_gamma 4.5
log_k -10.327
delta_h 14.700 #kJ/mol #89cox/wag
-analytic -7.7058363E+2 -1.2433524E-1 4.2038783E+4 2.7739481E+2 -2.6727365E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
4.000Co+2 + 4.000H2O = Co4(OH)4+4 + 4.000H+
-llnl_gamma 11.6
log_k -29.879
delta_h 149.720 #kJ/mol #98ply/zha
-analytic 1.334282E+3 1.9950128E-1 -7.7947699E+4 -4.8652605E+2 3.7044363E+6
#References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: Default value;
1.000H2AsO4- + 1.000Co+2 = CoAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -11.805
delta_h 86.431 #kJ/mol #Internal calculation
-analytic 2.394843E+2 3.2348517E-2 -1.356988E+4 -8.7461179E+1 8.8585346E+4
#References = LogK/DGf: 95mir/kis; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Co+2 = CoCl+
-llnl_gamma 4.1
log_k 0.570
delta_h -2.167 #kJ/mol #Internal calculation
-analytic 8.0574795E+2 1.3135618E-1 -4.4524256E+4 -2.9329178E+2 2.7312211E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
2.000Cl- + 1.000Co+2 = CoCl2
-llnl_gamma 3.4
log_k 0.020
delta_h 4.070 #kJ/mol #89pan/sus
-analytic 1.7082442E+3 2.5831875E-1 -9.2266579E+4 -6.1993113E+2 5.1736747E+6
#References = LogK/DGf: 89pan/sus; DHf/DHr: 89pan/sus; S°: Internal calculation; V°: Default value;
3.000Cl- + 1.000Co+2 = CoCl3-
-llnl_gamma 3.6
log_k -1.710
delta_h 6.690 #kJ/mol #89pan/sus
-analytic 2.3905414E+3 3.6098211E-1 -1.2943697E+5 -8.6786921E+2 7.2662591E+6
#References = LogK/DGf: 89pan/sus; DHf/DHr: 89pan/sus; S°: Internal calculation; V°: Default value;
4.000Cl- + 1.000Co+2 = CoCl4-2
-llnl_gamma 4.7
log_k -2.090
delta_h 22.570 #kJ/mol #89pan/sus
-analytic 3.1844022E+3 4.6364547E-1 -1.7210282E+5 -1.1528992E+3 9.3588435E+6
#References = LogK/DGf: 89pan/sus; DHf/DHr: 89pan/sus; S°: Internal calculation; V°: Default value;
1.000HCO3- + 1.000Co+2 = CoCO3 + 1.000H+
-llnl_gamma 3.4
log_k -6.097
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000Co+2 + 1.000F- = CoF+
-llnl_gamma 4.1
log_k 1.500
delta_h -0.619 #kJ/mol #Internal calculation
-analytic 8.5095726E+2 1.3786643E-1 -4.6822558E+4 -3.0934134E+2 2.8380526E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO4- + 1.000Co+2 = CoH2AsO4+
-llnl_gamma 4.1
log_k 0.068
delta_h -5.168 #kJ/mol #Internal calculation
-analytic 8.1774725E+2 1.2785769E-1 -4.5499486E+4 -2.9684896E+2 2.7858819E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Co+2 = CoHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.236
delta_h 7.924 #kJ/mol #Internal calculation
-analytic 8.9532258E+2 1.4279332E-1 -4.7685642E+4 -3.2795077E+2 2.6044691E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000HCO3- + 1.000Co+2 = CoHCO3+
-llnl_gamma 4.1
log_k 1.893
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000Co+2 + 1.000H2PO4- = CoHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.150
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000Co+2 + 1.000HS- = CoHS+
-llnl_gamma 4.1
log_k 5.670
#References = LogK/DGf: 74nau/ryz;
#References = LogK/DGf: 74nau/ryz; V°: Default value;
1.000Co+2 + 1.000H2O = CoO + 2.000H+
-llnl_gamma 3.4
log_k -18.600
delta_h 105.706 #kJ/mol #Internal calculation
-analytic 2.9103455E+2 4.7420593E-2 -2.0159159E+4 -1.0691499E+2 7.4631811E+5
#References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 98ply/zha; Cp: 97asho/sas; V°: 97asho/sas;
1.000Co+2 + 2.000H2O = CoO2-2 + 4.000H+
-llnl_gamma 4.7
log_k -46.419
delta_h 214.484 #kJ/mol #Internal calculation
-analytic -1.0085439E+3 -1.6628697E-1 4.3266386E+4 3.6508701E+2 -3.2710279E+6
#References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Co+2 + 1.000H2O = CoOH+ + 1.000H+
-llnl_gamma 4.1
log_k -9.230
delta_h 45.961 #kJ/mol #Internal calculation
-analytic 1.9896607E+2 3.0381269E-2 -1.3890784E+4 -7.2250041E+1 7.2128149E+5
#References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 06bla/pia; Cp: 97asho/sas; V°: 97asho/sas;
1.000Co+2 + 1.000S2O3-2 = CoS2O3
-llnl_gamma 3.4
log_k 2.050
#References = LogK/DGf: 51den/mon;
#References = LogK/DGf: 51den/mon; V°: Default value;
1.000Co+2 + 1.000SO4-2 = CoSO4
-llnl_gamma 3.4
log_k 2.300
delta_h 2.090 #kJ/mol #97smi/mar
-analytic 1.7249114E+3 2.7120654E-1 -9.4889872E+4 -6.2585255E+2 5.6377899E+6
#References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value;
1.000Cr+3 + 1.000H2PO4- + 3.000H2O = Cr(OH)3(H2PO4)- + 3.000H+
-llnl_gamma 3.6
log_k -4.387
delta_h 49.800 #kJ/mol #98zie/jon
-analytic 1.2583773E+3 1.8792529E-1 -6.9148474E+4 -4.5565683E+2 3.6111764E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value;
1.000Cr+3 + 1.000H2PO4- + 3.000H2O = Cr(OH)3(HPO4)-2 + 4.000H+
-llnl_gamma 4.7
log_k -13.271
delta_h 59.600 #kJ/mol #98zie/jon
-analytic 1.3662182E+3 2.0474959E-1 -7.6017113E+4 -4.9721646E+2 3.9786411E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value;
1.000Cr+3 + 1.000H2PO4- + 3.000H2O = Cr(OH)3(PO4)-3 + 5.000H+
-llnl_gamma 6.7
log_k -24.578
delta_h 116.120 #kJ/mol #98zie/jon
-analytic 1.4798205E+3 2.2157389E-1 -8.5326103E+4 -5.387761E+2 4.3461058E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value;
1.000Cr+3 + 2.000H2PO4- + 4.000H2O = Cr(OH)4(HPO4)(H2PO4)-4 + 5.000H+
-llnl_gamma 9.6
log_k -22.907
delta_h 53.950 #kJ/mol #98zie/jon
-analytic 2.2228579E+3 3.3232464E-1 -1.2270758E+5 -8.1133415E+2 6.6055685E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98zie/jon; S°: 98zie/jon; V°: Default value;
2.000Cl- + 1.000Cr+3 + 1.000H2O = Cr(OH)Cl2 + 1.000H+
-llnl_gamma 3.4
log_k -5.730
delta_h 32.720 #kJ/mol #76del/hep
-analytic 1.7772105E+3 2.8561797E-1 -9.7804819E+4 -6.4784365E+2 5.5992793E+6
#References = LogK/DGf: 76del/hep; DHf/DHr: 76del/hep; S°: Internal calculation; V°: Default value;
2.000Cr+3 + 2.000H2O = Cr2(OH)2+4 + 2.000H+
-llnl_gamma 11.6
log_k -5.000
#References = LogK/DGf: 87rai/sas;
#References = LogK/DGf: 87rai/sas; V°: Default value;
2.000CrO4-2 + 2.000H+ = Cr2O7-2 + 1.000H2O
-llnl_gamma 4.7
log_k 14.750
delta_h -3.753 #kJ/mol #Internal calculation
-analytic 1.5883803E+3 2.5464846E-1 -8.7910255E+4 -5.72291E+2 5.4576283E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas;
3.000Cr+3 + 4.000H2O = Cr3(OH)4+5 + 4.000H+
-llnl_gamma 15.9
log_k -10.750
#References = LogK/DGf: 87rai/sas;
#References = LogK/DGf: 87rai/sas; V°: Default value;
1.000Br- + 1.000Cr+3 = CrBr+2
-llnl_gamma 5.7
log_k -0.657
delta_h 22.708 #kJ/mol #76del/hep
-analytic 1.1396789E+3 1.8584154E-1 -6.2633494E+4 -4.147712E+2 3.613871E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 76del/hep; S°: 76del/hep; V°: Default value;
1.000Cl- + 1.000Cr+2 = CrCl+
-llnl_gamma 4.1
log_k 5.600
delta_h -20.200 #kJ/mol #91all/bro
-analytic 9.6875417E+2 1.5500658E-1 -5.1412674E+4 -3.5220562E+2 3.0738836E+6
#References = LogK/DGf: 91all/bro; DHf/DHr: 91all/bro; S°: Internal calculation; V°: Default value;
1.000Cl- + 1.000Cr+3 = CrCl+2
-llnl_gamma 5.7
log_k 0.620
delta_h 20.920 #kJ/mol #64sil/mar
-analytic 1.1354945E+3 1.8607133E-1 -6.2020191E+4 -4.1321968E+2 3.5690917E+6
#References = LogK/DGf: 64sil/mar; DHf/DHr: 64sil/mar; S°: Internal calculation; V°: Default value;
2.000Cl- + 1.000Cr+3 = CrCl2+
-llnl_gamma 4.1
log_k -0.710
delta_h 20.920 #kJ/mol #64sil/mar
-analytic 1.7746396E+3 2.8873469E-1 -9.7135393E+4 -6.4634263E+2 5.6616761E+6
#References = LogK/DGf: 64sil/mar; DHf/DHr: 64sil/mar; S°: Internal calculation; V°: Default value;
1.000Cr+3 + 1.000H2PO4- = CrH2PO4+2
-llnl_gamma 5.7
log_k 2.549
#References = LogK/DGf: 76bae/mes;
#References = LogK/DGf: 76bae/mes; V°: Default value;
1.000Cr+3 + 1.000H2PO4- = CrHPO4+ + 1.000H+
-llnl_gamma 4.1
log_k 2.200
#References = LogK/DGf: 71sil/mar;
#References = LogK/DGf: 71sil/mar; V°: Default value;
1.000Cr+3 + 1.000H2O = CrO+ + 2.000H+
-llnl_gamma 4.1
log_k -9.840
delta_h 98.557 #kJ/mol #Internal calculation
-analytic 2.4494763E+2 3.9996447E-2 -1.5606442E+4 -8.8371338E+1 3.82342E+5
#References = LogK/DGf: 87rai/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cr+3 + 2.000H2O = CrO2- + 4.000H+
-llnl_gamma 3.6
log_k -27.649
delta_h 203.811 #kJ/mol #Internal calculation
-analytic -1.8395816E+2 -3.1185955E-2 1.3636037E+3 6.9029629E+1 -8.690201E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- + 1.000CrO4-2 + 2.000H+ = CrO3Cl- + 1.000H2O
-llnl_gamma 3.6
log_k 8.079
delta_h 5.450 #kJ/mol #76del/hep
-analytic 2.1003121E+3 3.341181E-1 -1.159292E+5 -7.6039863E+2 6.9812054E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 76del/hep; S°: 76del/hep; V°: Default value;
1.000Cr+2 + 1.000H2O = CrOH+ + 1.000H+
-llnl_gamma 4.1
log_k -5.300
delta_h 30.312 #kJ/mol #Internal calculation
-analytic 3.0621401E+2 4.9226503E-2 -1.7852153E+4 -1.1180383E+2 9.1890237E+5
#References = LogK/DGf: 83mic/deb; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97sho/sas;
1.000Cr+3 + 1.000H2O = CrOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -3.570
delta_h 38.068 #kJ/mol #Internal calculation
-analytic 2.1069818E+2 3.2843472E-2 -1.3954747E+4 -7.5133861E+1 7.6965246E+5
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Br- + 1.000Cs+ = CsBr
-llnl_gamma 3.4
log_k 0.022
delta_h 7.047 #kJ/mol #97sve/sho
-analytic 6.4329525E+2 9.9917411E-2 -3.507016E+4 -2.335035E+2 1.9868963E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cl- + 1.000Cs+ = CsCl
-llnl_gamma 3.4
log_k -0.126
delta_h 9.828 #kJ/mol #97sve/sho
-analytic 5.3671436E+2 8.4469039E-2 -2.9379963E+4 -1.9485098E+2 1.658936E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cs+ + 1.000I- = CsI
-llnl_gamma 3.4
log_k 0.982
delta_h -1.802 #kJ/mol #97sve/sho
-analytic 5.4186632E+2 8.5368332E-2 -2.9035527E+4 -1.9709445E+2 1.6664255E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cs+ + 1.000H2O = CsOH + 1.000H+
-llnl_gamma 3.4
log_k -15.677
delta_h 73.808 #kJ/mol #97asho/sas
-analytic 9.6099966E+0 -3.4983387E-3 -3.1138419E+3 -4.4683971E+0 -2.4387331E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cu+ + 2.000HS- = Cu(HS)2-
-llnl_gamma 3.6
log_k 16.880
delta_h -86.990 #kJ/mol #01aki/zot
-analytic 1.0004635E+3 1.5698231E-1 -4.9907153E+4 -3.6323305E+2 3.1822214E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 01aki/zot; V°: 01aki/zot;
1.000Cu+2 + 4.000NH3 = Cu(NH3)4+2
-llnl_gamma 5.7
log_k 12.350
delta_h -89.045 #kJ/mol #Internal calculation
-analytic 6.5057582E+2 7.6875372E-2 -3.4924197E+4 -2.3104929E+2 2.4629287E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
1.000Cu+ + 2.000H2O = Cu(OH)2- + 2.000H+
-llnl_gamma 3.6
log_k -16.180
delta_h -1.706 #kJ/mol #Internal calculation
-analytic -5.2739912E+2 -8.9213906E-2 2.9970322E+4 1.8602249E+2 -2.0448568E+6
#References = LogK/DGf: 95bev/pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 01aki/zot; V°: 01aki/zot;
2.000Cu+2 + 1.000H2O = Cu2(OH)+3 + 1.000H+
-llnl_gamma 8.2
log_k -6.400
delta_h 24.661 #kJ/mol #Internal calculation
-analytic 6.2008255E+2 1.0193118E-1 -3.4301375E+4 -2.2751373E+2 1.8794074E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; V°: Default value;
2.000Cu+2 + 2.000H2O = Cu2(OH)2+2 + 2.000H+
-llnl_gamma 5.7
log_k -10.429
delta_h 73.916 #kJ/mol #Internal calculation
-analytic 6.1241256E+2 9.8814466E-2 -3.6135166E+4 -2.2289771E+2 1.8170106E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; V°: Default value;
2.000Cu+ + 3.000HS- = Cu2S(HS)2-2 + 1.000H+
-llnl_gamma 4.7
log_k 29.300
delta_h -227.531 #kJ/mol #Internal calculation
-analytic 2.310401E+3 3.4433543E-1 -1.1328672E+5 -8.414917E+2 6.9707811E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
3.000Cu+2 + 4.000H2O = Cu3(OH)4+2 + 4.000H+
-llnl_gamma 5.7
log_k -21.099
delta_h 109.826 #kJ/mol #Internal calculation
-analytic 8.7687302E+2 1.4510498E-1 -5.2347836E+4 -3.2153519E+2 2.6631191E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; V°: Default value;
1.000H2AsO4- + 1.000Cu+2 = CuAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -9.325
delta_h 76.057 #kJ/mol #Internal calculation
-analytic 2.626085E+2 3.5517046E-2 -1.417144E+4 -9.5620344E+1 1.435021E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Cu+2 = CuCl+
-llnl_gamma 4.1
log_k 0.830
delta_h 6.359 #kJ/mol #Internal calculation
-analytic 8.3390902E+2 1.3508055E-1 -4.6805032E+4 -3.0258003E+2 2.8753569E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cl- + 1.000Cu+ = CuCl
-llnl_gamma 3.4
log_k 3.601
delta_h -11.542 #kJ/mol #Internal calculation
-analytic 6.9682073E+2 1.1145574E-1 -3.6152888E+4 -2.5390327E+2 2.0511204E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
2.000Cl- + 1.000Cu+2 = CuCl2
-llnl_gamma 3.4
log_k 0.600
delta_h 13.649 #kJ/mol #Internal calculation
-analytic 1.6510622E+3 2.675649E-1 -9.2495586E+4 -5.9955883E+2 5.6504478E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho;
2.000Cl- + 1.000Cu+ = CuCl2-
-llnl_gamma 3.6
log_k 4.813
delta_h -1.390 #kJ/mol #Internal calculation
-analytic 9.3079811E+2 1.4943939E-1 -4.9495975E+4 -3.3804672E+2 2.8396618E+6
#References = LogK/DGf: 01aki/zot; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
3.000Cl- + 1.000Cu+2 = CuCl3-
-llnl_gamma 3.6
log_k -1.280
delta_h 21.876 #kJ/mol #Internal calculation
-analytic 1.6530328E+3 2.6875545E-1 -9.5508234E+4 -5.9905145E+2 6.0632175E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho;
3.000Cl- + 1.000Cu+ = CuCl3-2
-llnl_gamma 4.7
log_k 4.593
delta_h -24.914 #kJ/mol #Internal calculation
-analytic 8.193345E+2 1.3272273E-1 -4.271742E+4 -2.9893153E+2 2.5466434E+6
#References = LogK/DGf: 05liu/mcp; DHf/DHr: Internal calculation; S°: 05liu/mcp; Cp: 05liu/mcp; V°: 05liu/mcp;
4.000Cl- + 1.000Cu+2 = CuCl4-2
-llnl_gamma 4.7
log_k -3.980
delta_h 27.657 #kJ/mol #Internal calculation
-analytic 1.6468256E+3 2.6794928E-1 -9.7853149E+4 -5.9597272E+2 6.418291E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Cu+2 = CuCO3 + 1.000H+
-llnl_gamma 3.4
log_k -3.560
delta_h 14.258 #kJ/mol #Internal calculation
-analytic 9.9493966E+2 1.4805279E-1 -5.3947417E+4 -3.6148134E+2 2.9122316E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
1.000Cu+2 + 1.000F- = CuF+
-llnl_gamma 4.1
log_k 1.580
delta_h 12.707 #kJ/mol #Internal calculation
-analytic 9.0349519E+2 1.4391597E-1 -5.1152437E+4 -3.2670884E+2 3.125681E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Cu+2 = CuH2AsO3+
-llnl_gamma 4.1
log_k 7.054
delta_h -46.255 #kJ/mol #Internal calculation
-analytic 6.4048484E+2 9.7287169E-2 -3.1510933E+4 -2.3336394E+2 1.8396872E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Cu+2 = CuH2AsO4+
-llnl_gamma 4.1
log_k 1.760
delta_h -10.919 #kJ/mol #Internal calculation
-analytic 8.3708708E+2 1.3054439E-1 -4.626741E+4 -3.035613E+2 2.8512836E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cu+ + 1.000H2PO4- = CuH2PO4
-llnl_gamma 3.4
log_k 0.870
delta_h 0.072 #kJ/mol #Internal calculation
-analytic 7.5823613E+2 1.1422404E-1 -4.0572783E+4 -2.7506678E+2 2.2485201E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
1.000Cu+2 + 1.000H2PO4- = CuH2PO4+
-llnl_gamma 4.1
log_k 1.140
delta_h -5.145 #kJ/mol #Internal calculation
-analytic 8.9465654E+2 1.4956712E-1 -4.8399116E+4 -3.2681664E+2 2.925297E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; V°: Default value;
1.000H2AsO4- + 1.000Cu+2 = CuHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.241
delta_h 4.151 #kJ/mol #Internal calculation
-analytic 9.0174788E+2 1.4276357E-1 -4.7805321E+4 -3.3001158E+2 2.611553E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000HCO3- + 1.000Cu+2 = CuHCO3+
-llnl_gamma 4.1
log_k 1.840
delta_h 8.599 #kJ/mol #Internal calculation
-analytic 8.9894429E+2 1.4805279E-1 -4.9182229E+4 -3.2696321E+2 2.9122316E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
1.000Cu+2 + 1.000H2PO4- = CuHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.960
delta_h 18.002 #kJ/mol #Internal calculation
-analytic 9.8806849E+2 1.4956712E-1 -5.381304E+4 -3.5929014E+2 2.925297E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
1.000Cu+ + 1.000HS- = CuHS
-llnl_gamma 3.4
log_k 13.020
delta_h -49.569 #kJ/mol #Internal calculation
-analytic 7.2536108E+2 1.135208E-1 -3.5911506E+4 -2.6274007E+2 2.1684359E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 01aki/zot; Cp: 01aki/zot; V°: 01aki/zot;
1.000Cu+2 + 1.000NO2- = CuNO2+
-llnl_gamma 4.1
log_k 1.960
delta_h -5.953 #kJ/mol #Internal calculation
-analytic 9.1084505E+2 1.4749544E-1 -4.978972E+4 -3.3134568E+2 3.0248667E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
1.000Cu+2 + 1.000NO3- = CuNO3+
-llnl_gamma 4.1
log_k 0.500
delta_h -7.587 #kJ/mol #Internal calculation
-analytic 8.7788093E+2 1.4270004E-1 -4.7837024E+4 -3.2011378E+2 2.8996936E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; V°: Default value;
1.000Cu+2 + 1.000H2O = CuO + 2.000H+
-llnl_gamma 3.4
log_k -16.200
delta_h 85.086 #kJ/mol #Internal calculation
-analytic -1.0822011E+2 -1.6681077E-2 2.3160756E+3 3.8279517E+1 -4.8841945E+5
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cu+2 + 2.000H2O = CuO2-2 + 4.000H+
-llnl_gamma 4.7
log_k -39.739
delta_h 178.318 #kJ/mol #Internal calculation
-analytic -1.0320473E+3 -1.7100293E-1 4.7751868E+4 3.7311655E+2 -3.5664622E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cu+2 + 1.000H2O = CuOH+ + 1.000H+
-llnl_gamma 4.1
log_k -7.950
delta_h 50.497 #kJ/mol #Internal calculation
-analytic 1.890945E+2 2.762379E-2 -1.290599E+4 -6.8113573E+1 5.8218861E+5
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97ply/wan; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cu+ + 1.000H2O = CuOH + 1.000H+
-llnl_gamma 3.4
log_k -11.554
delta_h 100.371 #kJ/mol #Internal calculation
-analytic -4.3706894E+2 -4.1362485E-2 2.5878517E+4 1.521298E+2 -2.2565364E+6
#References = LogK/DGf: 95bev/pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 01aki/zot; V°: 01aki/zot;
1.000Cu+2 + 1.000SO4-2 = CuSO4
-llnl_gamma 3.4
log_k 2.350
delta_h 7.300 #kJ/mol #07pow/bro
-analytic 1.7631569E+3 2.7073846E-1 -9.6741831E+4 -6.3864188E+2 5.6201861E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: 07pow/bro; S°: Internal calculation; V°: Default value;
1.000Cl- + 1.000Dy+3 = DyCl+2
-llnl_gamma 5.7
log_k 0.248
delta_h 13.769 #kJ/mol #95haa/sho
-analytic 8.3240863E+2 1.3607136E-1 -4.7252816E+4 -3.0188406E+2 2.9111383E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Dy+3 = DyCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 17.245 #kJ/mol #95haa/sho
-analytic 1.6092146E+3 2.6228645E-1 -8.9640045E+4 -5.8502399E+2 5.4069524E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Dy+3 = DyCl3
-llnl_gamma 3.4
log_k -0.429
delta_h 8.709 #kJ/mol #95haa/sho
-analytic 2.3531665E+3 3.8293705E-1 -1.28118E+5 -8.5790828E+2 7.5363305E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Dy+3 = DyCl4-
-llnl_gamma 3.6
log_k -0.841
delta_h -14.298 #kJ/mol #95haa/sho
-analytic 2.2301636E+3 3.6217067E-1 -1.1943079E+5 -8.1506895E+2 6.9711743E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Dy+3 = DyCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.316
delta_h -7.263 #kJ/mol #95haa/sho
-analytic 7.315151E+2 1.1890048E-1 -3.6613193E+4 -2.6980725E+2 1.8792604E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 1.000F- = DyF+2
-llnl_gamma 5.7
log_k 4.702
delta_h 23.183 #kJ/mol #95haa/sho
-analytic 9.253823E+2 1.4948314E-1 -5.2430694E+4 -3.3346924E+2 3.1781466E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 2.000F- = DyF2+
-llnl_gamma 4.1
log_k 8.231
delta_h 12.519 #kJ/mol #95haa/sho
-analytic 1.773682E+3 2.8506199E-1 -9.8272824E+4 -6.4162663E+2 5.9406888E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 3.000F- = DyF3
-llnl_gamma 3.4
log_k 10.880
delta_h -12.087 #kJ/mol #95haa/sho
-analytic 2.6024618E+3 4.1812809E-1 -1.4078719E+5 -9.4496254E+2 8.3741153E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 4.000F- = DyF4-
-llnl_gamma 3.6
log_k 13.016
delta_h -57.465 #kJ/mol #95haa/sho
-analytic 2.6223389E+3 4.1563419E-1 -1.3980552E+5 -9.5322278E+2 8.3874076E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 1.000H2PO4- = DyH2PO4+2
-llnl_gamma 5.7
log_k 0.963
delta_h -7.629 #kJ/mol #95haa/sho
-analytic 8.6571672E+2 1.3816819E-1 -4.9784834E+4 -3.1346699E+2 3.2610041E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Dy+3 = DyHCO3+2
-llnl_gamma 5.7
log_k 1.716
delta_h 7.024 #kJ/mol #95haa/sho
-analytic 8.7431968E+2 1.4002734E-1 -5.0541692E+4 -3.1574421E+2 3.2404302E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 1.000NO3- = DyNO3+2
-llnl_gamma 5.7
log_k 0.141
delta_h -30.398 #kJ/mol #95haa/sho
-analytic 7.961357E+2 1.263429E-1 -4.5043095E+4 -2.8965159E+2 3.0344556E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 1.000H2O = DyO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.110
delta_h 145.698 #kJ/mol #95haa/sho
-analytic 1.990996E+2 3.2285768E-2 -1.4110305E+4 -7.1780024E+1 9.423573E+3
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 2.000H2O = DyO2- + 4.000H+
-llnl_gamma 3.6
log_k -33.465
delta_h 253.849 #kJ/mol #95haa/sho
-analytic -2.0472586E+2 -3.6571131E-2 3.1717495E+3 7.5993831E+1 -1.4681273E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 2.000H2O = DyO2H + 3.000H+
-llnl_gamma 3.4
log_k -24.816
delta_h 217.576 #kJ/mol #95haa/sho
-analytic 2.1912774E+2 3.193467E-2 -1.5630066E+4 -7.9103389E+1 -4.7159677E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 1.000H2O = DyOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.827
delta_h 79.083 #kJ/mol #95haa/sho
-analytic 1.4657461E+2 2.2386785E-2 -1.0793605E+4 -5.1784898E+1 2.9018627E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Dy+3 + 1.000SO4-2 = DySO4+
-llnl_gamma 4.1
log_k 3.723
delta_h 19.765 #kJ/mol #95haa/sho
-analytic 1.6458401E+3 2.6071144E-1 -8.9289118E+4 -5.9710996E+2 5.0792162E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Cl- + 1.000Er+3 = ErCl+2
-llnl_gamma 5.7
log_k 0.321
delta_h 12.603 #kJ/mol #95haa/sho
-analytic 8.267709E+2 1.350414E-1 -4.6756514E+4 -2.9993776E+2 2.8700268E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Er+3 = ErCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 15.374 #kJ/mol #95haa/sho
-analytic 1.5960661E+3 2.5983599E-1 -8.8471132E+4 -5.8051943E+2 5.3013751E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Er+3 = ErCl3
-llnl_gamma 3.4
log_k -0.429
delta_h 5.091 #kJ/mol #95haa/sho
-analytic 2.3306282E+3 3.7922221E-1 -1.2590841E+5 -8.5040908E+2 7.3299763E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Er+3 = ErCl4-
-llnl_gamma 3.6
log_k -0.841
delta_h -20.785 #kJ/mol #95haa/sho
-analytic 2.1932292E+3 3.5535589E-1 -1.1597009E+5 -8.0257699E+2 6.6554688E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Er+3 = ErCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.169
delta_h -8.973 #kJ/mol #95haa/sho
-analytic 7.3934807E+2 1.1995521E-1 -3.6987528E+4 -2.726604E+2 1.9072278E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 1.000F- = ErF+2
-llnl_gamma 5.7
log_k 4.775
delta_h 24.137 #kJ/mol #95haa/sho
-analytic 9.2009403E+2 1.4857257E-1 -5.2017702E+4 -3.3155175E+2 3.1339814E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 2.000F- = ErF2+
-llnl_gamma 4.1
log_k 8.377
delta_h 13.054 #kJ/mol #95haa/sho
-analytic 1.7618247E+3 2.8294166E-1 -9.722175E+4 -6.3745052E+2 5.8319926E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 3.000F- = ErF3
-llnl_gamma 3.4
log_k 11.027
delta_h -12.424 #kJ/mol #95haa/sho
-analytic 2.5806444E+3 4.1441324E-1 -1.387489E+5 -9.3746326E+2 8.1677607E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 4.000F- = ErF4-
-llnl_gamma 3.6
log_k 13.236
delta_h -60.342 #kJ/mol #95haa/sho
-analytic 2.6019423E+3 4.1141777E-1 -1.3733559E+5 -9.4648997E+2 8.1144668E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 1.000H2PO4- = ErH2PO4+2
-llnl_gamma 5.7
log_k 1.037
delta_h -9.794 #kJ/mol #95haa/sho
-analytic 8.6051563E+2 1.3715349E-1 -4.9285966E+4 -3.1171948E+2 3.2236335E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Er+3 = ErHCO3+2
-llnl_gamma 5.7
log_k 1.789
delta_h 4.984 #kJ/mol #95haa/sho
-analytic 8.6600283E+2 1.3856784E-1 -4.9872894E+4 -3.1286712E+2 3.1926917E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 1.000NO3- = ErNO3+2
-llnl_gamma 5.7
log_k 0.141
delta_h -33.891 #kJ/mol #95haa/sho
-analytic 7.927088E+2 1.2553525E-1 -4.4610599E+4 -2.8862663E+2 3.00609E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 1.000H2O = ErO+ + 2.000H+
-llnl_gamma 4.1
log_k -15.963
delta_h 143.738 #kJ/mol #95haa/sho
-analytic 2.0538278E+2 3.3284769E-2 -1.4754882E+4 -7.3889134E+1 9.3547614E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 2.000H2O = ErO2- + 4.000H+
-llnl_gamma 3.6
log_k -32.586
delta_h 246.957 #kJ/mol #95haa/sho
-analytic -2.033288E+2 -3.6358022E-2 2.7450948E+3 7.5806351E+1 -1.3513288E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 2.000H2O = ErO2H + 3.000H+
-llnl_gamma 3.4
log_k -24.303
delta_h 213.151 #kJ/mol #95haa/sho
-analytic 2.4297393E+2 3.5998582E-2 -1.7298243E+4 -8.7553844E+1 -2.9732541E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 1.000H2O = ErOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.753
delta_h 77.916 #kJ/mol #95haa/sho
-analytic 1.544774E+2 2.3623307E-2 -1.1540759E+4 -5.4472633E+1 3.7538483E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Er+3 + 1.000SO4-2 = ErSO4+
-llnl_gamma 4.1
log_k 3.649
delta_h 20.059 #kJ/mol #95haa/sho
-analytic 1.6363931E+3 2.5910345E-1 -8.8832836E+4 -5.93635E+2 5.0547017E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Cl- + 1.000Eu+2 = EuCl+
-llnl_gamma 4.1
log_k 0.321
delta_h 8.611 #kJ/mol #95haa/sho
-analytic 8.7689506E+2 1.4309279E-1 -5.0463342E+4 -3.1772131E+2 3.2178048E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Cl- + 1.000Eu+3 = EuCl+2
-llnl_gamma 5.7
log_k 0.321
delta_h 13.850 #kJ/mol #95haa/sho
-analytic 8.2381886E+2 1.3443405E-1 -4.6518752E+4 -2.988471E+2 2.8377488E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Eu+3 = EuCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 18.617 #kJ/mol #95haa/sho
-analytic 1.586592E+3 2.5819501E-1 -8.7693006E+4 -5.7710489E+2 5.2039826E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Eu+2 = EuCl2
-llnl_gamma 3.4
log_k 1.229
delta_h 5.891 #kJ/mol #95haa/sho
-analytic 1.6456404E+3 2.6723431E-1 -9.4212135E+4 -5.964462E+2 6.0241784E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Eu+3 = EuCl3
-llnl_gamma 3.4
log_k -0.429
delta_h 11.329 #kJ/mol #95haa/sho
-analytic 2.3076362E+3 3.7460743E-1 -1.2432308E+5 -8.418823E+2 7.1478968E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Eu+2 = EuCl3-
-llnl_gamma 3.6
log_k 1.989
delta_h -3.227 #kJ/mol #95haa/sho
-analytic 1.8618152E+3 3.0434568E-1 -1.0854038E+5 -6.7402308E+2 7.227567E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Eu+3 = EuCl4-
-llnl_gamma 3.6
log_k -0.841
delta_h -9.682 #kJ/mol #95haa/sho
-analytic 2.162032E+3 3.5015272E-1 -1.1348488E+5 -7.9130521E+2 6.3462771E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Eu+2 = EuCl4-2
-llnl_gamma 4.7
log_k 2.824
delta_h -19.999 #kJ/mol #95haa/sho
-analytic 1.9170037E+3 3.1639376E-1 -1.1392737E+5 -6.9342549E+2 7.9504144E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Eu+3 = EuCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.389
delta_h -6.221 #kJ/mol #95haa/sho
-analytic 7.2456447E+2 1.1771851E-1 -3.6310253E+4 -2.6721069E+2 1.8604703E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+2 + 1.000F- = EuF+
-llnl_gamma 4.1
log_k -1.382
delta_h 17.118 #kJ/mol #95haa/sho
-analytic 9.0224796E+2 1.4533379E-1 -5.2675251E+4 -3.2649336E+2 3.3422815E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 1.000F- = EuF+2
-llnl_gamma 5.7
log_k 4.482
delta_h 23.440 #kJ/mol #95haa/sho
-analytic 9.1672326E+2 1.4780566E-1 -5.1731083E+4 -3.3048155E+2 3.1070255E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 2.000F- = EuF2+
-llnl_gamma 4.1
log_k 7.791
delta_h 14.031 #kJ/mol #95haa/sho
-analytic 1.7496083E+3 2.8072232E-1 -9.629651E+4 -6.3330421E+2 5.7367563E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+2 + 2.000F- = EuF2
-llnl_gamma 3.4
log_k -2.031
delta_h 17.703 #kJ/mol #95haa/sho
-analytic 1.8014988E+3 2.9000999E-1 -1.037089E+5 -6.5304941E+2 6.5579213E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 3.000F- = EuF3
-llnl_gamma 3.4
log_k 10.294
delta_h -9.114 #kJ/mol #95haa/sho
-analytic 2.5564081E+3 4.0979859E-1 -1.3701081E+5 -9.2893697E+2 7.9856874E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+2 + 3.000F- = EuF3-
-llnl_gamma 3.6
log_k -2.461
delta_h 3.810 #kJ/mol #95haa/sho
-analytic 1.8653716E+3 3.0178505E-1 -1.1030874E+5 -6.752568E+2 7.3823052E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 4.000F- = EuF4-
-llnl_gamma 3.6
log_k 12.283
delta_h -52.158 #kJ/mol #95haa/sho
-analytic 2.5367132E+3 4.0101848E-1 -1.3298987E+5 -9.2332008E+2 7.7116648E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+2 + 4.000F- = EuF4-2
-llnl_gamma 4.7
log_k -2.743
delta_h -37.366 #kJ/mol #95haa/sho
-analytic 2.0277941E+3 3.2467814E-1 -1.223425E+5 -7.3336069E+2 8.6805859E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 1.000H2PO4- = EuH2PO4+2
-llnl_gamma 5.7
log_k 1.037
delta_h -6.925 #kJ/mol #95haa/sho
-analytic 8.5703935E+2 1.365667E-1 -4.9058683E+4 -3.1037824E+2 3.1854205E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Eu+3 = EuHCO3+2
-llnl_gamma 5.7
log_k 1.642
delta_h 8.441 #kJ/mol #95haa/sho
-analytic 8.6819194E+2 1.3879695E-1 -4.9995921E+4 -3.135832E+2 3.173181E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 1.000NO3- = EuNO3+2
-llnl_gamma 5.7
log_k 0.874
delta_h -32.212 #kJ/mol #95haa/sho
-analytic 7.8647336E+2 1.2464865E-1 -4.410107E+4 -2.8615291E+2 2.9530008E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 1.000H2O = EuO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.329
delta_h 148.075 #kJ/mol #95haa/sho
-analytic 2.0540483E+2 3.3157682E-2 -1.4653418E+4 -7.393347E+1 4.1876472E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 2.000H2O = EuO2- + 4.000H+
-llnl_gamma 3.6
log_k -34.491
delta_h 261.329 #kJ/mol #95haa/sho
-analytic -2.0723013E+2 -3.70037E-2 3.064962E+3 7.6925014E+1 -1.4982582E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 2.000H2O = EuO2H + 3.000H+
-llnl_gamma 3.4
log_k -25.402
delta_h 222.296 #kJ/mol #95haa/sho
-analytic 3.2667111E+2 4.9590314E-2 -2.1368229E+4 -1.1847893E+2 -1.796434E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 1.000H2O = EuOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.900
delta_h 80.374 #kJ/mol #95haa/sho
-analytic 1.5033655E+2 2.2846479E-2 -1.1163238E+4 -5.3013995E+1 3.1763476E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Eu+3 + 1.000SO4-2 = EuSO4+
-llnl_gamma 4.1
log_k 3.723
delta_h 20.264 #kJ/mol #95haa/sho
-analytic 1.6444111E+3 2.6038061E-1 -8.9254622E+4 -5.965293E+2 5.0770112E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000HCO3- + 1.000Fe+2 = Fe(CO3)2-2 + 2.000H+
-llnl_gamma 4.7
log_k -13.690
delta_h -10.381 #kJ/mol #Internal calculation
-analytic 1.6792284E+3 2.4369047E-1 -8.9983963E+4 -6.1370659E+2 4.8722416E+6
#References = LogK/DGf: 17bbla; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
3.000HCO3- + 1.000Fe+3 = Fe(CO3)3-3 + 3.000H+
-llnl_gamma 6.7
log_k -6.990
delta_h 99.714 #kJ/mol #Internal calculation
-analytic 2.5008215E+3 3.6873638E-1 -1.3830388E+5 -9.035391E+2 7.2778669E+6
#References = LogK/DGf: 17bbla; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
1.000Fe+2 + 2.000HS- = Fe(HS)2
-llnl_gamma 3.4
log_k 6.450
delta_h -36.849 #kJ/mol #Internal calculation
-analytic 1.6097838E+3 2.5928191E-1 -8.6158019E+4 -5.8625995E+2 5.2446031E+6
#References = LogK/DGf: 99dav/phi; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
1.000Fe+3 + 4.000H2O = Fe(OH)4- + 4.000H+
-llnl_gamma 3.6
log_k -21.599
delta_h 144.981 #kJ/mol #Internal calculation
-analytic -4.4734751E+2 -4.7980357E-2 2.2242675E+4 1.5702037E+2 -2.0520918E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 99dia/sch; Cp: 99dia/sch; V°: 99dia/sch;
2.000Fe+3 + 2.000H2O = Fe2(OH)2+4 + 2.000H+
-llnl_gamma 11.6
log_k -2.919
delta_h 56.480 #kJ/mol #76bae/mes
-analytic 9.4112378E+2 1.4793483E-1 -5.080159E+4 -3.4182891E+2 2.4954882E+6
#References = LogK/DGf: 07ste; DHf/DHr: 76bae/mes; S°: Internal calculation; V°: Default value;
1.000H2AsO4- + 1.000Fe+3 = FeAsO4 + 2.000H+
-llnl_gamma 3.4
log_k -4.427
delta_h 42.544 #kJ/mol #Internal calculation
-analytic 7.6692268E+2 1.286338E-1 -3.6919314E+4 -2.8354545E+2 1.3992939E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Fe+2 = FeAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -10.980
delta_h 85.100 #kJ/mol #Internal calculation
-analytic 2.4918312E+2 3.4100103E-2 -1.3982901E+4 -9.0834786E+1 1.1856227E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Fe+2 = FeCl+
-llnl_gamma 4.1
log_k -0.160
delta_h 21.550 #kJ/mol #17bbla
-analytic 8.1211677E+2 1.3182173E-1 -4.6121049E+4 -2.9424044E+2 2.7725958E+6
#References = LogK/DGf: 04chi; DHf/DHr: 17bbla; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cl- + 1.000Fe+3 = FeCl+2
-llnl_gamma 5.7
log_k 1.520
delta_h 22.480 #kJ/mol #17bbla
-analytic 8.1446136E+2 1.3244719E-1 -4.5719767E+4 -2.9481007E+2 2.7025962E+6
#References = LogK/DGf: 00tag/dia; DHf/DHr: 17bbla; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho;
2.000Cl- + 1.000Fe+3 = FeCl2+
-llnl_gamma 4.1
log_k 0.700
delta_h 22.180 #kJ/mol #17bbla
-analytic 1.8008994E+3 2.8747657E-1 -9.8237163E+4 -6.5463736E+2 5.6390473E+6
#References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value;
2.000Cl- + 1.000Fe+2 = FeCl2
-llnl_gamma 3.4
log_k -1.740
delta_h 9.900 #kJ/mol #17bbla
-analytic 1.6056093E+3 2.6112556E-1 -8.8964995E+4 -5.8478902E+2 5.352141E+6
#References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Fe+2 = FeCO3 + 1.000H+
-llnl_gamma 3.4
log_k -5.140
delta_h 14.400 #kJ/mol #17bbla
-analytic 9.6797705E+2 1.4816163E-1 -5.2932711E+4 -3.5269684E+2 2.9309121E+6
#References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value;
1.000HCO3- + 1.000Fe+3 + 1.000H2O = FeCO3OH + 2.000H+
-llnl_gamma 3.4
log_k -9.970
delta_h 117.425 #kJ/mol #Internal calculation
-analytic 1.2362718E+3 1.7456198E-1 -7.0518618E+4 -4.4424638E+2 3.3328111E+6
#References = LogK/DGf: 17bbla; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
1.000CrO4-2 + 1.000Fe+3 = FeCrO4+
-llnl_gamma 4.1
log_k 7.800
delta_h 19.100 #kJ/mol #96bbar/pal
-analytic 1.8410071E+3 2.9366358E-1 -1.0087752E+5 -6.6638727E+2 5.9126379E+6
#References = LogK/DGf: 96bbar/pal; DHf/DHr: 96bbar/pal; S°: Internal calculation; V°: Default value;
1.000F- + 1.000Fe+2 = FeF+
-llnl_gamma 4.1
log_k 1.430
delta_h 0.150 #kJ/mol #Internal calculation
-analytic 8.7588021E+2 1.4031975E-1 -4.8713414E+4 -3.1783355E+2 2.983037E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000Fe+3 = FeF+2
-llnl_gamma 5.7
log_k 6.000
delta_h 20.833 #kJ/mol #Internal calculation
-analytic 9.0322119E+2 1.4595368E-1 -5.0109776E+4 -3.2568688E+2 2.9532789E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Fe+3 = FeH2AsO3+2
-llnl_gamma 5.7
log_k 7.485
delta_h -47.156 #kJ/mol #Internal calculation
-analytic 6.8616294E+2 1.0108806E-1 -3.5091161E+4 -2.4860989E+2 2.1377436E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Fe+2 = FeH2AsO4+
-llnl_gamma 4.1
log_k 2.966
delta_h -20.323 #kJ/mol #Internal calculation
-analytic 8.1737644E+2 1.2787919E-1 -4.4686367E+4 -2.9663802E+2 2.7870083E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Fe+3 = FeH2AsO4+2
-llnl_gamma 5.7
log_k 4.433
delta_h -26.990 #kJ/mol #Internal calculation
-analytic 8.8043405E+2 1.3378978E-1 -4.8973376E+4 -3.1805421E+2 3.1443056E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Fe+2 + 1.000H2PO4- = FeH2PO4+
-llnl_gamma 4.1
log_k 2.693
#References = LogK/DGf: 72bnri, 76smi/mar;
#References = LogK/DGf: 72bnri, 76smi/mar; V°: Default value;
1.000Fe+3 + 1.000H2PO4- = FeH2PO4+2
-llnl_gamma 5.7
log_k 5.423
#References = LogK/DGf: 72cnri;
#References = LogK/DGf: 72cnri; V°: Default value;
1.000H2AsO4- + 1.000Fe+2 = FeHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.435
delta_h 3.862 #kJ/mol #Internal calculation
-analytic 8.922345E+2 1.4212095E-1 -4.7342096E+4 -3.2674036E+2 2.5993348E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Fe+3 = FeHAsO4+ + 1.000H+
-llnl_gamma 4.1
log_k 3.142
delta_h -13.135 #kJ/mol #Internal calculation
-analytic 7.6208755E+2 1.2019393E-1 -3.7827178E+4 -2.7879052E+2 1.9504073E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Fe+3 + 1.000H2PO4- = FeHPO4+ + 1.000H+
-llnl_gamma 4.1
log_k 3.674
delta_h -29.668 #kJ/mol #Internal calculation
-analytic 1.1187466E+3 1.7919302E-1 -5.8323604E+4 -4.0866759E+2 3.4082733E+6
#References = LogK/DGf: 65lah; DHf/DHr: Internal calculation; S°: 65lah; V°: Default value;
1.000Fe+2 + 1.000H2PO4- = FeHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.608
#References = LogK/DGf: 72bnri;
#References = LogK/DGf: 72bnri; V°: Default value;
1.000Fe+2 + 1.000SO4-2 + 1.000H+ = FeHSO4+
-llnl_gamma 4.1
log_k 1.740
delta_h 9.900 #kJ/mol #17bbla
-analytic 1.6672948E+3 2.7084729E-1 -9.2726074E+4 -6.0568868E+2 5.6388667E+6
#References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value;
1.000Fe+3 + 1.000SO4-2 + 1.000H+ = FeHSO4+2
-llnl_gamma 5.7
log_k 2.480
delta_h 75.275 #kJ/mol #Internal calculation
-analytic 1.9214938E+3 3.0036436E-1 -1.0795639E+5 -6.9314293E+2 6.1031625E+6
#References = LogK/DGf: 08bla; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
1.000Fe+2 + 1.000H2O = FeO + 2.000H+
-llnl_gamma 3.4
log_k -20.600
delta_h 119.662 #kJ/mol #76bae/mes
-analytic 2.757701E+2 4.4685331E-2 -1.9853544E+4 -1.0126803E+2 6.6470377E+5
#References = LogK/DGf: 04chi; DHf/DHr: 76bae/mes; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas;
1.000Fe+3 + 1.000H2O = FeO+ + 2.000H+
-llnl_gamma 4.1
log_k -5.482
delta_h 79.606 #kJ/mol #97asho/sas
-analytic 2.2228976E+2 3.6463475E-2 -1.2122623E+4 -8.0531597E+1 1.1438653E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Fe+2 + 1.000H2O = FeOH+ + 1.000H+
-llnl_gamma 4.1
log_k -9.500
delta_h 55.228 #kJ/mol #76bae/mes
-analytic 1.7937208E+2 2.6856943E-2 -1.2823594E+4 -6.4847214E+1 5.8594887E+5
#References = LogK/DGf: 76bae/mes; DHf/DHr: 76bae/mes; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas;
1.000Fe+3 + 1.000H2O = FeOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -2.190
delta_h 35.903 #kJ/mol #Internal calculation
-analytic 1.6031592E+2 2.5129678E-2 -9.500017E+3 -5.7463507E+1 3.6045404E+5
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Fe+2 + 1.000H2PO4- = FePO4- + 2.000H+
-llnl_gamma 3.6
log_k -11.626
#References = LogK/DGf: 79mat/spo;
#References = LogK/DGf: 79mat/spo; V°: Default value;
1.000Fe+3 + 1.000SO4-2 = FeSO4+
-llnl_gamma 4.1
log_k 4.250
delta_h 26.000 #kJ/mol #17bbla
-analytic 1.9864742E+3 3.0036436E-1 -1.0858073E+5 -7.1784203E+2 6.1031625E+6
#References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value;
1.000Fe+2 + 1.000SO4-2 = FeSO4
-llnl_gamma 3.4
log_k 2.440
delta_h 8.400 #kJ/mol #17bbla
-analytic 1.7511722E+3 2.7084729E-1 -9.6362144E+4 -6.343748E+2 5.6388667E+6
#References = LogK/DGf: 17bbla; DHf/DHr: 17bbla; S°: Internal calculation; V°: Default value;
1.000Ga+3 + 2.000H2O = Ga(OH)2+ + 2.000H+
-llnl_gamma 4.5
log_k -7.268
delta_h 74.711 #kJ/mol #Internal calculation
-analytic -9.7674606E+2 -1.7926158E-1 4.552318E+4 3.6401659E+2 -2.7108582E+6
#References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia;
1.000Ga+3 + 3.000H2O = Ga(OH)3 + 3.000H+
-llnl_gamma 3.0
log_k -11.920
delta_h 104.965 #kJ/mol #Internal calculation
-analytic -9.8690073E+2 -1.8511743E-1 4.4260148E+4 3.6880384E+2 -2.7430059E+6
#References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia;
1.000Ga+3 + 4.000H2O = Ga(OH)4- + 4.000H+
-llnl_gamma 4.5
log_k -15.628
delta_h 106.332 #kJ/mol #99dia/sch
-analytic -1.8266759E+3 -3.0879955E-1 9.1339288E+4 6.7065764E+2 -5.5767401E+6
#References = LogK/DGf: 99dia/sch; DHf/DHr: Internal calculation; S°: 99dia/sch; Cp: 99dia/sch; V°: 99dia/sch;
1.000Ga+3 + 1.000H2O = GaOH+2 + 1.000H+
-llnl_gamma 4.5
log_k -2.835
delta_h 93.041 #kJ/mol #Internal calculation
-analytic 1.8100825E+2 1.3489432E-2 -1.6127449E+4 -5.7474004E+1 7.5047489E+5
#References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia;
1.000Cl- + 1.000Gd+3 = GdCl+2
-llnl_gamma 5.7
log_k -0.053
delta_h 17.566 #kJ/mol #95haa/sho
-analytic 8.2950543E+2 1.3564605E-1 -4.697037E+4 -3.008982E+2 2.8526503E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Gd+3 = GdCl2+
-llnl_gamma 4.1
log_k -0.392
delta_h 23.706 #kJ/mol #95haa/sho
-analytic 1.5973242E+3 2.6028079E-1 -8.85279E+4 -5.8089252E+2 5.2434454E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Gd+3 = GdCl3
-llnl_gamma 3.4
log_k -0.804
delta_h 18.662 #kJ/mol #95haa/sho
-analytic 2.3149591E+3 3.7577743E-1 -1.252585E+5 -8.4411579E+2 7.202813E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Gd+3 = GdCl4-
-llnl_gamma 3.6
log_k -1.216
delta_h 1.144 #kJ/mol #95haa/sho
-analytic 2.1881619E+3 3.548776E-1 -1.1556892E+5 -8.0028772E+2 6.4621406E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Gd+3 = GdCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.837
delta_h -2.086 #kJ/mol #95haa/sho
-analytic 7.1908844E+2 1.1724372E-1 -3.6132332E+4 -2.6524021E+2 1.8335566E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Gd+3 = GdF+2
-llnl_gamma 5.7
log_k 4.254
delta_h 23.825 #kJ/mol #95haa/sho
-analytic 9.2101056E+2 1.4871324E-1 -5.1990387E+4 -3.3213595E+2 3.1228141E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Gd+3 = GdF2+
-llnl_gamma 4.1
log_k 7.636
delta_h 13.872 #kJ/mol #95haa/sho
-analytic 1.7545637E+3 2.8176509E-1 -9.6640709E+4 -6.351671E+2 5.7672646E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Gd+3 = GdF3
-llnl_gamma 3.4
log_k 10.212
delta_h -8.818 #kJ/mol #95haa/sho
-analytic 2.5627899E+3 4.1096846E-1 -1.3757853E+5 -9.3116996E+2 8.0405975E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Gd+3 = GdF4-
-llnl_gamma 3.6
log_k 12.275
delta_h -49.536 #kJ/mol #95haa/sho
-analytic 2.533651E+3 4.0125059E-1 -1.3317191E+5 -9.22027E+2 7.746864E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Gd+3 + 1.000H2PO4- = GdH2PO4+2
-llnl_gamma 5.7
log_k 0.662
delta_h -1.961 #kJ/mol #95haa/sho
-analytic 8.6271852E+2 1.3781235E-1 -4.9548692E+4 -3.1236771E+2 3.1979764E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Gd+3 = GdHCO3+2
-llnl_gamma 5.7
log_k 1.341
delta_h 12.861 #kJ/mol #95haa/sho
-analytic 8.7799849E+2 1.4065642E-1 -5.068545E+4 -3.1707409E+2 3.1988302E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Gd+3 + 1.000NO3- = GdNO3+2
-llnl_gamma 5.7
log_k 0.060
delta_h -22.742 #kJ/mol #95haa/sho
-analytic 7.9153491E+2 1.2589502E-1 -4.4742719E+4 -2.8783539E+2 2.959031E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Gd+3 + 1.000H2O = GdO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.704
delta_h 152.790 #kJ/mol #95haa/sho
-analytic 2.0571741E+2 3.3390773E-2 -1.4454678E+4 -7.4196819E+1 -2.6705238E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Gd+3 + 2.000H2O = GdO2- + 4.000H+
-llnl_gamma 3.6
log_k -34.793
delta_h 266.622 #kJ/mol #95haa/sho
-analytic -2.3182252E+2 -4.0290979E-2 5.0145592E+3 8.5454736E+1 -1.7092838E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Gd+3 + 2.000H2O = GdO2H + 3.000H+
-llnl_gamma 3.4
log_k -25.630
delta_h 226.672 #kJ/mol #95haa/sho
-analytic 1.8449651E+2 2.593141E-2 -1.3404324E+4 -6.6630496E+1 -7.1354051E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Gd+3 + 1.000H2O = GdOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -8.274
delta_h 84.714 #kJ/mol #95haa/sho
-analytic 1.4769897E+2 2.2670571E-2 -1.0811226E+4 -5.2221149E+1 2.4412255E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Gd+3 + 1.000SO4-2 = GdSO4+
-llnl_gamma 4.1
log_k 3.348
delta_h 22.358 #kJ/mol #95haa/sho
-analytic 1.6475836E+3 2.6116032E-1 -8.9472694E+4 -5.977727E+2 5.079554E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ge(OH)4 = GeO(OH)3- + 1.000H+
-llnl_gamma 4.5
log_k -9.309
delta_h 27.364 #kJ/mol #98pok/sch
-analytic -2.3900693E+2 -5.2430713E-2 9.7373534E+3 8.8864806E+1 -6.41759E+5
#References = LogK/DGf: 98pok/sch; DHf/DHr: Internal calculation; S°: 98pok/sch; Cp: 98pok/sch; V°: 98pok/sch;
3.000H2AsO3- + 6.000HS- + 8.000H+ = H2As3S6- + 9.000H2O
-llnl_gamma 3.6
log_k 100.884
delta_h -503.405 #kJ/mol #Internal calculation
-analytic 5.1888519E+3 8.3909978E-1 -2.5779944E+5 -1.8854132E+3 1.7054239E+7
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000CrO4-2 + 2.000H+ = H2CrO4
-llnl_gamma 3.4
log_k 6.320
delta_h 39.595 #kJ/mol #Internal calculation
-analytic 1.3545765E+3 2.1151373E-1 -7.6293881E+4 -4.8721707E+2 4.4587595E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value;
0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H2O + 0.666666666666667H+ = H2N2O2
-llnl_gamma 3.4
log_k -35.639
delta_h 210.897 #kJ/mol #97asho/sas
-analytic 5.37306E+2 8.1090449E-2 -4.026654E+4 -1.9437679E+2 1.6805592E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H2PO4- = H2P2O7-2 + 1.000H2O
-llnl_gamma 4.7
log_k -1.761
delta_h 24.397 #kJ/mol #Internal calculation
-analytic 1.1707091E+2 1.9088425E-2 -9.8580261E+3 -4.0391015E+1 7.5435483E+5
#References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000F- + 1.000H2PO4- + 2.000H+ = H2PO3F + 1.000H2O
-llnl_gamma 3.4
log_k 3.725
#References = LogK/DGf: 82wag/eva;
#References = LogK/DGf: 82wag/eva; V°: Default value;
1.000HS- + 1.000H+ = H2S
-llnl_gamma 3.4
log_k 6.989
delta_h -22.300 #kJ/mol #89cox/wag
-analytic 7.4840577E+2 1.1981793E-1 -4.1347022E+4 -2.703232E+2 2.7054536E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89bsho/hel, 01sch/sho; V°: 89bsho/hel, 01sch/sho;
1.000S2O3-2 + 2.000H+ = H2S2O3
-llnl_gamma 3.4
log_k 2.320
delta_h 22.917 #kJ/mol #Internal calculation
-analytic 1.4978525E+3 2.381435E-1 -8.4048925E+4 -5.4206627E+2 5.0379569E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000S2O4-2 + 2.000H+ = H2S2O4
-llnl_gamma 3.4
log_k 2.800
delta_h 20.193 #kJ/mol #Internal calculation
-analytic 1.5238155E+3 2.4187869E-1 -8.5504151E+4 -5.5133604E+2 5.1465525E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
4.000HS- + 2.000Sb(OH)3 + 4.000H+ = H2Sb2S4 + 6.000H2O
-llnl_gamma 3.4
log_k 58.081
delta_h -307.718 #kJ/mol #Internal calculation
-analytic 2.6641369E+3 4.3670693E-1 -1.2861198E+5 -9.7061511E+2 8.6076208E+6
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000SeO3-2 + 2.000H+ = H2SeO3
-llnl_gamma 3.4
log_k 9.859
delta_h 1.856 #kJ/mol #97asho/sas
-analytic 1.5653292E+3 2.4888806E-1 -8.681006E+4 -5.6508583E+2 5.3117488E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H4SiO4 = H2SiO4-2 + 2.000H+
-llnl_gamma 4.7
log_k -23.270
delta_h 75.000 #kJ/mol #92gre/fug
-analytic 1.8444997E+2 9.7943151E-3 -1.169742E+4 -6.9072336E+1 -4.3719491E+4
#References = LogK/DGf: 01fel/cho; DHf/DHr: 92gre/fug; S°: Internal calculation; V°: Default value;
1.000SO3-2 + 2.000H+ = H2SO3
-llnl_gamma 3.4
log_k 9.030
delta_h 21.452 #kJ/mol #Internal calculation
-analytic 1.2947646E+3 2.1816377E-1 -7.3029819E+4 -4.6771779E+2 4.5780383E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value;
1.000VO2+ + 2.000H2O = H2VO4- + 2.000H+
-llnl_gamma 3.6
log_k -7.084
delta_h 47.506 #kJ/mol #97asho/sas
-analytic -2.1038168E+2 -4.1213894E-2 6.4158857E+3 7.9915055E+1 -3.2698691E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
3.000H2AsO3- + 6.000HS- + 9.000H+ = H3As3S6 + 9.000H2O
-llnl_gamma 3.4
log_k 104.464
delta_h -520.971 #kJ/mol #Internal calculation
-analytic 5.1998117E+3 8.4127029E-1 -2.5689763E+5 -1.8896477E+3 1.700323E+7
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000H2AsO4- + 1.000H+ = H3AsO4
-llnl_gamma 3.4
log_k 2.302
delta_h 11.056 #kJ/mol #Internal calculation
-analytic 1.6315873E+2 4.0730166E-2 -7.3546434E+3 -6.1578557E+1 3.5904024E+5
#References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok;
2.000H2PO4- + 1.000H+ = H3P2O7- + 1.000H2O
-llnl_gamma 3.6
log_k 0.489
delta_h 26.523 #kJ/mol #Internal calculation
-analytic 8.3061274E+2 1.3309825E-1 -4.8202369E+4 -2.996259E+2 2.9574473E+6
#References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2PO2- + 1.000H+ = H3PO2
-llnl_gamma 3.4
log_k 1.969
delta_h 4.727 #kJ/mol #97asho/sas
-analytic 6.8841428E+2 1.0842507E-1 -3.7571028E+4 -2.4947228E+2 2.1818556E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2PO3- + 1.000H+ = H3PO3
-llnl_gamma 3.4
log_k 1.777
delta_h 4.700 #kJ/mol #97asho/sas
-analytic 7.1612589E+2 1.1249268E-1 -3.9032552E+4 -2.5960426E+2 2.2579962E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2PO4- + 1.000H+ = H3PO4
-llnl_gamma 3.4
log_k 2.140
delta_h 8.480 #kJ/mol #92gre/fug
-analytic 7.1025826E+2 1.120357E-1 -3.9337244E+4 -2.5690319E+2 2.3206747E+6
#References = LogK/DGf: 92gre/fug; DHf/DHr: 92gre/fug; S°: Internal calculation; Cp: 89bsho/hel; V°: 89bsho/hel;
1.000VO2+ + 2.000H2O = H3VO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.265
delta_h 35.811 #kJ/mol #97asho/sas
-analytic 3.0523392E+2 4.1966796E-2 -1.8681863E+4 -1.0878304E+2 9.6218428E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H2PO4- + 2.000H+ = H4P2O7 + 1.000H2O
-llnl_gamma 3.4
log_k 1.489
delta_h 39.160 #kJ/mol #92gre/fug
-analytic 1.6126525E+3 2.5529404E-1 -9.1325765E+4 -5.8281122E+2 5.436486E+6
#References = LogK/DGf: 92gre/fug; DHf/DHr: 92gre/fug; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas;
1.000Al+3 + 2.000H2O = HAlO2 + 3.000H+
-llnl_gamma 3.4
log_k -16.419
delta_h 144.671 #kJ/mol #Internal calculation
-analytic 3.0111681E+2 5.3614646E-2 -2.3398929E+4 -1.0760033E+2 9.9640736E+5
#References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel;
3.000H2AsO3- + 6.000HS- + 7.000H+ = HAs3S6-2 + 9.000H2O
-llnl_gamma 4.7
log_k 92.977
delta_h -475.787 #kJ/mol #Internal calculation
-analytic 4.2493503E+3 6.9212628E-1 -2.0833961E+5 -1.5448174E+3 1.4097958E+7
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000H2AsO4- = HAsO4-2 + 1.000H+
-llnl_gamma 4.7
log_k -6.960
delta_h 4.299 #kJ/mol #Internal calculation
-analytic -7.549673E+2 -1.2127731E-1 4.1238812E+4 2.7249295E+2 -2.5259568E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Be+2 + 2.000H2O = HBeO2- + 3.000H+
-llnl_gamma 3.6
log_k -23.240
delta_h 89.448 #kJ/mol #97asho/sas
-analytic -1.7137505E+2 -3.4273976E-2 1.1241032E+3 6.2929524E+1 -1.005633E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Bi+3 + 2.000H2O = HBiO2 + 3.000H+
-llnl_gamma 3.4
log_k -8.191
delta_h 129.295 #kJ/mol #97asho/sas
-analytic 9.1087347E+1 1.0428909E-2 -6.7213732E+2 -3.3966638E+1 -1.4298866E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000BrO- + 1.000H+ = HBrO
-llnl_gamma 3.4
log_k 8.576
delta_h -18.890 #kJ/mol #97asho/sas
-analytic 7.253877E+2 1.1480283E-1 -3.8836477E+4 -2.6179657E+2 2.4016072E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cd+2 + 2.000H2O = HCdO2- + 3.000H+
-llnl_gamma 3.6
log_k -33.299
delta_h 156.473 #kJ/mol #Internal calculation
-analytic -3.516615E+2 -6.1079417E-2 1.0635961E+4 1.2688406E+2 -1.1615318E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- + 1.000H+ = HCl
-llnl_gamma 3.4
log_k -0.710
delta_h -12.298 #kJ/mol #Internal calculation
-analytic 4.7680511E+2 9.0813234E-2 -2.5457077E+4 -1.770237E+2 1.673506E+6
#References = LogK/DGf: 97tag/zot; DHf/DHr: Internal calculation; S°: 99aki/zot, d'apres 97tag/zot; Cp: 99aki/zot, d'apres 97tag/zot; V°: 99aki/zot, d'apres 97tag/zot;
1.000ClO- + 1.000H+ = HClO
-llnl_gamma 3.4
log_k 7.550
delta_h -13.281 #kJ/mol #97asho/sas
-analytic 7.2521759E+2 1.1476363E-1 -3.9121335E+4 -2.617481E+2 2.4008143E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000ClO2- + 1.000H+ = HClO2
-llnl_gamma 3.4
log_k 1.979
delta_h 14.650 #kJ/mol #97asho/sas
-analytic 7.8823545E+2 1.2433371E-1 -4.4591826E+4 -2.8450347E+2 2.6864106E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000CN- + 1.000H+ = HCN
-llnl_gamma 3.4
log_k 9.236
delta_h -43.612 #kJ/mol #93sho/mck
-analytic 6.7984466E+2 1.0836107E-1 -3.6475991E+4 -2.458413E+2 2.4661422E+6
#References = LogK/DGf: 93sho/mck; DHf/DHr: Internal calculation; S°: 93sho/mck; Cp: 93sho/mck; V°: 93sho/mck;
1.000Co+2 + 2.000H2O = HCoO2- + 3.000H+
-llnl_gamma 3.6
log_k -31.699
delta_h 139.444 #kJ/mol #Internal calculation
-analytic -1.951837E+2 -3.7858926E-2 7.0808385E+2 7.1116015E+1 -3.1778511E+5
#References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cr+3 + 2.000H2O = HCrO2 + 3.000H+
-llnl_gamma 3.4
log_k -16.189
delta_h 154.240 #kJ/mol #97asho/sas
-analytic 3.6735811E+2 5.8200917E-2 -2.3439453E+4 -1.3253915E+2 5.0453384E+5
#References = LogK/DGf: 87rai/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000CrO4-2 + 1.000H+ = HCrO4-
-llnl_gamma 3.6
log_k 6.520
delta_h 7.379 #kJ/mol #97asho/sas
-analytic 8.4378626E+2 1.3502887E-1 -4.740433E+4 -3.0371949E+2 2.9338263E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cu+2 + 2.000H2O = HCuO2- + 3.000H+
-llnl_gamma 3.6
log_k -26.599
delta_h 139.437 #kJ/mol #Internal calculation
-analytic -1.9630819E+0 -4.8454332E-3 -4.8866403E+3 -7.6413323E-1 -4.3655109E+5
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000F- + 1.000H+ = HF
-llnl_gamma 3.4
log_k 3.208
delta_h 13.871 #kJ/mol #89bsho/hel
-analytic 6.685259E+2 1.0837656E-1 -3.7235003E+4 -2.4153097E+2 2.2142404E+6
#References = LogK/DGf: 89bsho/hel; DHf/DHr: Internal calculation; S°: 89bsho/hel; Cp: 89bsho/hel; V°: 89bsho/hel;
2.000F- + 1.000H+ = HF2-
-llnl_gamma 3.6
log_k 2.630
delta_h 20.783 #kJ/mol #88sho/hel
-analytic 7.3983285E+2 1.1859498E-1 -4.0367651E+4 -2.6775612E+2 2.2558792E+6
#References = LogK/DGf: 88sho/hel; DHf/DHr: Internal calculation; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel;
1.000Fe+3 + 2.000H2O = HFeO2 + 3.000H+
-llnl_gamma 3.4
log_k -14.299
delta_h 150.624 #kJ/mol #Internal calculation
-analytic 2.8403883E+2 4.3661342E-2 -1.6755709E+4 -1.0274206E+2 -8.2526659E+4
#References = LogK/DGf: 07ste; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Fe+2 + 2.000H2O = HFeO2- + 3.000H+
-llnl_gamma 3.6
log_k -31.929
delta_h 152.120 #kJ/mol #Internal calculation
-analytic -2.1867164E+2 -4.1451824E-2 2.1450309E+3 7.9872634E+1 -5.0962263E+5
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hf+4 + 1.000H2O = HfO+2 + 2.000H+
-llnl_gamma 5.7
log_k -2.402
delta_h 73.943 #kJ/mol #97asho/sas
-analytic 2.3087962E+2 3.8441027E-2 -1.3351566E+4 -8.2329949E+1 3.3408399E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hf+4 + 2.000H2O = HfO2 + 4.000H+
-llnl_gamma 3.4
log_k -10.669
delta_h 101.647 #kJ/mol #97asho/sas
-analytic 6.3229225E+2 1.055366E-1 -3.8059279E+4 -2.2939535E+2 1.8532929E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hf+4 + 1.000H2O = HfOH+3 + 1.000H+
-llnl_gamma 8.2
log_k -0.203
delta_h 28.209 #kJ/mol #97asho/sas
-analytic 2.0533269E+2 3.2551789E-2 -1.3507144E+4 -7.2442957E+1 8.2823499E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hg+2 + 2.000HS- = Hg(HS)2
-llnl_gamma 3.4
log_k 39.759
delta_h -194.111 #kJ/mol #Internal calculation
-analytic 1.5703288E+3 2.4882753E-1 -7.6284095E+4 -5.687611E+2 5.1969865E+6
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000Hg+2 + 2.000H2O = Hg(OH)2 + 2.000H+
-llnl_gamma 3.4
log_k -6.074
delta_h 50.266 #kJ/mol #Internal calculation
-analytic 2.5504881E+2 3.4576584E-2 -1.5730388E+4 -9.1319729E+1 6.4825247E+5
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 12bla; Cp: 05bes/app; V°: 05bes/app;
1.000HCO3- + 1.000Hg+2 + 1.000H2O = Hg(OH)CO3- + 2.000H+
-llnl_gamma 3.6
log_k -5.095
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
1.000Hg2+2 + 1.000H2O = Hg2(OH)+ + 1.000H+
-llnl_gamma 4.1
log_k -5.000
#References = LogK/DGf: 76bae/mes;
#References = LogK/DGf: 76bae/mes; V°: Default value;
2.000Hg+2 + 1.000H2O = Hg2(OH)+3 + 1.000H+
-llnl_gamma 8.2
log_k -3.330
delta_h 12.803 #kJ/mol #76bae/mes
-analytic 5.8590903E+2 8.7693177E-2 -3.1204346E+4 -2.1362369E+2 1.5888227E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: 76bae/mes; S°: Internal calculation; V°: Default value;
3.000Hg+2 + 3.000H2O = Hg3(OH)3+3 + 3.000H+
-llnl_gamma 8.2
log_k -6.420
#References = LogK/DGf: 76bae/mes;
#References = LogK/DGf: 76bae/mes; V°: Default value;
1.000Hg+2 + 1.000Cl- = HgCl+
-llnl_gamma 4.1
log_k 7.210
delta_h -32.683 #kJ/mol #Internal calculation
-analytic 8.3901966E+2 1.3660176E-1 -4.524016E+4 -3.0460641E+2 2.9270363E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
2.000Cl- + 1.000Hg+2 = HgCl2
-llnl_gamma 3.4
log_k 13.980
delta_h -72.022 #kJ/mol #Internal calculation
-analytic 1.628757E+3 2.6423967E-1 -8.7765028E+4 -5.9148558E+2 5.7245444E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
3.000Cl- + 1.000Hg+2 = HgCl3-
-llnl_gamma 3.6
log_k 15.060
delta_h -87.739 #kJ/mol #Internal calculation
-analytic 1.7509172E+3 2.8619069E-1 -9.6316803E+4 -6.3530984E+2 6.5688689E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
4.000Cl- + 1.000Hg+2 = HgCl4-2
-llnl_gamma 4.7
log_k 15.420
delta_h -109.351 #kJ/mol #Internal calculation
-analytic 1.6653929E+3 2.7781643E-1 -9.2970913E+4 -6.0481699E+2 6.7205484E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Hg+2 = HgCO3 + 1.000H+
-llnl_gamma 3.4
log_k 1.050
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
1.000F- + 1.000Hg+2 = HgF+
-llnl_gamma 4.1
log_k 1.667
delta_h -0.202 #kJ/mol #97sve/sho
-analytic 8.7968696E+2 1.4114389E-1 -4.9515774E+4 -3.1881056E+2 3.0980316E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Hg+2 = HgHCO3+
-llnl_gamma 4.1
log_k 5.380
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
1.000Hg+2 + 1.000H2PO4- = HgHPO4 + 1.000H+
-llnl_gamma 3.4
log_k 1.587
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
1.000Hg+2 + 1.000H2O = HgOH+ + 1.000H+
-llnl_gamma 4.1
log_k -3.400
delta_h 30.174 #kJ/mol #Internal calculation
-analytic 2.5448996E+2 3.8721267E-2 -1.6514553E+4 -9.0978336E+1 9.8455322E+5
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hg+2 + 1.000Cl- + 1.000H2O = HgOHCl + 1.000H+
-llnl_gamma 3.4
log_k 4.060
delta_h 0.005 #kJ/mol #76bae/mes
-analytic 9.4079578E+2 1.4495159E-1 -5.0409798E+4 -3.406853E+2 2.8557973E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: 76bae/mes; S°: Internal calculation; V°: Default value;
1.000Hg+2 + 1.000H2PO4- = HgPO4- + 2.000H+
-llnl_gamma 3.6
log_k -3.962
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
1.000Hg+2 + 2.000HS- = HgS(HS)- + 1.000H+
-llnl_gamma 3.6
log_k 33.628
delta_h -176.127 #kJ/mol #Internal calculation
-analytic 1.0519057E+3 1.673117E-1 -4.8800229E+4 -3.8143431E+2 3.4978895E+6
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000Hg+2 + 2.000HS- = HgS2-2 + 2.000H+
-llnl_gamma 4.7
log_k 25.328
#References = LogK/DGf: 63sch/wid;
#References = LogK/DGf: 63sch/wid; V°: Default value;
1.000Hg + 1.000HSO5- + 1.000H+ = HgSO4 + 1.000H2O
-llnl_gamma 3.4
log_k 39.255
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
1.000Hf+4 + 2.000H2O = HHfO2+ + 3.000H+
-llnl_gamma 4.1
log_k -5.978
delta_h 67.509 #kJ/mol #97asho/sas
-analytic 6.1003011E+2 9.6257534E-2 -3.8336254E+4 -2.1878112E+2 2.2430609E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hf+4 + 3.000H2O = HHfO3- + 5.000H+
-llnl_gamma 3.6
log_k -17.176
delta_h 131.409 #kJ/mol #97asho/sas
-analytic 8.7243783E+1 9.1189023E-3 -1.190634E+4 -2.8625359E+1 3.2241806E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Hg+2 + 2.000H2O = HHgO2- + 3.000H+
-llnl_gamma 3.6
log_k -21.099
delta_h 92.387 #kJ/mol #Internal calculation
-analytic -3.9741873E+2 -6.8982004E-2 1.8309097E+4 1.428694E+2 -1.6039648E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000In+3 + 2.000H2O = HInO2 + 3.000H+
-llnl_gamma 3.4
log_k -12.428
delta_h 141.752 #kJ/mol #97asho/sas
-analytic 2.4945689E+2 3.7724642E-2 -1.374409E+4 -9.0375438E+1 -3.0281458E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000IO- + 1.000H+ = HIO
-llnl_gamma 3.4
log_k 10.629
delta_h -30.480 #kJ/mol #97asho/sas
-analytic 6.4143044E+2 1.0206306E-1 -3.3047826E+4 -2.3170884E+2 2.0409398E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000IO3- + 1.000H+ = HIO3
-llnl_gamma 3.4
log_k 0.806
delta_h 9.868 #kJ/mol #97asho/sas
-analytic 7.1654677E+2 1.1308546E-1 -4.0076957E+4 -2.594041E+2 2.3859365E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Mn+2 + 2.000H2O = HMnO2- + 3.000H+
-llnl_gamma 3.6
log_k -34.785
delta_h 165.700 #kJ/mol #97asho/sas
-analytic -3.4178178E+2 -5.8907129E-2 9.9726351E+3 1.2301493E+2 -1.1805526E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000MoO4-2 + 1.000H+ = HMoO4-
-llnl_gamma 3.6
log_k 4.398
delta_h 4.211 #kJ/mol #97asho/sas
-analytic 7.9784108E+2 1.2859409E-1 -4.5530162E+4 -2.8764328E+2 2.9050439E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H2O = HN2O2- + 0.333333333333333H+
-llnl_gamma 3.6
log_k -42.676
delta_h 228.610 #kJ/mol #97asho/sas
-analytic -2.4262613E+2 -4.1231924E-2 1.457473E+3 8.7665055E+1 -8.5036888E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000NbO3- + 1.000H+ = HNbO3
-llnl_gamma 3.4
log_k 7.110
delta_h -5.781 #kJ/mol #97asho/sas
-analytic 9.7366392E+2 1.5468766E-1 -5.4365139E+4 -3.5110892E+2 3.4191788E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ni+2 + 2.000H2O = HNiO2- + 3.000H+
-llnl_gamma 3.6
log_k -31.499
delta_h 128.446 #kJ/mol #Internal calculation
-analytic -1.5708374E+2 -3.1961335E-2 -1.8863724E+3 5.7311697E+1 -3.3200996E+4
#References = LogK/DGf: 12bla; DHf/DHr: Internal calculation; S°: 12coo/oli; Cp: 97asho/sas; V°: 97asho/sas;
1.000NO2- + 1.000H+ = HNO2
-llnl_gamma 3.4
log_k 3.225
delta_h -14.668 #kJ/mol #97asho/sas
-analytic 6.440201E+2 1.0196703E-1 -3.477125E+4 -2.3381749E+2 2.1328321E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000NO3- + 1.000H+ = HNO3
-llnl_gamma 3.4
log_k -1.303
delta_h 16.890 #kJ/mol #97asho/sas
-analytic 7.1469679E+2 1.1228921E-1 -4.0454654E+4 -2.5890435E+2 2.3867115E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- + 1.000Ho+3 = HoCl+2
-llnl_gamma 5.7
log_k 0.248
delta_h 14.019 #kJ/mol #95haa/sho
-analytic 8.30936E+2 1.3592313E-1 -4.7056266E+4 -3.0142634E+2 2.8866931E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Ho+3 = HoCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 17.744 #kJ/mol #95haa/sho
-analytic 1.6030059E+3 2.6130157E-1 -8.9033175E+4 -5.8291466E+2 5.3400537E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Ho+3 = HoCl3
-llnl_gamma 3.4
log_k -0.429
delta_h 9.832 #kJ/mol #95haa/sho
-analytic 2.3395084E+3 3.8054766E-1 -1.2692279E+5 -8.5314333E+2 7.4093196E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Ho+3 = HoCl4-
-llnl_gamma 3.6
log_k -0.841
delta_h -12.427 #kJ/mol #95haa/sho
-analytic 2.2089413E+3 3.5855886E-1 -1.1752471E+5 -8.0770811E+2 6.7660298E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Ho+3 = HoCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.243
delta_h -7.432 #kJ/mol #95haa/sho
-analytic 7.2948334E+2 1.1872287E-1 -3.6463635E+4 -2.6909442E+2 1.8697064E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Ho+3 = HoF+2
-llnl_gamma 5.7
log_k 4.775
delta_h 22.390 #kJ/mol #95haa/sho
-analytic 9.235634E+2 1.4924318E-1 -5.2178725E+4 -3.3290883E+2 3.1543171E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Ho+3 = HoF2+
-llnl_gamma 4.1
log_k 8.377
delta_h 11.307 #kJ/mol #95haa/sho
-analytic 1.7668683E+3 2.8396018E-1 -9.7562456E+4 -6.3933872E+2 5.8735722E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Ho+3 = HoF3
-llnl_gamma 3.4
log_k 11.027
delta_h -13.048 #kJ/mol #95haa/sho
-analytic 2.5885864E+3 4.1573881E-1 -1.394832E+5 -9.4019803E+2 8.2471101E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Ho+3 = HoF4-
-llnl_gamma 3.6
log_k 13.163
delta_h -57.927 #kJ/mol #95haa/sho
-analytic 2.5952669E+3 4.1115742E-1 -1.3747882E+5 -9.4382861E+2 8.1655564E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ho+3 + 1.000H2PO4- = HoH2PO4+2
-llnl_gamma 5.7
log_k 1.037
delta_h -7.549 #kJ/mol #95haa/sho
-analytic 8.6398893E+2 1.3798258E-1 -4.956159E+4 -3.1290317E+2 3.2354506E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Ho+3 = HoHCO3+2
-llnl_gamma 5.7
log_k 1.716
delta_h 7.399 #kJ/mol #95haa/sho
-analytic 8.740395E+2 1.400801E-1 -5.0409954E+4 -3.1571845E+2 3.2189952E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ho+3 + 1.000NO3- = HoNO3+2
-llnl_gamma 5.7
log_k 0.215
delta_h -29.818 #kJ/mol #95haa/sho
-analytic 7.9393802E+2 1.2608632E-1 -4.4812801E+4 -2.8888958E+2 3.0068565E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ho+3 + 1.000H2O = HoO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.036
delta_h 145.778 #kJ/mol #95haa/sho
-analytic 2.0182629E+2 3.2811956E-2 -1.4241552E+4 -7.2768876E+1 1.624869E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ho+3 + 2.000H2O = HoO2- + 4.000H+
-llnl_gamma 3.6
log_k -33.465
delta_h 254.473 #kJ/mol #95haa/sho
-analytic -2.0577818E+2 -3.6606642E-2 3.3101648E+3 7.6324873E+1 -1.4877272E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ho+3 + 2.000H2O = HoO2H + 3.000H+
-llnl_gamma 3.4
log_k -24.523
delta_h 216.527 #kJ/mol #95haa/sho
-analytic 2.1580819E+2 3.1415206E-2 -1.5301138E+4 -7.7913743E+1 -4.9642473E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ho+3 + 1.000H2O = HoOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.753
delta_h 79.039 #kJ/mol #95haa/sho
-analytic 1.4826432E+2 2.2747286E-2 -1.0866063E+4 -5.240166E+1 2.9420983E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Ho+3 + 1.000SO4-2 = HoSO4+
-llnl_gamma 4.1
log_k 3.649
delta_h 20.183 #kJ/mol #95haa/sho
-analytic 1.6456043E+3 2.6077455E-1 -8.927716E+4 -5.9705393E+2 5.0761041E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000H2PO4- = HP2O7-3 + 1.000H2O + 1.000H+
-llnl_gamma 6.7
log_k -8.411
delta_h 27.426 #kJ/mol #Internal calculation
-analytic -5.4508318E+2 -9.0484926E-2 2.5827196E+4 1.9921533E+2 -1.415148E+6
#References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Pb+2 + 2.000H2O = HPbO2- + 3.000H+
-llnl_gamma 3.6
log_k -27.199
delta_h 130.485 #kJ/mol #Internal calculation
-analytic -4.0970302E+2 -7.1282023E-2 1.8365533E+4 1.4675885E+2 -1.8656159E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2PO3- = HPO3-2 + 1.000H+
-llnl_gamma 4.7
log_k -6.144
delta_h 0.516 #kJ/mol #97asho/sas
-analytic -7.7016674E+2 -1.2356881E-1 4.2208754E+4 2.7809573E+2 -2.5631627E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000F- + 1.000H2PO4- + 1.000H+ = HPO3F- + 1.000H2O
-llnl_gamma 3.6
log_k 2.920
#References = LogK/DGf: 82wag/eva;
#References = LogK/DGf: 82wag/eva; V°: Default value;
1.000H2PO4- = HPO4-2 + 1.000H+
-llnl_gamma 4.0
log_k -7.212
delta_h 3.600 #kJ/mol #89cox/wag
-analytic -7.4660952E+2 -1.2024237E-1 4.0983294E+4 2.692598E+2 -2.5314009E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
1.000S2O3-2 + 1.000H+ = HS2O3-
-llnl_gamma 3.6
log_k 1.720
delta_h 8.253 #kJ/mol #Internal calculation
-analytic 7.6374624E+2 1.2282783E-1 -4.3349935E+4 -2.7623756E+2 2.691769E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000S2O4-2 + 1.000H+ = HS2O4-
-llnl_gamma 3.6
log_k 2.500
delta_h 3.818 #kJ/mol #Internal calculation
-analytic 7.6786272E+2 1.233539E-1 -4.3511107E+4 -2.7760873E+2 2.7308934E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
4.000HS- + 2.000Sb(OH)3 + 3.000H+ = HSb2S4- + 6.000H2O
-llnl_gamma 3.6
log_k 53.020
delta_h -302.105 #kJ/mol #Internal calculation
-analytic 2.1999422E+3 3.6360416E-1 -1.0258034E+5 -8.0392889E+2 6.9332366E+6
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000Sc+3 + 2.000H2O = HScO2 + 3.000H+
-llnl_gamma 3.4
log_k -16.093
delta_h 164.044 #kJ/mol #97asho/sas
-analytic 2.3904793E+2 3.5869316E-2 -1.3955722E+4 -8.6703197E+1 -3.9880228E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000SeO3-2 + 1.000H+ = HSeO3-
-llnl_gamma 3.6
log_k 7.286
delta_h -5.164 #kJ/mol #97asho/sas
-analytic 7.9467131E+2 1.2793593E-1 -4.4347776E+4 -2.8632355E+2 2.8181688E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000SeO4-2 + 1.000H+ = HSeO4-
-llnl_gamma 3.6
log_k 1.906
delta_h 17.563 #kJ/mol #97asho/sas
-analytic 7.9284838E+2 1.2748511E-1 -4.5583015E+4 -2.8606089E+2 2.824407E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H4SiO4 = HSiO3- + 1.000H2O + 1.000H+
-llnl_gamma 3.6
log_k -9.820
delta_h 29.249 #kJ/mol #Internal calculation
-analytic -5.8169918E+2 -9.3104803E-2 3.1944291E+4 2.0897781E+2 -2.1872745E+6
#References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Sn+2 + 2.000H2O = HSnO2- + 3.000H+
-llnl_gamma 3.6
log_k -16.584
delta_h 69.671 #kJ/mol #97asho/sas
-analytic -3.9144694E+2 -6.7898528E-2 1.9173616E+4 1.4087015E+2 -1.5801606E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000SO3-2 + 1.000H+ = HSO3-
-llnl_gamma 4.2
log_k 7.170
delta_h 3.667 #kJ/mol #Internal calculation
-analytic 8.1037722E+2 1.3067662E-1 -4.5360157E+4 -2.9173848E+2 2.8319756E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas;
1.000SO4-2 + 1.000H+ = HSO4-
-llnl_gamma 3.6
log_k 1.982
delta_h 22.440 #kJ/mol #04chi
-analytic 8.1698382E+2 1.2949891E-1 -4.7437648E+4 -2.9402229E+2 2.936438E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas;
1.000Tl+3 + 2.000H2O = HTlO2 + 3.000H+
-llnl_gamma 3.4
log_k -3.299
delta_h 100.748 #kJ/mol #Internal calculation
-analytic 9.9888596E+1 1.1922988E-2 1.2344241E+2 -3.7092635E+1 -1.366605E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000U+4 + 2.000H2O = HUO2+ + 3.000H+
-llnl_gamma 4.1
log_k -4.988
delta_h 96.790 #kJ/mol #97bsho/sas
-analytic 3.7763911E+2 6.0546026E-2 -2.1655184E+4 -1.3557093E+2 6.5908462E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000U+3 + 2.000H2O = HUO2 + 3.000H+
-llnl_gamma 3.4
log_k -21.187
delta_h 202.729 #kJ/mol #97bsho/sas
-analytic 1.6270551E+2 2.2126769E-2 -1.0494373E+4 -5.8842701E+1 -8.613161E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000U+4 + 3.000H2O = HUO3- + 5.000H+
-llnl_gamma 3.6
log_k -16.553
delta_h 104.650 #kJ/mol #97bsho/sas
-analytic 1.1664748E+2 1.3247146E-2 -1.3203135E+4 -4.0068079E+1 5.5818665E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000UO2+2 + 2.000H2O = HUO4- + 3.000H+
-llnl_gamma 3.6
log_k -19.230
delta_h 72.175 #kJ/mol #97bsho/sas
-analytic -3.6154088E+2 -6.0676487E-2 1.5385894E+4 1.3001175E+2 -1.1475142E+6
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000VO2+ + 2.000H2O = HVO4-2 + 3.000H+
-llnl_gamma 4.7
log_k -15.140
delta_h 62.301 #kJ/mol #97asho/sas
-analytic -6.7215301E+2 -1.1795716E-1 2.5803944E+4 2.4962048E+2 -1.0698044E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000WO4-2 + 1.000H+ = HWO4-
-llnl_gamma 3.6
log_k 3.592
delta_h 6.318 #kJ/mol #97asho/sas
-analytic 7.945168E+2 1.2806601E-1 -4.5447682E+4 -2.8660276E+2 2.889406E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Y+3 + 2.000H2O = HYO2 + 3.000H+
-llnl_gamma 3.4
log_k -25.989
delta_h 221.152 #kJ/mol #97asho/sas
-analytic 2.2343843E+2 3.3226388E-2 -1.5839398E+4 -8.1108271E+1 -4.8987062E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Zn+2 + 2.000H2O = HZnO2- + 3.000H+
-llnl_gamma 3.6
log_k -27.733
delta_h 129.317 #kJ/mol #97asho/sas
-analytic -2.0589946E+2 -4.077416E-2 2.6672542E+3 7.550614E+1 -4.8517335E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000ZrO+2 + 1.000H2O = HZrO2+ + 1.000H+
-llnl_gamma 4.1
log_k -3.355
delta_h 2.913 #kJ/mol #97asho/sas
-analytic 3.3229766E+2 5.1263668E-2 -2.2024667E+4 -1.1941399E+2 1.6370614E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000ZrO+2 + 2.000H2O = HZrO3- + 3.000H+
-llnl_gamma 3.6
log_k -14.261
delta_h 65.514 #kJ/mol #97asho/sas
-analytic -1.6630156E+2 -3.272255E-2 3.0769802E+3 6.2127795E+1 -2.0038157E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- + 1.000In+3 = InCl+2
-llnl_gamma 5.7
log_k 3.272
delta_h -5.365 #kJ/mol #97sve/sho
-analytic 8.0564837E+2 1.3148067E-1 -4.3715489E+4 -2.9287838E+2 2.6449128E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000In+3 = InF+2
-llnl_gamma 5.7
log_k 4.640
delta_h 26.865 #kJ/mol #97sve/sho
-analytic 8.9887702E+2 1.4513202E-1 -4.9986462E+4 -3.2432121E+2 2.9031806E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000In+3 + 1.000H2O = InO+ + 2.000H+
-llnl_gamma 4.1
log_k -7.827
delta_h 99.167 #kJ/mol #97asho/sas
-analytic 1.7999311E+2 2.9477107E-2 -1.0184982E+4 -6.5096607E+1 -1.2182196E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000In+3 + 2.000H2O = InO2- + 4.000H+
-llnl_gamma 3.6
log_k -22.030
delta_h 182.466 #kJ/mol #97asho/sas
-analytic -2.150161E+2 -3.8048615E-2 6.808841E+3 7.9720336E+1 -1.4018343E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000In+3 + 1.000H2O = InOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -4.015
delta_h 24.892 #kJ/mol #97asho/sas
-analytic 1.7814483E+2 2.6786047E-2 -1.1493918E+4 -6.4158541E+1 6.3654978E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Al+3 + 1.000K+ + 2.000H2O = KAlO2 + 4.000H+
-llnl_gamma 3.4
log_k -24.221
delta_h 211.675 #kJ/mol #97apok/hel
-analytic 6.0684613E+2 9.1807292E-2 -4.2432883E+4 -2.1638658E+2 1.7170012E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97apok/hel; S°: 97apok/hel; Cp: 97apok/hel; V°: 97apok/hel;
1.000H2AsO4- + 1.000K+ = KAsO4-2 + 2.000H+
-llnl_gamma 4.7
log_k -14.003
delta_h 119.613 #kJ/mol #Internal calculation
-analytic -2.515611E+2 -5.1873631E-2 1.000985E+4 9.4532457E+1 -1.2856881E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Br- + 1.000K+ = KBr
-llnl_gamma 3.4
log_k -1.746
delta_h 14.345 #kJ/mol #97sve/sho
-analytic 6.5419032E+2 1.0441276E-1 -3.6116409E+4 -2.3806473E+2 2.0573592E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cl- + 1.000K+ = KCl
-llnl_gamma 3.4
log_k -0.500
delta_h 4.180 #kJ/mol #97smi/mar
-analytic 7.8954676E+2 1.2046966E-1 -4.47224E+4 -2.855347E+2 2.7176383E+6
#References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; Cp: 97bpok/hel; V°: 97bpok/hel;
1.000H2AsO4- + 1.000K+ = KH2AsO4
-llnl_gamma 3.4
log_k -1.903
delta_h 13.748 #kJ/mol #Internal calculation
-analytic 6.6054908E+2 1.0281308E-1 -3.6977052E+4 -2.3970567E+2 2.13804E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000K+ + 1.000H2PO4- = KH2PO4
-llnl_gamma 3.4
log_k 0.440
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000H2AsO4- + 1.000K+ = KHAsO4- + 1.000H+
-llnl_gamma 3.6
log_k -6.434
delta_h 9.920 #kJ/mol #Internal calculation
-analytic 1.467403E+2 1.7322199E-2 -8.6602186E+3 -5.4068689E+1 3.9976957E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000K+ + 1.000H2PO4- = KHPO4- + 1.000H+
-llnl_gamma 3.6
log_k -6.432
delta_h 31.590 #kJ/mol #97smi/mar
-analytic 8.4152863E+2 1.2701334E-1 -4.7518341E+4 -3.0549548E+2 2.6202474E+6
#References = LogK/DGf: 89mar/smi; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value;
1.000I- + 1.000K+ = KI
-llnl_gamma 3.4
log_k -1.606
delta_h 8.560 #kJ/mol #97sve/sho
-analytic 6.1044268E+2 9.8874428E-2 -3.3332375E+4 -2.2276147E+2 1.9092241E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000K+ + 1.000H2O = KOH + 1.000H+
-llnl_gamma 3.4
log_k -14.460
delta_h 66.438 #kJ/mol #Internal calculation
-analytic 1.2132073E+2 1.3166159E-2 -1.0189264E+4 -4.4122918E+1 3.243138E+5
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97apok/hel; Cp: 97apok/hel; V°: 97apok/hel;
1.000K+ + 2.000H2PO4- = KP2O7-3 + 1.000H2O + 2.000H+
-llnl_gamma 6.7
log_k -15.710
delta_h 39.592 #kJ/mol #76smi/mar
-analytic 1.6898717E+3 2.6082183E-1 -9.4815762E+4 -6.1661111E+2 5.3719684E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value;
1.000K+ + 1.000H2PO4- = KPO4-2 + 2.000H+
-llnl_gamma 4.7
log_k -18.260
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000K+ + 1.000SO4-2 = KSO4-
-llnl_gamma 3.6
log_k 0.880
delta_h 2.949 #kJ/mol #Internal calculation
-analytic 9.1525391E+2 1.4348835E-1 -5.125381E+4 -3.3151921E+2 3.1178337E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cl- + 1.000La+3 = LaCl+2
-llnl_gamma 5.7
log_k 0.321
delta_h 14.100 #kJ/mol #95haa/sho
-analytic 8.1635365E+2 1.3260405E-1 -4.6231541E+4 -2.9594009E+2 2.824797E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000La+3 = LaCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 19.241 #kJ/mol #95haa/sho
-analytic 1.5772337E+3 2.5601855E-1 -8.7259189E+4 -5.7351591E+2 5.1747829E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000La+3 = LaCl3
-llnl_gamma 3.4
log_k -0.356
delta_h 12.158 #kJ/mol #95haa/sho
-analytic 2.2943871E+3 3.7167207E-1 -1.2361589E+5 -8.3685781E+2 7.0939249E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000La+3 = LaCl4-
-llnl_gamma 3.6
log_k -0.768
delta_h -7.980 #kJ/mol #95haa/sho
-analytic 2.1478116E+3 3.4713391E-1 -1.126144E+5 -7.8597892E+2 6.2657917E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000La+3 = LaCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -3.195
delta_h -1.369 #kJ/mol #95haa/sho
-analytic 8.8070388E+2 1.3716955E-1 -4.6016534E+4 -3.225356E+2 2.456756E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000La+3 = LaF+2
-llnl_gamma 5.7
log_k 3.895
delta_h 26.413 #kJ/mol #95haa/sho
-analytic 9.0882E+2 1.4587324E-1 -5.1579534E+4 -3.2743946E+2 3.0943374E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000La+3 = LaF2+
-llnl_gamma 4.1
log_k 6.765
delta_h 19.514 #kJ/mol #95haa/sho
-analytic 1.7394221E+3 2.7840438E-1 -9.6090191E+4 -6.2946552E+2 5.7065757E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000La+3 = LaF3
-llnl_gamma 3.4
log_k 8.828
delta_h -0.995 #kJ/mol #95haa/sho
-analytic 2.5428954E+3 4.068631E-1 -1.3668427E+5 -9.2391198E+2 7.9317093E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000La+3 = LaF4-
-llnl_gamma 3.6
log_k 10.524
delta_h -41.617 #kJ/mol #95haa/sho
-analytic 2.515919E+3 3.9700172E-1 -1.3225007E+5 -9.1569753E+2 7.6129792E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000La+3 + 1.000H2PO4- = LaH2PO4+2
-llnl_gamma 5.7
log_k 1.330
delta_h -7.975 #kJ/mol #95haa/sho
-analytic 8.4941487E+2 1.3470872E-1 -4.8690076E+4 -3.0739148E+2 3.1716234E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000La+3 = LaHCO3+2
-llnl_gamma 5.7
log_k 2.009
delta_h 6.972 #kJ/mol #95haa/sho
-analytic 8.6124708E+2 1.3701977E-1 -4.9647011E+4 -3.1083645E+2 3.1620088E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000La+3 + 1.000NO3- = LaNO3+2
-llnl_gamma 5.7
log_k 0.581
delta_h -29.415 #kJ/mol #95haa/sho
-analytic 7.7848412E+2 1.2273477E-1 -4.3906254E+4 -2.8300578E+2 2.9375218E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000La+3 + 1.000H2O = LaO+ + 2.000H+
-llnl_gamma 4.1
log_k -18.162
delta_h 159.159 #kJ/mol #95haa/sho
-analytic 2.0014934E+2 3.1719093E-2 -1.5018625E+4 -7.183422E+1 3.1418007E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000La+3 + 2.000H2O = LaO2- + 4.000H+
-llnl_gamma 3.6
log_k -40.795
delta_h 298.184 #kJ/mol #95haa/sho
-analytic -2.1961504E+2 -3.9453937E-2 1.8528912E+3 8.1546283E+1 -1.5478704E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000La+3 + 2.000H2O = LaO2H + 3.000H+
-llnl_gamma 3.4
log_k -27.894
delta_h 237.270 #kJ/mol #95haa/sho
-analytic 1.9825776E+2 2.7576247E-2 -1.5440239E+4 -7.1245745E+1 -5.5951918E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000La+3 + 1.000H2O = LaOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -8.633
delta_h 85.057 #kJ/mol #95haa/sho
-analytic 1.4427123E+2 2.1295472E-2 -1.1155726E+4 -5.0627263E+1 3.0552209E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000La+3 + 1.000SO4-2 = LaSO4+
-llnl_gamma 4.1
log_k 3.723
delta_h 18.143 #kJ/mol #95haa/sho
-analytic 1.6377756E+3 2.5721268E-1 -8.890972E+4 -5.9382155E+2 5.0523888E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Cl- + 1.000Li+ = LiCl
-llnl_gamma 3.4
log_k -1.499
delta_h 4.704 #kJ/mol #97sve/sho
-analytic 7.6755332E+2 1.2376014E-1 -4.224031E+4 -2.7980405E+2 2.4961471E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Li+ + 1.000H2O = LiOH + 1.000H+
-llnl_gamma 3.4
log_k -13.642
delta_h 56.014 #kJ/mol #97asho/sas
-analytic 9.6654044E+1 1.3349364E-2 -7.2486634E+3 -3.685422E+1 1.0932062E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- + 1.000Lu+3 = LuCl+2
-llnl_gamma 5.7
log_k -0.045
delta_h 13.572 #kJ/mol #95haa/sho
-analytic 8.3065237E+2 1.3557724E-1 -4.7247739E+4 -3.0126799E+2 2.9172646E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Lu+3 = LuCl2+
-llnl_gamma 4.1
log_k -0.604
delta_h 15.727 #kJ/mol #95haa/sho
-analytic 1.61013E+3 2.6205259E-1 -8.9751532E+4 -5.855227E+2 5.4225904E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Lu+3 = LuCl3
-llnl_gamma 3.4
log_k -1.162
delta_h 3.412 #kJ/mol #95haa/sho
-analytic 2.3529382E+3 3.8350344E-1 -1.2778237E+5 -8.585713E+2 7.5222257E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Lu+3 = LuCl4-
-llnl_gamma 3.6
log_k -1.721
delta_h -25.993 #kJ/mol #95haa/sho
-analytic 2.2401685E+3 3.6276615E-1 -1.1968456E+5 -8.1943287E+2 7.0233821E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Lu+3 = LuCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.023
delta_h -11.057 #kJ/mol #95haa/sho
-analytic 9.2406689E+2 1.4413187E-1 -4.7864787E+4 -3.3852998E+2 2.5909955E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Lu+3 = LuF+2
-llnl_gamma 5.7
log_k 4.848
delta_h 25.714 #kJ/mol #95haa/sho
-analytic 9.2300257E+2 1.4904467E-1 -5.2423005E+4 -3.3238037E+2 3.1725407E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Lu+3 = LuF2+
-llnl_gamma 4.1
log_k 8.524
delta_h 14.338 #kJ/mol #95haa/sho
-analytic 1.7748138E+3 2.8514135E-1 -9.8383874E+4 -6.4182295E+2 5.9403278E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Lu+3 = LuF3
-llnl_gamma 3.4
log_k 11.219
delta_h -12.652 #kJ/mol #95haa/sho
-analytic 2.6041361E+3 4.1869459E-1 -1.406988E+5 -9.4562601E+2 8.3600163E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Lu+3 = LuF4-
-llnl_gamma 3.6
log_k 13.456
delta_h -64.092 #kJ/mol #95haa/sho
-analytic 2.6641709E+3 4.2131603E-1 -1.418005E+5 -9.6851587E+2 8.5160108E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Lu+3 + 1.000H2PO4- = LuH2PO4+2
-llnl_gamma 5.7
log_k 1.183
delta_h -13.375 #kJ/mol #95haa/sho
-analytic 8.6590697E+2 1.3785867E-1 -4.9658582E+4 -3.1367006E+2 3.2788681E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Lu+3 = LuHCO3+2
-llnl_gamma 5.7
log_k 1.936
delta_h 1.528 #kJ/mol #95haa/sho
-analytic 8.6599778E+2 1.3847545E-1 -4.9953575E+4 -3.1285827E+2 3.23073E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Lu+3 + 1.000NO3- = LuNO3+2
-llnl_gamma 5.7
log_k 0.581
delta_h -41.640 #kJ/mol #95haa/sho
-analytic 8.0197507E+2 1.2673942E-1 -4.5031902E+4 -2.9209596E+2 3.0782898E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Lu+3 + 1.000H2O = LuO+ + 2.000H+
-llnl_gamma 4.1
log_k -15.303
delta_h 136.978 #kJ/mol #95haa/sho
-analytic 2.0718473E+2 3.3444629E-2 -1.4940859E+4 -7.4445172E+1 1.6552843E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Lu+3 + 2.000H2O = LuO2- + 4.000H+
-llnl_gamma 3.6
log_k -31.926
delta_h 238.950 #kJ/mol #95haa/sho
-analytic -2.031016E+2 -3.5822636E-2 2.3596072E+3 7.5853834E+1 -1.2225828E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Lu+3 + 2.000H2O = LuO2H + 3.000H+
-llnl_gamma 3.4
log_k -23.863
delta_h 207.023 #kJ/mol #95haa/sho
-analytic 2.7472209E+2 4.1467291E-2 -1.9503709E+4 -9.8921901E+1 -6.7283733E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Lu+3 + 1.000H2O = LuOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.607
delta_h 74.709 #kJ/mol #95haa/sho
-analytic 1.6163537E+2 2.4554978E-2 -1.2175062E+4 -5.6942191E+1 4.5975122E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Lu+3 + 1.000SO4-2 = LuSO4+
-llnl_gamma 4.1
log_k 3.649
delta_h 19.185 #kJ/mol #95haa/sho
-analytic 1.6468472E+3 2.6057252E-1 -8.9434909E+4 -5.9741623E+2 5.0976962E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Mg+2 = Mg(HCO3)+
-llnl_gamma 4.1
log_k 1.038
delta_h 1.841 #kJ/mol #Internal calculation
-analytic 8.7719553E+2 1.3812548E-1 -5.0324925E+4 -3.170514E+2 3.1978527E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 74rea/lan; Cp: 95sho/kor; V°: 95sho/kor;
4.000Mg+2 + 4.000H2O = Mg4(OH)4+4 + 4.000H+
-llnl_gamma 11.6
log_k -39.749
delta_h 229.186 #kJ/mol #Internal calculation
-analytic 1.2606143E+3 2.0941563E-1 -8.0065384E+4 -4.6056936E+2 4.0347961E+6
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 99yun/glu; V°: Default value;
1.000H2AsO4- + 1.000Mg+2 = MgAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -12.735
delta_h 99.689 #kJ/mol #Internal calculation
-analytic 2.7241155E+2 3.5613036E-2 -1.6231778E+4 -9.8493595E+1 2.1275556E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Mg+2 = MgCl+
-llnl_gamma 4.1
log_k 0.350
delta_h -1.729 #kJ/mol #Internal calculation
-analytic 8.3625242E+2 1.3422618E-1 -4.6833475E+4 -3.0373291E+2 2.9090889E+6
#References = LogK/DGf: 96bou; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Mg+2 = MgCO3 + 1.000H+
-llnl_gamma 3.4
log_k -7.347
delta_h 23.505 #kJ/mol #Internal calculation
-analytic 7.7698275E+2 1.265144E-1 -4.0717861E+4 -2.8627787E+2 2.0351522E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 74rea/lan; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000Mg+2 = MgF+
-llnl_gamma 4.1
log_k 1.149
delta_h 3.388 #kJ/mol #97sve/sho
-analytic 9.3050785E+2 1.4739513E-1 -5.2881126E+4 -3.3671118E+2 3.30941E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Mg+2 = MgH2AsO3+
-llnl_gamma 4.1
log_k 1.674
delta_h -21.477 #kJ/mol #Internal calculation
-analytic 6.4358882E+2 9.5687821E-2 -3.3449863E+4 -2.3423757E+2 1.8981269E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Mg+2 = MgH2AsO4+
-llnl_gamma 4.1
log_k 1.512
delta_h -15.687 #kJ/mol #Internal calculation
-analytic 8.3847543E+2 1.2866732E-1 -4.6573522E+4 -3.0382345E+2 2.9045112E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Mg+2 + 1.000H2PO4- = MgH2PO4+
-llnl_gamma 4.1
log_k 1.170
delta_h 13.510 #kJ/mol #96bou
-analytic 9.8988011E+2 1.5251379E-1 -5.3902191E+4 -3.5863879E+2 3.0254907E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: 96bou; S°: Internal calculation; V°: Default value;
1.000H2AsO4- + 1.000Mg+2 = MgHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.539
delta_h 10.494 #kJ/mol #Internal calculation
-analytic 9.2236978E+2 1.4553222E-1 -4.9509641E+4 -3.3734861E+2 2.7116164E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Mg+2 + 1.000H2PO4- = MgHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.303
delta_h 16.152 #kJ/mol #76smi/mar
-analytic 9.8487047E+2 1.5251379E-1 -5.4040192E+4 -3.5863879E+2 3.0254907E+6
#References = LogK/DGf: 63tay/fra, 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value;
1.000Mg+2 + 1.000H2O = MgOH+ + 1.000H+
-llnl_gamma 4.1
log_k -11.680
delta_h 62.834 #kJ/mol #Internal calculation
-analytic 2.2363765E+2 3.1867527E-2 -1.6730585E+4 -8.0256794E+1 8.7882059E+5
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Mg+2 + 2.000H2PO4- = MgP2O7-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -10.610
delta_h 45.031 #kJ/mol #76smi/mar
-analytic 1.8398416E+3 2.8632228E-1 -1.0242809E+5 -6.6975443E+2 5.7772117E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value;
1.000Mg+2 + 1.000H2PO4- = MgPO4- + 2.000H+
-llnl_gamma 3.6
log_k -14.710
delta_h 31.170 #kJ/mol #96bou
-analytic 1.0921013E+3 1.6933809E-1 -6.1181385E+4 -4.0019842E+2 3.3929554E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: 96bou; S°: Internal calculation; V°: Default value;
1.000Mg+2 + 1.000SO4-2 = MgSO4
-llnl_gamma 3.4
log_k 2.230
delta_h 5.860 #kJ/mol #76smi/mar
-analytic 1.692301E+3 2.6688413E-1 -9.1846155E+4 -6.1481292E+2 5.3092016E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; Cp: 97mcc/sho; V°: 97mcc/sho;
1.000H2AsO4- + 1.000Mn+2 = MnAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -12.330
delta_h 78.986 #kJ/mol #Internal calculation
-analytic 2.3868013E+2 3.2373586E-2 -1.3286951E+4 -8.778006E+1 9.8539255E+4
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Mn+2 = MnCl+
-llnl_gamma 4.1
log_k -0.126
delta_h 19.022 #kJ/mol #97sve/sho
-analytic 8.5360667E+2 1.3944842E-1 -4.8025035E+4 -3.0980515E+2 2.8766051E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000Mn+2 = MnF+
-llnl_gamma 4.1
log_k 0.920
delta_h 2.479 #kJ/mol #97sve/sho
-analytic 8.8233543E+2 1.4187997E-1 -4.9330737E+4 -3.2022106E+2 3.0317507E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO4- + 1.000Mn+2 = MnH2AsO4+
-llnl_gamma 4.1
log_k 1.006
delta_h -2.373 #kJ/mol #Internal calculation
-analytic 8.5233388E+2 1.346871E-1 -4.7596439E+4 -3.0908784E+2 2.9309768E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Mn+2 + 1.000H2PO4- = MnH2PO4+
-llnl_gamma 4.1
log_k 1.343
#References = LogK/DGf: 79mat/spo;
#References = LogK/DGf: 79mat/spo; V°: Default value;
1.000H2AsO4- + 1.000Mn+2 = MnHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.065
delta_h 9.357 #kJ/mol #Internal calculation
-analytic 8.9133184E+2 1.4178927E-1 -4.7598277E+4 -3.2624556E+2 2.5998848E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Mn+2 + 1.000H2PO4- = MnHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.632
#References = LogK/DGf: 79mat/spo;
#References = LogK/DGf: 79mat/spo; V°: Default value;
1.000Mn+2 + 1.000H2O = MnO + 2.000H+
-llnl_gamma 3.4
log_k -22.194
delta_h 122.917 #kJ/mol #97asho/sas
-analytic 2.4166991E+2 3.9150052E-2 -1.7430046E+4 -8.9673142E+1 4.2802115E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Mn+2 + 2.000H2O = MnO2-2 + 4.000H+
-llnl_gamma 4.7
log_k -48.272
delta_h 235.076 #kJ/mol #97asho/sas
-analytic -1.0584707E+3 -1.7468961E-1 4.7267384E+4 3.8252863E+2 -3.804217E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Mn+2 + 1.000H2O = MnOH+ + 1.000H+
-llnl_gamma 4.1
log_k -10.612
delta_h 60.303 #kJ/mol #97asho/sas
-analytic 1.7784334E+2 2.6842082E-2 -1.2422964E+4 -6.4772698E+1 4.8751735E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Mn+2 + 1.000H2PO4- = MnPO4- + 2.000H+
-llnl_gamma 3.6
log_k -12.344
#References = LogK/DGf: 79mat/spo;
#References = LogK/DGf: 79mat/spo; V°: Default value;
1.000Mn+2 + 1.000SO4-2 = MnSO4
-llnl_gamma 3.4
log_k 1.993
delta_h 9.555 #kJ/mol #97sve/sho
-analytic 1.6669991E+3 2.6400995E-1 -9.0477791E+4 -6.0575368E+2 5.2128104E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.33333333333333NH3 + 0.333333333333333N2 + 1.000H+ = N2H5+
-llnl_gamma 4.1
log_k -19.616
delta_h 104.619 #kJ/mol #97asho/sas
-analytic 5.8563295E+1 -2.6409657E-3 -9.6380335E+3 -1.9202785E+1 2.1777613E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.33333333333333NH3 + 0.333333333333333N2 + 2.000H+ = N2H6+2
-llnl_gamma 5.7
log_k -20.643
delta_h 95.382 #kJ/mol #97asho/sas
-analytic -9.7147098E+1 -2.8901066E-2 -1.4784198E+3 3.7243413E+1 -1.8458041E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H+ = N2O + 0.333333333333333H2O
-llnl_gamma 3.4
log_k -7.655
delta_h 42.826 #kJ/mol #01sch/sho
-analytic 1.8605674E+2 3.919814E-2 -9.6413622E+3 -7.1070532E+1 2.4875632E+5
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
0.666666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H2O = N2O2-2 + 1.33333333333333H+
-llnl_gamma 4.7
log_k -53.671
delta_h 257.189 #kJ/mol #97asho/sas
-analytic -1.0364412E+3 -1.6896426E-1 4.4624122E+4 3.7375669E+2 -3.676592E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000Na+ + 2.000H2PO4- = Na2P2O7-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -13.620
#References = LogK/DGf: 76smi/mar;
#References = LogK/DGf: 76smi/mar; V°: Default value;
1.000Al+3 + 1.000Na+ + 2.000H2O = NaAlO2 + 4.000H+
-llnl_gamma 3.4
log_k -23.628
delta_h 190.348 #kJ/mol #95pok/hel
-analytic 6.5459073E+2 1.0393137E-1 -4.4810329E+4 -2.3513564E+2 2.0371086E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95pok/hel; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel;
1.000H2AsO4- + 1.000Na+ = NaAsO4-2 + 2.000H+
-llnl_gamma 4.7
log_k -13.867
delta_h 87.299 #kJ/mol #Internal calculation
-analytic -3.4933501E+2 -7.1708394E-2 1.6125283E+4 1.2933658E+2 -1.5353401E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000B(OH)3 + 1.000Na+ + 1.000H2O = NaB(OH)4 + 1.000H+
-llnl_gamma 3.0
log_k -8.976
delta_h 13.466 #kJ/mol #95pok/sch
-analytic -5.2102045E+1 -2.7905158E-5 4.0380388E+3 1.395685E+1 -4.3955612E+5
#References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch;
1.000Br- + 1.000Na+ = NaBr
-llnl_gamma 3.4
log_k -1.369
delta_h 8.228 #kJ/mol #97sve/sho
-analytic 7.7684069E+2 1.2166448E-1 -4.3187848E+4 -2.8215454E+2 2.5371411E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Na+ = NaCO3- + 1.000H+
-llnl_gamma 3.6
log_k -9.057
delta_h 32.451 #kJ/mol #Internal calculation
-analytic 8.7001165E+2 1.1462014E-1 -4.8239424E+4 -3.1452097E+2 2.3836603E+6
#References = LogK/DGf: 90nor/plu; DHf/DHr: Internal calculation; S°: 13ste/ben; V°: Default value;
1.000F- + 1.000Na+ = NaF
-llnl_gamma 3.4
log_k -0.970
delta_h 7.196 #kJ/mol #97sve/sho
-analytic 8.3493341E+2 1.3086197E-1 -4.6137586E+4 -3.0331405E+2 2.6985114E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Na+ = NaH2AsO3
-llnl_gamma 3.4
log_k 0.273
delta_h -8.134 #kJ/mol #Internal calculation
-analytic 5.4981405E+2 8.1313023E-2 -2.8352819E+4 -2.0026664E+2 1.4985896E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Na+ = NaH2AsO4
-llnl_gamma 3.4
log_k -1.788
delta_h 9.245 #kJ/mol #Internal calculation
-analytic 7.4433985E+2 1.1409501E-1 -4.2065553E+4 -2.6964707E+2 2.5038958E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Na+ + 1.000H2PO4- = NaH2PO4
-llnl_gamma 3.4
log_k 0.410
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000H2AsO4- + 1.000Na+ = NaHAsO4- + 1.000H+
-llnl_gamma 3.6
log_k -6.298
delta_h 7.794 #kJ/mol #Internal calculation
-analytic 1.8758022E+2 2.0070238E-2 -1.1257068E+4 -6.8100842E+1 5.6937754E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000HCO3- + 1.000Na+ = NaHCO3
-llnl_gamma 3.4
log_k -0.247
delta_h 11.979 #kJ/mol #Internal calculation
-analytic 7.8588954E+2 1.1462014E-1 -4.3192767E+4 -2.8380464E+2 2.3836603E+6
#References = LogK/DGf: 90nor/plu; DHf/DHr: Internal calculation; S°: 13ste/ben; V°: Default value;
1.000Na+ + 2.000H2PO4- = NaHP2O7-2 + 1.000H2O + 1.000H+
-llnl_gamma 4.7
log_k -7.010
#References = LogK/DGf: 76smi/mar;
#References = LogK/DGf: 76smi/mar; V°: Default value;
1.000Na+ + 1.000H2PO4- = NaHPO4- + 1.000H+
-llnl_gamma 3.6
log_k -6.340
delta_h 34.940 #kJ/mol #97smi/mar
-analytic 8.9614224E+2 1.3295877E-1 -5.0616671E+4 -3.2470053E+2 2.7641904E+6
#References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: Default value;
1.000I- + 1.000Na+ = NaI
-llnl_gamma 3.4
log_k -1.553
delta_h 6.654 #kJ/mol #97sve/sho
-analytic 6.9652771E+2 1.1039589E-1 -3.8648051E+4 -2.5339188E+2 2.278602E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Na+ + 1.000H2O = NaOH + 1.000H+
-llnl_gamma 3.4
log_k -14.750
delta_h 53.395 #kJ/mol #Internal calculation
-analytic 5.4228076E+2 8.188068E-2 -3.2983502E+4 -1.9826056E+2 1.7571455E+6
#References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 95pok/hel;
1.000Na+ + 2.000H2PO4- = NaP2O7-3 + 1.000H2O + 2.000H+
-llnl_gamma 6.7
log_k -15.520
delta_h 38.336 #kJ/mol #76smi/mar
-analytic 1.7437765E+3 2.6676725E-1 -9.7673535E+4 -6.3581617E+2 5.5159114E+6
#References = LogK/DGf: 76smi/mar; DHf/DHr: 76smi/mar; S°: Internal calculation; V°: Default value;
1.000Na+ + 1.000H2PO4- = NaPO4-2 + 2.000H+
-llnl_gamma 4.7
log_k -18.070
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000Na+ + 1.000SO4-2 = NaSO4-
-llnl_gamma 4.5
log_k 0.936
delta_h -2.788 #kJ/mol #Internal calculation
-analytic 9.3587508E+2 1.4438561E-1 -5.3022893E+4 -3.3839769E+2 3.3063928E+6
#References = LogK/DGf: 95pok/sch; DHf/DHr: Internal calculation; S°: 95pok/sch; Cp: 95pok/sch; V°: 95pok/sch;
1.000Cl- + 1.000Nd+3 = NdCl+2
-llnl_gamma 4.5
log_k 0.353
delta_h -9.470 #kJ/mol #Internal calculation
-analytic 8.1125308E+2 1.3290115E-1 -4.4437392E+4 -2.9596645E+2 2.7440063E+6
#References = LogK/DGf: 02mig/will; DHf/DHr: Internal calculation; S°: 02mig/will; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Nd+3 = NdCl2+
-llnl_gamma 4.5
log_k -2.515
delta_h 61.356 #kJ/mol #Internal calculation
-analytic 1.5654601E+3 2.5357963E-1 -8.7419323E+4 -5.6819053E+2 4.9403891E+6
#References = LogK/DGf: 02mig/will; DHf/DHr: Internal calculation; S°: 02mig/will; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Nd+3 = NdCl3
-llnl_gamma 3.4
log_k -0.283
delta_h 14.733 #kJ/mol #95haa/sho
-analytic 2.2484789E+3 3.638319E-1 -1.1928708E+5 -8.2107854E+2 6.6277119E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Nd+3 = NdCl4-
-llnl_gamma 3.6
log_k -0.695
delta_h -3.159 #kJ/mol #95haa/sho
-analytic 1.6636197E+3 2.8151308E-1 -8.1237365E+4 -6.1456822E+2 3.9942372E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Nd+3 = NdCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.609
delta_h -4.092 #kJ/mol #95haa/sho
-analytic 7.1585094E+2 1.1644129E-1 -3.5928996E+4 -2.6401133E+2 1.8319437E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Nd+3 = NdF+2
-llnl_gamma 5.7
log_k 4.409
delta_h 22.486 #kJ/mol #95haa/sho
-analytic 9.0701022E+2 1.4596845E-1 -5.0799804E+4 -3.2720465E+2 3.0141759E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Nd+3 = NdF2+
-llnl_gamma 4.1
log_k 7.644
delta_h 13.371 #kJ/mol #95haa/sho
-analytic 1.71891E+3 2.7521732E-1 -9.3572659E+4 -6.2275347E+2 5.4656377E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Nd+3 = NdF3
-llnl_gamma 3.4
log_k 10.000
delta_h -8.064 #kJ/mol #95haa/sho
-analytic 2.4963985E+3 3.9902305E-1 -1.3185181E+5 -9.081332E+2 7.4655024E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Nd+3 = NdF4-
-llnl_gamma 3.6
log_k 11.990
delta_h -48.613 #kJ/mol #95haa/sho
-analytic 2.0115814E+3 3.2824721E-1 -9.9239104E+4 -7.3716718E+2 5.2859015E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Nd+3 + 1.000H2PO4- = NdH2PO4+2
-llnl_gamma 5.7
log_k 1.103
delta_h -5.272 #kJ/mol #95haa/sho
-analytic 8.4865154E+2 1.3506644E-1 -4.8254648E+4 -3.0743365E+2 3.0893144E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Nd+3 = NdHCO3+2
-llnl_gamma 5.7
log_k 1.862
delta_h 9.057 #kJ/mol #95haa/sho
-analytic 8.6312487E+2 1.3775449E-1 -4.9329757E+4 -3.1183922E+2 3.0885617E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000NO3- + 1.000Nd+3 = NdNO3+2
-llnl_gamma 5.7
log_k 0.790
delta_h -27.851 #kJ/mol #95haa/sho
-analytic 7.7708742E+2 1.230451E-1 -4.33463E+4 -2.8275768E+2 2.8505013E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Nd+3 + 1.000H2O = NdO+ + 2.000H+
-llnl_gamma 4.1
log_k -17.062
delta_h 154.131 #kJ/mol #95haa/sho
-analytic 2.1594467E+2 3.4768269E-2 -1.5557677E+4 -7.7628738E+1 7.9528355E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Nd+3 + 2.000H2O = NdO2- + 4.000H+
-llnl_gamma 3.6
log_k -37.057
delta_h 278.717 #kJ/mol #95haa/sho
-analytic -2.1114089E+2 -3.7481289E-2 2.7207202E+3 7.8285008E+1 -1.5625265E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Nd+3 + 2.000H2O = NdO2H + 3.000H+
-llnl_gamma 3.4
log_k -26.355
delta_h 230.105 #kJ/mol #95haa/sho
-analytic 1.9658179E+2 2.7624854E-2 -1.4737448E+4 -7.0729978E+1 -5.9797696E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Nd+3 + 1.000H2O = NdOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -8.120
delta_h 83.126 #kJ/mol #95haa/sho
-analytic 1.5768478E+2 2.3996887E-2 -1.1745692E+4 -5.5564534E+1 3.4906451E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Nd+3 + 1.000SO4-2 = NdSO4+
-llnl_gamma 4.1
log_k 3.723
delta_h 19.640 #kJ/mol #95haa/sho
-analytic 1.6353148E+3 2.5876304E-1 -8.8784595E+4 -5.9319424E+2 5.05476E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000NO2- + 4.000H+ = NF3 + 2.000H2O
-llnl_gamma 3.4
log_k -59.038
delta_h 398.898 #kJ/mol #01sch/sho
-analytic 2.9769595E+3 4.7504862E-1 -1.881972E+5 -1.0766255E+3 1.0455912E+7
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
1.000NH3 + 1.000H+ = NH4+
-llnl_gamma 2.5
log_k 9.241
delta_h -51.750 #kJ/mol #97asho/sas
-analytic 3.7494579E+1 -1.5452439E-3 -6.956038E+2 -1.1496407E+1 2.6555112E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ni+2 + 4.000CN- = Ni(CN)4-2
-llnl_gamma 4.7
log_k 34.083
delta_h -189.579 #kJ/mol #05gam/bug
-analytic 3.115726E+3 4.8046959E-1 -1.6103638E+5 -1.1305387E+3 1.0015469E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value;
1.000Ni+2 + 5.000CN- = Ni(CN)5-3
-llnl_gamma 6.7
log_k 33.337
delta_h -203.321 #kJ/mol #05gam/bug
-analytic 3.8659718E+3 5.9560653E-1 -2.0178908E+5 -1.403727E+3 1.2446855E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value;
1.000H2AsO4- + 1.000Ni+2 = NiAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -10.665
delta_h 84.853 #kJ/mol #Internal calculation
-analytic 2.2480706E+2 2.9293225E-2 -1.2692927E+4 -8.1674962E+1 4.139955E+4
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Ni+2 = NiCl+
-llnl_gamma 4.1
log_k 0.151
delta_h 5.242 #kJ/mol #Internal calculation
-analytic 7.9676213E+2 1.2939034E-1 -4.4201349E+4 -2.8974155E+2 2.6676555E+6
#References = LogK/DGf: 05gam/bug; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Ni+2 = NiCO3 + 1.000H+
-llnl_gamma 3.4
log_k -6.056
#References = LogK/DGf: 05gam/bug;
#References = LogK/DGf: 05gam/bug; V°: Default value;
1.000F- + 1.000Ni+2 = NiF+
-llnl_gamma 4.1
log_k 1.501
delta_h 13.990 #kJ/mol #05gam/bug
-analytic 8.779514E+2 1.3998177E-1 -4.922259E+4 -3.1775188E+2 2.9480422E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO4- + 1.000Ni+2 = NiH2AsO4+
-llnl_gamma 4.1
log_k 1.680
delta_h -9.191 #kJ/mol #Internal calculation
-analytic 8.0557652E+2 1.2506786E-1 -4.4376704E+4 -2.9209453E+2 2.7044683E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Ni+2 = NiHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.786
delta_h 12.531 #kJ/mol #Internal calculation
-analytic 8.954335E+2 1.4271768E-1 -4.7838089E+4 -3.2756746E+2 2.5977277E+6
#References = LogK/DGf: 05gam/bug; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Ni+2 + 2.000H2PO4- = NiHP2O7- + 1.000H2O + 1.000H+
-llnl_gamma 3.6
log_k -3.200
#References = LogK/DGf: 05gam/bug;
#References = LogK/DGf: 05gam/bug; V°: Default value;
1.000Ni+2 + 1.000H2PO4- = NiHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.091
#References = LogK/DGf: 05gam/bug;
#References = LogK/DGf: 05gam/bug; V°: Default value;
1.000Ni+2 + 1.000HS- = NiHS+
-llnl_gamma 4.1
log_k 5.251
#References = LogK/DGf: 05gam/bug;
#References = LogK/DGf: 05gam/bug; V°: Default value;
1.000NO3- + 1.000Ni+2 = NiNO3+
-llnl_gamma 4.1
log_k 0.551
#References = LogK/DGf: 05gam/bug;
#References = LogK/DGf: 05gam/bug; V°: Default value;
1.000Ni+2 + 1.000H2O = NiO + 2.000H+
-llnl_gamma 3.4
log_k -19.500
delta_h 98.873 #kJ/mol #Internal calculation
-analytic 3.3919349E+2 5.4537568E-2 -2.3157132E+4 -1.2467759E+2 9.9759929E+5
#References = LogK/DGf: 12bla; DHf/DHr: Internal calculation; S°: 12coo/oli; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ni+2 + 1.000H2O = NiOH+ + 1.000H+
-llnl_gamma 4.1
log_k -9.500
delta_h 35.576 #kJ/mol #Internal calculation
-analytic 2.1705626E+2 3.3172862E-2 -1.5100461E+4 -7.912071E+1 8.87139E+5
#References = LogK/DGf: 98ply/zha; DHf/DHr: Internal calculation; S°: 12coo/oli; Cp: 97asho/sas; V°: 97asho/sas;
1.000Ni+2 + 2.000H2PO4- = NiP2O7-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -9.010
delta_h 8.643 #kJ/mol #Internal calculation
-analytic 1.8117237E+3 2.8442207E-1 -9.9320159E+4 -6.6151768E+2 5.7309693E+6
#References = LogK/DGf: 05gam/bug; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
1.000Ni+2 + 1.000SO4-2 = NiSO4
-llnl_gamma 3.4
log_k 2.420
delta_h 10.150 #kJ/mol #05gam/bug
-analytic 1.7287551E+3 2.7178492E-1 -9.5602329E+4 -6.2662671E+2 5.6741374E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value;
0.166666666666667N2 + 0.666666666666667NO2- + 0.666666666666667H+ = NO + 0.333333333333333H2O
-llnl_gamma 3.4
log_k -7.261
delta_h 54.740 #kJ/mol #01sch/sho
-analytic 5.4973567E+2 8.9332424E-2 -3.4851798E+4 -1.9828458E+2 2.1249305E+6
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
1.000CN- + 0.500O2 = OCN-
-llnl_gamma 3.5
log_k 48.714
delta_h -290.559 #kJ/mol #97asho/sas
-analytic -7.4703802E+1 -1.2812911E-2 2.0195988E+4 2.594405E+1 -4.1751971E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2O = OH- + 1.000H+
-llnl_gamma 3.5
log_k -14.001
delta_h 55.815 #kJ/mol #89cox/wag
-analytic -7.2302789E+2 -1.159352E-1 3.7292444E+4 2.6126053E+2 -2.4853506E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 97asho/sas; V°: 97asho/sas;
2.000H2PO4- = P2O7-4 + 1.000H2O + 2.000H+
-llnl_gamma 9.6
log_k -17.811
delta_h 32.478 #kJ/mol #Internal calculation
-analytic -1.516313E+3 -2.4488765E-1 8.2037869E+4 5.4735201E+2 -5.1583205E+6
#References = LogK/DGf: 92gre/fug; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 97asho/sas; V°: 97asho/sas;
1.000HCO3- + 1.000Pb+2 = Pb(CO3) + 1.000H+
-llnl_gamma 3.4
log_k -3.327
delta_h 11.685 #kJ/mol #06bla/pia
-analytic 9.2699314E+2 1.4344292E-1 -5.1261272E+4 -3.3714324E+2 2.9408143E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 06bla/pia; V°: Default value;
2.000HCO3- + 1.000Pb+2 = Pb(CO3)2-2 + 2.000H+
-llnl_gamma 4.7
log_k -10.524
#References = LogK/DGf: 06bla/pia;
#References = LogK/DGf: 06bla/pia; V°: Default value;
1.000H2PO4- + 1.000Pb+2 = Pb(H2PO4)+
-llnl_gamma 4.1
log_k 1.500
#References = LogK/DGf: 72anri;
#References = LogK/DGf: 72anri; V°: Default value;
1.000Pb+2 + 2.000HS- = Pb(HS)2
-llnl_gamma 3.4
log_k 15.010
delta_h -65.579 #kJ/mol #Internal calculation
-analytic 1.6254192E+3 2.5826523E-1 -8.6954701E+4 -5.8916322E+2 5.5187301E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Pb+2 + 3.000HS- = Pb(HS)3-
-llnl_gamma 3.6
log_k 16.260
delta_h -73.330 #kJ/mol #Internal calculation
-analytic 1.9733495E+3 3.1294736E-1 -1.0667543E+5 -7.1501503E+2 6.8140809E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Pb+2 + 4.000H2O = Pb(OH)4-2 + 4.000H+
-llnl_gamma 4.7
log_k -38.899
delta_h 197.474 #kJ/mol #Internal calculation
-analytic 4.2315542E+2 3.5447211E-2 -3.179048E+4 -1.5132056E+2 7.4989763E+5
#References = LogK/DGf: 01per/hef; DHf/DHr: Internal calculation; S°: 97cro; V°: Default value;
1.000Pb+2 + 2.000SO4-2 = Pb(SO4)2-2
-llnl_gamma 4.7
log_k 3.470
#References = LogK/DGf: 06bla/pia;
#References = LogK/DGf: 06bla/pia; V°: Default value;
2.000Pb+2 + 1.000H2O = Pb2(OH)+3 + 1.000H+
-llnl_gamma 8.2
log_k -7.180
#References = LogK/DGf: 99lot/och;
#References = LogK/DGf: 99lot/och; V°: Default value;
4.000Pb+2 + 4.000H2O = Pb4(OH)4+4 + 4.000H+
-llnl_gamma 11.6
log_k -20.629
delta_h 82.037 #kJ/mol #Internal calculation
-analytic 1.239277E+3 1.7918943E-1 -7.1832869E+4 -4.5043386E+2 3.7483522E+6
#References = LogK/DGf: 99lot/och; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
6.000Pb+2 + 8.000H2O = Pb6(OH)8+4 + 8.000H+
-llnl_gamma 11.6
log_k -42.677
delta_h 192.157 #kJ/mol #Internal calculation
-analytic 1.8703337E+3 2.6255071E-1 -1.1146481E+5 -6.7865283E+2 5.4977346E+6
#References = LogK/DGf: 99lot/och; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
1.000H2AsO4- + 1.000Pb+2 = PbAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -11.735
delta_h 95.026 #kJ/mol #Internal calculation
-analytic 3.5533474E+2 5.2767349E-2 -2.015591E+4 -1.2948412E+2 4.6230102E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Pb+2 = PbCl+
-llnl_gamma 4.1
log_k 1.440
delta_h 4.318 #kJ/mol #Internal calculation
-analytic 8.6382261E+2 1.4020235E-1 -4.7427426E+4 -3.1399197E+2 2.8304634E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
2.000Cl- + 1.000Pb+2 = PbCl2
-llnl_gamma 3.4
log_k 2.000
delta_h 7.948 #kJ/mol #Internal calculation
-analytic 1.542624E+3 2.4867269E-1 -8.4545842E+4 -5.6074298E+2 5.0068672E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
3.000Cl- + 1.000Pb+2 = PbCl3-
-llnl_gamma 3.6
log_k 1.690
delta_h 7.811 #kJ/mol #Internal calculation
-analytic 1.7730074E+3 2.8656961E-1 -9.7270496E+4 -6.4482215E+2 5.7833213E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
4.000Cl- + 1.000Pb+2 = PbCl4-2
-llnl_gamma 4.7
log_k 1.400
delta_h 1.324 #kJ/mol #Internal calculation
-analytic 1.7059952E+3 2.7716813E-1 -9.3612905E+4 -6.2096366E+2 5.625213E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000Pb+2 = PbF+
-llnl_gamma 4.1
log_k 2.270
delta_h -4.055 #kJ/mol #Internal calculation
-analytic 8.713746E+2 1.3980171E-1 -4.7875425E+4 -3.1641945E+2 2.9110628E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
2.000F- + 1.000Pb+2 = PbF2
-llnl_gamma 3.4
log_k 3.010
delta_h -8.880 #kJ/mol #Internal calculation
-analytic 1.7070384E+3 2.7307904E-1 -9.3362629E+4 -6.2056635E+2 5.6219623E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Pb+2 = PbH2AsO3+
-llnl_gamma 4.1
log_k 5.172
delta_h -20.319 #kJ/mol #Internal calculation
-analytic 7.3145603E+2 1.1407873E-1 -3.7319759E+4 -2.6618318E+2 2.0914473E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Pb+2 = PbH2AsO4+
-llnl_gamma 4.1
log_k 1.534
delta_h 6.559 #kJ/mol #Internal calculation
-analytic 9.3632677E+2 1.4861299E-1 -5.207374E+4 -3.3932581E+2 3.1285417E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2PO4- + 1.000Pb+2 = PbH2PO4+
-llnl_gamma 4.1
log_k -1.500
#References = LogK/DGf: 74nri;
#References = LogK/DGf: 74nri; V°: Default value;
1.000H2AsO4- + 1.000Pb+2 = PbHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.166
delta_h 11.030 #kJ/mol #Internal calculation
-analytic 8.6079856E+2 1.3564372E-1 -4.6327577E+4 -3.1465555E+2 2.5397795E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000HCO3- + 1.000Pb+2 = PbHCO3+
-llnl_gamma 4.1
log_k 3.443
#References = LogK/DGf: 89mar/smi;
#References = LogK/DGf: 89mar/smi; V°: Default value;
1.000H2PO4- + 1.000Pb+2 = PbHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.105
#References = LogK/DGf: 72anri, 76smi/mar;
#References = LogK/DGf: 72anri, 76smi/mar; V°: Default value;
1.000Pb+2 + 1.000H2O = PbO + 2.000H+
-llnl_gamma 3.4
log_k -16.950
delta_h 97.823 #kJ/mol #Internal calculation
-analytic 1.6034879E+2 2.4525912E-2 -1.0990386E+4 -5.9908315E+1 4.3582989E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Pb+2 + 1.000H2O = PbOH+ + 1.000H+
-llnl_gamma 4.1
log_k -7.510
delta_h 4.021 #kJ/mol #Internal calculation
-analytic 6.3009541E+1 8.0294244E-3 -3.0296716E+3 -2.5513203E+1 3.3702106E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H2PO4- + 1.000Pb+2 = PbP2O7-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -9.478
#References = LogK/DGf: 82wag/eva;
#References = LogK/DGf: 82wag/eva; V°: Default value;
1.000Pb+2 + 1.000SO4-2 = PbSO4
-llnl_gamma 3.4
log_k 2.820
delta_h 6.860 #kJ/mol #Internal calculation
-analytic 1.7031678E+3 2.6612858E-1 -9.4494186E+4 -6.168295E+2 5.6487689E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 06bla/pia; V°: Default value;
1.000Pd+2 + 2.000SO4-2 = Pd(SO4)2-2
-llnl_gamma 4.7
log_k 4.543
delta_h 13.311 #kJ/mol #98sas/sho
-analytic 1.8328034E+3 2.8730619E-1 -1.0245546E+5 -6.6270592E+2 6.1815486E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pd+2 + 3.000SO4-2 = Pd(SO4)3-4
-llnl_gamma 9.6
log_k 6.330
delta_h 22.791 #kJ/mol #98sas/sho
-analytic 2.003922E+3 3.1049E-1 -1.1510777E+5 -7.2128973E+2 7.1731075E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Cl- + 1.000Pd+2 = PdCl+
-llnl_gamma 4.1
log_k 6.112
delta_h -30.306 #kJ/mol #98sas/sho
-analytic 8.1839102E+2 1.3409427E-1 -4.3615188E+4 -2.9786761E+2 2.7628651E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
2.000Cl- + 1.000Pd+2 = PdCl2
-llnl_gamma 3.4
log_k 10.728
delta_h -63.428 #kJ/mol #98sas/sho
-analytic 1.6134857E+3 2.6312736E-1 -8.5772785E+4 -5.8779223E+2 5.4161121E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
3.000Cl- + 1.000Pd+2 = PdCl3-
-llnl_gamma 3.6
log_k 13.138
delta_h -96.181 #kJ/mol #98sas/sho
-analytic 1.6089602E+3 2.6370322E-1 -8.5838371E+4 -5.8634303E+2 5.71817E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
4.000Cl- + 1.000Pd+2 = PdCl4-2
-llnl_gamma 4.7
log_k 15.138
delta_h -142.184 #kJ/mol #98sas/sho
-analytic 1.5764881E+3 2.5922383E-1 -8.3561047E+4 -5.7571264E+2 5.8839455E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pd+2 + 1.000H2O = PdO + 2.000H+
-llnl_gamma 3.4
log_k -2.182
delta_h 6.074 #kJ/mol #98sas/sho
-analytic 2.6894351E+2 4.4303894E-2 -1.3156672E+4 -9.9694179E+1 5.759613E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pd+2 + 1.000H2O = PdOH+ + 1.000H+
-llnl_gamma 4.1
log_k -0.988
delta_h 6.864 #kJ/mol #98sas/sho
-analytic 1.7819067E+2 2.7741691E-2 -9.7512242E+3 -6.4881145E+1 5.1561571E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pd+2 + 1.000SO4-2 = PdSO4
-llnl_gamma 3.4
log_k 2.477
delta_h 5.546 #kJ/mol #98sas/sho
-analytic 1.6703525E+3 2.6532462E-1 -9.0413635E+4 -6.0720933E+2 5.223936E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000F- + 1.000H2PO4- = PO3F-2 + 1.000H2O
-llnl_gamma 4.7
log_k -1.180
#References = LogK/DGf: 82wag/eva;
#References = LogK/DGf: 82wag/eva; V°: Default value;
1.000H2PO4- = PO4-3 + 2.000H+
-llnl_gamma 4.0
log_k -19.560
delta_h 18.200 #kJ/mol #89cox/wag
-analytic -1.4841661E+3 -2.403801E-1 8.1179902E+4 5.3408286E+2 -5.116392E+6
#References = LogK/DGf: 89cox/wag; DHf/DHr: 89cox/wag; S°: Internal calculation; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- + 1.000Pr+3 = PrCl+2
-llnl_gamma 5.7
log_k 0.321
delta_h 14.599 #kJ/mol #95haa/sho
-analytic 8.2254676E+2 1.3444003E-1 -4.61668E+4 -2.9856961E+2 2.7847004E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Pr+3 = PrCl2+
-llnl_gamma 4.1
log_k 0.056
delta_h 20.070 #kJ/mol #95haa/sho
-analytic 1.5750521E+3 2.5636087E-1 -8.640606E+4 -5.7323784E+2 5.0506311E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Pr+3 = PrCl3
-llnl_gamma 3.4
log_k -0.283
delta_h 14.109 #kJ/mol #95haa/sho
-analytic 2.2754534E+3 3.6890787E-1 -1.2146797E+5 -8.306082E+2 6.8417122E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Pr+3 = PrCl4-
-llnl_gamma 3.6
log_k -0.695
delta_h -4.157 #kJ/mol #95haa/sho
-analytic 1.7182161E+3 2.9070316E-1 -8.5507738E+4 -6.3375482E+2 4.3909277E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Pr+3 = PrCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.756
delta_h -3.380 #kJ/mol #95haa/sho
-analytic 7.2138626E+2 1.1758392E-1 -3.6202894E+4 -2.6611833E+2 1.8416958E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Pr+3 = PrF+2
-llnl_gamma 5.7
log_k 4.262
delta_h 23.448 #kJ/mol #95haa/sho
-analytic 9.1398788E+2 1.4748959E-1 -5.1312825E+4 -3.2975399E+2 3.0542718E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Pr+3 = PrF2+
-llnl_gamma 4.1
log_k 7.424
delta_h 14.875 #kJ/mol #95haa/sho
-analytic 1.7346648E+3 2.7829632E-1 -9.4856916E+4 -6.2835263E+2 5.57848E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Pr+3 = PrF3
-llnl_gamma 3.4
log_k 9.780
delta_h -6.684 #kJ/mol #95haa/sho
-analytic 2.5235027E+3 4.0409891E-1 -1.3413726E+5 -9.1766238E+2 7.6794967E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Pr+3 = PrF4-
-llnl_gamma 3.6
log_k 11.697
delta_h -47.314 #kJ/mol #95haa/sho
-analytic 2.4722098E+3 3.9032688E-1 -1.2770305E+5 -9.0092669E+2 7.1748958E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000H2PO4- + 1.000Pr+3 = PrH2PO4+2
-llnl_gamma 5.7
log_k 1.183
delta_h -6.015 #kJ/mol #95haa/sho
-analytic 8.5579502E+2 1.3661585E-1 -4.8693192E+4 -3.10067E+2 3.1303306E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Pr+3 = PrHCO3+2
-llnl_gamma 5.7
log_k 1.936
delta_h -13.317 #kJ/mol #95haa/sho
-analytic 8.4632289E+2 1.3502981E-1 -4.7807723E+4 -3.0679399E+2 3.0973294E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000NO3- + 1.000Pr+3 = PrNO3+2
-llnl_gamma 5.7
log_k 0.655
delta_h -27.588 #kJ/mol #95haa/sho
-analytic 7.8435651E+2 1.2461456E-1 -4.3847358E+4 -2.8544941E+2 2.8921439E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Pr+3 + 1.000H2O = PrO+ + 2.000H+
-llnl_gamma 4.1
log_k -17.282
delta_h 155.136 #kJ/mol #95haa/sho
-analytic 2.1505188E+2 3.4941731E-2 -1.5395073E+4 -7.747595E+1 5.2658598E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Pr+3 + 2.000H2O = PrO2- + 4.000H+
-llnl_gamma 3.6
log_k -37.570
delta_h 281.272 #kJ/mol #95haa/sho
-analytic -2.1156529E+2 -3.7236822E-2 2.7251464E+3 7.829187E+1 -1.5797207E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Pr+3 + 2.000H2O = PrO2H + 3.000H+
-llnl_gamma 3.4
log_k -26.575
delta_h 230.986 #kJ/mol #95haa/sho
-analytic 2.0346398E+2 2.8379542E-2 -1.498398E+4 -7.3311633E+1 -6.079409E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Pr+3 + 1.000H2O = PrOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -8.266
delta_h 83.714 #kJ/mol #95haa/sho
-analytic 1.568605E+2 2.4159485E-2 -1.1569421E+4 -5.5430282E+1 3.2291166E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Pr+3 + 1.000SO4-2 = PrSO4+
-llnl_gamma 4.1
log_k -3.607
delta_h 61.106 #kJ/mol #95haa/sho
-analytic 1.6468349E+3 2.6102645E-1 -9.1474867E+4 -5.9754798E+2 5.078874E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Pt+2 + 2.000SO4-2 = Pt(SO4)2-2
-llnl_gamma 4.7
log_k 4.858
delta_h 11.138 #kJ/mol #98sas/sho
-analytic 1.825619E+3 2.8625926E-1 -1.0194747E+5 -6.6013311E+2 6.1585846E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pt+2 + 3.000SO4-2 = Pt(SO4)3-4
-llnl_gamma 9.6
log_k 6.242
delta_h 22.544 #kJ/mol #98sas/sho
-analytic 1.9956647E+3 3.0926635E-1 -1.1461914E+5 -7.1836382E+2 7.1424764E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Cl- + 1.000Pt+2 = PtCl+
-llnl_gamma 4.1
log_k 8.692
delta_h -45.782 #kJ/mol #98sas/sho
-analytic 8.136846E+2 1.3336916E-1 -4.2478118E+4 -2.9625189E+2 2.7354002E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
2.000Cl- + 1.000Pt+2 = PtCl2
-llnl_gamma 3.4
log_k 15.515
delta_h -92.745 #kJ/mol #98sas/sho
-analytic 1.6086651E+3 2.6251481E-1 -8.3744569E+4 -5.8633828E+2 5.3618285E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
3.000Cl- + 1.000Pt+2 = PtCl3-
-llnl_gamma 3.6
log_k 18.526
delta_h -130.801 #kJ/mol #98sas/sho
-analytic 1.5878969E+3 2.6017188E-1 -8.2562704E+4 -5.7909542E+2 5.5922413E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
4.000Cl- + 1.000Pt+2 = PtCl4-2
-llnl_gamma 4.7
log_k 20.057
delta_h -177.245 #kJ/mol #98sas/sho
-analytic 1.5484326E+3 2.5438399E-1 -7.9703614E+4 -5.662E+2 5.7008799E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pt+2 + 1.000H2O = PtO + 2.000H+
-llnl_gamma 3.4
log_k 4.437
delta_h -32.955 #kJ/mol #98sas/sho
-analytic 2.8023516E+2 4.6356445E-2 -1.1971125E+4 -1.037808E+2 6.5162285E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pt+2 + 1.000H2O = PtOH+ + 1.000H+
-llnl_gamma 4.1
log_k 2.465
delta_h -13.841 #kJ/mol #98sas/sho
-analytic 1.8597453E+2 2.89547E-2 -9.3880305E+3 -6.7592535E+1 5.8654615E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Pt+2 + 1.000SO4-2 = PtSO4
-llnl_gamma 3.4
log_k 2.990
delta_h 2.368 #kJ/mol #98sas/sho
-analytic 1.6713406E+3 2.6568597E-1 -9.0259829E+4 -6.0764518E+2 5.2221456E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Br- + 1.000Rb+ = RbBr
-llnl_gamma 3.4
log_k -1.217
delta_h 13.931 #kJ/mol #97sve/sho
-analytic 6.4939177E+2 1.0250026E-1 -3.5678839E+4 -2.3605365E+2 2.0087942E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cl- + 1.000Rb+ = RbCl
-llnl_gamma 3.4
log_k -0.947
delta_h 13.180 #kJ/mol #97sve/sho
-analytic 6.4893651E+2 1.0345519E-1 -3.5314004E+4 -2.3619336E+2 1.9698919E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000Rb+ = RbF
-llnl_gamma 3.4
log_k 1.000
delta_h 1.899 #kJ/mol #97sve/sho
-analytic 7.2299104E+2 1.1414147E-1 -3.8880808E+4 -2.6290537E+2 2.2158284E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000I- + 1.000Rb+ = RbI
-llnl_gamma 3.4
log_k -0.960
delta_h 7.975 #kJ/mol #97sve/sho
-analytic 5.9916632E+2 9.5931446E-2 -3.2538042E+4 -2.1835691E+2 1.8413876E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Rb+ + 1.000H2O = RbOH + 1.000H+
-llnl_gamma 3.4
log_k -14.204
delta_h 64.213 #kJ/mol #97asho/sas
-analytic 5.1747365E-1 -3.1864225E-3 -1.8801903E+3 -1.6746387E+0 -2.9523567E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Rh+3 + 2.000SO4-2 = Rh(SO4)2-
-llnl_gamma 3.6
log_k 2.131
delta_h 67.868 #kJ/mol #98sas/sho
-analytic 2.551319E+3 4.0341267E-1 -1.4205388E+5 -9.2337766E+2 8.1624977E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+2 + 2.000SO4-2 = Rh(SO4)2-2
-llnl_gamma 4.7
log_k 4.513
delta_h 12.231 #kJ/mol #98sas/sho
-analytic 1.8025014E+3 2.8181344E-1 -1.0096726E+5 -6.5150893E+2 6.1115526E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+3 + 3.000SO4-2 = Rh(SO4)3-3
-llnl_gamma 6.7
log_k 1.969
delta_h 108.811 #kJ/mol #98sas/sho
-analytic 2.7847276E+3 4.3682983E-1 -1.5921351E+5 -1.0036951E+3 9.2967665E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+2 + 3.000SO4-2 = Rh(SO4)3-4
-llnl_gamma 9.6
log_k 6.110
delta_h 22.050 #kJ/mol #98sas/sho
-analytic 1.973948E+3 3.0504126E-1 -1.1363556E+5 -7.1027158E+2 7.099959E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Cl- + 1.000Rh+2 = RhCl+
-llnl_gamma 4.1
log_k -0.207
delta_h 3.515 #kJ/mol #98sas/sho
-analytic 7.9942463E+2 1.3016858E-1 -4.4359067E+4 -2.9095129E+2 2.6916905E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Cl- + 1.000Rh+3 = RhCl+2
-llnl_gamma 5.7
log_k 2.022
delta_h -0.348 #kJ/mol #98sas/sho
-analytic 8.3283361E+2 1.3629397E-1 -4.66684E+4 -3.0224381E+2 2.9300334E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
2.000Cl- + 1.000Rh+3 = RhCl2+
-llnl_gamma 4.1
log_k 3.303
delta_h -11.813 #kJ/mol #98sas/sho
-analytic 1.6310717E+3 2.6554033E-1 -8.9751306E+4 -5.9332801E+2 5.5326626E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
2.000Cl- + 1.000Rh+2 = RhCl2
-llnl_gamma 3.4
log_k -0.773
delta_h -3.394 #kJ/mol #98sas/sho
-analytic 1.5927413E+3 2.5933664E-1 -8.7318436E+4 -5.8080917E+2 5.2631047E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
3.000Cl- + 1.000Rh+3 = RhCl3
-llnl_gamma 3.4
log_k 3.338
delta_h -32.382 #kJ/mol #98sas/sho
-analytic 2.366619E+3 3.8725125E-1 -1.2704145E+5 -8.6423353E+2 7.6313997E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
3.000Cl- + 1.000Rh+2 = RhCl3-
-llnl_gamma 3.6
log_k -2.093
delta_h -20.215 #kJ/mol #98sas/sho
-analytic 1.5502432E+3 2.5286251E-1 -8.5900495E+4 -5.6587094E+2 5.3864897E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
4.000Cl- + 1.000Rh+3 = RhCl4-
-llnl_gamma 3.6
log_k 3.300
delta_h -72.492 #kJ/mol #98sas/sho
-analytic 2.3207399E+3 3.7507528E-1 -1.2284848E+5 -8.4908994E+2 7.4479454E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
4.000Cl- + 1.000Rh+2 = RhCl4-2
-llnl_gamma 4.7
log_k -3.297
delta_h -56.417 #kJ/mol #98sas/sho
-analytic 1.4969207E+3 2.4443621E-1 -8.2504138E+4 -5.4840384E+2 5.3881494E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+3 + 1.000H2O = RhO+ + 2.000H+
-llnl_gamma 4.1
log_k -5.400
delta_h 75.962 #kJ/mol #98sas/sho
-analytic 2.2483762E+2 3.667892E-2 -1.3279613E+4 -8.0884344E+1 3.1195009E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+2 + 1.000H2O = RhO + 2.000H+
-llnl_gamma 3.4
log_k -15.948
delta_h 81.032 #kJ/mol #98sas/sho
-analytic 2.918108E+2 4.7802055E-2 -1.9189086E+4 -1.0768961E+2 7.8405239E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+2 + 1.000H2O = RhOH+ + 1.000H+
-llnl_gamma 4.1
log_k -7.834
delta_h 43.198 #kJ/mol #98sas/sho
-analytic 1.9955285E+2 3.0147506E-2 -1.382324E+4 -7.2042752E+1 7.3365394E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+3 + 1.000H2O = RhOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -2.498
delta_h 42.178 #kJ/mol #98sas/sho
-analytic 1.7459634E+2 2.7147056E-2 -1.1659E+4 -6.1672037E+1 5.7958425E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+3 + 1.000SO4-2 = RhSO4+
-llnl_gamma 4.1
log_k 1.560
delta_h 31.110 #kJ/mol #98sas/sho
-analytic 1.6670695E+3 2.6422071E-1 -9.1392594E+4 -6.0470485E+2 5.204568E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Rh+2 + 1.000SO4-2 = RhSO4
-llnl_gamma 3.4
log_k 2.477
delta_h 4.798 #kJ/mol #98sas/sho
-analytic 1.6662284E+3 2.643244E-1 -9.0242681E+4 -6.0564173E+2 5.221268E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+3 + 2.000SO4-2 = Ru(SO4)2-
-llnl_gamma 3.6
log_k 2.710
delta_h 64.563 #kJ/mol #98sas/sho
-analytic 2.5456562E+3 4.0235895E-1 -1.4128764E+5 -9.2146744E+2 8.0966633E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+2 + 2.000SO4-2 = Ru(SO4)2-2
-llnl_gamma 4.7
log_k 4.147
delta_h 14.572 #kJ/mol #98sas/sho
-analytic 1.8095702E+3 2.8292532E-1 -1.0145972E+5 -6.5407292E+2 6.1319394E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+3 + 3.000SO4-2 = Ru(SO4)3-3
-llnl_gamma 6.7
log_k 2.328
delta_h 106.761 #kJ/mol #98sas/sho
-analytic 2.7805071E+3 4.3599372E-1 -1.5859115E+5 -1.0023081E+3 9.2353812E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+2 + 3.000SO4-2 = Ru(SO4)3-4
-llnl_gamma 9.6
log_k 5.304
delta_h 27.151 #kJ/mol #98sas/sho
-analytic 1.9783349E+3 3.0571876E-1 -1.1412926E+5 -7.1183982E+2 7.1125138E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Cl- + 1.000Ru+2 = RuCl+
-llnl_gamma 4.1
log_k -0.493
delta_h 5.645 #kJ/mol #98sas/sho
-analytic 8.0086052E+2 1.3040448E-1 -4.4592224E+4 -2.9141572E+2 2.7040583E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Cl- + 1.000Ru+3 = RuCl+2
-llnl_gamma 5.7
log_k 2.183
delta_h -1.019 #kJ/mol #98sas/sho
-analytic 8.4566243E+2 1.3854465E-1 -4.7776586E+4 -3.0665709E+2 3.0454742E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
2.000Cl- + 1.000Ru+3 = RuCl2+
-llnl_gamma 4.1
log_k 3.779
delta_h -14.033 #kJ/mol #98sas/sho
-analytic 1.6644313E+3 2.7146021E-1 -9.2650933E+4 -6.0479864E+2 5.8402814E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
2.000Cl- + 1.000Ru+2 = RuCl2
-llnl_gamma 3.4
log_k -1.293
delta_h 0.824 #kJ/mol #98sas/sho
-analytic 1.595528E+3 2.5972204E-1 -8.7828475E+4 -5.816473E+2 5.295329E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
3.000Cl- + 1.000Ru+3 = RuCl3
-llnl_gamma 3.4
log_k 4.335
delta_h -37.199 #kJ/mol #98sas/sho
-analytic 2.4332648E+3 3.988706E-1 -1.3271343E+5 -8.8718544E+2 8.2273139E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
3.000Cl- + 1.000Ru+2 = RuCl3-
-llnl_gamma 3.6
log_k -2.790
delta_h -13.870 #kJ/mol #98sas/sho
-analytic 1.55914E+3 2.544506E-1 -8.6909863E+4 -5.6886442E+2 5.4510262E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
4.000Cl- + 1.000Ru+3 = RuCl4-
-llnl_gamma 3.6
log_k 4.194
delta_h -75.975 #kJ/mol #98sas/sho
-analytic 2.42266E+3 3.9315121E-1 -1.3187021E+5 -8.8413287E+2 8.3862363E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
4.000Cl- + 1.000Ru+2 = RuCl4-2
-llnl_gamma 4.7
log_k -4.140
delta_h -47.364 #kJ/mol #98sas/sho
-analytic 1.5103672E+3 2.468895E-1 -8.4008102E+4 -5.528902E+2 5.4881187E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
5.000Cl- + 1.000Ru+3 = RuCl5-2
-llnl_gamma 4.7
log_k 3.907
delta_h -165.659 #kJ/mol #98sas/sho
-analytic 2.4406041E+3 3.9395351E-1 -1.3121619E+5 -8.9436672E+2 8.8003754E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
6.000Cl- + 1.000Ru+3 = RuCl6-3
-llnl_gamma 6.7
log_k 3.525
delta_h -265.789 #kJ/mol #98sas/sho
-analytic 2.398678E+3 3.8299788E-1 -1.242379E+5 -8.8470795E+2 8.5785524E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+3 + 1.000H2O = RuO+ + 2.000H+
-llnl_gamma 4.1
log_k -3.509
delta_h 65.666 #kJ/mol #98sas/sho
-analytic 2.1053454E+2 3.4339559E-2 -1.1504754E+4 -7.5918756E+1 1.9210195E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+2 + 1.000H2O = RuO + 2.000H+
-llnl_gamma 3.4
log_k -15.399
delta_h 78.642 #kJ/mol #98sas/sho
-analytic 2.8502004E+2 4.6597664E-2 -1.8545838E+4 -1.0524041E+2 7.3798215E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+2 + 1.000H2O = RuOH+ + 1.000H+
-llnl_gamma 4.1
log_k -7.555
delta_h 42.231 #kJ/mol #98sas/sho
-analytic 1.9064829E+2 2.88222E-2 -1.3104526E+4 -6.888978E+1 6.7728052E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+3 + 1.000H2O = RuOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -2.234
delta_h 40.921 #kJ/mol #98sas/sho
-analytic 1.6252471E+2 2.5115178E-2 -1.0499562E+4 -5.7513454E+1 4.6956955E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+3 + 1.000SO4-2 = RuSO4+
-llnl_gamma 4.1
log_k 2.066
delta_h 28.223 #kJ/mol #98sas/sho
-analytic 1.6578068E+3 2.6264554E-1 -9.0448177E+4 -6.0149528E+2 5.1271119E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000Ru+2 + 1.000SO4-2 = RuSO4
-llnl_gamma 3.4
log_k 2.403
delta_h 5.341 #kJ/mol #98sas/sho
-analytic 1.6653938E+3 2.6410378E-1 -9.0244049E+4 -6.053037E+2 5.2208407E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
1.000HS- = S-2 + 1.000H+
-llnl_gamma 5.0
log_k -17.100
delta_h 73.277 #kJ/mol #Internal calculation
-analytic 7.5990924E+2 1.0332456E-1 -4.4624166E+4 -2.7565023E+2 2.1275102E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; V°: Default value;
1.500HS- + 0.250S2O3-2 = S2-2 + 0.750H2O
-llnl_gamma 4.7
log_k -3.333
delta_h 8.189 #kJ/mol #04chi
-analytic -5.0808391E+1 -5.7939636E-3 2.6885856E+3 1.7194332E+1 -2.0986896E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel;
2.000SO3-2 + 2.000H+ = S2O5-2 + 1.000H2O
-llnl_gamma 4.7
log_k 12.850
delta_h 2.605 #kJ/mol #Internal calculation
-analytic 1.4609098E+3 2.3526643E-1 -8.090417E+4 -5.2657763E+2 4.9896902E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 97asho/sas; V°: 97asho/sas;
2.000HS- + 0.500S2O3-2 + 1.000H+ = S3-2 + 1.500H2O
-llnl_gamma 4.7
log_k 7.903
delta_h -44.062 #kJ/mol #04chi
-analytic 6.4105216E+2 1.0610644E-1 -3.2939051E+4 -2.3376269E+2 2.144492E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel;
1.000S2O4-2 + 1.000SO3-2 + 2.000H+ = S3O6-2 + 1.000H2O
-llnl_gamma 4.7
log_k 18.881
delta_h -68.607 #kJ/mol #97asho/sas
-analytic 1.4125857E+3 2.2730359E-1 -7.4567136E+4 -5.1132411E+2 4.7880078E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.500HS- + 0.750S2O3-2 + 2.000H+ = S4-2 + 2.250H2O
-llnl_gamma 4.7
log_k 18.036
delta_h -90.143 #kJ/mol #04chi
-analytic 1.3325896E+3 2.1804958E-1 -6.8851089E+4 -4.8463888E+2 4.4953752E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel;
1.000S2O3-2 + 1.000S2O4-2 + 2.000H+ = S4O6-2 + 1.000H2O
-llnl_gamma 4.7
log_k 27.056
delta_h -104.283 #kJ/mol #97asho/sas
-analytic 1.509226E+3 2.4211391E-1 -7.8114083E+4 -5.4560243E+2 5.1288867E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
3.000HS- + 1.000S2O3-2 + 3.000H+ = S5-2 + 3.000H2O
-llnl_gamma 4.7
log_k 27.949
delta_h -134.964 #kJ/mol #04chi
-analytic 2.027203E+3 3.3042854E-1 -1.0499647E+5 -7.366256E+2 6.8555421E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 88sho/hel; V°: 88sho/hel;
2.500S2O3-2 + 3.000H+ = S5O6-2 + 1.500H2O
-llnl_gamma 4.7
log_k 0.871
delta_h 26.266 #kJ/mol #97asho/sas
-analytic 2.1005465E+3 3.3737902E-1 -1.1779345E+5 -7.6187185E+2 7.1131185E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97asho/sas; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
4.000HS- + 2.000Sb(OH)3 + 2.000H+ = Sb2S4-2 + 6.000H2O
-llnl_gamma 4.7
log_k 43.519
delta_h -258.255 #kJ/mol #Internal calculation
-analytic 1.1425624E+3 2.0226605E-1 -4.4375611E+4 -4.2266863E+2 3.1427329E+6
#References = LogK/DGf: 05bes/app; DHf/DHr: Internal calculation; S°: 05bes/app; Cp: 05bes/app; V°: 05bes/app;
1.000CN- + 0.500HS- + 0.250S2O3-2 + 1.000H+ = SCN- + 0.750H2O
-llnl_gamma 3.5
log_k 23.306
delta_h -117.402 #kJ/mol #97asho/sas
-analytic 7.1893928E+2 1.1608779E-1 -3.3663289E+4 -2.6057297E+2 2.4386067E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Sc+3 + 1.000H2O = ScO+ + 2.000H+
-llnl_gamma 4.1
log_k -9.732
delta_h 106.303 #kJ/mol #97asho/sas
-analytic 1.8771228E+2 3.0715425E-2 -1.0976497E+4 -6.8152772E+1 -1.0201253E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Sc+3 + 2.000H2O = ScO2- + 4.000H+
-llnl_gamma 3.6
log_k -25.989
delta_h 206.682 #kJ/mol #97asho/sas
-analytic -2.3820422E+2 -4.1309483E-2 7.3527354E+3 8.7856356E+1 -1.5577674E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Sc+3 + 1.000H2O = ScOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -4.308
delta_h 60.247 #kJ/mol #97asho/sas
-analytic 1.3842768E+2 2.1384803E-2 -8.6113214E+3 -4.925553E+1 1.4670462E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000CN- + 0.750HSe- + 0.250SeO4-2 + 1.250H+ = SeCN- + 1.000H2O
-llnl_gamma 3.6
log_k 43.890
delta_h -221.410 #kJ/mol #97asho/sas
-analytic 9.452807E+2 1.5128321E-1 -4.0871323E+4 -3.4175692E+2 3.2217591E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
6.000F- + 1.000SO4-2 + 8.000H+ = SF6 + 4.000H2O
-llnl_gamma 3.4
log_k -70.065
delta_h 548.922 #kJ/mol #01sch/sho
-analytic 6.0803233E+3 9.6429773E-1 -3.7059279E+5 -2.1964555E+3 2.1340358E+7
#References = LogK/DGf: 01sch/sho; DHf/DHr: Internal calculation; S°: 01sch/sho; Cp: 01sch/sho; V°: 01sch/sho;
2.000H4SiO4 = Si2O2(OH)5- + 1.000H2O + 1.000H+
-llnl_gamma 3.6
log_k -8.500
delta_h 21.714 #kJ/mol #Internal calculation
-analytic 1.601384E+2 2.2967889E-2 -6.9307816E+3 -6.1445436E+1 -1.7592628E+4
#References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
2.000H4SiO4 = Si2O3(OH)4-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -19.400
delta_h 57.128 #kJ/mol #Internal calculation
-analytic 2.4483144E+2 2.2967889E-2 -1.2759796E+4 -9.2176672E+1 -1.7592628E+4
#References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
3.000H4SiO4 = Si3O5(OH)5-3 + 2.000H2O + 3.000H+
-llnl_gamma 4.5
log_k -29.401
delta_h 87.404 #kJ/mol #Internal calculation
-analytic 3.7867599E+2 3.6141463E-2 -1.9849346E+4 -1.4240552E+2 8.5342353E+3
#References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
3.000H4SiO4 = Si3O6(OH)3-3 + 3.000H2O + 3.000H+
-llnl_gamma 4.5
log_k -29.401
delta_h 87.404 #kJ/mol #Internal calculation
-analytic 4.0153365E+2 3.9520722E-2 -2.108976E+4 -1.5068655E+2 7.8380589E+4
#References = LogK/DGf: 07las; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
4.000H4SiO4 = Si4O12H4-4 + 4.000H2O + 4.000H+
-llnl_gamma 9.6
log_k -39.201
delta_h 116.539 #kJ/mol #Internal calculation
-analytic 5.353782E+2 5.2694296E-2 -2.811968E+4 -2.0091539E+2 1.0450745E+5
#References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
4.000H4SiO4 = Si4O6(OH)6-2 + 4.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -15.201
delta_h 33.154 #kJ/mol #Internal calculation
-analytic 3.659921E+2 5.2694296E-2 -1.5805722E+4 -1.3945292E+2 1.0450745E+5
#References = LogK/DGf: 07las; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
4.000H4SiO4 = Si4O7(OH)6-4 + 3.000H2O + 4.000H+
-llnl_gamma 9.6
log_k -39.101
delta_h 115.968 #kJ/mol #Internal calculation
-analytic 5.1252054E+2 4.9315037E-2 -2.6849451E+4 -1.9263437E+2 3.4661098E+4
#References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
4.000H4SiO4 = Si4O8(OH)4-4 + 4.000H2O + 4.000H+
-llnl_gamma 9.6
log_k -39.101
delta_h 115.968 #kJ/mol #Internal calculation
-analytic 5.353782E+2 5.2694296E-2 -2.8089865E+4 -2.0091539E+2 1.0450745E+5
#References = LogK/DGf: 01fel/cho; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
6.000H4SiO4 = Si6O15-6 + 9.000H2O + 6.000H+
-llnl_gamma 4.5
log_k -61.503
delta_h 190.220 #kJ/mol #Internal calculation
-analytic 8.7164025E+2 8.9179221E-2 -4.6705767E+4 -3.2621617E+2 3.6630024E+5
#References = LogK/DGf: 07las; DHf/DHr: Internal calculation; S°: 17bbla; V°: Default value;
6.000F- + 1.000H4SiO4 + 4.000H+ = SiF6-2 + 4.000H2O
-llnl_gamma 4.7
log_k 26.230
delta_h -59.090 #kJ/mol #88sho/hel
-analytic 2.9934391E+3 4.815153E-1 -1.587155E+5 -1.0854045E+3 9.5404116E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 88sho/hel; S°: 88sho/hel; Cp: 88sho/hel; V°: 88sho/hel;
1.000Cl- + 1.000Sm+3 = SmCl+2
-llnl_gamma 5.7
log_k 0.321
delta_h 14.474 #kJ/mol #95haa/sho
-analytic 8.1417583E+2 1.3280258E-1 -4.5595045E+4 -2.9554718E+2 2.7369344E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Sm+3 = SmCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 19.990 #kJ/mol #95haa/sho
-analytic 1.5580755E+3 2.5323144E-1 -8.5086474E+4 -5.67261E+2 4.928058E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Sm+3 = SmCl3
-llnl_gamma 3.4
log_k -0.356
delta_h 13.779 #kJ/mol #95haa/sho
-analytic 2.2472217E+3 3.6383443E-1 -1.1911355E+5 -8.2077824E+2 6.6150902E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Sm+3 = SmCl4-
-llnl_gamma 3.6
log_k -0.768
delta_h -5.236 #kJ/mol #95haa/sho
-analytic 1.6568872E+3 2.8048624E-1 -8.0746942E+4 -6.1229656E+2 3.9675208E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Sm+3 = SmCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.462
delta_h -5.178 #kJ/mol #95haa/sho
-analytic 7.183597E+2 1.1692218E-1 -3.5990243E+4 -2.64966E+2 1.8374698E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Sm+3 = SmF+2
-llnl_gamma 5.7
log_k 4.409
delta_h 22.985 #kJ/mol #95haa/sho
-analytic 9.0555003E+2 1.4583404E-1 -5.0713933E+4 -3.2667713E+2 3.0059032E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Sm+3 = SmF2+
-llnl_gamma 4.1
log_k 7.718
delta_h 13.451 #kJ/mol #95haa/sho
-analytic 1.7179557E+3 2.7518278E-1 -9.3475565E+4 -6.2242385E+2 5.4564423E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Sm+3 = SmF3
-llnl_gamma 3.4
log_k 10.147
delta_h -8.776 #kJ/mol #95haa/sho
-analytic 2.4954036E+3 3.9902558E-1 -1.3169091E+5 -9.078329E+2 7.4528808E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Sm+3 = SmF4-
-llnl_gamma 3.6
log_k 12.137
delta_h -50.074 #kJ/mol #95haa/sho
-analytic 2.0120174E+3 3.2837719E-1 -9.9124744E+4 -7.3741492E+2 5.2771225E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000H2PO4- + 1.000Sm+3 = SmH2PO4+2
-llnl_gamma 5.7
log_k 1.037
delta_h -5.553 #kJ/mol #95haa/sho
-analytic 8.469815E+2 1.3486836E-1 -4.8141097E+4 -3.0688495E+2 3.0825426E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Sm+3 = SmHCO3+2
-llnl_gamma 5.7
log_k 1.789
delta_h 8.851 #kJ/mol #95haa/sho
-analytic 8.6053979E+2 1.37448E-1 -4.9163484E+4 -3.1096544E+2 3.0781942E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000NO3- + 1.000Sm+3 = SmNO3+2
-llnl_gamma 5.7
log_k 0.801
delta_h -29.298 #kJ/mol #95haa/sho
-analytic 7.7581105E+2 1.2291034E-1 -4.3203226E+4 -2.8239324E+2 2.8456925E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Sm+3 + 1.000H2O = SmO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.476
delta_h 150.160 #kJ/mol #95haa/sho
-analytic 2.1723031E+2 3.5096449E-2 -1.5517824E+4 -7.8097469E+1 9.9892946E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Sm+3 + 2.000H2O = SmO2- + 4.000H+
-llnl_gamma 3.6
log_k -35.005
delta_h 266.129 #kJ/mol #95haa/sho
-analytic -2.0144743E+2 -3.5964054E-2 2.6216666E+3 7.4845743E+1 -1.4959409E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Sm+3 + 2.000H2O = SmO2H + 3.000H+
-llnl_gamma 3.4
log_k -25.915
delta_h 226.722 #kJ/mol #95haa/sho
-analytic 3.2264693E+2 4.8800504E-2 -2.1330832E+4 -1.1692234E+2 -2.0013885E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Sm+3 + 1.000H2O = SmOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.973
delta_h 81.791 #kJ/mol #95haa/sho
-analytic 1.604726E+2 2.4561137E-2 -1.1909836E+4 -5.6581066E+1 3.7186057E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000SO4-2 + 1.000Sm+3 = SmSO4+
-llnl_gamma 4.1
log_k 3.723
delta_h 19.890 #kJ/mol #95haa/sho
-analytic 1.6441727E+3 2.6039619E-1 -8.9216864E+4 -5.9647906E+2 5.075477E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Sn+2 + 1.000H2O = SnO + 2.000H+
-llnl_gamma 3.4
log_k -7.072
delta_h 42.963 #kJ/mol #97asho/sas
-analytic 1.9003412E+2 2.9470557E-2 -1.0300215E+4 -7.0305864E+1 2.3307576E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Sn+2 + 1.000H2O = SnOH+ + 1.000H+
-llnl_gamma 4.1
log_k -3.407
delta_h 27.532 #kJ/mol #97asho/sas
-analytic 1.5185251E+2 2.26432E-2 -8.6556514E+3 -5.515485E+1 3.1095711E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000HCO3- + 1.000Sr+2 = Sr(CO3) + 1.000H+
-llnl_gamma 3.4
log_k -7.522
delta_h 36.523 #kJ/mol #Internal calculation
-analytic 7.1800764E+2 1.1713203E-1 -3.8145718E+4 -2.6405068E+2 1.8547892E+6
#References = LogK/DGf: 84bus/plu; DHf/DHr: Internal calculation; S°: 84bus/plu; Cp: 97sve/sho; V°: 97sve/sho;
1.000HCO3- + 1.000Sr+2 = Sr(HCO3)+
-llnl_gamma 4.1
log_k 1.180
delta_h 25.315 #kJ/mol #Internal calculation
-analytic 9.6006291E+2 1.5199542E-1 -5.5122473E+4 -3.4633219E+2 3.3475266E+6
#References = LogK/DGf: 84bus/plu; DHf/DHr: Internal calculation; S°: 84bus/plu; Cp: 95sho/kor; V°: 95sho/kor;
1.000H2AsO4- + 1.000Sr+2 = SrAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -13.586
delta_h 106.774 #kJ/mol #Internal calculation
-analytic 3.0904863E+2 4.4557984E-2 -1.8324214E+4 -1.1237079E+2 3.1953453E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Sr+2 = SrCl+
-llnl_gamma 4.1
log_k -0.230
delta_h 7.551 #kJ/mol #Internal calculation
-analytic 8.1483398E+2 1.3239255E-1 -4.5357313E+4 -2.963007E+2 2.7351726E+6
#References = LogK/DGf: 96bou; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000Sr+2 = SrF+
-llnl_gamma 4.1
log_k 0.174
delta_h 4.780 #kJ/mol #97sve/sho
-analytic 8.549729E+2 1.3681732E-1 -4.7790892E+4 -3.1037473E+2 2.9070099E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO3- + 1.000Sr+2 = SrH2AsO3+
-llnl_gamma 4.1
log_k 0.399
delta_h 0.626 #kJ/mol #Internal calculation
-analytic 6.6325279E+2 1.0241162E-1 -3.4997932E+4 -2.4144609E+2 1.9057574E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2AsO4- + 1.000Sr+2 = SrH2AsO4+
-llnl_gamma 4.1
log_k 0.820
delta_h 3.838 #kJ/mol #Internal calculation
-analytic 8.639698E+2 1.3631157E-1 -4.8294405E+4 -3.1311061E+2 2.9300089E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2PO4- + 1.000Sr+2 = SrH2PO4+
-llnl_gamma 4.1
log_k 0.830
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000H2AsO4- + 1.000Sr+2 = SrHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -5.151
delta_h 16.090 #kJ/mol #Internal calculation
-analytic 8.6810085E+2 1.3702965E-1 -4.6939884E+4 -3.1741842E+2 2.5566666E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2PO4- + 1.000Sr+2 = SrHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -4.700
#References = LogK/DGf: 97smi/mar;
#References = LogK/DGf: 97smi/mar; V°: Default value;
1.000Sr+2 + 1.000H2O = SrOH+ + 1.000H+
-llnl_gamma 4.1
log_k -13.290
delta_h 82.608 #kJ/mol #Internal calculation
-analytic 1.3925835E+2 2.0503061E-2 -1.0913316E+4 -5.0593077E+1 2.7838631E+5
#References = LogK/DGf: 76bae/mes; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
2.000H2PO4- + 1.000Sr+2 = SrP2O7-2 + 1.000H2O + 2.000H+
-llnl_gamma 4.7
log_k -12.410
#References = LogK/DGf: 76smi/mar;
#References = LogK/DGf: 76smi/mar; V°: Default value;
1.000H2PO4- + 1.000Sr+2 = SrPO4- + 2.000H+
-llnl_gamma 3.6
log_k -13.560
#References = LogK/DGf: 96bou;
#References = LogK/DGf: 96bou; V°: Default value;
1.000SO4-2 + 1.000Sr+2 = SrSO4
-llnl_gamma 3.4
log_k 2.300
delta_h 7.029 #kJ/mol #06bla/ign
-analytic 1.7733534E+3 2.6670392E-1 -9.749797E+4 -6.4131673E+2 5.6300692E+6
#References = LogK/DGf: 06bla/ign; DHf/DHr: 06bla/ign; S°: Internal calculation; V°: Default value;
1.000Cl- + 1.000Tb+3 = TbCl+2
-llnl_gamma 5.7
log_k 0.248
delta_h 14.019 #kJ/mol #95haa/sho
-analytic 8.2636481E+2 1.3516859E-1 -4.6636167E+4 -2.9986384E+2 2.8440981E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Tb+3 = TbCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 17.994 #kJ/mol #95haa/sho
-analytic 1.5907027E+3 2.592204E-1 -8.7918639E+4 -5.7868264E+2 5.2257141E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Tb+3 = TbCl3
-llnl_gamma 3.4
log_k -0.429
delta_h 10.206 #kJ/mol #95haa/sho
-analytic 2.3151289E+3 3.7630951E-1 -1.2477837E+5 -8.447025E+2 7.1928096E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Tb+3 = TbCl4-
-llnl_gamma 3.6
log_k -0.841
delta_h -11.803 #kJ/mol #95haa/sho
-analytic 2.1704367E+3 3.5191379E-1 -1.1409893E+5 -7.9440799E+2 6.4180439E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Tb+3 = TbCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.389
delta_h -6.595 #kJ/mol #95haa/sho
-analytic 7.1212831E+2 1.1821708E-1 -3.5408797E+4 -2.6324867E+2 1.8124921E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Tb+3 = TbF+2
-llnl_gamma 5.7
log_k 4.702
delta_h 22.684 #kJ/mol #95haa/sho
-analytic 9.1896886E+2 1.484885E-1 -5.1773866E+4 -3.3134581E+2 3.1117157E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Tb+3 = TbF2+
-llnl_gamma 4.1
log_k 8.231
delta_h 12.020 #kJ/mol #95haa/sho
-analytic 1.7544768E+3 2.8187668E-1 -9.6470633E+4 -6.350988E+2 5.7591387E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Tb+3 = TbF3
-llnl_gamma 3.4
log_k 10.807
delta_h -11.918 #kJ/mol #95haa/sho
-analytic 2.5641193E+3 4.1150067E-1 -1.3737827E+5 -9.3175712E+2 8.0306002E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Tb+3 = TbF4-
-llnl_gamma 3.6
log_k 12.943
delta_h -56.422 #kJ/mol #95haa/sho
-analytic 2.5515215E+3 4.0376241E-1 -1.3381147E+5 -9.2866045E+2 7.8008608E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000H2PO4- + 1.000Tb+3 = TbH2PO4+2
-llnl_gamma 5.7
log_k 0.963
delta_h -7.005 #kJ/mol #95haa/sho
-analytic 8.5978775E+2 1.3733185E-1 -4.9177828E+4 -3.1148232E+2 3.1926878E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Tb+3 = TbHCO3+2
-llnl_gamma 5.7
log_k 1.716
delta_h -14.557 #kJ/mol #95haa/sho
-analytic 8.5058122E+2 1.3578331E-1 -4.8298031E+4 -3.0831879E+2 3.1608553E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000NO3- + 1.000Tb+3 = TbNO3+2
-llnl_gamma 5.7
log_k 0.508
delta_h -31.242 #kJ/mol #95haa/sho
-analytic 7.8947978E+2 1.2540017E-1 -4.430973E+4 -2.8736954E+2 2.9630741E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tb+3 + 1.000H2O = TbO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.183
delta_h 146.740 #kJ/mol #95haa/sho
-analytic 2.0816256E+2 3.3910407E-2 -1.4725197E+4 -7.5027614E+1 5.1884448E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tb+3 + 2.000H2O = TbO2- + 4.000H+
-llnl_gamma 3.6
log_k -34.198
delta_h 258.906 #kJ/mol #95haa/sho
-analytic -1.9759152E+2 -3.5265685E-2 2.5663792E+3 7.3395747E+1 -1.4501139E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tb+3 + 2.000H2O = TbO2H + 3.000H+
-llnl_gamma 3.4
log_k -25.036
delta_h 219.580 #kJ/mol #95haa/sho
-analytic 2.2033529E+2 3.2200812E-2 -1.5776727E+4 -7.9521389E+1 -4.6987081E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tb+3 + 1.000H2O = TbOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.827
delta_h 79.582 #kJ/mol #95haa/sho
-analytic 1.547826E+2 2.3885736E-2 -1.1340663E+4 -5.4726702E+1 3.3100949E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000SO4-2 + 1.000Tb+3 = TbSO4+
-llnl_gamma 4.1
log_k 3.723
delta_h 19.266 #kJ/mol #95haa/sho
-analytic 1.6378326E+3 2.5957663E-1 -8.8820607E+4 -5.9425471E+2 5.0533778E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tl+3 + 2.000H2O = Tl(OH)2+ + 2.000H+
-llnl_gamma 4.1
log_k -1.569
delta_h 59.815 #kJ/mol #Internal calculation
-analytic 4.276899E+2 6.2849603E-2 -2.3635778E+4 -1.5324922E+2 9.3179018E+5
#References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 17abla; V°: Default value;
1.000Tl+3 + 1.000SO4-2 = Tl(SO4)+
-llnl_gamma 4.1
log_k 4.380
delta_h 11.958 #kJ/mol #Internal calculation
-analytic 1.8636088E+3 2.9458748E-1 -1.0166459E+5 -6.7594831E+2 5.9127165E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 17abla; V°: Default value;
1.000Tl+3 + 1.000Cl- = TlCl+2
-llnl_gamma 5.7
log_k 7.743
delta_h -27.242 #kJ/mol #Internal calculation
-analytic 7.8251767E+2 1.2726102E-1 -4.0012323E+4 -2.8493738E+2 2.3595147E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 97sve/sho; V°: 97sve/sho;
1.000Cl- + 1.000Tl+ = TlCl
-llnl_gamma 3.4
log_k 0.523
delta_h -11.690 #kJ/mol #09xio
-analytic 6.4703688E+2 1.0349976E-1 -3.4122179E+4 -2.3650095E+2 1.9805354E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: 09xio; S°: Internal calculation; Cp: 97sve/sho; V°: 97sve/sho;
1.000Tl+3 + 2.000Cl- = TlCl2+
-llnl_gamma 4.1
log_k 13.500
delta_h -44.780 #kJ/mol #Internal calculation
-analytic 1.750453E+3 2.816997E-1 -9.1629414E+4 -6.3647215E+2 5.4486013E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
1.000Tl+ + 2.000Cl- = TlCl2-
-llnl_gamma 3.6
log_k 0.003
delta_h -17.850 #kJ/mol #82wag/eva
-analytic 1.3893312E+3 2.1764915E-1 -7.5784562E+4 -5.0568142E+2 4.5547295E+6
#References = LogK/DGf: 09xio; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value;
1.000Tl+3 + 3.000Cl- = TlCl3
-llnl_gamma 3.4
log_k 16.500
delta_h -47.473 #kJ/mol #Internal calculation
-analytic 2.3934561E+3 3.8436306E-1 -1.2660392E+5 -8.695951E+2 7.5411857E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
1.000Tl+3 + 4.000Cl- = TlCl4-
-llnl_gamma 3.6
log_k 18.340
delta_h -42.353 #kJ/mol #Internal calculation
-analytic 3.0366682E+3 4.8702642E-1 -1.6198657E+5 -1.102718E+3 9.6337701E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
1.000Tl+ + 1.000HCO3- = TlCO3- + 1.000H+
-llnl_gamma 3.6
log_k -8.170
delta_h 11.100 #kJ/mol #17abla
-analytic 7.4259247E+2 1.0785127E-1 -4.1546607E+4 -2.7059371E+2 2.3108902E+6
#References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value;
1.000F- + 1.000Tl+ = TlF
-llnl_gamma 3.4
log_k 0.100
delta_h 7.510 #kJ/mol #Internal calculation
-analytic 7.2685203E+2 1.1460803E-1 -3.9447315E+4 -2.6421614E+2 2.2374603E+6
#References = LogK/DGf: 09xio; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000Tl+ + 1.000HCO3- = TlHCO3
-llnl_gamma 3.4
log_k 0.900
delta_h 8.480 #kJ/mol #17abla
-analytic 6.9710431E+2 1.0785127E-1 -3.9001479E+4 -2.5199482E+2 2.3108902E+6
#References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value;
1.000HS- + 1.000Tl+ = TlHS
-llnl_gamma 3.4
log_k 2.710
delta_h 8.473 #kJ/mol #17abla
-analytic 7.5537387E+2 1.1564699E-1 -4.2183587E+4 -2.7228448E+2 2.497071E+6
#References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value;
1.000Tl+3 + 2.000H2O = TlO2- + 4.000H+
-llnl_gamma 3.6
log_k -14.999
delta_h 155.556 #kJ/mol #Internal calculation
-analytic -2.5181581E+2 -4.4884683E-2 1.4153163E+4 9.1700236E+1 -2.1492104E+6
#References = LogK/DGf: 81tur/whi; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Tl+3 + 1.000H2O = TlOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -0.643
delta_h 10.635 #kJ/mol #Internal calculation
-analytic 9.8777617E+1 1.4275663E-2 -4.2930168E+3 -3.6285945E+1 4.5243559E+4
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Tl+ + 1.000H2O = TlOH + 1.000H+
-llnl_gamma 3.4
log_k -13.310
delta_h 58.236 #kJ/mol #Internal calculation
-analytic -1.0817025E+1 -5.1018864E-3 -1.0444619E+3 2.47141E+0 -3.185702E+5
#References = LogK/DGf: 09xio; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Tl+ + 1.000H2PO4- = TlPO4-2 + 2.000H+
-llnl_gamma 4.7
log_k -16.020
delta_h 3.600 #kJ/mol #17abla
-analytic 7.9859702E+2 1.093656E-1 -4.4043205E+4 -2.9325723E+2 2.3239556E+6
#References = LogK/DGf: 09xio; DHf/DHr: 17abla; S°: Internal calculation; V°: Default value;
1.000Tl+ + 1.000SO4-2 = TlSO4-
-llnl_gamma 3.6
log_k 1.380
delta_h -0.840 #kJ/mol #82wag/eva
-analytic 1.5130977E+3 2.3053693E-1 -8.4059499E+4 -5.4758948E+2 5.0188448E+6
#References = LogK/DGf: 09xio; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value;
1.000Cl- + 1.000Tm+3 = TmCl+2
-llnl_gamma 5.7
log_k 0.248
delta_h 13.021 #kJ/mol #95haa/sho
-analytic 8.2725632E+2 1.3522175E-1 -4.6781855E+4 -3.0014594E+2 2.8689264E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Tm+3 = TmCl2+
-llnl_gamma 4.1
log_k -0.018
delta_h 15.499 #kJ/mol #95haa/sho
-analytic 1.5966813E+3 2.6008996E-1 -8.84748E+4 -5.8078391E+2 5.2992244E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Tm+3 = TmCl3
-llnl_gamma 3.4
log_k -0.429
delta_h 5.216 #kJ/mol #95haa/sho
-analytic 2.3311354E+3 3.7940257E-1 -1.2591841E+5 -8.5061726E+2 7.3288759E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Tm+3 = TmCl4-
-llnl_gamma 3.6
log_k -0.841
delta_h -20.411 #kJ/mol #95haa/sho
-analytic 2.1934665E+3 3.5555517E-1 -1.1596197E+5 -8.0269123E+2 6.6517968E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Tm+3 = TmCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -2.096
delta_h -9.266 #kJ/mol #95haa/sho
-analytic 7.3741418E+2 1.1985883E-1 -3.6824595E+4 -2.7200984E+2 1.8965307E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Tm+3 = TmF+2
-llnl_gamma 5.7
log_k 4.848
delta_h 23.594 #kJ/mol #95haa/sho
-analytic 9.2055759E+2 1.4875293E-1 -5.1992818E+4 -3.3175993E+2 3.1328809E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Tm+3 = TmF2+
-llnl_gamma 4.1
log_k 8.451
delta_h 12.511 #kJ/mol #95haa/sho
-analytic 1.762581E+3 2.8321851E-1 -9.7201588E+4 -6.3778056E+2 5.830526E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Tm+3 = TmF3
-llnl_gamma 3.4
log_k 11.100
delta_h -12.843 #kJ/mol #95haa/sho
-analytic 2.5811298E+3 4.145936E-1 -1.3873053E+5 -9.3767144E+2 8.1666603E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Tm+3 = TmF4-
-llnl_gamma 3.6
log_k 13.309
delta_h -60.635 #kJ/mol #95haa/sho
-analytic 2.5968348E+3 4.1089632E-1 -1.3698788E+5 -9.4470499E+2 8.0925281E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000H2PO4- + 1.000Tm+3 = TmH2PO4+2
-llnl_gamma 5.7
log_k 1.037
delta_h -9.794 #kJ/mol #95haa/sho
-analytic 8.6117111E+2 1.3741492E-1 -4.9286862E+4 -3.1200594E+2 3.2217149E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Tm+3 = TmHCO3+2
-llnl_gamma 5.7
log_k 1.789
delta_h 4.984 #kJ/mol #95haa/sho
-analytic 8.6648825E+2 1.387482E-1 -4.9876381E+4 -3.1307529E+2 3.1915913E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000NO3- + 1.000Tm+3 = TmNO3+2
-llnl_gamma 5.7
log_k 0.215
delta_h -34.060 #kJ/mol #95haa/sho
-analytic 7.9323793E+2 1.2571561E-1 -4.4605263E+4 -2.888348E+2 3.0049896E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tm+3 + 1.000H2O = TmO+ + 2.000H+
-llnl_gamma 4.1
log_k -15.890
delta_h 142.945 #kJ/mol #95haa/sho
-analytic 2.0545696E+2 3.3376845E-2 -1.4711688E+4 -7.3957503E+1 9.3189542E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tm+3 + 2.000H2O = TmO2- + 4.000H+
-llnl_gamma 3.6
log_k -32.659
delta_h 247.001 #kJ/mol #95haa/sho
-analytic -2.0085342E+2 -3.5879637E-2 2.6085707E+3 7.4866442E+1 -1.3431204E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tm+3 + 2.000H2O = TmO2H + 3.000H+
-llnl_gamma 3.4
log_k -24.156
delta_h 211.940 #kJ/mol #95haa/sho
-analytic 2.45708E+2 3.6308603E-2 -1.73663E+4 -8.8563737E+1 -2.9312229E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Tm+3 + 1.000H2O = TmOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.680
delta_h 77.123 #kJ/mol #95haa/sho
-analytic 1.5542484E+2 2.3881134E-2 -1.1537644E+4 -5.4868008E+1 3.7688406E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000SO4-2 + 1.000Tm+3 = TmSO4+
-llnl_gamma 4.1
log_k 3.649
delta_h 19.684 #kJ/mol #95haa/sho
-analytic 1.6450215E+3 2.6061676E-1 -8.9241948E+4 -5.9684934E+2 5.0765906E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000U+4 + 1.000H2O = U(OH)+3 + 1.000H+
-llnl_gamma 8.2
log_k -0.533
delta_h 46.808 #kJ/mol #97bsho/sas
-analytic 1.4994368E+2 2.387185E-2 -9.5100277E+3 -5.2425834E+1 3.57955E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000U+3 + 1.000H2O = UO+ + 2.000H+
-llnl_gamma 4.1
log_k -12.701
delta_h 130.982 #kJ/mol #97bsho/sas
-analytic 2.0886554E+2 3.383063E-2 -1.3271703E+4 -7.5398437E+1 -5.0777344E+4
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000U+4 + 1.000H2O = UO+2 + 2.000H+
-llnl_gamma 5.7
log_k -1.999
delta_h 73.139 #kJ/mol #97bsho/sas
-analytic 2.0859076E+2 3.4819859E-2 -1.1122129E+4 -7.4710262E+1 1.0648873E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000U+4 + 2.000H2O = UO2 + 4.000H+
-llnl_gamma 3.4
log_k -4.548
delta_h 76.066 #kJ/mol #97bsho/sas
-analytic 5.4725996E+2 9.0640876E-2 -3.0028487E+4 -1.9888477E+2 1.245457E+6
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000UO2+2 + 1.000H2O = UO2OH+ + 1.000H+
-llnl_gamma 4.1
log_k -5.210
delta_h 43.313 #kJ/mol #97bsho/sas
-analytic 1.0031917E+2 1.6446281E-2 -5.9122732E+3 -3.6843066E+1 5.0064359E+4
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000UO2+ + 1.000H2O = UO2OH + 1.000H+
-llnl_gamma 3.4
log_k -18.155
delta_h 72.918 #kJ/mol #97bsho/sas
-analytic 2.4094706E+2 3.7064053E-2 -1.8701958E+4 -8.839972E+1 1.0057097E+6
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000UO2+2 + 1.000H2O = UO3 + 2.000H+
-llnl_gamma 3.4
log_k -10.304
delta_h 51.185 #kJ/mol #97bsho/sas
-analytic 2.0564115E+2 3.5316098E-2 -1.1430037E+4 -7.7304802E+1 2.7978288E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000UO2+ + 1.000H2O = UO3- + 2.000H+
-llnl_gamma 3.6
log_k -36.480
delta_h 170.532 #kJ/mol #97bsho/sas
-analytic -3.5272956E+2 -6.1588589E-2 7.3245496E+3 1.2870494E+2 -7.4903473E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000UO2+2 + 2.000H2O = UO4-2 + 4.000H+
-llnl_gamma 4.7
log_k -33.011
delta_h 142.227 #kJ/mol #97bsho/sas
-analytic -1.0830094E+3 -1.7714535E-1 5.2803562E+4 3.9125126E+2 -3.7704336E+6
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000U+3 + 1.000H2O = UOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -6.177
delta_h 73.411 #kJ/mol #97bsho/sas
-analytic 1.4477018E+2 2.2167814E-2 -9.8257942E+3 -5.1251545E+1 1.9713067E+5
#References = LogK/DGf: 97bsho/sas; DHf/DHr: Internal calculation; S°: 97bsho/sas; Cp: 97bsho/sas; V°: 97bsho/sas;
1.000V+3 + 1.000H2O = VO+ + 2.000H+
-llnl_gamma 4.1
log_k -6.214
delta_h 89.338 #kJ/mol #97asho/sas
-analytic 1.8770925E+2 3.0762416E-2 -9.191893E+3 -6.8514039E+1 -2.4283861E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000VO2+ + 2.000H2O = VO4-3 + 4.000H+
-llnl_gamma 6.7
log_k -28.408
delta_h 89.131 #kJ/mol #97asho/sas
-analytic -1.3114652E+3 -2.2432087E-1 5.8918005E+4 4.8012618E+2 -3.1747366E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000V+2 + 1.000H2O = VOH+ + 1.000H+
-llnl_gamma 4.1
log_k -6.507
delta_h 34.502 #kJ/mol #97asho/sas
-analytic 2.0303204E+2 3.1037934E-2 -1.3814423E+4 -7.3280231E+1 7.882834E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000V+3 + 1.000H2O = VOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -2.256
delta_h 47.409 #kJ/mol #97asho/sas
-analytic 1.2096157E+2 1.845495E-2 -6.4511051E+3 -4.3279191E+1 7.9506606E+2
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000VO+2 + 1.000H2O = VOOH+ + 1.000H+
-llnl_gamma 4.1
log_k -5.628
delta_h 29.107 #kJ/mol #97asho/sas
-analytic 1.2330351E+2 1.8146401E-2 -7.1321182E+3 -4.5523874E+1 1.9784396E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Cl- + 1.000Yb+3 = YbCl+2
-llnl_gamma 5.7
log_k 0.333
delta_h 13.785 #kJ/mol #95haa/sho
-analytic 8.2488423E+2 1.3489634E-1 -4.6522628E+4 -2.9931533E+2 2.835956E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000Cl- + 1.000Yb+3 = YbCl2+
-llnl_gamma 4.1
log_k -0.079
delta_h 17.474 #kJ/mol #95haa/sho
-analytic 1.5878435E+3 2.5863557E-1 -8.7707501E+4 -5.776944E+2 5.2095498E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000Cl- + 1.000Yb+3 = YbCl3
-llnl_gamma 3.4
log_k -0.565
delta_h 8.358 #kJ/mol #95haa/sho
-analytic 2.3001243E+3 3.7624264E-1 -1.238496E+5 -8.3980541E+2 7.1622904E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000Cl- + 1.000Yb+3 = YbCl4-
-llnl_gamma 3.6
log_k -0.976
delta_h -16.270 #kJ/mol #95haa/sho
-analytic 2.1638442E+3 3.5055953E-1 -1.1343596E+5 -7.9234149E+2 6.3757397E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Yb+3 = YbCO3+ + 1.000H+
-llnl_gamma 4.1
log_k -1.865
delta_h -9.464 #kJ/mol #95haa/sho
-analytic 7.4106225E+2 1.2046266E-1 -3.7100486E+4 -2.7321439E+2 1.9240136E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000F- + 1.000Yb+3 = YbF+2
-llnl_gamma 5.7
log_k 5.006
delta_h 23.066 #kJ/mol #95haa/sho
-analytic 9.1795409E+2 1.4835747E-1 -5.1674345E+4 -3.308834E+2 3.1010883E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
2.000F- + 1.000Yb+3 = YbF2+
-llnl_gamma 4.1
log_k 8.609
delta_h 11.983 #kJ/mol #95haa/sho
-analytic 1.7534876E+3 2.8169934E-1 -9.6314159E+4 -6.3465987E+2 5.7421677E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
3.000F- + 1.000Yb+3 = YbF3
-llnl_gamma 3.4
log_k 11.331
delta_h -13.539 #kJ/mol #95haa/sho
-analytic 2.5629877E+3 4.114338E-1 -1.3704775E+5 -9.3138904E+2 8.000081E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
4.000F- + 1.000Yb+3 = YbF4-
-llnl_gamma 3.6
log_k 13.541
delta_h -60.458 #kJ/mol #95haa/sho
-analytic 2.5622312E+3 4.0508844E-1 -1.3402564E+5 -9.3263429E+2 7.8047796E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000H2PO4- + 1.000Yb+3 = YbH2PO4+2
-llnl_gamma 5.7
log_k 1.268
delta_h -9.505 #kJ/mol #95haa/sho
-analytic 8.5853809E+2 1.370498E-1 -4.8983311E+4 -3.1106042E+2 3.1875313E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000HCO3- + 1.000Yb+3 = YbHCO3+2
-llnl_gamma 5.7
log_k 2.014
delta_h 5.195 #kJ/mol #95haa/sho
-analytic 8.6528139E+2 1.3862051E-1 -4.9643048E+4 -3.1266004E+2 3.1613912E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000NO3- + 1.000Yb+3 = YbNO3+2
-llnl_gamma 5.7
log_k 0.373
delta_h -32.716 #kJ/mol #95haa/sho
-analytic 7.8981467E+2 1.2529386E-1 -4.4290871E+4 -2.87586E+2 2.9660968E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Yb+3 + 1.000H2O = YbO+ + 2.000H+
-llnl_gamma 4.1
log_k -15.585
delta_h 142.704 #kJ/mol #95haa/sho
-analytic 2.0861033E+2 3.3977007E-2 -1.483219E+4 -7.5048398E+1 9.9930406E+4
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Yb+3 + 2.000H2O = YbO2- + 4.000H+
-llnl_gamma 3.6
log_k -32.501
delta_h 247.846 #kJ/mol #95haa/sho
-analytic -2.0532378E+2 -3.6413396E-2 2.9680257E+3 7.6478357E+1 -1.3792715E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Yb+3 + 2.000H2O = YbO2H + 3.000H+
-llnl_gamma 3.4
log_k -23.705
delta_h 210.986 #kJ/mol #95haa/sho
-analytic 2.4276523E+2 3.5582437E-2 -1.7020496E+4 -8.7428351E+1 -3.2501542E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Yb+3 + 1.000H2O = YbOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.449
delta_h 77.175 #kJ/mol #95haa/sho
-analytic 1.5766009E+2 2.4335116E-2 -1.1632886E+4 -5.5626954E+1 3.8205078E+5
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000SO4-2 + 1.000Yb+3 = YbSO4+
-llnl_gamma 4.1
log_k 3.807
delta_h 19.531 #kJ/mol #95haa/sho
-analytic 1.6441652E+3 2.605671E-1 -8.9159178E+4 -5.9652084E+2 5.0711413E+6
#References = LogK/DGf: 95haa/sho; DHf/DHr: Internal calculation; S°: 95haa/sho; Cp: 95haa/sho; V°: 95haa/sho;
1.000Y+3 + 1.000H2O = YO+ + 2.000H+
-llnl_gamma 4.1
log_k -16.403
delta_h 144.876 #kJ/mol #97asho/sas
-analytic 1.7383177E+2 2.839874E-2 -1.2141049E+4 -6.3107802E+1 -1.6216002E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Y+3 + 2.000H2O = YO2- + 4.000H+
-llnl_gamma 3.6
log_k -36.471
delta_h 267.261 #kJ/mol #97asho/sas
-analytic -2.2299951E+2 -3.9318553E-2 3.5552163E+3 8.2320621E+1 -1.5440345E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Y+3 + 1.000H2O = YOH+2 + 1.000H+
-llnl_gamma 5.7
log_k -7.680
delta_h 76.375 #kJ/mol #97asho/sas
-analytic 1.2386246E+2 1.8873335E-2 -8.8238344E+3 -4.4022432E+1 1.2057058E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2AsO4- + 1.000Zn+2 = ZnAsO4- + 2.000H+
-llnl_gamma 3.6
log_k -11.060
delta_h 84.463 #kJ/mol #Internal calculation
-analytic 2.6280073E+2 3.475728E-2 -1.4939568E+4 -9.5458814E+1 1.8580958E+5
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000Cl- + 1.000Zn+2 = ZnCl+
-llnl_gamma 4.1
log_k 0.211
delta_h 43.294 #kJ/mol #97sve/sho
-analytic 9.1361445E+2 1.4753515E-1 -5.2117963E+4 -3.2997759E+2 3.0154093E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
2.000Cl- + 1.000Zn+2 = ZnCl2
-llnl_gamma 3.4
log_k 0.276
delta_h 31.078 #kJ/mol #97sve/sho
-analytic 1.6355779E+3 2.6390977E-1 -9.1712261E+4 -5.9323753E+2 5.4709533E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
3.000Cl- + 1.000Zn+2 = ZnCl3-
-llnl_gamma 3.6
log_k 0.018
delta_h 13.142 #kJ/mol #97sve/sho
-analytic 1.6985673E+3 2.7606491E-1 -9.5952687E+4 -6.1670256E+2 5.9522014E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000F- + 1.000Zn+2 = ZnF+
-llnl_gamma 4.1
log_k 1.190
delta_h 2.798 #kJ/mol #97sve/sho
-analytic 8.9752817E+2 1.4255028E-1 -5.0262611E+4 -3.2528594E+2 3.0793424E+6
#References = LogK/DGf: 97sve/sho; DHf/DHr: Internal calculation; S°: 97sve/sho; Cp: 97sve/sho; V°: 97sve/sho;
1.000H2AsO4- + 1.000Zn+2 = ZnH2AsO4+
-llnl_gamma 4.1
log_k 0.526
delta_h -5.620 #kJ/mol #Internal calculation
-analytic 8.396717E+2 1.3021386E-1 -4.7011903E+4 -3.0428997E+2 2.9028133E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2PO4- + 1.000Zn+2 = ZnH2PO4+
-llnl_gamma 4.1
log_k 1.593
#References = LogK/DGf: 73bnri;
#References = LogK/DGf: 73bnri; V°: Default value;
1.000H2AsO4- + 1.000Zn+2 = ZnHAsO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.946
delta_h 7.927 #kJ/mol #Internal calculation
-analytic -4.3975368E+2 -5.7657456E-2 -2.1643265E+4 1.8509704E+2 6.0073968E+6
#References = LogK/DGf: 07mar/acc; DHf/DHr: Internal calculation; S°: 07mar/acc; Cp: 07mar/acc; V°: 07mar/acc;
1.000H2PO4- + 1.000Zn+2 = ZnHPO4 + 1.000H+
-llnl_gamma 3.4
log_k -3.912
#References = LogK/DGf: 73bnri;
#References = LogK/DGf: 73bnri; V°: Default value;
1.000Zn+2 + 1.000H2O = ZnO + 2.000H+
-llnl_gamma 3.4
log_k -17.927
delta_h 111.664 #kJ/mol #97asho/sas
-analytic 2.7777296E+2 4.3494159E-2 -1.9035993E+4 -1.0159021E+2 5.8289371E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Zn+2 + 2.000H2O = ZnO2-2 + 4.000H+
-llnl_gamma 4.7
log_k -40.509
delta_h 172.305 #kJ/mol #97asho/sas
-analytic -9.7295827E+2 -1.6187649E-1 4.2449993E+4 3.5246165E+2 -3.0054003E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000Zn+2 + 1.000H2O = ZnOH+ + 1.000H+
-llnl_gamma 4.1
log_k -7.834
delta_h 75.257 #kJ/mol #97asho/sas
-analytic 2.3584815E+2 3.4874931E-2 -1.6156931E+4 -8.3813428E+1 6.6682543E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000H2PO4- + 1.000Zn+2 = ZnPO4- + 2.000H+
-llnl_gamma 3.6
log_k -11.514
#References = LogK/DGf: 79mat/spo;
#References = LogK/DGf: 79mat/spo; V°: Default value;
1.000ZrO+2 + 2.000H+ = Zr+4 + 1.000H2O
-llnl_gamma 11.0
log_k 1.721
delta_h -59.949 #kJ/mol #97asho/sas
-analytic -2.4476261E+2 -4.0474856E-2 1.3976089E+4 8.7639781E+1 -4.6082932E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000ZrO+2 + 1.000H2O = ZrO2 + 2.000H+
-llnl_gamma 3.4
log_k -7.973
delta_h 36.757 #kJ/mol #97asho/sas
-analytic 3.9674511E+2 6.5971072E-2 -2.4251064E+4 -1.4502298E+2 1.4045832E+6
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
1.000ZrO+2 + 1.000H+ = ZrOH+3
-llnl_gamma 5.0
log_k 2.052
delta_h -34.419 #kJ/mol #97asho/sas
-analytic -4.2410573E+1 -8.4292559E-3 8.5854081E+2 1.6257399E+1 3.4390503E+5
#References = LogK/DGf: 97asho/sas; DHf/DHr: Internal calculation; S°: 97asho/sas; Cp: 97asho/sas; V°: 97asho/sas;
PHASES
Fix_H+ # A tips to keep constant the pH during calculation by adding or removing acid or base / Necessary when you know the final pH of the sample
H+ = H+
log_k 0.0
2K2SO4.Fe2(SO4)3:14H2O
K4Fe2(SO4)5:14H2O = 2.000Fe+3 + 4.000K+ + 5.000SO4-2 + 14.000H2O
log_k -13.051
#References = LogK/DGf: 04chr;
#References = LogK/DGf: 04chr; V°: Default value;
2KCl.FeCl3:H2O
K2FeCl5:H2O = 5.000Cl- + 1.000Fe+3 + 2.000K+ + 1.000H2O
log_k 5.630
#References = LogK/DGf: 04chr;
#References = LogK/DGf: 04chr; V°: Default value;
Acanthite(alpha)
Ag2S + 1.000H+ = 2.000Ag+ + 1.000HS-
log_k -36.070
delta_h -641.936 #kJ/mol #78hel/del
-analytic -8.8668683E+2 -1.3249431E-1 3.795628E+4 3.2177022E+2 -2.9677377E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Adamite
Zn2AsO4(OH) + 3.000H+ = 1.000H2AsO4- + 2.000Zn+2 + 1.000H2O
log_k 5.710
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Aegerine(alpha)
NaFe(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Fe+3 + 1.000Na+ + 2.000H4SiO4
log_k 0.912
delta_h 43.313 #kJ/mol #95rob/hem
-analytic -7.406299E+2 -1.212207E-1 3.8435485E+4 2.6988839E+2 -1.6934447E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del;
Afwillite
Ca3Si2O4(OH)6 + 6.000H+ = 3.000Ca+2 + 2.000H4SiO4 + 2.000H2O
log_k 49.419
delta_h -269.228 #kJ/mol #10abla/bou
-analytic -8.9495681E+2 -1.4090315E-1 5.8099033E+4 3.2930349E+2 -2.072877E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 52meg;
Ag(element)
Ag + 0.500O2 + 2.000H+ = 1.000Ag+2 + 1.000H2O
log_k -4.138
delta_h -34.108 #kJ/mol #Internal calculation
-analytic -3.8808912E+2 -5.9880852E-2 2.1889053E+4 1.3861309E+2 -1.2978849E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Ag2O
Ag2O + 2.000H+ = 2.000Ag+ + 1.000H2O
log_k 12.569
delta_h -43.307 #kJ/mol #Internal calculation
-analytic -2.6503701E+2 -3.0442903E-2 1.7771454E+4 9.5717874E+1 -8.685479E+5
#References = LogK/DGf: 74nau/ryz; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 74nau/ryz;
Akermanite
Ca2MgSi2O7 + 6.000H+ + 1.000H2O = 2.000Ca+2 + 1.000Mg+2 + 2.000H4SiO4
log_k 46.084
delta_h -312.880 #kJ/mol #Internal calculation
-analytic -9.9888741E+2 -1.6370527E-1 6.532027E+4 3.6454937E+2 -2.4319821E+6
#References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Al(element)
Al + 0.750O2 + 3.000H+ = 1.000Al+3 + 1.500H2O
log_k 149.922
delta_h -958.045 #kJ/mol #By convention
-analytic -5.9569614E+2 -9.7790495E-2 8.196932E+4 2.1101875E+2 -1.9826646E+6
#References = S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem;
Alabandite
MnS + 1.000H+ = 1.000Mn+2 + 1.000HS-
log_k -0.003
delta_h -892.939 #kJ/mol #Internal calculation
-analytic -9.5453269E+2 -1.5284532E-1 5.2895279E+4 3.4627472E+2 -3.035299E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Alamosite
PbSiO3 + 2.000H+ + 1.000H2O = 1.000Pb+2 + 1.000H4SiO4
log_k 6.173
delta_h -29.451 #kJ/mol #98cha
-analytic -3.4667488E+2 -5.7187538E-2 1.8994912E+4 1.2780121E+2 -8.9311262E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan;
Albite(low)
NaAlSi3O8 + 4.000H+ + 4.000H2O = 1.000Al+3 + 1.000Na+ + 3.000H4SiO4
log_k 2.996
delta_h -84.003 #kJ/mol #95rob/hem
-analytic -7.9517148E+2 -1.3560657E-1 4.136093E+4 2.9057117E+2 -1.7001681E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
AlF3
AlF3 = 1.000Al+3 + 3.000F-
log_k -17.324
delta_h -34.050 #kJ/mol #89cox/wag
-analytic -2.536379E+3 -4.1169235E-1 1.3845573E+5 9.1690139E+2 -8.1243733E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Almandine(alpha)
Fe3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Fe+2 + 3.000H4SiO4
log_k 42.164
delta_h -465.683 #kJ/mol #95rob/hem
-analytic -2.0747602E+3 -3.4400542E-1 1.2649788E+5 7.4967969E+2 -5.3176103E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Alunite(K)
KAl3(OH)6(SO4)2 + 6.000H+ = 3.000Al+3 + 1.000K+ + 2.000SO4-2 + 6.000H2O
log_k -0.531
delta_h -230.738 #kJ/mol #Internal calculation
-analytic -3.9372227E+3 -6.4645916E-1 2.2226074E+5 1.4239813E+3 -1.2407909E+7
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Alunite(Na)
NaAl3(SO4)2(OH)6 + 6.000H+ = 3.000Al+3 + 1.000Na+ + 2.000SO4-2 + 6.000H2O
log_k 2.332
delta_h -257.759 #kJ/mol #Internal calculation
-analytic -4.202779E+3 -6.862295E-1 2.3740304E+5 1.5199984E+3 -1.3127781E+7
#References = LogK/DGf: 90sto/cyg; DHf/DHr: Internal calculation; S°: 90sto/cyg; Cp: 90sto/cyg; V°: Default value;
Amesite
Mg4Al2(Al2Si2)O10(OH)8 + 20.000H+ = 4.000Al+3 + 4.000Mg+2 + 2.000H4SiO4 + 10.000H2O
log_k 69.386
delta_h -766.388 #kJ/mol #05vid/par
-analytic -3.2797388E+3 -5.2672257E-1 2.0325343E+5 1.1802283E+3 -8.5289928E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par;
Amesite(Fe)
Fe4Al2(Al2Si2)O10(OH)8 + 20.000H+ = 4.000Al+3 + 4.000Fe+2 + 2.000H4SiO4 + 10.000H2O
log_k 57.018
delta_h -686.828 #kJ/mol #05vid/par
-analytic -3.1787916E+3 -5.1645017E-1 1.9379716E+5 1.1448985E+3 -8.2836278E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par;
Amorphous_silica
SiO2 + 2.000H2O = 1.000H4SiO4
log_k -2.700
delta_h 13.616 #kJ/mol #00gun/arn
-analytic -7.5442279E+1 -1.3954755E-2 2.382603E+3 2.8303328E+1 -9.9813899E+4
#References = LogK/DGf: Internal calculation; DHf/DHr: 00gun/arn; S°: 00gun/arn; Cp: 00gun/arn; V°: 78hel/del;
Analcime
Na0.99Al0.99Si2.01O6:H2O + 3.960H+ + 1.040H2O = 0.990Al+3 + 0.990Na+ + 2.010H4SiO4
log_k 6.644
delta_h -102.690 #kJ/mol #04neu/hov
-analytic -7.3535625E+2 -1.2074917E-1 4.0614895E+4 2.6709108E+2 -1.6996879E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04neu/hov; S°: 82joh/flo, 04neu/hov; Cp: 82joh/flo; V°: 97coo/alb;
Andalusite
Al2SiO5 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 1.000H2O
log_k 16.200
delta_h -246.943 #kJ/mol #Internal calculation
-analytic -9.4491085E+2 -1.6161079E-1 5.8544159E+4 3.3942223E+2 -2.3949134E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Andradite
Ca3Fe2Si3O12 + 12.000H+ = 3.000Ca+2 + 2.000Fe+3 + 3.000H4SiO4
log_k 33.771
delta_h -137.101 #kJ/mol #Internal calculation
-analytic -1.7750635E+3 -3.0215418E-1 1.0225104E+5 6.4762814E+2 -4.1374034E+6
#References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Anglesite
PbSO4 = 1.000Pb+2 + 1.000SO4-2
log_k -7.848
delta_h 11.550 #kJ/mol #89cox/wag
-analytic -1.6531981E+3 -2.6395827E-1 9.1052323E+4 5.9877998E+2 -5.5988089E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 78hel/del; V°: 95rob/hem;
Anhydrite
CaSO4 = 1.000Ca+2 + 1.000SO4-2
log_k -4.436
delta_h -17.940 #kJ/mol #95rob/hem
-analytic -1.6180783E+3 -2.6204431E-1 8.9585348E+4 5.8663288E+2 -5.3589324E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Annite
KFe3(AlSi3)O10(OH)2 + 10.000H+ = 1.000Al+3 + 3.000Fe+2 + 1.000K+ + 3.000H4SiO4
log_k 32.755
delta_h -313.153 #kJ/mol #92cir/nav
-analytic -1.6418531E+3 -2.7064069E-1 9.6776711E+4 5.9663958E+2 -4.0567843E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 92cir/nav; S°: 95dac/ben; Cp: 95dac/ben; V°: 78hel/del;
Anorthite
Ca(Al2Si2)O8 + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 2.000H4SiO4
log_k 24.224
delta_h -308.188 #kJ/mol #95rob/hem
-analytic -1.2541786E+3 -2.1480513E-1 7.6226681E+4 4.5313217E+2 -3.0636629E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Antarcticite
CaCl2:6H2O = 1.000Ca+2 + 2.000Cl- + 6.000H2O
log_k 3.939
delta_h 13.990 #kJ/mol #87gar/par
-analytic -1.5031522E+3 -2.192157E-1 8.01557E+4 5.4683953E+2 -4.4012858E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 63wyc;
Anthophyllite
Mg7Si8O22(OH)2 + 14.000H+ + 8.000H2O = 7.000Mg+2 + 8.000H4SiO4
log_k 73.751
delta_h -601.914 #kJ/mol #95rob/hem
-analytic -2.8758921E+3 -4.6730293E-1 1.6983684E+5 1.0481122E+3 -6.5916202E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Antigorite
Mg48Si34O85(OH)62 + 96.000H+ = 48.000Mg+2 + 34.000H4SiO4 + 11.000H2O
log_k 499.883
delta_h -3822.754 #kJ/mol #98hol/pow
-analytic -1.7937737E+4 -2.8167781E+0 1.0790974E+6 6.5213513E+3 -4.2537913E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow;
Aplowite
CoSO4:H2O = 1.000Co+2 + 1.000SO4-2 + 1.000H2O
log_k -1.050
delta_h -52.050 #kJ/mol #74nau/ryz
-analytic -1.6977806E+3 -2.6156887E-1 9.5472539E+4 6.1264708E+2 -5.4629265E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: 94pan;
Aragonite
CaCO3 + 1.000H+ = 1.000HCO3- + 1.000Ca+2
log_k 2.014
delta_h -25.150 #kJ/mol #87gar/par
-analytic -8.5903123E+2 -1.3909109E-1 4.7686355E+4 3.1246945E+2 -2.7210775E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; Cp: 87gar/par; V°: 78hel/del,82plu/bus;
Arcanite
K2(SO4) = 2.000K+ + 1.000SO4-2
log_k -1.849
delta_h 24.080 #kJ/mol #98cha
-analytic -1.4896046E+3 -2.3691432E-1 8.216249E+4 5.4168296E+2 -5.1151218E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem;
Argutite(alpha)
GeO2 + 2.000H2O = 1.000Ge(OH)4
log_k -5.021
delta_h 34.742 #kJ/mol #98pok/sch
-analytic -1.9377128E+2 -2.6476754E-2 9.1208986E+3 6.9974681E+1 -6.3070701E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98pok/sch; S°: 98pok/sch; Cp: 98pok/sch; V°: 98pok/sch;
Argutite(beta)
GeO2 + 2.000H2O = 1.000Ge(OH)4
log_k -1.972
#delta_h 0.000 #kJ/mol
-analytic -1.9190781E+2 -2.5696884E-2 1.0260385E+4 6.8827626E+1 -6.3342241E+5
#References = LogK/DGf: Internal calculation; Cp: 98pok/sch; V°: Default value;
Arsenocrandallite
CaAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Ca+2 + 6.000H2O
log_k 10.139
#References = LogK/DGf: 93sch/got;
#References = LogK/DGf: 93sch/got; V°: Default value;
Arsenoflorencite(Ce)
CeAl3(AsO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Ce+3 + 6.000H2O
log_k 9.343
#References = LogK/DGf: 93sch/got;
#References = LogK/DGf: 93sch/got; V°: Default value;
Arsenoflorencite(La)
LaAl3(AsO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000La+3 + 6.000H2O
log_k 9.620
#References = LogK/DGf: 93sch/got;
#References = LogK/DGf: 93sch/got; V°: Default value;
Arsenogorceixite
BaAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Ba+2 + 6.000H2O
log_k 7.107
#References = LogK/DGf: 93sch/got;
#References = LogK/DGf: 93sch/got; V°: Default value;
Arsenogoyazite
SrAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Sr+2 + 6.000H2O
log_k 9.925
#References = LogK/DGf: 93sch/got;
#References = LogK/DGf: 93sch/got; V°: Default value;
Arsenolite
As2O3 + 3.000H2O = 2.000H2AsO3- + 2.000H+
log_k -19.860
delta_h -292.780 #kJ/mol #Internal calculation
-analytic -5.6102814E+2 -1.0192874E-1 2.0917516E+4 2.0807283E+2 -1.1967234E+6
#References = LogK/DGf: 96pok/gou; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou;
Arsenopyrite
FeAsS + 1.000H+ + 1.500H2O = 1.000AsH3 + 1.000Fe+2 + 1.000HS- + 0.750O2
log_k -92.127
delta_h -1296.440 #kJ/mol #Internal calculation
-analytic -6.0251263E+2 -1.0058457E-1 2.3258322E+3 2.2199275E+2 -1.4874118E+6
#References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok;
Artinite
Mg2(OH)2(CO3):3H2O + 3.000H+ = 1.000HCO3- + 2.000Mg+2 + 5.000H2O
log_k 20.136
delta_h -132.468 #kJ/mol #73hem/rob
-analytic -1.1867161E+3 -1.8267755E-1 6.9943006E+4 4.3083069E+2 -3.4966396E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 73hem/rob; S°: 72hem/rob; Cp: 78hel/del; V°: 78hel/del;
As(element)
As + 1.500H2O = 1.000AsH3 + 0.750O2
log_k -81.937
delta_h -465.737 #kJ/mol #Internal calculation
-analytic 2.5055717E+2 3.970253E-2 -4.134511E+4 -8.8495171E+1 1.1837015E+6
#References = S°: 73hul/des; Cp: 73hul/des; V°: 96pok/gou;
As2O5
As2O5 + 3.000H2O = 2.000H2AsO4- + 2.000H+
log_k 2.242
delta_h -36.939 #kJ/mol #01gas/aza
-analytic -1.1057586E+3 -1.8607046E-1 6.2340868E+4 4.0250341E+2 -3.6964597E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 01gas/aza; S°: 01gas/aza; Cp: 01gas/aza; V°: 84pan/stu;
Au(element)
Au + 0.750O2 + 3.000H+ = 1.000Au+3 + 1.500H2O
log_k -11.448
delta_h 49.202 #kJ/mol #Internal calculation
-analytic -5.9281352E+2 -9.3575653E-2 3.2164366E+4 2.1116629E+2 -1.8784565E+6
#References = S°: 95rob/hem; Cp: 78hel/del; V°: 78hel/del;
Augelite
Al2PO4(OH)3 + 5.000H+ = 2.000Al+3 + 1.000H2PO4- + 3.000H2O
log_k 10.273
#References = LogK/DGf: 79vie/tar;
#References = LogK/DGf: 79vie/tar; V°: 63wyc;
Austinite
CaZnAsO4(OH) + 3.000H+ = 1.000H2AsO4- + 1.000Ca+2 + 1.000Zn+2 + 1.000H2O
log_k 6.880
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Azurite
Cu3(OH)2(CO3)2 + 4.000H+ = 2.000HCO3- + 3.000Cu+2 + 2.000H2O
log_k 3.747
delta_h -83.679 #kJ/mol #Internal calculation
-analytic -2.1448754E+3 -3.4196657E-1 1.1800361E+5 7.7882015E+2 -6.4310505E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 78hel/del;
B(OH)3
B(OH)3 = 1.000B(OH)3
log_k -0.158
delta_h 22.474 #kJ/mol #89cox/wag
-analytic -1.628273E+2 -2.107058E-2 8.2790335E+3 5.9514336E+1 -5.4057728E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
B2O3
B2O3 + 3.000H2O = 2.000B(OH)3
log_k 5.569
delta_h -13.662 #kJ/mol #89cox/wag
-analytic -3.4280383E+2 -4.5698084E-2 2.1548261E+4 1.2316096E+2 -1.336014E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Ba3(AsO4)2
Ba3(AsO4)2 + 4.000H+ = 2.000H2AsO4- + 3.000Ba+2
log_k 15.320
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: Default value;
BaHAsO4:H2O
BaHAsO4:H2O + 1.000H+ = 1.000H2AsO4- + 1.000Ba+2 + 1.000H2O
log_k -6.040
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: Default value;
BaHPO4
BaHPO4 + 1.000H+ = 1.000Ba+2 + 1.000H2PO4-
log_k -7.410
delta_h -25.577 #kJ/mol #71par/wag
-analytic -9.1214193E+2 -1.4086019E-1 5.0076197E+4 3.274915E+2 -2.8075543E+6
#References = LogK/DGf: 66spi/mik; DHf/DHr: 71par/wag; S°: Internal calculation; V°: Default value;
Barite
BaSO4 = 1.000Ba+2 + 1.000SO4-2
log_k -10.051
delta_h 26.335 #kJ/mol #Internal calculation
-analytic -1.5795476E+3 -2.5599275E-1 8.5701092E+4 5.7308831E+2 -5.3061761E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Bassanite
CaSO4:0.5H2O = 1.000Ca+2 + 1.000SO4-2 + 0.500H2O
log_k -3.920
delta_h -17.358 #kJ/mol #Internal calculation
-analytic -1.5729035E+3 -2.5188116E-1 8.755323E+4 5.6963784E+2 -5.2540419E+6
#References = LogK/DGf: 06bla/las; DHf/DHr: Internal calculation; S°: CODATA87; Cp: 06bla/pia; V°: 93bar;
Beidellite(Ca)
Ca0.17Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.170Ca+2 + 3.660H4SiO4
log_k 5.772
delta_h -207.636 #kJ/mol #15bla/vie
-analytic -1.3355791E+3 -2.2568605E-1 7.4303954E+4 4.8279924E+2 -3.131931E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Beidellite(K)
K0.34Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.340K+ + 3.660H4SiO4
log_k 4.603
delta_h -189.103 #kJ/mol #15bla/vie
-analytic -1.3190472E+3 -2.2258811E-1 7.2702972E+4 4.7730921E+2 -3.102583E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Beidellite(Mg)
Mg0.17Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.170Mg+2 + 3.660H4SiO4
log_k 5.227
delta_h -208.816 #kJ/mol #15bla/vie
-analytic -1.3521676E+3 -2.2765027E-1 7.525898E+4 4.8845306E+2 -3.1820933E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Beidellite(Na)
Na0.34Al2.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 2.340Al+3 + 0.340Na+ + 3.660H4SiO4
log_k 5.101
delta_h -197.721 #kJ/mol #15bla/vie
-analytic -1.3386993E+3 -2.2463256E-1 7.4157253E+4 4.8394872E+2 -3.1512349E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
BeidelliteSBId
Ca0.185K0.104(Si3.574Al0.426)(Al1.812Mg0.090Fe0.112)O10(OH)2 + 7.704H+ + 2.296H2O = 2.238Al+3 + 0.185Ca+2 + 0.112Fe+3 + 0.104K+ + 0.090Mg+2 + 3.574H4SiO4
log_k 7.581
delta_h -213.413 #kJ/mol #12gai/bla
-analytic -1.3787656E+3 -2.3939016E-1 7.6094677E+4 5.0012905E+2 -3.1147421E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla;
Berlinite
AlPO4 + 2.000H+ = 1.000Al+3 + 1.000H2PO4-
log_k 1.207
delta_h -107.151 #kJ/mol #Internal calculation
-analytic -1.0573784E+3 -1.7484921E-1 6.1600955E+4 3.8046739E+2 -3.3188486E+6
#References = LogK/DGf: 82wag/eva; DHf/DHr: Internal calculation; S°: 68wag/eva; Cp: 74nau/ryz, 76wag/eva, 71par/wag; V°: 95rob/hem;
Berndtite
SnS2 + 0.750H2O = 1.500HS- + 1.000Sn+2 + 0.250S2O3-2
log_k -32.150
delta_h -1345.463 #kJ/mol #Internal calculation
-analytic -1.5831678E+3 -2.5536788E-1 7.8446309E+4 5.7537073E+2 -5.3044545E+6
#References = LogK/DGf: 85jac/hel; DHf/DHr: Internal calculation; S°: 85jac/hel; Cp: 85jac/hel; V°: 85jac/hel;
BerthierineISGS
(Si1.332Al0.668)(Al0.976Fe1.622Mg0.157)O5(OH)4 + 8.672H+ = 1.644Al+3 + 1.440Fe+2 + 0.157Mg+2 + 1.332H4SiO4 + 0.182Fe+3 + 3.672H2O
log_k 27.914
delta_h -300.389 #kJ/mol #14bla/gai
-analytic -1.4276745E+3 -2.2611664E-1 8.8218864E+4 5.1303234E+2 -3.7644318E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 14bla/gai; S°: 14bla/gai; Cp: 14bla/gai; V°: 14bla/gai;
Berthierine(FeII)
(Fe2Al)(SiAl)O5(OH)4 + 10.000H+ = 2.000Al+3 + 2.000Fe+2 + 1.000H4SiO4 + 5.000H2O
log_k 34.564
delta_h -376.684 #kJ/mol #15bla/vie
-analytic -1.6002897E+3 -2.5384816E-1 1.0057852E+5 5.7464339E+2 -4.3309794E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Berthierine(FeIII)
(Fe2.67Al0.33)(Si1.34Al0.66)O5(OH)4 + 8.640H+ = 0.990Al+3 + 2.340Fe+2 + 1.340H4SiO4 + 0.330Fe+3 + 3.640H2O
log_k 28.806
delta_h -267.547 #kJ/mol #15bla/vie
-analytic -1.4124955E+3 -2.2245289E-1 8.6891604E+4 5.085334E+2 -3.7462466E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Berthierite
FeSb2S4 + 6.000H2O = 1.000Fe+2 + 4.000HS- + 2.000Sb(OH)3 + 2.000H+
log_k -61.051
delta_h -3167.239 #kJ/mol #Internal calculation
-analytic -2.8385187E+3 -4.707434E-1 1.3512197E+5 1.0358927E+3 -8.7675587E+6
#References = LogK/DGf: 92sea/rob; DHf/DHr: Internal calculation; S°: 92sea/rob; Cp: 92sea/rob; V°: 92sea/rob;
Beudantite
PbFe3(AsO4)2(OH)5:H2O + 9.000H+ = 2.000H2AsO4- + 3.000Fe+3 + 1.000Pb+2 + 6.000H2O
log_k -9.350
#References = LogK/DGf: 04gab/vie;
#References = LogK/DGf: 04gab/vie; V°: Default value;
Bieberite
CoSO4:7H2O = 1.000Co+2 + 1.000SO4-2 + 7.000H2O
log_k -2.354
delta_h 11.840 #kJ/mol #74nau/ryz
-analytic -1.5170859E+3 -2.3266408E-1 8.2917437E+4 5.5012875E+2 -4.9125493E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan;
Bilinite
Fe3(SO4)4:22H2O = 2.000Fe+3 + 4.000SO4-2 + 1.000Fe+2 + 22.000H2O
log_k -16.373
delta_h 205.143 #kJ/mol #02hem/sea
-analytic -6.6744363E+3 -9.6599887E-1 3.6113505E+5 2.4093244E+3 -2.0169302E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 69bol/ptu;
Bischofite
MgCl2:6H2O = 2.000Cl- + 1.000Mg+2 + 6.000H2O
log_k 4.458
delta_h -8.710 #kJ/mol #74nau/ryz
-analytic -1.4873588E+3 -2.2708702E-1 8.1366041E+4 5.4098252E+2 -4.6230067E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; Cp: 74nau/ryz; V°: 63wyc;
Bloedite
Na2Mg(SO4)2:4H2O = 1.000Mg+2 + 2.000Na+ + 2.000SO4-2 + 4.000H2O
log_k -2.351
#References = LogK/DGf: 84har/mol;
#References = LogK/DGf: 84har/mol; V°: 63wyc;
Bobbierite
Mg3(PO4)2:8H2O + 4.000H+ = 3.000Mg+2 + 2.000H2PO4- + 8.000H2O
log_k 13.917
#References = LogK/DGf: 63tay/fra, 96bou;
#References = LogK/DGf: 63tay/fra, 96bou; V°: 84nri;
Boehmite
AlO(OH) + 3.000H+ = 1.000Al+3 + 2.000H2O
log_k 7.623
delta_h -113.660 #kJ/mol #95rob/hem
-analytic -4.3396543E+2 -7.2229552E-2 2.7350449E+4 1.5532539E+2 -1.1514377E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Bornite(alpha)
Cu5FeS4 + 4.000H+ = 4.000Cu+ + 1.000Cu+2 + 1.000Fe+2 + 4.000HS-
log_k -107.495
delta_h -3492.330 #kJ/mol #95rob/hem
-analytic -3.659479E+3 -5.7956821E-1 1.6798561E+5 1.3295933E+3 -1.1434908E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 78hel/del,70pan/kin; V°: 95rob/hem;
Bromellite
BeO + 2.000H+ = 1.000Be+2 + 1.000H2O
log_k 6.291
delta_h -59.205 #kJ/mol #89cox/wag
-analytic -3.2291539E+2 -5.0116258E-2 1.9507644E+4 1.1655322E+2 -8.6081375E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Brucite
Mg(OH)2 + 2.000H+ = 1.000Mg+2 + 2.000H2O
log_k 17.109
delta_h -114.518 #kJ/mol #08bla
-analytic -3.1427691E+2 -4.6777014E-2 2.206956E+4 1.1341328E+2 -8.2871799E+5
#References = LogK/DGf: 08bla; DHf/DHr: 08bla; S°: Internal calculation; Cp: 95rob/hem; V°: 95rob/hem;
Brushite
CaHPO4:2H2O + 1.000H+ = 1.000Ca+2 + 1.000H2PO4- + 2.000H2O
log_k 0.599
delta_h -7.375 #kJ/mol #Internal calculation
-analytic -8.5811366E+2 -1.4463428E-1 4.5245431E+4 3.1462289E+2 -2.5274181E+6
#References = LogK/DGf: 84nan; DHf/DHr: Internal calculation; S°: 84nan; Cp: 70gre/mor, after 64aega/wak and bega/wak; V°: 84nri;
Bunsenite
NiO + 2.000H+ = 1.000Ni+2 + 1.000H2O
log_k 12.504
delta_h -106.030 #kJ/mol #90hem
-analytic -3.2351855E+2 -5.0846585E-2 2.2284798E+4 1.1595365E+2 -9.317096E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 90hem; S°: 90hem; Cp: 95rob/hem; V°: 78hel/del;
Burkeite
Na6CO3(SO4)2 + 1.000H+ = 1.000HCO3- + 6.000Na+ + 2.000SO4-2
log_k -0.770
#References = LogK/DGf: 84har/mol;
#References = LogK/DGf: 84har/mol; V°: 63wyc;
C(element)
C + 1.000O2 + 1.000H2O = 1.000HCO3- + 1.000H+
log_k 64.165
delta_h -391.966 #kJ/mol #By convention
-analytic -7.6325021E+2 -1.2547556E-1 6.408155E+4 2.7556713E+2 -2.8426018E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
C2AH8
Ca2Al2O5:8H2O + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 13.000H2O
log_k 59.706
delta_h -436.130 #kJ/mol #06bla/las
-analytic -1.3381438E+3 -1.8057991E-1 8.8514659E+4 4.800024E+2 -2.9267857E+6
#References = LogK/DGf: 06bla/las; DHf/DHr: 06bla/las; S°: Internal calculation; V°: 92wol;
C2SHa
Ca2(HSiO4)(OH) + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4 + 1.000H2O
log_k 35.538
delta_h -198.104 #kJ/mol #10abla/bou
-analytic -5.4007688E+2 -8.5574374E-2 3.6690287E+4 1.9876611E+2 -1.2235594E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 10abla/bou;
C3AH6
Ca3Al2(OH)12 + 12.000H+ = 2.000Al+3 + 3.000Ca+2 + 12.000H2O
log_k 80.316
delta_h -584.260 #kJ/mol #99sch/nav
-analytic -1.518827E+3 -2.4785722E-1 1.0537657E+5 5.5063889E+2 -3.8146768E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: 99sch/nav; S°: Internal calculation; Cp: 79ede/sat; V°: 92wol;
C3FH6
Ca3Fe2(OH)12 + 12.000H+ = 3.000Ca+2 + 2.000Fe+3 + 12.000H2O
log_k 72.366
delta_h -311.607 #kJ/mol #85bab/mat
-analytic -1.5057927E+3 -2.4127496E-1 1.009448E+5 5.4694503E+2 -3.7206553E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 85bab/mat; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay;
C4AH13
Ca4Al2O7:13H2O + 14.000H+ = 2.000Al+3 + 4.000Ca+2 + 20.000H2O
log_k 103.644
delta_h -647.400 #kJ/mol #76hou/ste
-analytic -1.547187E+3 -2.3711762E-1 1.1098856E+5 5.6250523E+2 -3.7879875E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: 76hou/ste; S°: Internal calculation; Cp: 10bbla/bou; V°: 92wol;
C4FH13
Ca4Fe2O7:13H2O + 14.000H+ = 4.000Ca+2 + 2.000Fe+3 + 20.000H2O
log_k 95.115
delta_h -371.442 #kJ/mol #85bab/mat
-analytic -1.6380053E+3 -2.5734869E-1 1.0933342E+5 6.0001352E+2 -3.6936298E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 85bab/mat; S°: 10bbla/bou; Cp: 85bab/mat; V°: 97tay;
Ca(element)
Ca + 0.500O2 + 2.000H+ = 1.000Ca+2 + 1.000H2O
log_k 139.842
delta_h -822.763 #kJ/mol #89cox/wag
-analytic -3.4331328E+2 -5.4813886E-2 6.1858785E+4 1.2329396E+2 -1.1609874E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Ca3(AsO4)2:3.66H2O
Ca3(AsO4)2:3.66H2O + 4.000H+ = 2.000H2AsO4- + 3.000Ca+2 + 3.660H2O
log_k 16.769
#References = LogK/DGf: 99bot/bro;
#References = LogK/DGf: 99bot/bro; V°: Default value;
Ca4(OH)2(AsO4)2:4H2O
Ca4(OH)2(AsO4)2:4H2O + 6.000H+ = 2.000H2AsO4- + 4.000Ca+2 + 6.000H2O
log_k 37.088
#References = LogK/DGf: 99bot/bro;
#References = LogK/DGf: 99bot/bro; V°: Default value;
Ca4H(PO4)3:2.5H2O
Ca4H(PO4)3:2.5H2O + 5.000H+ = 4.000Ca+2 + 3.000H2PO4- + 2.500H2O
log_k 11.809
#References = LogK/DGf: 84nan;
#References = LogK/DGf: 84nan; V°: Default value;
Ca4H(PO4)3:3H2O
Ca4H(PO4)3:3H2O + 5.000H+ = 4.000Ca+2 + 3.000H2PO4- + 3.000H2O
log_k 10.114
#References = LogK/DGf: NIST46.4;
#References = LogK/DGf: NIST46.4; V°: Default value;
Ca5(AsO4)3OH
Ca5(AsO4)3OH + 7.000H+ = 3.000H2AsO4- + 5.000Ca+2 + 1.000H2O
log_k 31.610
#References = LogK/DGf: 99bot/bro;
#References = LogK/DGf: 99bot/bro; V°: Default value;
CaAlH(PO4)2:6H2O
CaAlH(PO4)2:6H2O + 3.000H+ = 1.000Al+3 + 1.000Ca+2 + 2.000H2PO4- + 6.000H2O
log_k -14.312
#References = LogK/DGf: 64atay/gur;
#References = LogK/DGf: 64atay/gur; V°: Default value;
CaCl2:2H2O
CaCl2:2H2O = 1.000Ca+2 + 2.000Cl- + 2.000H2O
log_k 7.949
delta_h -44.790 #kJ/mol #87gar/par
-analytic -1.513717E+3 -2.3596477E-1 8.4379603E+4 5.5049295E+2 -4.724728E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 63wyc;
CaCl2:4H2O
CaCl2:4H2O = 1.000Ca+2 + 2.000Cl- + 4.000H2O
log_k 5.353
delta_h -11.310 #kJ/mol #87gar/par
-analytic -1.5164797E+3 -2.2891709E-1 8.2477243E+4 5.5165864E+2 -4.585891E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 03dea;
CaCl2:H2O
CaCl2:H2O = 1.000Ca+2 + 2.000Cl- + 1.000H2O
log_k 7.848
delta_h -52.160 #kJ/mol #87gar/par
-analytic -1.5340511E+3 -2.4305421E-1 8.5978677E+4 5.5795149E+2 -4.8556422E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 03dea;
CaCrO4(s)
CaCrO4 = 1.000Ca+2 + 1.000CrO4-2
log_k -3.150
delta_h -22.807 #kJ/mol #Internal calculation
-analytic -1.6003913E+3 -2.5327361E-1 8.8679697E+4 5.7948673E+2 -5.2074222E+6
#References = LogK/DGf: 04wan/li; DHf/DHr: Internal calculation; S°: 03dea; V°: 90rob/cam;
CaHAsO3
CaHAsO3 + 1.000H+ = 1.000H2AsO3- + 1.000Ca+2
log_k 34.250
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: Default value;
CaHAsO4:H2O
CaHAsO4:H2O + 1.000H+ = 1.000H2AsO4- + 1.000Ca+2 + 1.000H2O
log_k 2.020
#References = LogK/DGf: 99bot/bro;
#References = LogK/DGf: 99bot/bro; V°: Default value;
Calcite
CaCO3 + 1.000H+ = 1.000HCO3- + 1.000Ca+2
log_k 1.847
delta_h -25.325 #kJ/mol #Internal calculation
-analytic -8.5010157E+2 -1.3947146E-1 4.6881027E+4 3.0964897E+2 -2.6591521E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 82plu/bus; Cp: 95rob/hem; V°: 78hel/del,82plu/bus;
Calomel
Hg2Cl2 = 2.000Cl- + 1.000Hg2+2
log_k -17.844
delta_h -8.133 #kJ/mol #89cox/wag
-analytic -1.4752372E+3 -2.4016758E-1 7.5072302E+4 5.3775896E+2 -4.7508354E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 85cha/dav; V°: 95rob/hem;
Carbonate(K)
K2CO3:1.5H2O + 1.000H+ = 1.000HCO3- + 2.000K+ + 1.500H2O
log_k 13.357
delta_h -15.889 #kJ/mol #Internal calculation
-analytic -8.1150653E+2 -1.1714552E-1 4.5311586E+4 2.9716423E+2 -2.4445099E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
Carnallite
KMgCl3:6H2O = 3.000Cl- + 1.000K+ + 1.000Mg+2 + 6.000H2O
log_k 4.328
delta_h 9.340 #kJ/mol #74nau/ryz
-analytic -2.2749456E+3 -3.3777677E-1 1.2302546E+5 8.2655741E+2 -6.9256834E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 63wyc;
Cassiterite
SnO2 + 2.000H+ = 1.000Sn+2 + 0.500O2 + 1.000H2O
log_k -45.458
delta_h 276.957 #kJ/mol #89cox/wag
-analytic -1.7331081E+2 -2.6966618E-2 -6.0764942E+3 6.4780312E+1 -3.5741422E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Cattierite
CoS2 + 0.750H2O = 1.000Co+2 + 1.500HS- + 0.250S2O3-2
log_k -27.182
delta_h -1397.082 #kJ/mol #95rob/hem
-analytic -1.6114899E+3 -2.6089444E-1 8.1620674E+4 5.84998E+2 -5.26276E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 87pan/mah; V°: 95rob/hem;
Cd(element)
Cd + 0.500O2 + 2.000H+ = 1.000Cd+2 + 1.000H2O
log_k 56.613
delta_h -355.683 #kJ/mol #By convention
-analytic -3.7605104E+2 -5.7701274E-2 3.9271634E+4 1.3428955E+2 -1.2570585E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Cd(OH)2
Cd(OH)2 + 2.000H+ = 1.000Cd+2 + 2.000H2O
log_k 13.859
delta_h -87.730 #kJ/mol #Internal calculation
-analytic -2.6341404E+2 -3.928067E-2 1.798239E+4 9.5479833E+1 -6.7442691E+5
#References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 82wag/eva; Cp: 99yun/glu; V°: 01mer/vie;
Cd3(PO4)2
Cd3(PO4)2 + 4.000H+ = 3.000Cd+2 + 2.000H2PO4-
log_k 8.970
delta_h -206.960 #kJ/mol #01ben/jem
-analytic -2.2188303E+3 -3.4072698E-1 1.2852167E+5 7.9746224E+2 -6.662007E+6
#References = LogK/DGf: 82wag/eva; DHf/DHr: 01ben/jem; S°: Internal calculation; V°: Default value;
Cd5(PO4)3Cl
Cd5(PO4)3Cl + 6.000H+ = 5.000Cd+2 + 1.000Cl- + 3.000H2PO4-
log_k 12.673
#References = LogK/DGf: 84vie/tar;
#References = LogK/DGf: 84vie/tar; V°: Default value;
Cd5(PO4)3OH
Cd5(PO4)3OH + 7.000H+ = 5.000Cd+2 + 3.000H2PO4- + 1.000H2O
log_k 19.842
#References = LogK/DGf: 84vie/tar;
#References = LogK/DGf: 84vie/tar; V°: Default value;
CdCl2
CdCl2 = 1.000Cd+2 + 2.000Cl-
log_k -0.656
delta_h -18.580 #kJ/mol #82wag/eva
-analytic -1.5398355E+3 -2.5000543E-1 8.4903441E+4 5.5986018E+2 -5.0123509E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 84pan;
CdCl2:2.5H2O
CdCl2:2.5H2O = 1.000Cd+2 + 2.000Cl- + 2.500H2O
log_k -1.900
delta_h 7.285 #kJ/mol #82wag/eva
-analytic -1.5455863E+3 -2.3680873E-1 8.3342855E+4 5.6115591E+2 -4.7812346E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; V°: 01mer/vie;
CdCl2:H2O
CdCl2:H2O = 1.000Cd+2 + 2.000Cl- + 1.000H2O
log_k -1.692
delta_h -7.470 #kJ/mol #82wag/eva
-analytic -1.5542041E+3 -2.4384252E-1 8.4786317E+4 5.6422392E+2 -4.9155105E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; V°: 01mer/vie;
CdSiO3
CdSiO3 + 2.000H+ + 1.000H2O = 1.000Cd+2 + 1.000H4SiO4
log_k 7.789
delta_h -62.194 #kJ/mol #77bar/kna
-analytic -3.8663006E+2 -6.2897758E-2 2.204666E+4 1.4122595E+2 -9.0909826E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 77bar/kna; S°: 77bar/kna; Cp: 77bar/kna; V°: Default value;
CdSO4
CdSO4 = 1.000Cd+2 + 1.000SO4-2
log_k -0.157
delta_h -51.980 #kJ/mol #82wag/eva
-analytic -1.6519358E+3 -2.6396523E-1 9.3414686E+4 5.9762838E+2 -5.4781853E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 74nau/ryz; V°: 94pan;
CdSO4:8/3H2O
CdSO4:2.67H2O = 1.000Cd+2 + 1.000SO4-2 + 2.670H2O
log_k -1.726
delta_h -19.126 #kJ/mol #89cox/wag
-analytic -1.615595E+3 -2.5938745E-1 8.8741909E+4 5.8676356E+2 -5.1864875E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 82dek; V°: 95rob/hem;
Celadonite
K(MgAl)Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.000Al+3 + 1.000K+ + 1.000Mg+2 + 4.000H4SiO4
log_k 10.202
delta_h -124.261 #kJ/mol #02par/vid
-analytic -1.1286899E+3 -1.926429E-1 5.9153366E+4 4.1424004E+2 -2.4075349E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 02par/vid; S°: 02par/vid; Cp: 98hol/pow; V°: 02par/vid;
Celadonite(Fe)
KFeAlSi4O10(OH)2 + 6.000H+ + 4.000H2O = 1.000Al+3 + 1.000Fe+2 + 1.000K+ + 4.000H4SiO4
log_k 6.432
delta_h -103.862 #kJ/mol #02par/vid
-analytic -1.100626E+3 -1.8968446E-1 5.65505E+4 4.0420595E+2 -2.3325867E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 02par/vid; S°: 02par/vid; Cp: 98hol/pow; V°: 02par/vid;
Celestite
SrSO4 = 1.000SO4-2 + 1.000Sr+2
log_k -6.620
delta_h -2.451 #kJ/mol #Internal calculation
-analytic -1.6382672E+3 -2.613432E-1 9.0848416E+4 5.9292511E+2 -5.5376131E+6
#References = LogK/DGf: 06bla/ign; DHf/DHr: Internal calculation; S°: 06bla/ign; Cp: 06bla/ign; V°: 78hel/del;
Cerussite
PbCO3 + 1.000H+ = 1.000HCO3- + 1.000Pb+2
log_k -2.963
delta_h 12.709 #kJ/mol #Internal calculation
-analytic -8.8003794E+2 -1.4186343E-1 4.7401255E+4 3.2029804E+2 -2.8596729E+6
#References = LogK/DGf: 84tay/lop; DHf/DHr: Internal calculation; S°: 60kel; Cp: 78hel/del; V°: 78hel/del;
Chabazite
Ca(Al2Si4)O12:6H2O + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 4.000H4SiO4 + 2.000H2O
log_k 11.517
delta_h -209.797 #kJ/mol #08bla
-analytic -1.2464746E+3 -2.1259542E-1 6.8500775E+4 4.531977E+2 -2.647602E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 08bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Chalcedony
SiO2 + 2.000H2O = 1.000H4SiO4
log_k -3.453
delta_h 19.574 #kJ/mol #78hel/del
-analytic -7.3377874E+1 -1.5148816E-2 1.4875718E+3 2.8206423E+1 -3.0469035E+4
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Chalcocite(alpha)
Cu2S + 1.000H+ = 2.000Cu+ + 1.000HS-
log_k -34.020
delta_h -955.598 #kJ/mol #Internal calculation
-analytic -8.6799862E+2 -1.3644873E-1 3.6090929E+4 3.1664721E+2 -2.6589476E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 78hel/del; V°: 84pan/stu;
Chalcocyanite
CuSO4 = 1.000Cu+2 + 1.000SO4-2
log_k 2.940
delta_h -72.762 #kJ/mol #89cox/wag
-analytic -1.6722243E+3 -2.6806561E-1 9.5237171E+4 6.0518642E+2 -5.496615E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem;
Chalcopyrite(alpha)
CuFeS2 + 2.000H+ = 1.000Cu+2 + 1.000Fe+2 + 2.000HS-
log_k -33.986
delta_h -1600.068 #kJ/mol #95rob/hem
-analytic -1.9243258E+3 -3.0811621E-1 9.6811708E+4 6.9764039E+2 -6.1131044E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 78hel/del,70pan/kin; V°: 95rob/hem;
Chamosite(Daphnite)
Fe5Al(AlSi3)O10(OH)8 + 16.000H+ = 2.000Al+3 + 5.000Fe+2 + 3.000H4SiO4 + 6.000H2O
log_k 47.579
delta_h -504.518 #kJ/mol #01vid/par
-analytic -2.6210061E+3 -4.2497094E-1 1.5576281E+5 9.4858884E+2 -6.610337E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 01vid/par; S°: 01vid/par; Cp: 05vid/par; V°: 05vid/par;
Chlorapatite(Pp)
Ca5(PO4)3Cl + 6.000H+ = 5.000Ca+2 + 1.000Cl- + 3.000H2PO4-
log_k 14.533
#References = LogK/DGf: 84vie/tar,after 72bduf;
#References = LogK/DGf: 84vie/tar,after 72bduf; Cp: 68val/kog; V°: 74nau/ryz;
Chlorapatite(Synth)
Ca5(PO4)3Cl + 6.000H+ = 5.000Ca+2 + 1.000Cl- + 3.000H2PO4-
log_k 5.210
delta_h -132.541 #kJ/mol #Internal calculation
-analytic -3.7341248E+3 -6.1240037E-1 2.0792436E+5 1.3570982E+3 -1.1868242E+7
#References = LogK/DGf: 68val/kog; DHf/DHr: Internal calculation; S°: 71par/wag; Cp: 68val/kog; V°: 74nau/ryz;
Chlorargyrite
AgCl = 1.000Ag+ + 1.000Cl-
log_k -9.749
delta_h 65.704 #kJ/mol #89cox/wag
-analytic -7.3805491E+2 -1.1588653E-1 3.759537E+4 2.6854718E+2 -2.4659102E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 78rob/hem,70pan; V°: 95rob/hem;
Chlorite(Cca-2)
(Mg2.964Fe1.927Al1.116Ca0.011)(Si2.633Al1.367)O10(OH)8 + 17.468H+ = 2.483Al+3 + 0.011Ca+2 + 1.712Fe+2 + 2.964Mg+2 + 2.633H4SiO4 + 0.215Fe+3 + 7.468H2O
log_k 61.315
delta_h -612.127 #kJ/mol #14bla/gai
-analytic -2.9118253E+3 -4.6718919E-1 1.7751461E+5 1.0510111E+3 -7.432582E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 14bla/gai; S°: 14bla/gai; Cp: 09gai/rog; V°: 14bla/gai;
Chloritoid
FeAl2SiO5(OH)2 + 8.000H+ = 2.000Al+3 + 1.000Fe+2 + 1.000H4SiO4 + 3.000H2O
log_k 21.777
delta_h -292.184 #kJ/mol #87woo/gar
-analytic -1.213842E+3 -2.031818E-1 7.455402E+4 4.3686995E+2 -3.0991352E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87woo/gar; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Chloromagnesite
MgCl2 = 2.000Cl- + 1.000Mg+2
log_k 22.025
delta_h -159.540 #kJ/mol #98cha
-analytic -1.5873891E+3 -2.5606716E-1 9.4920821E+4 5.7613443E+2 -5.1746834E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem;
Chromite
FeCr2O4 + 8.000H+ = 2.000Cr+3 + 1.000Fe+2 + 4.000H2O
log_k 15.121
delta_h -98.470 #kJ/mol #95rob/hem
-analytic -1.188199E+3 -1.9125998E-1 7.34955E+4 4.2430775E+2 -3.2075483E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Chrysotile
Mg3Si2O5(OH)4 + 6.000H+ = 3.000Mg+2 + 2.000H4SiO4 + 1.000H2O
log_k 33.170
delta_h -249.218 #kJ/mol #04eva
-analytic -1.1167594E+3 -1.7467297E-1 6.800348E+4 4.0577219E+2 -2.6786499E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04eva; S°: 04eva; Cp: 95rob/hem; V°: 78hel/del;
Cinnabar(alpha)
HgS + 1.000H+ = 1.000HS- + 1.000Hg+2
log_k -39.006
delta_h -661.517 #kJ/mol #78hel/del
-analytic -9.1509124E+2 -1.4584128E-1 3.8659923E+4 3.323669E+2 -2.8906437E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 87pan/mah; V°: 78hel/del;
Cinnabar(beta)
HgS + 1.000H+ = 1.000HS- + 1.000Hg+2
log_k -38.620
#delta_h 0.000 #kJ/mol
-analytic -9.1312982E+2 -1.4554513E-1 3.8723371E+4 3.3155065E+2 -2.8779555E+6
#References = LogK/DGf: Internal calculation; Cp: 87pan/mah; V°: Default value;
Claudetite
As2O3 + 3.000H2O = 2.000H2AsO3- + 2.000H+
log_k -19.926
delta_h -294.176 #kJ/mol #Internal calculation
-analytic -5.5963281E+2 -1.0154829E-1 2.0924644E+4 2.0741682E+2 -1.1945366E+6
#References = LogK/DGf: 96pok/gou; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou;
Clinochlore
Mg5Al(AlSi3)O10(OH)8 + 16.000H+ = 2.000Al+3 + 5.000Mg+2 + 3.000H4SiO4 + 6.000H2O
log_k 61.682
delta_h -600.773 #kJ/mol #05vid/par
-analytic -2.7499165E+3 -4.3731761E-1 1.6729236E+5 9.9346322E+2 -6.8782833E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par;
Clinoclase
Cu3AsO4(OH)3 + 5.000H+ = 1.000H2AsO4- + 3.000Cu+2 + 3.000H2O
log_k 10.099
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Clinoptilolite(Ca)
Ca0.55(Si4.9Al1.1)O12:3.9H2O + 4.400H+ + 3.700H2O = 1.100Al+3 + 0.550Ca+2 + 4.900H4SiO4
log_k -2.107
delta_h -69.841 #kJ/mol #09bla
-analytic -8.8892191E+2 -1.5134613E-1 4.3221828E+4 3.2542243E+2 -1.6236035E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Clinoptilolite(K)
K1.1(Si4.9Al1.1)O12:2.7H2O + 4.400H+ + 4.900H2O = 1.100Al+3 + 1.100K+ + 4.900H4SiO4
log_k -1.162
delta_h -60.469 #kJ/mol #09bla
-analytic -8.5037461E+2 -1.4523594E-1 4.1442259E+4 3.1185182E+2 -1.6125516E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Clinoptilolite(Na)
Na1.1(Si4.9Al1.1)O12:3.5H2O + 4.400H+ + 4.100H2O = 1.100Al+3 + 1.100Na+ + 4.900H4SiO4
log_k -0.134
delta_h -62.203 #kJ/mol #09bla
-analytic -9.0182875E+2 -1.4840199E-1 4.4213705E+4 3.3009383E+2 -1.7021357E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Clinozoisite
Ca2Al3Si3O12(OH) + 13.000H+ = 3.000Al+3 + 2.000Ca+2 + 3.000H4SiO4 + 1.000H2O
log_k 41.886
delta_h -480.273 #kJ/mol #04got
-analytic -2.0148592E+3 -3.4374508E-1 1.220382E+5 7.2958916E+2 -4.9251982E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04got; S°: 04got; Cp: 04got; V°: 04got;
Co(element)
Co + 0.500O2 + 2.000H+ = 1.000Co+2 + 1.000H2O
log_k 52.732
delta_h -337.363 #kJ/mol #By convention
-analytic -4.0115316E+2 -6.2717054E-2 3.9584488E+4 1.4340947E+2 -1.3369355E+6
#References = S°: 87fer, 91din; Cp: 87fer, 91din; V°: 87fer;
Co(FeO2)2(alpha)
Co(FeO2)2 + 8.000H+ = 1.000Co+2 + 2.000Fe+3 + 4.000H2O
log_k 0.769
delta_h 38.563 #kJ/mol #74nau/ryz
-analytic -1.172307E+3 -1.8959065E-1 6.6969756E+4 4.2042598E+2 -3.1407431E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan;
Co(OH)2(blue)
Co(OH)2 + 2.000H+ = 1.000Co+2 + 2.000H2O
log_k 13.798
#References = LogK/DGf: 98ply/zha;
#References = LogK/DGf: 98ply/zha; V°: 01mer/vie;
Co(OH)2(pink-pc)
Co(OH)2 + 2.000H+ = 1.000Co+2 + 2.000H2O
log_k 13.203
delta_h -93.560 #kJ/mol #98ply/zha
-analytic -3.2548549E+2 -4.3882938E-2 2.1554613E+4 1.1664714E+2 -8.1411583E+5
#References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: 01mer/vie;
Co(OH)2(pink-wc)
Co(OH)2 + 2.000H+ = 1.000Co+2 + 2.000H2O
log_k 12.204
delta_h -88.460 #kJ/mol #98ply/zha
-analytic -3.2559061E+2 -4.3882938E-2 2.1288222E+4 1.1664714E+2 -8.1411583E+5
#References = LogK/DGf: 98ply/zha; DHf/DHr: 98ply/zha; S°: Internal calculation; V°: 01mer/vie;
Co2SiO4
Co2SiO4 + 4.000H+ = 2.000Co+2 + 1.000H4SiO4
log_k 7.353
delta_h -99.394 #kJ/mol #82wag/eva
-analytic -6.9992699E+2 -1.1052198E-1 4.0453716E+4 2.5269536E+2 -1.8426353E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 61kel/kin; V°: 82pan;
Co3(PO4)2
Co3(PO4)2 + 4.000H+ = 3.000Co+2 + 2.000H2PO4-
log_k 4.360
#References = LogK/DGf: 84vie/tar;
#References = LogK/DGf: 84vie/tar; V°: Default value;
CoCl2
CoCl2 = 2.000Cl- + 1.000Co+2
log_k 8.474
delta_h -79.220 #kJ/mol #98cha
-analytic -1.5576924E+3 -2.5385132E-1 8.8980097E+4 5.6601272E+2 -5.0802554E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan;
CoCl2:6H2O
CoCl2:6H2O = 2.000Cl- + 1.000Co+2 + 6.000H2O
log_k -2.542
delta_h 8.060 #kJ/mol #97smi/mar
-analytic -1.5511741E+3 -2.2451571E-1 8.2789246E+4 5.6132179E+2 -4.5388176E+6
#References = LogK/DGf: 97smi/mar; DHf/DHr: 97smi/mar; S°: Internal calculation; V°: 94pan;
Coesite(alpha)
SiO2 + 2.000H2O = 1.000H4SiO4
log_k -2.913
delta_h 16.779 #kJ/mol #78hel/del
-analytic -7.4881786E+1 -1.5356336E-2 1.7099772E+3 2.8770707E+1 -3.3717148E+4
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
CoF2
CoF2 = 1.000Co+2 + 2.000F-
log_k -1.391
delta_h -56.770 #kJ/mol #98cha
-analytic -1.6903491E+3 -2.7132265E-1 9.4540309E+4 6.1180462E+2 -5.4320174E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan;
CoHPO4
CoHPO4 + 1.000H+ = 1.000Co+2 + 1.000H2PO4-
log_k 0.490
#References = LogK/DGf: 84vie/tar;
#References = LogK/DGf: 84vie/tar; V°: Default value;
Conichalcite
CaCuAsO4(OH) + 3.000H+ = 1.000H2AsO4- + 1.000Ca+2 + 1.000Cu+2 + 1.000H2O
log_k 1.290
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
CoO
CoO + 2.000H+ = 1.000Co+2 + 1.000H2O
log_k 13.774
delta_h -105.530 #kJ/mol #95rob/hem
-analytic -3.0331783E+2 -4.7767985E-2 2.1056697E+4 1.0918952E+2 -8.4211862E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Cooperite
PtS + 1.000H+ = 1.000Pt+2 + 1.000HS-
log_k -60.932
delta_h -546.853 #kJ/mol #Internal calculation
-analytic -9.6573285E+2 -1.5547846E-1 3.5270369E+4 3.5048183E+2 -3.0565926E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Copiapite
Fe5(SO4)6(OH)2:20H2O + 2.000H+ = 4.000Fe+3 + 6.000SO4-2 + 1.000Fe+2 + 22.000H2O
log_k -16.592
delta_h 189.226 #kJ/mol #02hem/sea
-analytic -1.0400833E+4 -1.5545629E+0 5.7432844E+5 3.7516742E+3 -3.2165823E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam;
Coquimbite
Fe2(SO4)3:9H2O = 2.000Fe+3 + 3.000SO4-2 + 9.000H2O
log_k -8.988
delta_h 87.473 #kJ/mol #02hem/sea
-analytic -5.0457378E+3 -7.601657E-1 2.7965171E+5 1.819718E+3 -1.5764089E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam;
Cordierite
Mg2Al3(AlSi5)O18 + 16.000H+ + 2.000H2O = 4.000Al+3 + 2.000Mg+2 + 5.000H4SiO4
log_k 49.408
delta_h -660.411 #kJ/mol #95rob/hem
-analytic -2.8575817E+3 -4.7701981E-1 1.7292169E+5 1.0300555E+3 -7.0735857E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Cordierite(hydrated)
Mg2Al3(AlSi5)O18:H2O + 16.000H+ + 1.000H2O = 4.000Al+3 + 2.000Mg+2 + 5.000H4SiO4
log_k 51.657
delta_h -669.993 #kJ/mol #78hel/del
-analytic -2.8158585E+3 -4.7070958E-1 1.7098236E+5 1.0152376E+3 -6.9122658E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Corkite
PbFe3(PO4)(OH)6SO4 + 8.000H+ = 3.000Fe+3 + 1.000H2PO4- + 1.000Pb+2 + 1.000SO4-2 + 6.000H2O
log_k -1.951
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Cornetite
Cu3PO4(OH)3 + 5.000H+ = 3.000Cu+2 + 1.000H2PO4- + 3.000H2O
log_k 15.015
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Corundum(alpha)
Al2O3 + 6.000H+ = 2.000Al+3 + 3.000H2O
log_k 18.297
delta_h -258.590 #kJ/mol #89cox/wag
-analytic -8.8185832E+2 -1.4783302E-1 5.7250215E+4 3.1491339E+2 -2.4018418E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Corundum(gamma)
Al2O3 + 6.000H+ = 2.000Al+3 + 3.000H2O
log_k 21.518
delta_h -277.390 #kJ/mol #89cox/wag
-analytic -8.8325049E+2 -1.4837185E-1 5.8287666E+4 3.1545881E+2 -2.4067195E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 78hel/del;
CoS(alpha)
CoS + 1.000H+ = 1.000Co+2 + 1.000HS-
log_k -7.441
delta_h -856.933 #kJ/mol #74nau/ryz
-analytic -9.8082433E+2 -1.5438094E-1 5.2331798E+4 3.5505821E+2 -3.082632E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: 03dea;
CoS(beta)
CoS + 1.000H+ = 1.000Co+2 + 1.000HS-
log_k -11.070
#References = LogK/DGf: 61kel/kin;
#References = LogK/DGf: 61kel/kin; V°: 03dea;
CoSO4
CoSO4 = 1.000Co+2 + 1.000SO4-2
log_k 3.009
delta_h -78.680 #kJ/mol #98cha
-analytic -1.6651626E+3 -2.6798761E-1 9.5301217E+4 6.0234347E+2 -5.5139714E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan;
Cotunnite
PbCl2 = 2.000Cl- + 1.000Pb+2
log_k -4.807
delta_h 26.160 #kJ/mol #98cha
-analytic -1.5285807E+3 -2.4847644E-1 8.279877E+4 5.5665154E+2 -5.0890703E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan;
Covellite
CuS + 1.000H+ = 1.000Cu+2 + 1.000HS-
log_k -22.060
delta_h -771.914 #kJ/mol #Internal calculation
-analytic -9.6591009E+2 -1.5396767E-1 4.7082843E+4 3.5005416E+2 -3.0532461E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 84pan/stu; V°: 84pan/stu;
Cr(element)
Cr + 0.500O2 + 2.000H+ = 1.000Cr+2 + 1.000H2O
log_k 70.926
delta_h -574.970 #kJ/mol #By convention
-analytic -3.9811906E+2 -6.2085731E-2 4.4690912E+4 1.4249723E+2 -1.3279421E+6
#References = S°: 98cha; Cp: 98cha; V°: 95rob/hem;
Cr(OH)2(s)
Cr(OH)2 + 2.000H+ = 1.000Cr+2 + 2.000H2O
log_k 10.999
delta_h -212.952 #kJ/mol #Internal calculation
-analytic -3.3948282E+2 -4.6109787E-2 2.1399517E+4 1.2208472E+2 -8.5650556E+5
#References = LogK/DGf: 41hum/sto; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: Default value;
Cr(OH)3(s)
Cr(OH)3 + 3.000H+ = 1.000Cr+3 + 3.000H2O
log_k 9.349
delta_h -30.126 #kJ/mol #Internal calculation
-analytic -4.8037286E+2 -6.9149432E-2 2.9750107E+4 1.7114769E+2 -1.1500436E+6
#References = LogK/DGf: 87rai/sas; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: Default value;
Cr2(SO4)3(s)
Cr2(SO4)3 = 2.000Cr+3 + 3.000SO4-2
log_k 4.379
delta_h -107.370 #kJ/mol #91kna/kub
-analytic -4.983517E+3 -8.0844343E-1 2.8588851E+5 1.8002566E+3 -1.6406042E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 91kna/kub; S°: 91kna/kub; Cp: 91kna/kub; V°: 94pan;
Cr2S3(s)
Cr2S3 + 1.000H+ + 0.750H2O = 2.000Cr+2 + 2.500HS- + 0.250S2O3-2
log_k -16.703
delta_h -2631.168 #kJ/mol #84pan/stu
-analytic -2.569488E+3 -4.131322E-1 1.383505E+5 9.3181265E+2 -8.3363903E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 91kna/kub; V°: 87pan/mah;
Crandallite
CaAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 1.000Ca+2 + 2.000H2PO4- + 6.000H2O
log_k 21.043
#References = LogK/DGf: 79vie/tar;
#References = LogK/DGf: 79vie/tar; V°: 63wyc;
CrCl2(s)
CrCl2 = 2.000Cl- + 1.000Cr+2
log_k 12.744
delta_h -241.066 #kJ/mol #98bal/nor
-analytic -1.5567655E+3 -2.530602E-1 9.0179283E+4 5.6558406E+2 -5.0672666E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98bal/nor; S°: 98bal/nor; Cp: 91kna/kub; V°: 84pan;
CrCl3(s)
CrCl3 + 0.500H2O = 2.500Cl- + 1.000Cr+2 + 0.500ClO- + 1.000H+
log_k -15.227
delta_h -112.165 #kJ/mol #98bal/nor
-analytic -2.1917886E+3 -3.5673616E-1 1.1696505E+5 7.9690933E+2 -7.2252838E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98bal/nor; S°: 98bal/nor; Cp: 91kna/kub; V°: 84pan;
Cristobalite(alpha)
SiO2 + 2.000H2O = 1.000H4SiO4
log_k -3.160
delta_h 16.496 #kJ/mol #04fab/sax
-analytic -7.6499595E+1 -1.5230412E-2 1.8688606E+3 2.9150764E+1 -4.6197887E+4
#References = LogK/DGf: Internal calculation; DHf/DHr: 04fab/sax; S°: 04fab/sax; Cp: 04fab/sax; V°: 04fab/sax;
Cristobalite(beta)
SiO2 + 2.000H2O = 1.000H4SiO4
log_k -3.099
#delta_h 0.000 #kJ/mol
-analytic -8.2954599E+1 -1.5481501E-2 2.6263322E+3 3.1150006E+1 -1.2588219E+5
#References = LogK/DGf: Internal calculation; Cp: 04fab/sax; V°: 04fab/sax;
CrO2(s)
CrO2 + 3.000H+ = 1.000Cr+3 + 0.250O2 + 1.500H2O
log_k 0.441
delta_h 10.797 #kJ/mol #04chi
-analytic -3.9544036E+2 -6.5853987E-2 2.3130555E+4 1.4119104E+2 -1.016237E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 93bar; V°: 92wol;
CrO3(s)
CrO3 + 1.000H2O = 1.000CrO4-2 + 2.000H+
log_k -3.017
delta_h -10.070 #kJ/mol #98bal/nor
-analytic -1.2885322E+3 -2.1285233E-1 7.1785289E+4 4.6789964E+2 -4.4072946E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98bal/nor; S°: 98bal/nor; Cp: 91kna/kub; V°: 92wol;
Crocoite
PbCrO4 = 1.000CrO4-2 + 1.000Pb+2
log_k -12.550
delta_h 48.940 #kJ/mol #76del/hep
-analytic -1.570868E+3 -2.5330672E-1 8.465467E+4 5.6987672E+2 -5.3526745E+6
#References = LogK/DGf: 42kol/per; DHf/DHr: 76del/hep; S°: Internal calculation; Cp: 74nau/ryz; V°: 00lyd;
Cronstedtite(Th)
Fe3SiAlO5(OH)4 + 10.000H+ = 1.000Al+3 + 2.000Fe+2 + 1.000H4SiO4 + 1.000Fe+3 + 5.000H2O
log_k 98.744
delta_h -644.313 #kJ/mol #15bla/vie
-analytic -1.6435076E+3 -2.5592947E-1 1.2183138E+5 5.8971886E+2 -4.3813826E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
CrPO4(green)
CrPO4 + 2.000H+ = 1.000Cr+3 + 1.000H2PO4-
log_k -5.326
#References = LogK/DGf: 51zha;
#References = LogK/DGf: 51zha; V°: Default value;
CrPO4(purple)
CrPO4 + 2.000H+ = 1.000Cr+3 + 1.000H2PO4-
log_k 0.298
#References = LogK/DGf: 51zha;
#References = LogK/DGf: 51zha; V°: Default value;
CrS(s)
CrS + 1.000H+ = 1.000Cr+2 + 1.000HS-
log_k 1.675
delta_h -1045.139 #kJ/mol #84pan/stu
-analytic -9.6518362E+2 -1.5487928E-1 5.4210689E+4 3.4989598E+2 -3.0741659E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 91kna/kub; V°: 87pan/mah;
Cu(element)
Cu + 0.500O2 + 2.000H+ = 1.000Cu+2 + 1.000H2O
log_k 31.600
delta_h -214.586 #kJ/mol #By convention
-analytic -4.0433895E+2 -6.2132696E-2 3.3258027E+4 1.4458197E+2 -1.3194359E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Cu3(PO4)2
Cu3(PO4)2 + 4.000H+ = 3.000Cu+2 + 2.000H2PO4-
log_k 2.210
delta_h -154.596 #kJ/mol #Internal calculation
-analytic -2.2061898E+3 -3.5165819E-1 1.2563737E+5 7.9557351E+2 -6.821496E+6
#References = LogK/DGf: 84vie/tar; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value;
Cu3(PO4)2:3H2O
Cu3(PO4)2:3H2O + 4.000H+ = 3.000Cu+2 + 2.000H2PO4- + 3.000H2O
log_k 3.979
delta_h -142.084 #kJ/mol #Internal calculation
-analytic -2.1761185E+3 -3.4230804E-1 1.2324311E+5 7.8540337E+2 -6.6343056E+6
#References = LogK/DGf: 84vie/tar; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value;
Cummingtonite
Mg7Si8O22(OH)2 + 14.000H+ + 8.000H2O = 7.000Mg+2 + 8.000H4SiO4
log_k 76.119
delta_h -615.124 #kJ/mol #98hol/pow
-analytic -2.8856764E+3 -4.6647181E-1 1.71165E+5 1.0512319E+3 -6.615536E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Cuprite
Cu2O + 2.000H+ = 2.000Cu+ + 1.000H2O
log_k -1.472
delta_h -264.638 #kJ/mol #95rob/hem
-analytic -1.8162588E+2 -2.4802858E-2 7.4534047E+3 6.7250863E+1 -3.4290774E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 98cha; V°: 78hel/del;
Dawsonite
NaAlCO3(OH)2 + 3.000H+ = 1.000Al+3 + 1.000HCO3- + 1.000Na+ + 2.000H2O
log_k 4.324
delta_h -76.330 #kJ/mol #76fer/stu
-analytic -1.1738544E+3 -1.847184E-1 6.6671294E+4 4.2438366E+2 -3.5978925E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 76fer/stu; S°: 76fer/stu; Cp: 76fer/stu; V°: 95rob/hem;
Diaspore
AlO(OH) + 3.000H+ = 1.000Al+3 + 2.000H2O
log_k 6.864
delta_h -108.760 #kJ/mol #95rob/hem
-analytic -4.3752143E+2 -7.1234798E-2 2.7576638E+4 1.5621774E+2 -1.1929039E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del;
Dickite
Al2Si2O5(OH)4 + 6.000H+ = 2.000Al+3 + 2.000H4SiO4 + 1.000H2O
log_k 9.385
delta_h -185.218 #kJ/mol #06bla/pia
-analytic -9.8833761E+2 -1.6981612E-1 5.5980146E+4 3.5799436E+2 -2.2435754E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 06bla/pia; S°: 06bla/pia; Cp: 06bla/pia; V°: 78hel/del,78rob/hem;
Diopside
CaMg(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Ca+2 + 1.000Mg+2 + 2.000H4SiO4
log_k 21.734
delta_h -158.241 #kJ/mol #Internal calculation
-analytic -7.3256027E+2 -1.2200954E-1 4.3264387E+4 2.6840491E+2 -1.6523537E+6
#References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Dolomite
CaMg(CO3)2 + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 1.000Mg+2
log_k 3.533
delta_h -65.360 #kJ/mol #95rob/hem
-analytic -1.7923634E+3 -2.8963524E-1 9.9594493E+4 6.5114488E+2 -5.6008392E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del,92ajoh;
Dolomite(disordered)
CaMg(CO3)2 + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 1.000Mg+2
log_k 4.299
delta_h -73.162 #kJ/mol #78hel/del,92ajoh
-analytic -1.7814513E+3 -2.8852827E-1 9.9264201E+4 6.4714323E+2 -5.5534198E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,92ajoh; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Dolomite(ordered)
CaMg(CO3)2 + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 1.000Mg+2
log_k 2.754
delta_h -60.916 #kJ/mol #78hel/del,92ajoh
-analytic -1.7923812E+3 -2.8963813E-1 9.9363286E+4 6.5115141E+2 -5.6008892E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,92ajoh; S°: 78hel/del,92ajoh; Cp: 95rob/hem; V°: 78hel/del,92ajoh;
Duftite
PbCuAsO4(OH) + 3.000H+ = 1.000H2AsO4- + 1.000Cu+2 + 1.000Pb+2 + 1.000H2O
log_k -1.975
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Eastonite
KMg2Al3Si2O10(OH)2 + 14.000H+ = 3.000Al+3 + 1.000K+ + 2.000Mg+2 + 2.000H4SiO4 + 4.000H2O
log_k 46.297
delta_h -518.108 #kJ/mol #98hol/pow
-analytic -2.2626622E+3 -3.6781449E-1 1.3974058E+5 8.1502842E+2 -5.9384003E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow;
Edenite(alpha)
Na(Ca2Mg5)(AlSi7)O22(OH)2 + 18.000H+ + 4.000H2O = 1.000Al+3 + 2.000Ca+2 + 5.000Mg+2 + 1.000Na+ + 7.000H4SiO4
log_k 81.914
delta_h -695.630 #kJ/mol #97got
-analytic -3.2738397E+3 -5.2963683E-1 1.9601616E+5 1.1899835E+3 -7.8504554E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 97got; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Enstatite(alpha)
MgSiO3 + 2.000H+ + 1.000H2O = 1.000Mg+2 + 1.000H4SiO4
log_k 11.840
delta_h -95.598 #kJ/mol #78hel/del
-analytic -4.0596458E+2 -6.5274481E-2 2.4728317E+4 1.4755347E+2 -9.5862765E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Epidote
Ca2FeAl2Si3O12(OH) + 13.000H+ = 2.000Al+3 + 2.000Ca+2 + 1.000Fe+3 + 3.000H4SiO4 + 1.000H2O
log_k 32.213
delta_h -319.731 #kJ/mol #04got
-analytic -1.9683601E+3 -3.3537675E-1 1.1609664E+5 7.1303625E+2 -4.7279254E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04got; S°: 04got; Cp: 04got; V°: 04got;
Epsomite
MgSO4:7H2O = 1.000Mg+2 + 1.000SO4-2 + 7.000H2O
log_k -1.882
delta_h 10.990 #kJ/mol #Internal calculation
-analytic -1.5513219E+3 -2.348529E-1 8.4843897E+4 5.6216047E+2 -4.9901416E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 95rob/hem;
Erdite
NaFeS2:2H2O + 0.875H+ = 1.000Fe+2 + 1.000Na+ + 1.875HS- + 0.125SO4-2 + 1.500H2O
log_k -5.502
delta_h -1601.564 #kJ/mol #14las/pia
-analytic -1.7758919E+3 -2.7870101E-1 9.5924056E+4 6.4515997E+2 -5.7471571E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 14las/pia; S°: 14las/pia; Cp: 14las/pia; V°: 14las/pia;
Eskolaite
Cr2O3 + 6.000H+ = 2.000Cr+3 + 3.000H2O
log_k 7.752
delta_h -27.640 #kJ/mol #04chi
-analytic -9.2143736E+2 -1.4829777E-1 5.6819072E+4 3.2801756E+2 -2.5624398E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04chi; S°: 04chi; Cp: 98cha; V°: 82pan;
Ettringite
Ca6Al2(SO4)3(OH)12:26H2O + 12.000H+ = 2.000Al+3 + 6.000Ca+2 + 3.000SO4-2 + 38.000H2O
log_k 56.958
delta_h -379.834 #kJ/mol #63ber/new
-analytic -5.8739201E+3 -9.2601596E-1 3.359888E+5 2.1355777E+3 -1.816004E+7
#References = LogK/DGf: 10bbla/bou; DHf/DHr: 63ber/new; S°: Internal calculation; Cp: 79ede/sat; V°: 70moo/tay;
Ettringite(Cr)
Ca6Al2(OH)12(CrO4)3:26H2O + 12.000H+ = 2.000Al+3 + 6.000Ca+2 + 3.000CrO4-2 + 38.000H2O
log_k 60.228
delta_h -503.048 #kJ/mol #00per/pal
-analytic -5.6621419E+3 -8.8153945E-1 3.3100874E+5 2.04981E+3 -1.7523479E+7
#References = LogK/DGf: 00per/pal; DHf/DHr: 00per/pal; S°: Internal calculation; Cp: 00per/pal; V°: 70moo/tay;
Ettringite(Fe)
Ca6Fe2(SO4)3(OH)12:26H2O + 12.000H+ = 6.000Ca+2 + 2.000Fe+3 + 3.000SO4-2 + 38.000H2O
log_k 54.538
delta_h -146.584 #kJ/mol #Internal calculation
-analytic -5.8142211E+3 -9.0312797E-1 3.330148E+5 2.1116997E+3 -1.8149699E+7
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 98gla/tyr;
Farringtonite
Mg3(PO4)2 + 4.000H+ = 3.000Mg+2 + 2.000H2PO4-
log_k 15.820
delta_h -214.093 #kJ/mol #Internal calculation
-analytic -2.1864644E+3 -3.514523E-1 1.2767779E+5 7.9006441E+2 -6.767132E+6
#References = LogK/DGf: 68rac/sop; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 63oet/mdo; V°: 84nri;
Faustite
ZnAl6(PO4)4(OH)8:4H2O + 16.000H+ = 6.000Al+3 + 4.000H2PO4- + 1.000Zn+2 + 12.000H2O
log_k 19.620
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Fayalite
Fe2SiO4 + 4.000H+ = 2.000Fe+2 + 1.000H4SiO4
log_k 19.024
delta_h -159.491 #kJ/mol #Internal calculation
-analytic -6.8762518E+2 -1.1070573E-1 4.2630586E+4 2.4917955E+2 -1.7694972E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Fe(element)
Fe + 0.500O2 + 2.000H+ = 1.000Fe+2 + 1.000H2O
log_k 58.855
delta_h -369.763 #kJ/mol #By convention
-analytic -4.014146E+2 -6.2766612E-2 4.1333856E+4 1.43645E+2 -1.3415415E+6
#References = S°: 95par/kho; Cp: 98cha; V°: 04fab/sax;
Fe(OH)2
Fe(OH)2 + 2.000H+ = 1.000Fe+2 + 2.000H2O
log_k 12.849
delta_h -88.120 #kJ/mol #Internal calculation
-analytic -2.9086021E+2 -4.4441353E-2 1.9654273E+4 1.0510539E+2 -8.0336702E+5
#References = LogK/DGf: 53leu/kho; DHf/DHr: Internal calculation; S°: 04chi; Cp: 98cha; V°: 01mer/vie;
Fe10S11
Fe10S11 + 9.000H+ + 0.750H2O = 10.000Fe+2 + 10.500HS- + 0.250S2O3-2
log_k -59.393
delta_h -9307.558 #kJ/mol #05wal/pel
-analytic -1.0247541E+4 -1.6442491E+0 5.5479559E+5 3.713517E+3 -3.3003255E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla;
Fe11S12
Fe11S12 + 10.000H+ + 0.750H2O = 11.000Fe+2 + 11.500HS- + 0.250S2O3-2
log_k -64.318
delta_h -10183.030 #kJ/mol #05wal/pel
-analytic -1.1209127E+4 -1.7980662E+0 6.0722668E+5 4.0616032E+3 -3.6083435E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla;
Fe2(SO4)3
Fe2(SO4)3 = 2.000Fe+3 + 3.000SO4-2
log_k 0.038
delta_h -43.057 #kJ/mol #05maj/nav
-analytic -5.0254842E+3 -8.1193357E-1 2.8639722E+5 1.8156972E+3 -1.6516854E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05maj/nav; S°: 05maj/nav; Cp: 02hem/sea; V°: 95rob/hem;
Fe7.016S8
Fe7.016S8 + 6.032H+ + 0.738H2O = 7.016Fe+2 + 7.508HS- + 0.246S2O3-2
log_k -47.306
delta_h -6681.355 #kJ/mol #05wal/pel
-analytic -7.4502653E+3 -1.2023844E+0 4.0062256E+5 2.7021792E+3 -2.3877714E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla;
Fe9S10
Fe9S10 + 8.000H+ + 0.750H2O = 9.000Fe+2 + 9.500HS- + 0.250S2O3-2
log_k -55.459
delta_h -8430.205 #kJ/mol #05wal/pel
-analytic -9.2866178E+3 -1.490432E+0 5.0226629E+5 3.3654308E+3 -2.9923075E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 08bla;
FeCl2
FeCl2 = 2.000Cl- + 1.000Fe+2
log_k 8.981
delta_h -83.000 #kJ/mol #95par/kho
-analytic -1.5585132E+3 -2.5366E-1 8.9253296E+4 5.6618099E+2 -5.0857622E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95par/kho; S°: 95par/kho; Cp: 98cha; V°: 95rob/hem;
FeCl2:2H2O
FeCl2:2H2O = 2.000Cl- + 1.000Fe+2 + 2.000H2O
log_k 4.358
delta_h -44.808 #kJ/mol #08bla
-analytic -1.5686338E+3 -2.42868E-1 8.7303116E+4 5.6888852E+2 -4.8971831E+6
#References = LogK/DGf: 08bla; DHf/DHr: 08bla; S°: Internal calculation; V°: 63wyc;
FeCl2:4H2O
FeCl2:4H2O = 2.000Cl- + 1.000Fe+2 + 4.000H2O
log_k 3.029
delta_h -24.776 #kJ/mol #08bla
-analytic -1.6320501E+3 -2.4549264E-1 8.9188377E+4 5.9186788E+2 -4.9251642E+6
#References = LogK/DGf: 04chr; DHf/DHr: 08bla; S°: Internal calculation; V°: Default value;
FeCl2:H2O
FeCl2:H2O = 2.000Cl- + 1.000Fe+2 + 1.000H2O
log_k 6.113
delta_h -63.904 #kJ/mol #08bla
-analytic -1.6192509E+3 -2.5484279E-1 9.1072961E+4 5.8736481E+2 -5.1123546E+6
#References = LogK/DGf: 08bla; DHf/DHr: 08bla; S°: Internal calculation; V°: Default value;
FeCl3
FeCl3 + 0.500H2O = 2.500Cl- + 1.000Fe+2 + 0.500ClO- + 1.000H+
log_k -2.347
delta_h -55.698 #kJ/mol #95par/kho
-analytic -2.200554E+3 -3.5861983E-1 1.215657E+5 7.9976034E+2 -7.2500453E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95par/kho; S°: 95par/kho; Cp: 98cha; V°: 95rob/hem;
FeCl3:6H2O
FeCl3:6H2O = 3.000Cl- + 1.000Fe+3 + 6.000H2O
log_k 11.368
delta_h 44.382 #kJ/mol #08bla
-analytic -2.3364324E+3 -3.5441283E-1 1.2873391E+5 8.4914519E+2 -7.0635904E+6
#References = LogK/DGf: 95par/kho; DHf/DHr: 08bla; S°: Internal calculation; V°: 63wyc;
FeO
FeO + 2.000H+ = 1.000Fe+2 + 1.000H2O
log_k 13.357
delta_h -103.790 #kJ/mol #98cha
-analytic -3.1220383E+2 -4.834456E-2 2.1654221E+4 1.1211641E+2 -8.9588453E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem;
Ferricopiapite
Fe5(SO4)6O(OH):20H2O + 3.000H+ = 5.000Fe+3 + 6.000SO4-2 + 22.000H2O
log_k -20.520
delta_h 272.108 #kJ/mol #02hem/sea
-analytic -1.0564876E+4 -1.583506E+0 5.8318376E+5 3.8099321E+3 -3.262022E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam;
Ferrihydrite(2L)
Fe(OH)3 + 3.000H+ = 1.000Fe+3 + 3.000H2O
log_k 3.399
delta_h 19.492 #kJ/mol #04maj/nav
-analytic -4.163067E+2 -6.3721905E-2 2.4777197E+4 1.4849926E+2 -1.0534262E+6
#References = LogK/DGf: 04maj/nav; DHf/DHr: 04maj/nav; S°: Internal calculation; Cp: 98cha; V°: 92wol;
Ferrihydrite(6L)
Fe(OH)3 + 3.000H+ = 1.000Fe+3 + 3.000H2O
log_k 2.999
delta_h 22.692 #kJ/mol #04maj/nav
-analytic -4.1614608E+2 -6.3721905E-2 2.461005E+4 1.4849926E+2 -1.0534262E+6
#References = LogK/DGf: 04maj/nav; DHf/DHr: 04maj/nav; S°: Internal calculation; Cp: 98cha; V°: 92wol;
Ferrite(Mn)
MnFe2O4 + 8.000H+ = 2.000Fe+3 + 1.000Mn+2 + 4.000H2O
log_k 14.904
delta_h -36.045 #kJ/mol #91kna/kub
-analytic -1.2061025E+3 -1.8386208E-1 7.2608251E+4 4.313399E+2 -3.1136494E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 91kna/kub; S°: 91kna/kub; V°: 63wyc;
Ferrohexahydrite
FeSO4:6H2O = 1.000Fe+2 + 1.000SO4-2 + 6.000H2O
log_k -2.531
delta_h 5.080 #kJ/mol #02hem/sea
-analytic -1.6596043E+3 -2.3653238E-1 8.9825981E+4 5.9913096E+2 -4.9951813E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 63wyc;
Ferropargasite
Na(Ca2Fe4Al)(Al2Si6)O22(OH)2 + 22.000H+ = 3.000Al+3 + 2.000Ca+2 + 4.000Fe+2 + 1.000Na+ + 6.000H4SiO4
log_k 83.811
delta_h -825.949 #kJ/mol #Internal calculation
-analytic -3.6647161E+3 -6.0530059E-1 2.225286E+5 1.3277171E+3 -9.1308196E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Ferrosilite(alpha)
FeSiO3 + 2.000H+ + 1.000H2O = 1.000Fe+2 + 1.000H4SiO4
log_k 8.049
delta_h -70.171 #kJ/mol #78hel/del,85hel
-analytic -3.7441336E+2 -6.2278443E-2 2.1736171E+4 1.3661561E+2 -8.8174094E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,85hel; S°: 78hel/del,85hel; Cp: 78hel/del,85hel; V°: 78hel/del,85hel;
Ferrotremolite
(Ca2Fe5)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 2.000Ca+2 + 5.000Fe+2 + 8.000H4SiO4
log_k 53.666
delta_h -430.891 #kJ/mol #Internal calculation
-analytic -2.5808755E+3 -4.3515611E-1 1.4518028E+5 9.4661918E+2 -5.778156E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
FeS(am)
FeS + 1.000H+ = 1.000Fe+2 + 1.000HS-
log_k -2.990
delta_h -882.717 #kJ/mol #Internal calculation
-analytic -9.7855552E+2 -1.5384783E-1 5.3595946E+4 3.5415352E+2 -3.0807102E+6
#References = LogK/DGf: 08bla; DHf/DHr: Internal calculation; S°: 08bla; V°: 08bla;
FeSO4
FeSO4 = 1.000Fe+2 + 1.000SO4-2
log_k 1.105
delta_h -67.140 #kJ/mol #02hem/sea
-analytic -1.6665074E+3 -2.6803428E-1 9.4749217E+4 6.0286264E+2 -5.5121344E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; Cp: 98cha; V°: 01mer/vie;
Florencite
CeAl3(PO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 1.000Ce+3 + 2.000H2PO4- + 6.000H2O
log_k 16.571
delta_h -387.869 #kJ/mol #Internal calculation
-analytic -3.1500189E+3 -4.9720992E-1 1.8546506E+5 1.1308926E+3 -9.3817581E+6
#References = LogK/DGf: 93sch/got; DHf/DHr: Internal calculation; S°: 93sch/got; Cp: 93sch/got; V°: 93sch/got;
Florencite(La)
LaAl3(PO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 1.000La+3 + 2.000H2PO4- + 6.000H2O
log_k 18.168
#References = LogK/DGf: 93sch/got;
#References = LogK/DGf: 93sch/got; V°: Default value;
Fluorapatite(Natur)
Ca5(PO4)3F + 6.000H+ = 5.000Ca+2 + 1.000F- + 3.000H2PO4-
log_k -0.910
delta_h -115.601 #kJ/mol #Internal calculation
-analytic -3.767611E+3 -6.2227721E-1 2.0719688E+5 1.3699122E+3 -1.177547E+7
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 71par/wag; Cp: 60kel; V°: 95rob/hem;
Fluorapatite(Pp)
Ca5(PO4)3F + 6.000H+ = 5.000Ca+2 + 1.000F- + 3.000H2PO4-
log_k 11.013
#References = LogK/DGf: 84vie/tar,after 71aduf;
#References = LogK/DGf: 84vie/tar,after 71aduf; Cp: 60kel; V°: 95rob/hem;
Fluorapatite(Synth)
Ca5(PO4)3F + 6.000H+ = 5.000Ca+2 + 1.000F- + 3.000H2PO4-
log_k -0.950
#References = LogK/DGf: 68mca,80bal/nor;
#References = LogK/DGf: 68mca,80bal/nor; Cp: 60kel; V°: 95rob/hem;
Fluorite
CaF2 = 1.000Ca+2 + 2.000F-
log_k -10.510
delta_h 14.560 #kJ/mol #Internal calculation
-analytic -1.6496881E+3 -2.661154E-1 8.8753095E+4 5.9836998E+2 -5.314625E+6
#References = LogK/DGf: 04gar/muc; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Fluorphlogopite
KMg3(AlSi3)O10(F)2 + 8.000H+ + 2.000H2O = 1.000Al+3 + 2.000F- + 1.000K+ + 3.000Mg+2 + 3.000H4SiO4
log_k 24.004
delta_h -318.663 #kJ/mol #95rob/hem
-analytic -3.131917E+3 -5.049797E-1 1.7879822E+5 1.134626E+3 -8.9577879E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del,78rob/hem; Cp: 78hel/del,78rob/hem; V°: 78hel/del,78rob/hem;
Forsterite
Mg2SiO4 + 4.000H+ = 2.000Mg+2 + 1.000H4SiO4
log_k 28.604
delta_h -219.449 #kJ/mol #Internal calculation
-analytic -7.4523058E+2 -1.1637461E-1 4.8850021E+4 2.6925846E+2 -1.9178335E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Foshagite
Ca4Si3O9(OH)2:0.5H2O + 8.000H+ + 0.500H2O = 4.000Ca+2 + 3.000H4SiO4
log_k 65.960
delta_h -380.238 #kJ/mol #56new
-analytic -1.2585018E+3 -2.0240154E-1 8.1696099E+4 4.6241638E+2 -2.9709346E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 56new; S°: Internal calculation; Cp: 10abla/bou; V°: 63wyc;
Friedel_Salt
Ca4Al2Cl2O6:10H2O + 12.000H+ = 2.000Al+3 + 4.000Ca+2 + 2.000Cl- + 16.000H2O
log_k 74.925
delta_h -486.198 #kJ/mol #10bbla/bou
-analytic -3.0374795E+3 -4.7993293E-1 1.857898E+5 1.1044722E+3 -8.9418034E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: 10bbla/bou; S°: Internal calculation; Cp: 10bbla/bou; V°: 97tay;
Galena
PbS + 1.000H+ = 1.000Pb+2 + 1.000HS-
log_k -14.836
delta_h -785.832 #kJ/mol #98cha
-analytic -9.2559447E+2 -1.4783473E-1 4.6673934E+4 3.3654389E+2 -3.0637316E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 78hel/del;
Gallobeudantite
PbGa3(AsO4)(SO4)(OH)6 + 8.000H+ = 1.000H2AsO4- + 3.000Ga+3 + 1.000Pb+2 + 1.000SO4-2 + 6.000H2O
log_k -8.702
#References = LogK/DGf: 04gab/vie;
#References = LogK/DGf: 04gab/vie; V°: Default value;
GaOOH
GaOOH + 3.000H+ = 1.000Ga+3 + 2.000H2O
log_k 1.484
delta_h -42.093 #kJ/mol #Internal calculation
-analytic 1.0023293E+3 1.8221867E-1 -4.8673381E+4 -3.7313745E+2 2.7896611E+6
#References = LogK/DGf: 97ben/dia; DHf/DHr: Internal calculation; S°: 97ben/dia; Cp: 97ben/dia; V°: 97ben/dia;
Gaylussite
CaNa2(CO3)2:5H2O + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 2.000Na+ + 5.000H2O
log_k 11.222
delta_h 1.696 #kJ/mol #Internal calculation
-analytic -1.7413503E+3 -2.4392783E-1 9.3840709E+4 6.3322318E+2 -5.0058535E+6
#References = LogK/DGf: 99kon/kon; DHf/DHr: Internal calculation; S°: 99kon/kon; V°: 63wyc;
Gehlenite
Ca2(Al2Si)O7 + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 1.000H4SiO4 + 3.000H2O
log_k 55.231
delta_h -496.484 #kJ/mol #95rob/hem
-analytic -1.4208825E+3 -2.3883898E-1 9.5639504E+4 5.1235581E+2 -3.6663668E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Gibbsite
Al(OH)3 + 3.000H+ = 1.000Al+3 + 3.000H2O
log_k 7.734
delta_h -102.759 #kJ/mol #Internal calculation
-analytic -4.2700652E+2 -7.0855369E-2 2.6131397E+4 1.5366735E+2 -1.068398E+6
#References = LogK/DGf: 95pok/hel; DHf/DHr: Internal calculation; S°: 95pok/hel; Cp: 95pok/hel; V°: 78hel/del;
Gibbsite(am)
Al(OH)3 + 3.000H+ = 1.000Al+3 + 3.000H2O
log_k 10.574
delta_h -119.770 #kJ/mol #93bar
-analytic -4.4929247E+2 -6.6408411E-2 2.8481118E+4 1.6024593E+2 -1.1003056E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 93bar; S°: 93bar; V°: 78hel/del;
Gibbsite(mc)
Al(OH)3 + 3.000H+ = 1.000Al+3 + 3.000H2O
log_k 9.349
delta_h -102.510 #kJ/mol #90nor/plu
-analytic -4.474939E+2 -6.6408411E-2 2.7579567E+4 1.6024593E+2 -1.1003056E+6
#References = LogK/DGf: 90nor/plu; DHf/DHr: 90nor/plu; S°: Internal calculation; V°: 78hel/del;
Gismondine
Ca2Al4Si4O16:9H2O + 16.000H+ = 4.000Al+3 + 2.000Ca+2 + 4.000H4SiO4 + 9.000H2O
log_k 38.970
delta_h -477.047 #kJ/mol #08bla
-analytic -2.3623241E+3 -3.9758373E-1 1.3740107E+5 8.5707925E+2 -5.4934427E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 08bla; S°: 10vie; Cp: 10vie; V°: 97coo/alb;
Glaserite
Na2K6(SO4)4 = 6.000K+ + 2.000Na+ + 4.000SO4-2
log_k -7.610
delta_h 78.360 #kJ/mol #82wag/eva
-analytic -6.2606699E+3 -9.6072689E-1 3.4399118E+5 2.270977E+3 -2.0768704E+7
#References = LogK/DGf: 80har/wea; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: 63wyc;
Glauberite
Na2Ca(SO4)2 = 1.000Ca+2 + 2.000Na+ + 2.000SO4-2
log_k 1.970
delta_h -13.160 #kJ/mol #82wag/eva
-analytic -3.3021312E+3 -5.1053323E-1 1.8312356E+5 1.197834E+3 -1.08312E+7
#References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: 63wyc;
Glauconite
(K0.75Mg0.25Fe1.5Al0.25)(Al0.25Si3.75)O10(OH)2 + 7.000H+ + 3.000H2O = 0.500Al+3 + 1.250Fe+3 + 0.750K+ + 0.250Mg+2 + 3.750H4SiO4 + 0.250Fe+2
log_k 1.859
delta_h -6.061 #kJ/mol #15bla/vie
-analytic -1.2913768E+3 -2.1105467E-1 6.897738E+4 4.6834296E+2 -3.0289483E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Glaucophane
Na2(Mg3Al2)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 2.000Al+3 + 3.000Mg+2 + 2.000Na+ + 8.000H4SiO4
log_k 36.994
delta_h -397.394 #kJ/mol #95rob/hem
-analytic -2.9923592E+3 -4.5495579E-1 1.6325111E+5 1.0864375E+3 -6.2996903E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Goethite
FeOOH + 3.000H+ = 1.000Fe+3 + 2.000H2O
log_k 0.359
delta_h 38.222 #kJ/mol #03maj/gre
-analytic -4.5237594E+2 -7.4573572E-2 2.5358223E+4 1.6282127E+2 -1.1532226E+6
#References = LogK/DGf: 95par/kho; DHf/DHr: 03maj/gre; S°: Internal calculation; Cp: 03maj/gre; V°: 95rob/hem;
Gorceixite
BaAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 1.000Ba+2 + 2.000H2PO4- + 6.000H2O
log_k 13.698
#References = LogK/DGf: 89sch/her;
#References = LogK/DGf: 89sch/her; V°: Default value;
Goyazite
SrAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2PO4- + 1.000Sr+2 + 6.000H2O
log_k 16.840
delta_h -334.188 #kJ/mol #Internal calculation
-analytic -2.9263008E+3 -4.5868866E-1 1.7030224E+5 1.052665E+3 -8.5380877E+6
#References = LogK/DGf: 89sch/her; DHf/DHr: Internal calculation; S°: 04gab/vie; Cp: 04gab/vie; V°: 04gab/vie;
Greenalite
Fe3Si2O5(OH)4 + 6.000H+ = 3.000Fe+2 + 2.000H4SiO4 + 1.000H2O
log_k 21.762
delta_h -177.218 #kJ/mol #83miy/kle
-analytic -1.0283665E+3 -1.6538517E-1 5.965835E+4 3.7468953E+2 -2.4713913E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 83miy/kle; S°: 83miy/kle; Cp: 83miy/kle; V°: 78hel/del;
Greenockite
CdS + 1.000H+ = 1.000Cd+2 + 1.000HS-
log_k -14.820
delta_h -812.203 #kJ/mol #06deo/nav
-analytic -9.3407344E+2 -1.4889994E-1 4.7625858E+4 3.3842378E+2 -2.9777133E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 06deo/nav; S°: 06bla/pia; Cp: 99yun/glu; V°: 95rob/hem;
Greenrust(Cl)
Fe4(OH)8Cl + 8.000H+ = 1.000Cl- + 3.000Fe+2 + 1.000Fe+3 + 8.000H2O
log_k 32.314
#References = LogK/DGf: 04chi;
#References = LogK/DGf: 04chi; V°: Default value;
Greenrust(CO3)
Fe6(OH)12CO3:2H2O + 13.000H+ = 1.000HCO3- + 4.000Fe+2 + 2.000Fe+3 + 14.000H2O
log_k 45.318
#References = LogK/DGf: 04chi;
#References = LogK/DGf: 04chi; V°: Default value;
Greenrust(OH)
Fe3O2(OH)4 + 8.000H+ = 2.000Fe+3 + 1.000Fe+2 + 6.000H2O
log_k 17.169
#References = LogK/DGf: 04chi;
#References = LogK/DGf: 04chi; V°: Default value;
Greenrust(SO3)
Fe8(OH)16SO3:4H2O + 14.000H+ = 8.000Fe+2 + 1.000SO4-2 + 19.000H2O
log_k 89.151
#References = LogK/DGf: 04chi;
#References = LogK/DGf: 04chi; V°: Default value;
Greenrust2(SO4)
Fe6(OH)12SO4:2H2O + 12.000H+ = 4.000Fe+2 + 1.000SO4-2 + 2.000Fe+3 + 14.000H2O
log_k 37.483
#References = LogK/DGf: 04chi;
#References = LogK/DGf: 04chi; V°: Default value;
Greigite
Fe3S4 + 2.000H+ + 0.750H2O = 3.000Fe+2 + 3.500HS- + 0.250S2O3-2
log_k -21.888
delta_h -3219.517 #kJ/mol #08bla
-analytic -3.570201E+3 -5.6427322E-1 1.9194922E+5 1.2935617E+3 -1.1385836E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 08bla; S°: 08bla; V°: 90rob/cam;
Grossular
Ca3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Ca+2 + 3.000H4SiO4
log_k 49.356
delta_h -449.383 #kJ/mol #95rob/hem
-analytic -1.7898762E+3 -3.0785068E-1 1.0917507E+5 6.518296E+2 -4.2728457E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Grunerite
Fe7Si8O22(OH)2 + 14.000H+ + 8.000H2O = 7.000Fe+2 + 8.000H4SiO4
log_k 48.006
delta_h -409.914 #kJ/mol #95rob/hem
-analytic -2.6902892E+3 -4.4886859E-1 1.4998014E+5 9.8514049E+2 -6.0960086E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Guerinite
Ca5H2(AsO4)4:9H2O + 6.000H+ = 4.000H2AsO4- + 5.000Ca+2 + 9.000H2O
log_k 19.677
#References = LogK/DGf: 99bot/bro;
#References = LogK/DGf: 99bot/bro; V°: 00bla/bid;
Gypsum
CaSO4:2H2O = 1.000Ca+2 + 1.000SO4-2 + 2.000H2O
log_k -4.607
delta_h -1.054 #kJ/mol #CODATA87
-analytic -1.5780732E+3 -2.5084443E-1 8.6902239E+4 5.7206662E+2 -5.2231969E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: CODATA87; S°: CODATA87; Cp: 74nau/ryz; V°: 95rob/hem;
Gyrolite
Ca2Si3O7.5(OH):2H2O + 4.000H+ + 1.500H2O = 2.000Ca+2 + 3.000H4SiO4
log_k 22.340
delta_h -122.848 #kJ/mol #10abla/bou
-analytic -6.8755561E+2 -1.1318025E-1 3.8602432E+4 2.5449685E+2 -1.3839182E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 10abla/bou;
Halite
NaCl = 1.000Cl- + 1.000Na+
log_k 1.594
delta_h 3.700 #kJ/mol #78hel/del, 98cha
-analytic -7.5224954E+2 -1.1904958E-1 4.1385703E+4 2.7417933E+2 -2.4809109E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del, 98cha; S°: 98cha; Cp: 78hel/del; V°: 78hel/del;
Halloysite
Al2Si2O5(OH)4 + 6.000H+ = 2.000Al+3 + 2.000H4SiO4 + 1.000H2O
log_k 10.322
delta_h -192.418 #kJ/mol #06bla/pia
-analytic -1.0007791E+3 -1.6597303E-1 5.8190625E+4 3.6071492E+2 -2.4135956E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 06bla/pia; S°: 06bla/pia; Cp: 06bla/pia; V°: 78hel/del,78rob/hem;
Halotrichite
FeAl2(SO4)4:22H2O = 2.000Al+3 + 1.000Fe+2 + 4.000SO4-2 + 22.000H2O
log_k -8.268
delta_h -51.420 #kJ/mol #02hem/sea
-analytic -6.5973401E+3 -9.5997803E-1 3.6022096E+5 2.3813523E+3 -2.0036447E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam;
Hedenbergite
CaFe(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Ca+2 + 1.000Fe+2 + 2.000H4SiO4
log_k 19.962
delta_h -145.672 #kJ/mol #Internal calculation
-analytic -7.0088314E+2 -1.1895508E-1 4.0925244E+4 2.573353E+2 -1.5744594E+6
#References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Hellyerite
NiCO3:6H2O + 1.000H+ = 1.000HCO3- + 1.000Ni+2 + 6.000H2O
log_k 2.811
delta_h -8.036 #kJ/mol #Internal calculation
-analytic -7.2497477E+2 -1.1756105E-1 4.0155828E+4 2.6463372E+2 -2.3703872E+6
#References = LogK/DGf: 02wal/pre; DHf/DHr: Internal calculation; S°: 02wal/pre; Cp: 13bla/gab; V°: 02wal/pre;
Hematite
Fe2O3 + 6.000H+ = 2.000Fe+3 + 3.000H2O
log_k -0.048
delta_h 68.503 #kJ/mol #90hem
-analytic -8.7606837E+2 -1.4278141E-1 5.020992E+4 3.1370037E+2 -2.3152594E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 90hem; S°: 90hem; Cp: 90hem; V°: 78hel/del;
Hemicarboaluminate
Ca8Al4CO16:22H2O + 27.000H+ = 4.000Al+3 + 1.000HCO3- + 8.000Ca+2 + 35.000H2O
log_k 183.649
delta_h -1204.541 #kJ/mol #Internal calculation
-analytic -4.0960967E+3 -6.33474E-1 2.7433851E+5 1.485131E+3 -1.1234344E+7
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay;
Hemihydroxichloride(Ca)
Ca2(OH)2Cl2:H2O + 2.000H+ = 2.000Ca+2 + 2.000Cl- + 3.000H2O
log_k 26.529
#References = LogK/DGf: 84har/mol;
#References = LogK/DGf: 84har/mol; V°: Default value;
Heulandite(Ca)
Ca1.07Al2.14Si6.86O18:6.17H2O + 8.560H+ + 3.270H2O = 2.140Al+3 + 1.070Ca+2 + 6.860H4SiO4
log_k 2.461
delta_h -155.114 #kJ/mol #09bla
-analytic -1.628558E+3 -2.8912394E-1 7.9875598E+4 5.9919633E+2 -2.9650422E+6
#References = LogK/DGf: 09bla; DHf/DHr: 09bla; S°: Internal calculation; Cp: 10vie; V°: 97coo/alb;
Heulandite(Na)
Na2.14Al2.14Si6.86O18:6.17H2O + 8.560H+ + 3.270H2O = 2.140Al+3 + 2.140Na+ + 6.860H4SiO4
log_k 2.801
delta_h -142.782 #kJ/mol #09bla
-analytic -1.6826166E+3 -2.8483288E-1 8.32622E+4 6.1698675E+2 -3.1660021E+6
#References = LogK/DGf: 09bla; DHf/DHr: 09bla; S°: Internal calculation; Cp: 10vie; V°: 97coo/alb;
Hexahydrite
MgSO4:6H2O = 1.000Mg+2 + 1.000SO4-2 + 6.000H2O
log_k -1.642
delta_h -4.625 #kJ/mol #Internal calculation
-analytic -1.5635759E+3 -2.3958884E-1 8.6359372E+4 5.6613697E+2 -5.0804651E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 63wyc;
Hg(l)
Hg = 1.000Hg
log_k -6.502
delta_h -109.553 #kJ/mol #By convention
-analytic 1.6301862E+2 2.9252808E-2 -1.3987911E+4 -5.8730822E+1 1.24437E+6
#References = S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem;
Hg2SO4
Hg2SO4 = 1.000Hg2+2 + 1.000SO4-2
log_k -6.192
delta_h -105.593 #kJ/mol #89cox/wag
-analytic -1.5653551E+3 -2.5198692E-1 8.5552386E+4 5.6783708E+2 -5.1315194E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 77bar/kna; V°: 95rob/hem;
Hg3(OH)3PO4
Hg3(OH)3PO4 + 5.000H+ = 3.000Hg+2 + 1.000H2PO4- + 3.000H2O
log_k -2.189
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
Hg3(PO4)2
Hg3(PO4)2 + 4.000H+ = 3.000Hg+2 + 2.000H2PO4-
log_k -10.175
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
HgCO3.2HgO
HgCO3(HgO)2 + 5.000H+ = 1.000HCO3- + 3.000Hg+2 + 2.000H2O
log_k -0.871
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
HgHPO4
HgHPO4 + 1.000H+ = 1.000Hg+2 + 1.000H2PO4-
log_k -5.887
#References = LogK/DGf: 05pow/bro;
#References = LogK/DGf: 05pow/bro; V°: Default value;
HgO(cr)
HgO + 2.000H+ = 1.000Hg+2 + 1.000H2O
log_k 2.444
delta_h -24.830 #kJ/mol #89cox/wag
-analytic -2.6918944E+2 -4.062154E-2 1.509946E+4 9.7449556E+1 -7.1398761E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem;
Hilgenstockite
Ca4O(PO4)2 + 6.000H+ = 4.000Ca+2 + 2.000H2PO4- + 1.000H2O
log_k 23.593
#References = LogK/DGf: 84vie/tar,after 71bduf;
#References = LogK/DGf: 84vie/tar,after 71bduf; V°: Default value;
Hillebrandite
Ca2SiO3(OH)2:0.17H2O + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4 + 1.170H2O
log_k 36.950
delta_h -219.135 #kJ/mol #56new
-analytic -5.190987E+2 -8.4848571E-2 3.6710332E+4 1.9067891E+2 -1.2092747E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 56new; S°: Internal calculation; Cp: 10abla/bou; V°: 95dai/pos;
Hinsdalite
PbAl3(PO4)(SO4)(OH)6 + 8.000H+ = 3.000Al+3 + 1.000H2PO4- + 1.000Pb+2 + 1.000SO4-2 + 6.000H2O
log_k 6.683
#References = LogK/DGf: 78ric/nri;
#References = LogK/DGf: 78ric/nri; V°: 63wyc;
Hopeite(alpha)
Zn3(PO4)2:4H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 4.000H2O
log_k -10.611
delta_h -106.828 #kJ/mol #84vie/tar, after 78yag
-analytic -2.236721E+3 -3.2581228E-1 1.2372475E+5 8.0060834E+2 -6.4694289E+6
#References = LogK/DGf: 73bnri,76smi/mar; DHf/DHr: 84vie/tar, after 78yag; S°: Internal calculation; V°: 63wyc;
Hopeite(beta)
Zn3(PO4)2:4H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 4.000H2O
log_k 8.460
delta_h -117.328 #kJ/mol #79vol
-analytic -2.2194893E+3 -3.2581228E-1 1.242732E+5 8.0060834E+2 -6.4694289E+6
#References = LogK/DGf: 84vie/tar; DHf/DHr: 79vol; S°: Internal calculation; V°: 63wyc;
Huntite
CaMg3(CO3)4 + 4.000H+ = 4.000HCO3- + 1.000Ca+2 + 3.000Mg+2
log_k 42.027
delta_h -351.140 #kJ/mol #73hem/rob
-analytic -3.6441569E+3 -5.8648612E-1 2.1369929E+5 1.3223465E+3 -1.1357584E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 73hem/rob; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Hydrocalumnite(Cr)
(CaCrO4)Al2O3(CaO)3:15H2O + 12.000H+ = 2.000Al+3 + 4.000Ca+2 + 1.000CrO4-2 + 21.000H2O
log_k 71.313
delta_h -541.448 #kJ/mol #01per/pal
-analytic -3.5783207E+3 -5.0255465E-1 2.139394E+5 1.2884901E+3 -9.4556278E+6
#References = LogK/DGf: 01per/pal; DHf/DHr: 01per/pal; S°: Internal calculation; V°: Default value;
Hydrocerussite
Pb3(CO3)2(OH)2 + 4.000H+ = 2.000HCO3- + 3.000Pb+2 + 2.000H2O
log_k 2.747
delta_h -34.559 #kJ/mol #83san/bar
-analytic -2.0958245E+3 -3.1542372E-1 1.1585472E+5 7.5875556E+2 -6.5296475E+6
#References = LogK/DGf: 84tay/lop; DHf/DHr: 83san/bar; S°: Internal calculation; V°: 63wyc;
Hydromagnesite
Mg5(OH)2(CO3)4:4H2O + 6.000H+ = 4.000HCO3- + 5.000Mg+2 + 6.000H2O
log_k 30.992
delta_h -293.700 #kJ/mol #99kon/kon
-analytic -3.9533154E+3 -6.2370002E-1 2.2665545E+5 1.4330902E+3 -1.2092221E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 99kon/kon; S°: 99kon/kon; Cp: 78hel/del; V°: 78hel/del;
Hydrophilite
CaCl2 = 1.000Ca+2 + 2.000Cl-
log_k 11.642
delta_h -81.770 #kJ/mol #87gar/par
-analytic -1.5067301E+3 -2.4695275E-1 8.6378175E+4 5.4864605E+2 -4.9159323E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; Cp: 95rob/hem; V°: 95rob/hem;
Hydrotalcite
Mg4Al2O7:10H2O + 14.000H+ = 2.000Al+3 + 4.000Mg+2 + 17.000H2O
log_k 73.735
delta_h -584.221 #kJ/mol #Internal calculation
-analytic -2.1319886E+3 -3.089556E-1 1.4017778E+5 7.6446731E+2 -5.6842725E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay;
Hydrotalcite(CO3)
Mg4Al2(OH)12(CO3):2H2O + 13.000H+ = 2.000Al+3 + 1.000HCO3- + 4.000Mg+2 + 14.000H2O
log_k 61.185
delta_h -557.469 #kJ/mol #Internal calculation
-analytic -2.7259893E+3 -4.1336153E-1 1.7153982E+5 9.7916011E+2 -7.8046336E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay;
Hydroxichloride(Ca)
CaOHCl + 1.000H+ = 1.000Ca+2 + 1.000Cl- + 1.000H2O
log_k 13.193
delta_h -82.086 #kJ/mol #Internal calculation
-analytic -9.0785233E+2 -1.4800871E-1 5.3456912E+4 3.3079406E+2 -2.9022986E+6
#References = LogK/DGf: 97all/dol,06bod/las; DHf/DHr: Internal calculation; S°: 97all/dol,06bod/las; Cp: 97all/dol; V°: Default value;
Hydroxichloride(Ca:13H2O)
Ca4Cl2(OH)6:13H2O + 6.000H+ = 4.000Ca+2 + 2.000Cl- + 19.000H2O
log_k 68.724
delta_h -271.930 #kJ/mol #82wag/eva
-analytic -2.5144134E+3 -3.3619106E-1 1.4584355E+5 9.1581072E+2 -6.3916917E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value;
Hydroxichloride(Ca:H2O)
CaCl(OH):H2O + 1.000H+ = 1.000Ca+2 + 1.000Cl- + 2.000H2O
log_k 11.350
delta_h -63.609 #kJ/mol #Internal calculation
-analytic -9.0320997E+2 -1.463023E-1 5.2136315E+4 3.2952491E+2 -2.8511568E+6
#References = LogK/DGf: 06bod/las; DHf/DHr: Internal calculation; S°: 06bod/las; Cp: 06bod/las; V°: Default value;
Hydroxichloride(Mg:4H2O)
Mg2Cl(OH)3:4H2O + 3.000H+ = 1.000Cl- + 2.000Mg+2 + 7.000H2O
log_k 26.028
delta_h -154.690 #kJ/mol #82wag/eva
-analytic -1.3894413E+3 -1.917876E-1 8.1521697E+4 5.019129E+2 -3.7979984E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value;
Hydroxyapatite(Natur)
Ca5(PO4)3(OH) + 7.000H+ = 5.000Ca+2 + 3.000H2PO4- + 1.000H2O
log_k 14.335
delta_h -178.395 #kJ/mol #Internal calculation
-analytic -3.0691022E+3 -5.0928107E-1 1.7215888E+5 1.1170822E+3 -9.4486356E+6
#References = LogK/DGf: 06bla/pia; DHf/DHr: Internal calculation; S°: 71par/wag; Cp: 60kel; V°: 95rob/hem;
Illite(Al)
K0.85Al2.85Si3.15O10(OH)2 + 9.400H+ + 0.600H2O = 2.850Al+3 + 0.850K+ + 3.150H4SiO4
log_k 13.020
delta_h -266.373 #kJ/mol #15bla/vie
-analytic -1.5387534E+3 -2.5698564E-1 8.8502308E+4 5.5542116E+2 -3.8044185E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Illite(FeII)
K0.85Fe0.25Al2.35Si3.4O10(OH)2 + 8.400H+ + 1.600H2O = 2.350Al+3 + 0.250Fe+2 + 0.850K+ + 3.400H4SiO4
log_k 9.455
delta_h -216.501 #kJ/mol #15bla/vie
-analytic -1.4595683E+3 -2.4184666E-1 8.2260382E+4 5.2766954E+2 -3.5962958E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Illite(FeIII)
K0.85Fe0.25Al2.6Si3.15O10(OH)2 + 9.400H+ + 0.600H2O = 2.600Al+3 + 0.250Fe+3 + 0.850K+ + 3.150H4SiO4
log_k 12.366
delta_h -237.562 #kJ/mol #15bla/vie
-analytic -1.5384465E+3 -2.5637966E-1 8.82495E+4 5.5525367E+2 -3.7937089E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Illite(IMt2)
(Na0.044K0.762)(Si3.387Al0.613)(Al1.427Fe0.376Mg0.241)O10(OH)2 + 8.452H+ + 1.548H2O = 2.040Al+3 + 0.292Fe+3 + 0.762K+ + 0.241Mg+2 + 0.044Na+ + 3.387H4SiO4 + 0.084Fe+2
log_k 11.522
delta_h -201.933 #kJ/mol #12gai/bla
-analytic -1.4826764E+3 -2.515287E-1 8.2740664E+4 5.3786616E+2 -3.4878725E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla;
Illite(Mg)
K0.85Mg0.25Al2.35Si3.4O10(OH)2 + 8.400H+ + 1.600H2O = 2.350Al+3 + 0.850K+ + 0.250Mg+2 + 3.400H4SiO4
log_k 11.011
delta_h -225.651 #kJ/mol #15bla/vie
-analytic -1.4676871E+3 -2.4262682E-1 8.3182692E+4 5.3052138E+2 -3.6178935E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Ilmenite
FeTiO3 + 2.000H+ + 1.000H2O = 1.000Fe+2 + 1.000Ti(OH)4
log_k 1.817
delta_h -87.445 #kJ/mol #Internal calculation
-analytic -8.0200194E+2 -8.5185125E-2 4.4828449E+4 2.8202101E+2 -1.6872918E+6
#References = LogK/DGf: 95rob/hem; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Imogolite
Al2SiO3(OH)4 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 3.000H2O
log_k 13.079
delta_h -205.884 #kJ/mol #82far/fra
-analytic -9.9685396E+2 -1.5191817E-1 5.9250133E+4 3.5684713E+2 -2.355096E+6
#References = LogK/DGf: 96su/har; DHf/DHr: 82far/fra; S°: Internal calculation; V°: 90rob/cam;
Jacobsite
Mn(FeO2)2 + 8.000H+ = 2.000Fe+3 + 1.000Mn+2 + 4.000H2O
log_k 15.737
delta_h -38.555 #kJ/mol #73bar/kna
-analytic -1.1571204E+3 -1.8677406E-1 7.0158142E+4 4.1537986E+2 -3.0755137E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 73bar/kna; S°: 73bar/kna; Cp: 73bar/kna; V°: 73bar/kna;
Jadeite
NaAl(SiO3)2 + 4.000H+ + 2.000H2O = 1.000Al+3 + 1.000Na+ + 2.000H4SiO4
log_k 7.553
delta_h -100.168 #kJ/mol #95rob/hem
-analytic -7.347264E+2 -1.230073E-1 4.0419614E+4 2.6777329E+2 -1.7069016E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del;
Jaffeite
Ca6(Si2O7)(OH)6 + 12.000H+ = 6.000Ca+2 + 2.000H4SiO4 + 5.000H2O
log_k 114.057
delta_h -636.767 #kJ/mol #10abla/bou
-analytic -1.5349618E+3 -2.439677E-1 1.0904909E+5 5.6451902E+2 -3.6321747E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 95ant/bid;
Jarosite(Ag)
AgFe3(SO4)2(OH)6 + 6.000H+ = 1.000Ag+ + 3.000Fe+3 + 2.000SO4-2 + 6.000H2O
log_k -11.585
#References = LogK/DGf: 75kas/bor;
#References = LogK/DGf: 75kas/bor; V°: Default value;
Jarosite(Cr)
KFe3(CrO4)2(OH)6 + 6.000H+ = 2.000CrO4-2 + 3.000Fe+3 + 1.000K+ + 6.000H2O
log_k -17.953
delta_h 187.025 #kJ/mol #96bbar/pal
-analytic -4.3142513E+3 -6.6392259E-1 2.367507E+5 1.5553893E+3 -1.3203161E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 96bbar/pal; S°: 96bbar/pal; V°: Default value;
Jarosite(H)
(H3O)Fe3(SO4)2(OH)6 + 5.000H+ = 3.000Fe+3 + 2.000SO4-2 + 7.000H2O
log_k -5.148
delta_h 100.355 #kJ/mol #04maj/ste
-analytic -4.1136071E+3 -6.6032279E-1 2.3021634E+5 1.4862583E+3 -1.2841946E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 04maj/ste; S°: 04maj/ste; Cp: 04maj/ste; V°: 90rob/cam;
Jarosite(K)
KFe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 1.000K+ + 2.000SO4-2 + 6.000H2O
log_k -11.002
delta_h 193.445 #kJ/mol #03dro/nav
-analytic -4.0725038E+3 -6.6132758E-1 2.2330981E+5 1.4763122E+3 -1.2742552E+7
#References = LogK/DGf: 96abar/pal; DHf/DHr: 03dro/nav; S°: Internal calculation; Cp: 03dro/nav; V°: 76men/sab;
Jarosite(Na)
NaFe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 1.000Na+ + 2.000SO4-2 + 6.000H2O
log_k 6.730
delta_h 48.745 #kJ/mol #93sto
-analytic -4.1386952E+3 -6.6780193E-1 2.3397518E+5 1.4972138E+3 -1.2888144E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 93sto; S°: 93sto; Cp: 93sto; V°: 08bas/pet;
Jarosite(NH4)
NH4Fe3(SO4)2(OH)6 + 5.000H+ = 3.000Fe+3 + 1.000NH3 + 2.000SO4-2 + 6.000H2O
log_k -19.030
#References = LogK/DGf: 75kas/bor;
#References = LogK/DGf: 75kas/bor; V°: Default value;
Jarosite(Pb)
Pb0.5Fe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 0.500Pb+2 + 2.000SO4-2 + 6.000H2O
log_k -11.456
#References = LogK/DGf: 75kas/bor;
#References = LogK/DGf: 75kas/bor; V°: Default value;
Jennite
Ca9Si6H22O32 + 18.000H+ = 9.000Ca+2 + 6.000H4SiO4 + 8.000H2O
log_k 147.327
delta_h -751.765 #kJ/mol #10abla/bou
-analytic -2.6307573E+3 -4.0861633E-1 1.6862399E+5 9.7047348E+2 -5.9582818E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 92tay;
K(element)
K + 0.250O2 + 1.000H+ = 1.000K+ + 0.500H2O
log_k 70.991
delta_h -392.022 #kJ/mol #By convention
-analytic -9.1374135E+1 -1.3192528E-2 2.6268854E+4 3.3391282E+1 -3.9402402E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
K2CO3
K2CO3 + 1.000H+ = 1.000HCO3- + 2.000K+
log_k 15.735
delta_h -46.500 #kJ/mol #74nau/ryz
-analytic -7.2554552E+2 -1.1522314E-1 4.2944444E+4 2.6627093E+2 -2.4243191E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan;
K2O
K2O + 2.000H+ = 2.000K+ + 1.000H2O
log_k 84.105
delta_h -426.940 #kJ/mol #98cha
-analytic -1.2949969E+2 -1.849469E-2 3.0142621E+4 4.9758117E+1 -4.5365715E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem;
K2SO4.FeSO4:6H2O
K2Fe(SO4)2:6H2O = 1.000Fe+2 + 2.000K+ + 2.000SO4-2 + 6.000H2O
log_k -4.612
delta_h 152.806 #kJ/mol #Internal calculation
-analytic -3.3166296E+3 -4.9665326E-1 1.749773E+5 1.208945E+3 -1.0510546E+7
#References = LogK/DGf: 04chr; DHf/DHr: Internal calculation; S°: 78hel/del; V°: Default value;
Kainite
KMgClSO4:3H2O = 1.000Cl- + 1.000K+ + 1.000Mg+2 + 1.000SO4-2 + 3.000H2O
log_k -0.191
delta_h -12.950 #kJ/mol #82wag/eva
-analytic -2.4715831E+3 -3.750269E-1 1.3589053E+5 8.9538701E+2 -7.8359036E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: 95rob/hem;
Kalicinite
KHCO3 = 1.000HCO3- + 1.000K+
log_k 0.267
delta_h 20.250 #kJ/mol #74nau/ryz
-analytic -6.4282447E+2 -1.0327343E-1 3.4628329E+4 2.3515917E+2 -2.1465615E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; Cp: 74nau/ryz; V°: 90rob/cam;
Kalsilite(alpha)
K(AlSi)O4 + 4.000H+ = 1.000Al+3 + 1.000K+ + 1.000H4SiO4
log_k 11.202
delta_h -120.371 #kJ/mol #78hel/del
-analytic -6.0320192E+2 -1.0110047E-1 3.5920601E+4 2.1876915E+2 -1.5343817E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Kalsilite(beta)
K(AlSi)O4 + 4.000H+ = 1.000Al+3 + 1.000K+ + 1.000H4SiO4
log_k 10.633
#delta_h 0.000 #kJ/mol
-analytic -5.8442108E+2 -9.9203495E-2 3.5030038E+4 2.1219208E+2 -1.5925147E+6
#References = LogK/DGf: Internal calculation; V°: Default value;
Kaolinite
Al2Si2O5(OH)4 + 6.000H+ = 2.000Al+3 + 2.000H4SiO4 + 1.000H2O
log_k 6.471
delta_h -169.718 #kJ/mol #01fia/nav
-analytic -9.8589763E+2 -1.6937521E-1 5.5087963E+4 3.5699227E+2 -2.2447679E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 01fia/nav; S°: 91rob/hem; Cp: 91rob/hem; V°: 95rob/hem;
KatoiteSi1
Ca3Al2(SiO4)1(OH)8 + 12.000H+ = 2.000Al+3 + 3.000Ca+2 + 1.000H4SiO4 + 8.000H2O
log_k 71.157
delta_h -545.767 #kJ/mol #Internal calculation
-analytic -1.5900906E+3 -2.5746139E-1 1.073972E+5 5.7530205E+2 -4.0668066E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 10bbla/bou;
KCl.MgCl2:6H2O
KMgCl3:6H2O = 3.000Cl- + 1.000K+ + 1.000Mg+2 + 6.000H2O
log_k 4.388
#References = LogK/DGf: 93bal/chr;
#References = LogK/DGf: 93bal/chr; V°: 78hel/del;
KH2PO4
KH2PO4 = 1.000K+ + 1.000H2PO4-
log_k 0.278
delta_h 15.960 #kJ/mol #74nau/ryz
-analytic -6.8356427E+2 -1.1018905E-1 3.6862491E+4 2.4991571E+2 -2.2527827E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; Cp: 74nau/ryz; V°: Default value;
Kieserite
MgSO4:H2O = 1.000Mg+2 + 1.000SO4-2 + 1.000H2O
log_k -0.120
delta_h -51.464 #kJ/mol #Internal calculation
-analytic -1.675392E+3 -2.6430477E-1 9.4859468E+4 6.0553128E+2 -5.5499544E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 63wyc;
Kornelite
Fe2(SO4)3:7H2O = 2.000Fe+3 + 3.000SO4-2 + 7.000H2O
log_k -7.878
delta_h 63.133 #kJ/mol #02hem/sea
-analytic -5.0601867E+3 -7.7002704E-1 2.8197413E+5 1.8248979E+3 -1.5951453E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam;
Krausite(Cr)
KFe(CrO4)2:2H2O = 2.000CrO4-2 + 1.000Fe+3 + 1.000K+ + 2.000H2O
log_k -19.391
delta_h 126.422 #kJ/mol #98bar/pal
-analytic -3.0951955E+3 -5.1208975E-1 1.6928317E+5 1.1232185E+3 -1.0544992E+7
#References = LogK/DGf: 98bar/pal; DHf/DHr: 98bar/pal; S°: Internal calculation; Cp: 98bar/pal; V°: Default value;
Kyanite
Al2SiO5 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 1.000H2O
log_k 15.929
delta_h -242.655 #kJ/mol #Internal calculation
-analytic -9.485757E+2 -1.6240697E-1 5.8492435E+4 3.4098741E+2 -2.4009295E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
La2O3glass
La2O3 + 6.000H+ = 2.000La+3 + 3.000H2O
log_k 78.615
#References = LogK/DGf: 92plo/wic;
#References = LogK/DGf: 92plo/wic; V°: Default value;
Lanarkite
Pb2SO5 + 2.000H+ = 2.000Pb+2 + 1.000SO4-2 + 1.000H2O
log_k 2.630
delta_h -39.234 #kJ/mol #Internal calculation
-analytic -1.9604686E+3 -3.0210769E-1 1.1025931E+5 7.0955048E+2 -6.4337692E+6
#References = LogK/DGf: 74nau/ryz; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: 74nau/ryz;
Lansfordite
MgCO3:5H2O + 1.000H+ = 1.000HCO3- + 1.000Mg+2 + 5.000H2O
log_k 5.287
delta_h -11.810 #kJ/mol #99kon/kon
-analytic -9.2863008E+2 -1.2359468E-1 4.9906125E+4 3.3602233E+2 -2.4965615E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 99kon/kon; S°: 99kon/kon; V°: 63wyc;
Larnite(alpha)
Ca2SiO4 + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4
log_k 39.038
delta_h -240.494 #kJ/mol #95rob/hem
-analytic -5.3892335E+2 -9.1993849E-2 3.847885E+4 1.982105E+2 -1.25589E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del,60kel; Cp: 78hel/del,60kel; V°: 78hel/del,60kel;
Larnite(beta)
Ca2SiO4 + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4
log_k 39.317
#delta_h 0.000 #kJ/mol
-analytic -5.4348923E+2 -9.2133718E-2 3.9158937E+4 1.9957422E+2 -1.3242947E+6
#References = LogK/DGf: Internal calculation; V°: Default value;
Larnite(gamma)
Ca2SiO4 + 4.000H+ = 2.000Ca+2 + 1.000H4SiO4
log_k 41.439
#delta_h 0.000 #kJ/mol
-analytic -5.187959E+2 -9.0929534E-2 3.8574283E+4 1.9110002E+2 -1.3242947E+6
#References = LogK/DGf: Internal calculation; V°: Default value;
Laumontite
Ca(Al2Si4)O12:4H2O + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 4.000H4SiO4
log_k 11.673
delta_h -213.577 #kJ/mol #96kis/nav
-analytic -1.3452439E+3 -2.3274579E-1 7.3108028E+4 4.9030577E+2 -2.8556958E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 96kis/nav; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Laurelite
PbF2 = 2.000F- + 1.000Pb+2
log_k -7.522
delta_h 6.530 #kJ/mol #98cha
-analytic -1.6567833E+3 -2.6527112E-1 9.0348537E+4 6.007234E+2 -5.4339956E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 84pan;
Laurionite
PbClOH + 1.000H+ = 1.000Cl- + 1.000Pb+2 + 1.000H2O
log_k 0.620
delta_h 6.285 #kJ/mol #Internal calculation
-analytic -9.2015889E+2 -1.425926E-1 5.0121058E+4 3.3475251E+2 -2.9457123E+6
#References = LogK/DGf: 99lot/och; DHf/DHr: Internal calculation; S°: 78ric/nri; V°: 90rob/cam;
Laurite
RuS2 + 0.750H2O = 1.000Ru+2 + 1.500HS- + 0.250S2O3-2
log_k -70.816
delta_h -1168.171 #kJ/mol #Internal calculation
-analytic -1.6080494E+3 -2.6004134E-1 6.8333168E+4 5.8390348E+2 -5.2675697E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Leonhardtite
MgSO4:4H2O = 1.000Mg+2 + 1.000SO4-2 + 4.000H2O
log_k -0.891
delta_h -24.030 #kJ/mol #74nau/ryz
-analytic -1.7166655E+3 -2.5173008E-1 9.4720451E+4 6.1946915E+2 -5.3071504E+6
#References = LogK/DGf: 80har/wea; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 95rob/hem;
Leonite
K2Mg(SO4)2:4H2O = 2.000K+ + 1.000Mg+2 + 2.000SO4-2 + 4.000H2O
log_k -3.981
delta_h 15.290 #kJ/mol #74nau/ryz
-analytic -3.2370487E+3 -4.8641433E-1 1.7742068E+5 1.1719169E+3 -1.038381E+7
#References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 63wyc;
Lepidocrocite
FeOOH + 3.000H+ = 1.000Fe+3 + 2.000H2O
log_k 1.847
delta_h 27.622 #kJ/mol #03maj/gre
-analytic -4.3383044E+2 -6.9925424E-2 2.5170237E+4 1.5548345E+2 -1.1227055E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 03maj/gre; S°: 03maj/gre; Cp: 03maj/gre; V°: 63wyc;
Libenthenite
Cu2PO4OH + 3.000H+ = 2.000Cu+2 + 1.000H2PO4- + 1.000H2O
log_k 6.871
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Lime
CaO + 2.000H+ = 1.000Ca+2 + 1.000H2O
log_k 32.699
delta_h -193.910 #kJ/mol #89cox/wag
-analytic -2.2981557E+2 -3.8112701E-2 2.1667824E+4 8.4052037E+1 -6.0246011E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Linnaeite
Co3S4 + 2.000H+ + 0.750H2O = 3.000Co+2 + 3.500HS- + 0.250S2O3-2
log_k -49.968
delta_h -3058.828 #kJ/mol #95rob/hem
-analytic -3.5384953E+3 -5.7069446E-1 1.8185875E+5 1.2839328E+3 -1.1403739E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 87pan/mah; V°: 95rob/hem;
Litharge
PbO + 2.000H+ = 1.000Pb+2 + 1.000H2O
log_k 12.631
delta_h -65.501 #kJ/mol #98cha
-analytic -3.563847E+2 -5.7066663E-2 2.2379673E+4 1.3050539E+2 -1.0630718E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 97asho/sas;
Lizardite
Mg3Si2O5(OH)4 + 6.000H+ = 3.000Mg+2 + 2.000H4SiO4 + 1.000H2O
log_k 33.081
delta_h -247.218 #kJ/mol #04eva
-analytic -1.117212E+3 -1.7478888E-1 6.7935984E+4 4.0603359E+2 -2.680649E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 04eva; S°: 04eva; Cp: 95rob/hem; V°: 95rob/hem;
Loellingite
FeAs2 + 2.000H+ + 2.000H2O = 2.000AsH3 + 1.000Fe+2 + 1.000O2
log_k -119.076
delta_h -1215.463 #kJ/mol #Internal calculation
-analytic 1.411125E+2 2.2260988E-2 -4.8195613E+4 -4.7832872E+1 1.1718775E+6
#References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok;
Mackinawite
FeS + 1.000H+ = 1.000Fe+2 + 1.000HS-
log_k -3.540
delta_h -879.578 #kJ/mol #Internal calculation
-analytic -9.7649823E+2 -1.5351376E-1 5.3325403E+4 3.5340009E+2 -3.0749484E+6
#References = LogK/DGf: 08bla; DHf/DHr: Internal calculation; S°: 08bla; V°: 63wyc;
Maghemite(disordered)
Fe2O3 + 6.000H+ = 2.000Fe+3 + 3.000H2O
log_k 2.836
delta_h 50.373 #kJ/mol #03maj/gre
-analytic -8.8036566E+2 -1.4332938E-1 5.1397964E+4 3.1512919E+2 -2.3308743E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 03maj/gre; S°: 03maj/gre; Cp: 03maj/gre; V°: 63wyc;
Magnesiochromite
MgCr2O4 + 8.000H+ = 2.000Cr+3 + 1.000Mg+2 + 4.000H2O
log_k 22.175
delta_h -137.370 #kJ/mol #95rob/hem
-analytic -1.3008844E+3 -2.0539954E-1 8.2056835E+4 4.6453838E+2 -3.590453E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Magnesioferrite
MgFe2O4 + 8.000H+ = 2.000Fe+3 + 1.000Mg+2 + 4.000H2O
log_k 19.251
delta_h -72.516 #kJ/mol #73bar/kna
-analytic -1.3050893E+3 -2.030592E-1 8.091508E+4 4.6655307E+2 -3.6413273E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 73bar/kna; S°: 73bar/kna; Cp: 73bar/kna; V°: 73bar/kna;
Magnesite(Natur)
MgCO3 + 1.000H+ = 1.000HCO3- + 1.000Mg+2
log_k 1.415
delta_h -38.990 #kJ/mol #99kon/kon
-analytic -9.3271446E+2 -1.4911657E-1 5.2089668E+4 3.3809675E+2 -2.90857E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 99kon/kon; S°: 99kon/kon; Cp: 95rob/hem; V°: 78hel/del;
Magnesite(Synth)
MgCO3 + 1.000H+ = 1.000HCO3- + 1.000Mg+2
log_k 2.227
delta_h -43.630 #kJ/mol #95rob/hem
-analytic -9.3271499E+2 -1.4911657E-1 5.2332032E+4 3.3809675E+2 -2.90857E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del;
Magnetite
Fe3O4 + 8.000H+ = 2.000Fe+3 + 1.000Fe+2 + 4.000H2O
log_k 10.356
delta_h -17.831 #kJ/mol #90hem
-analytic -1.1631852E+3 -1.8861061E-1 6.9308057E+4 4.1714384E+2 -3.1005717E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 90hem; S°: 90hem; Cp: 90hem; V°: 78hel/del;
Magnetite(am)
Fe3O4 + 8.000H+ = 2.000Fe+3 + 1.000Fe+2 + 4.000H2O
log_k 14.589
delta_h -41.989 #kJ/mol #Internal calculation
-analytic -1.1631852E+3 -1.8861061E-1 7.0569905E+4 4.1714384E+2 -3.1005717E+6
#References = LogK/DGf: 98bre/lin; DHf/DHr: Internal calculation; S°: 90hem; Cp: 90hem; V°: 78hel/del;
Malachite
Cu2(OH)2(CO3) + 3.000H+ = 1.000HCO3- + 2.000Cu+2 + 2.000H2O
log_k 5.169
delta_h -65.926 #kJ/mol #Internal calculation
-analytic -1.2433609E+3 -1.9656033E-1 6.8823291E+4 4.514828E+2 -3.6325842E+6
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 78hel/del;
Manganosite
MnO + 2.000H+ = 1.000Mn+2 + 1.000H2O
log_k 18.356
delta_h -121.934 #kJ/mol #Internal calculation
-analytic -3.0659429E+2 -4.7374303E-2 2.2223817E+4 1.1078223E+2 -8.5224618E+5
#References = LogK/DGf: 78hel/del,82wag/eva; DHf/DHr: Internal calculation; S°: 78hel/del,82wag/eva; Cp: 78hel/del,82wag/eva; V°: 78hel/del,82wag/eva;
Mansfieldite
AlAsO4:2H2O + 2.000H+ = 1.000Al+3 + 1.000H2AsO4- + 2.000H2O
log_k -2.741
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Marcassite
FeS2 + 0.750H2O = 1.000Fe+2 + 1.500HS- + 0.250S2O3-2
log_k -22.861
delta_h -1413.782 #kJ/mol #76gro/wes
-analytic -1.6065259E+3 -2.5998313E-1 8.2303131E+4 5.8363906E+2 -5.2486093E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 76gro/wes; S°: 76gro/wes; Cp: 95rob/hem; V°: 95rob/hem;
Margarite
CaAl2(Al2Si2)O10(OH)2 + 14.000H+ = 4.000Al+3 + 1.000Ca+2 + 2.000H4SiO4 + 4.000H2O
log_k 36.984
delta_h -518.308 #kJ/mol #95rob/hem
-analytic -2.1229088E+3 -3.5998623E-1 1.3002189E+5 7.6440042E+2 -5.3630992E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Massicot
PbO + 2.000H+ = 1.000Pb+2 + 1.000H2O
log_k 12.742
delta_h -66.848 #kJ/mol #98cha
-analytic -3.4244788E+2 -5.404025E-2 2.1867688E+4 1.2514125E+2 -1.0396973E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 97asho/sas;
Melanterite
FeSO4:7H2O = 1.000Fe+2 + 1.000SO4-2 + 7.000H2O
log_k -2.321
delta_h 12.450 #kJ/mol #95par/kho
-analytic -1.6552153E+3 -2.3204983E-1 8.905843E+4 5.9755167E+2 -4.9092281E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95par/kho; S°: 95par/kho; V°: 95rob/hem;
Mercallite
KHSO4 = 1.000K+ + 1.000SO4-2 + 1.000H+
log_k -1.400
delta_h -0.590 #kJ/mol #74nau/ryz
-analytic -1.3844563E+3 -2.2459138E-1 7.7602064E+4 5.0277535E+2 -4.8309273E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; Cp: 74nau/ryz; V°: 63wyc;
Merlinoite(K)
K1.04Al1.04Si1.96O6:1.69H2O + 4.160H+ + 0.150H2O = 1.040Al+3 + 1.040K+ + 1.960H4SiO4
log_k 9.474
delta_h -105.628 #kJ/mol #09bla
-analytic -6.5093001E+2 -1.0679723E-1 3.6895381E+4 2.3667889E+2 -1.524412E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 09bla; V°: 97coo/alb;
Merlinoite(Na)
Na1.04Al1.04Si1.96O6:2.27H2O + 4.160H+ = 1.040Al+3 + 1.040Na+ + 1.960H4SiO4 + 0.430H2O
log_k 10.290
delta_h -115.307 #kJ/mol #09bla
-analytic -6.9150391E+2 -1.1117277E-1 3.9599453E+4 2.5078389E+2 -1.6379226E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 09bla; V°: 97coo/alb;
Merwinite
Ca3Mg(SiO4)2 + 8.000H+ = 3.000Ca+2 + 1.000Mg+2 + 2.000H4SiO4
log_k 69.275
delta_h -454.214 #kJ/mol #Internal calculation
-analytic -1.2658462E+3 -2.0682686E-1 8.6359915E+4 4.6180063E+2 -3.161213E+6
#References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Metacinnabar
HgS + 0.375H2O = 0.500Hg2+2 + 0.750HS- + 0.125S2O3-2
log_k -26.849
delta_h -665.454 #kJ/mol #Internal calculation
-analytic -7.4895143E+2 -1.2091262E-1 3.3202511E+4 2.7243241E+2 -2.4290831E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Mg(element)
Mg + 0.500O2 + 2.000H+ = 1.000Mg+2 + 1.000H2O
log_k 122.773
delta_h -746.763 #kJ/mol #89cox/wag
-analytic -4.08313E+2 -6.2313851E-2 6.1313219E+4 1.4516509E+2 -1.3496343E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Mg3(PO4)2:22H2O
Mg3(PO4)2:22H2O + 4.000H+ = 3.000Mg+2 + 2.000H2PO4- + 22.000H2O
log_k 15.993
#References = LogK/DGf: 63tay/fra;
#References = LogK/DGf: 63tay/fra; V°: 63wyc;
MgCl2.FeCl2:8H2O
MgFeCl4:8H2O = 4.000Cl- + 1.000Fe+2 + 1.000Mg+2 + 8.000H2O
log_k 8.587
#References = LogK/DGf: 04chr;
#References = LogK/DGf: 04chr; V°: Default value;
MgHPO4
MgHPO4 + 1.000H+ = 1.000Mg+2 + 1.000H2PO4-
log_k -5.815
#References = LogK/DGf: 70web/rac;
#References = LogK/DGf: 70web/rac; V°: Default value;
MgSO4
MgSO4 = 1.000Mg+2 + 1.000SO4-2
log_k 9.104
delta_h -114.550 #kJ/mol #98cha
-analytic -1.6958776E+3 -2.6892365E-1 9.92454E+4 6.1255125E+2 -5.6382589E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan;
Microcline
K(AlSi3)O8 + 4.000H+ + 4.000H2O = 1.000Al+3 + 1.000K+ + 3.000H4SiO4
log_k 0.004
delta_h -56.203 #kJ/mol #95rob/hem
-analytic -7.3677713E+2 -1.2898219E-1 3.6861528E+4 2.703714E+2 -1.547971E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Mimetite
Pb5(AsO4)3Cl + 6.000H+ = 3.000H2AsO4- + 1.000Cl- + 5.000Pb+2
log_k -19.800
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Minium
Pb3O4 + 6.000H+ = 3.000Pb+2 + 0.500O2 + 3.000H2O
log_k 30.530
delta_h -142.109 #kJ/mol #98cha
-analytic -7.3831714E+2 -1.1326585E-1 4.6892371E+4 2.7062221E+2 -2.1599093E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 82pan;
Minnesotaite
Fe3Si4O10(OH)2 + 6.000H+ + 4.000H2O = 3.000Fe+2 + 4.000H4SiO4
log_k 14.924
delta_h -148.467 #kJ/mol #83miy/kle
-analytic -1.1632242E+3 -1.9560839E-1 6.2685869E+4 4.2632471E+2 -2.550644E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 83miy/kle; S°: 83miy/kle; Cp: 83miy/kle; V°: 83miy/kle;
Mirabilite
Na2SO4:10H2O = 2.000Na+ + 1.000SO4-2 + 10.000H2O
log_k -1.233
delta_h 79.471 #kJ/mol #Internal calculation
-analytic -1.3776661E+3 -1.9982533E-1 7.3063678E+4 5.0163355E+2 -4.4718258E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 74nau/ryz; V°: 63wyc;
Mn3(PO4)2
Mn3(PO4)2 + 4.000H+ = 3.000Mn+2 + 2.000H2PO4-
log_k 0.817
#References = LogK/DGf: 76plu/jon;
#References = LogK/DGf: 76plu/jon; V°: Default value;
MnHPO4
MnHPO4 + 1.000H+ = 1.000Mn+2 + 1.000H2PO4-
log_k -4.119
#References = LogK/DGf: 69wag/eva;
#References = LogK/DGf: 69wag/eva; V°: Default value;
Monetite
CaHPO4 + 1.000H+ = 1.000Ca+2 + 1.000H2PO4-
log_k 0.300
delta_h -24.098 #kJ/mol #Internal calculation
-analytic -8.7069886E+2 -1.4527619E-1 4.7592739E+4 3.1728734E+2 -2.7042006E+6
#References = LogK/DGf: 84nan; DHf/DHr: Internal calculation; S°: 84nan; Cp: 70gre/mor, after 64a,bega/wak; V°: 84nri;
Monocarboaluminate
Ca4Al2CO9:10.68H2O + 13.000H+ = 2.000Al+3 + 1.000HCO3- + 4.000Ca+2 + 16.680H2O
log_k 80.545
delta_h -530.628 #kJ/mol #61ber/new
-analytic -2.3817751E+3 -3.6967084E-1 1.5167004E+5 8.6445012E+2 -6.6840807E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: 61ber/new; S°: Internal calculation; Cp: 10bbla/bou; V°: 97tay;
Monohydrocalcite
CaCO3:H2O + 1.000H+ = 1.000HCO3- + 1.000Ca+2 + 1.000H2O
log_k 2.727
delta_h -20.470 #kJ/mol #73hul/tur
-analytic -8.8143561E+2 -1.3428792E-1 4.8239049E+4 3.2006788E+2 -2.6295945E+6
#References = LogK/DGf: 73hul/tur; DHf/DHr: 73hul/tur; S°: Internal calculation; V°: 95rob/hem;
Monosulfate(Fe)
Ca4Fe2SO10:12H2O + 12.000H+ = 4.000Ca+2 + 2.000Fe+3 + 1.000SO4-2 + 18.000H2O
log_k 66.044
delta_h -279.843 #kJ/mol #Internal calculation
-analytic -3.0676685E+3 -4.7986154E-1 1.8792596E+5 1.1113267E+3 -9.1941407E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 97tay;
Monosulfoaluminate
Ca4Al2SO10:12H2O + 12.000H+ = 2.000Al+3 + 4.000Ca+2 + 1.000SO4-2 + 18.000H2O
log_k 73.064
delta_h -539.403 #kJ/mol #10bbla/bou
-analytic -3.1633795E+3 -5.130326E-1 1.93277E+5 1.1496646E+3 -9.2111182E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: 10bbla/bou; S°: Internal calculation; Cp: 79ede/sat; V°: 97tay;
Monteponite
CdO + 2.000H+ = 1.000Cd+2 + 1.000H2O
log_k 15.103
delta_h -103.400 #kJ/mol #89cox/wag
-analytic -2.8999212E+2 -4.4122592E-2 2.0465536E+4 1.0456389E+2 -8.1139219E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 77bar/kna; V°: 95rob/hem;
Monticellite
CaMgSiO4 + 4.000H+ = 1.000Ca+2 + 1.000Mg+2 + 1.000H4SiO4
log_k 30.086
delta_h -208.370 #kJ/mol #Internal calculation
-analytic -6.6777556E+2 -1.0740318E-1 4.4094085E+4 2.4286258E+2 -1.6850827E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Montmorillonite(HcCa)
Ca0.3Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.300Ca+2 + 0.600Mg+2 + 4.000H4SiO4
log_k 6.886
delta_h -163.897 #kJ/mol #15bla/vie
-analytic -1.1987196E+3 -1.994055E-1 6.5477183E+4 4.3491916E+2 -2.731862E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Montmorillonite(HcK)
K0.6Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.600K+ + 0.600Mg+2 + 4.000H4SiO4
log_k 4.433
delta_h -128.961 #kJ/mol #15bla/vie
-analytic -1.1640022E+3 -1.9321886E-1 6.2206019E+4 4.2325721E+2 -2.6596285E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Montmorillonite(HcMg)
Mg0.3Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.900Mg+2 + 4.000H4SiO4
log_k 5.980
delta_h -166.297 #kJ/mol #15bla/vie
-analytic -1.2259604E+3 -2.0260769E-1 6.7058294E+4 4.4417262E+2 -2.8128793E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Montmorillonite(HcNa)
Na0.6Mg0.6Al1.4Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.400Al+3 + 0.600Mg+2 + 0.600Na+ + 4.000H4SiO4
log_k 5.455
delta_h -144.991 #kJ/mol #15bla/vie
-analytic -1.1995138E+3 -1.9693447E-1 6.4864744E+4 4.3526999E+2 -2.7485531E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Montmorillonite(MgCa)
Ca0.17Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.170Ca+2 + 0.340Mg+2 + 4.000H4SiO4
log_k 4.206
delta_h -156.001 #kJ/mol #15bla/vie
-analytic -1.1681531E+3 -1.9703009E-1 6.3091915E+4 4.2391799E+2 -2.6192696E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Montmorillonite(MgK)
K0.34Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.340K+ + 0.340Mg+2 + 4.000H4SiO4
log_k 2.814
delta_h -136.199 #kJ/mol #15bla/vie
-analytic -1.1789485E+3 -1.9748246E-1 6.3047518E+4 4.2815749E+2 -2.690647E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Montmorillonite(MgMg)
Mg0.17Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.510Mg+2 + 4.000H4SiO4
log_k 3.692
delta_h -157.361 #kJ/mol #15bla/vie
-analytic -1.2140639E+3 -2.0280334E-1 6.5797701E+4 4.4001162E+2 -2.7774984E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Montmorillonite(MgNa)
Na0.34Mg0.34Al1.66Si4O10(OH)2 + 6.000H+ + 4.000H2O = 1.660Al+3 + 0.340Mg+2 + 0.340Na+ + 4.000H4SiO4
log_k 3.394
delta_h -145.287 #kJ/mol #15bla/vie
-analytic -1.1990748E+3 -1.9958851E-1 6.4554512E+4 4.3496584E+2 -2.7410469E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Moorhouseite
CoSO4:6H2O = 1.000Co+2 + 1.000SO4-2 + 6.000H2O
log_k -2.200
delta_h 1.570 #kJ/mol #74nau/ryz
-analytic -1.6642975E+3 -2.3740234E-1 9.0199421E+4 6.0079534E+2 -5.0029128E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 74nau/ryz; V°: 94pan;
MordeniteB(Ca)
Ca0.515Al1.03Si4.97O12:3.1H2O + 4.120H+ + 4.780H2O = 1.030Al+3 + 0.515Ca+2 + 4.970H4SiO4
log_k -2.918
delta_h -67.875 #kJ/mol #09bla
-analytic -8.7298564E+2 -1.4943245E-1 4.2359887E+4 3.1948275E+2 -1.5995946E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 09bla; S°: 09bla; Cp: 10vie; V°: 95rob/hem;
MordeniteJ
Ca0.289Na0.362Al0.94Si5.06O12:3.468H2O + 3.760H+ + 4.772H2O = 0.940Al+3 + 0.289Ca+2 + 0.362Na+ + 5.060H4SiO4
log_k -4.181
delta_h -41.249 #kJ/mol #92joh/tas
-analytic -7.9185479E+2 -1.432055E-1 3.5546154E+4 2.9294945E+2 -1.2210443E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 92joh/tas; S°: 92joh/tas; Cp: 92joh/tas; V°: 92joh/tas;
Mullite
Al6Si2O13 + 18.000H+ = 6.000Al+3 + 2.000H4SiO4 + 5.000H2O
log_k 50.493
delta_h -762.738 #kJ/mol #95rob/hem
-analytic -2.7906089E+3 -4.7256381E-1 1.7601823E+5 9.9958525E+2 -7.269678E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Muscovite(disordered)
KAl2(AlSi3)O10(OH)2 + 10.000H+ = 3.000Al+3 + 1.000K+ + 3.000H4SiO4
log_k 14.000
delta_h -276.123 #kJ/mol #95has/cyg
-analytic -1.5948808E+3 -2.7315468E-1 9.0610119E+4 5.7769416E+2 -3.8271104E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95has/cyg; S°: 76rob/hem; Cp: 76rob/hem; V°: 95rob/hem;
Muscovite(ordered)
KAl2(AlSi3)O10(OH)2 + 10.000H+ = 3.000Al+3 + 1.000K+ + 3.000H4SiO4
log_k 11.337
delta_h -260.923 #kJ/mol #06bla/pia
-analytic -1.5948808E+3 -2.7315468E-1 8.9816169E+4 5.7769416E+2 -3.8271104E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 06bla/pia; S°: 76rob/hem; Cp: 76rob/hem; V°: 95rob/hem;
Na(element)
Na + 0.250O2 + 1.000H+ = 1.000Na+ + 0.500H2O
log_k 67.389
delta_h -380.222 #kJ/mol #By convention
-analytic -1.6166581E+2 -2.1496048E-2 2.9333667E+4 5.802293E+1 -5.7739696E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Na2CO3
Na2CO3 + 1.000H+ = 1.000HCO3- + 2.000Na+
log_k 11.449
delta_h -41.410 #kJ/mol #95rob/hem
-analytic -8.4894412E+2 -1.2888968E-1 4.9145083E+4 3.0909826E+2 -2.7428307E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 98cha; V°: 95rob/hem;
Na2CO3:7H2O
Na2CO3:7H2O + 1.000H+ = 1.000HCO3- + 2.000Na+ + 7.000H2O
log_k 9.865
delta_h 27.981 #kJ/mol #Internal calculation
-analytic -9.4556051E+2 -1.1189443E-1 4.9158689E+4 3.4382997E+2 -2.3892135E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
Na2HPO4
Na2HPO4 + 1.000H+ = 2.000Na+ + 1.000H2PO4-
log_k 9.240
delta_h -35.180 #kJ/mol #82wag/eva
-analytic -8.4129375E+2 -1.2884853E-1 4.8346931E+4 3.0612801E+2 -2.7290688E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 67and/cou; Cp: 67and/cou; V°: 84nri;
Na2O
Na2O + 2.000H+ = 2.000Na+ + 1.000H2O
log_k 67.457
delta_h -351.710 #kJ/mol #95rob/hem
-analytic -2.4603552E+2 -3.0789283E-2 3.2197702E+4 9.0081382E+1 -7.3070451E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Na2SO4.FeSO4:4H2O
Na2Fe(SO4)2:4H2O = 1.000Fe+2 + 2.000Na+ + 2.000SO4-2 + 4.000H2O
log_k -3.211
#References = LogK/DGf: 04chr;
#References = LogK/DGf: 04chr; V°: Default value;
Na3PO4
Na3PO4 + 2.000H+ = 3.000Na+ + 1.000H2PO4-
log_k 23.521
delta_h -106.220 #kJ/mol #74nau/ryz
-analytic -1.0220022E+3 -1.5431706E-1 6.20248E+4 3.7196974E+2 -3.2813874E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 67and/cou; Cp: 67and/cou; V°: Default value;
NaFeS2
NaFeS2 + 0.875H+ + 0.500H2O = 1.000Fe+2 + 1.000Na+ + 1.875HS- + 0.125SO4-2
log_k -1.228
delta_h -1642.504 #kJ/mol #14las/pia
-analytic -1.8526615E+3 -2.9429281E-1 1.0215613E+5 6.7264478E+2 -6.0333541E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 14las/pia; S°: 14las/pia; Cp: 14las/pia; V°: Default value;
NaH2PO4
NaH2PO4 = 1.000Na+ + 1.000H2PO4-
log_k 2.301
delta_h -6.140 #kJ/mol #82wag/eva
-analytic -7.392466E+2 -1.1613447E-1 4.0935684E+4 2.6908589E+2 -2.3967257E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 67and/cou; Cp: 67and/cou; V°: Default value;
Nahcolite
NaHCO3 = 1.000HCO3- + 1.000Na+
log_k -0.413
delta_h 18.730 #kJ/mol #82van
-analytic -7.113399E+2 -1.1020638E-1 3.8282295E+4 2.5918806E+2 -2.3075365E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 82van; S°: Internal calculation; Cp: 74nau/ryz; V°: 95rob/hem;
Natrolite
Na2(Al2Si3)O10:2H2O + 8.000H+ = 2.000Al+3 + 2.000Na+ + 3.000H4SiO4
log_k 19.310
delta_h -222.463 #kJ/mol #83joh/flo
-analytic -1.3669751E+3 -2.2420689E-1 7.7495689E+4 4.9677472E+2 -3.2024942E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 83joh/flo; S°: 83joh/flo; Cp: 83joh/flo; V°: 95rob/hem;
Natron
Na2CO3:10H2O + 1.000H+ = 1.000HCO3- + 2.000Na+ + 10.000H2O
log_k 9.494
delta_h 50.170 #kJ/mol #Internal calculation
-analytic -7.6609055E+2 -1.0254428E-1 3.9588496E+4 2.8214483E+2 -2.2020231E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: Default value;
Nepheline
Na(AlSi)O4 + 4.000H+ = 1.000Al+3 + 1.000Na+ + 1.000H4SiO4
log_k 14.072
delta_h -146.839 #kJ/mol #Internal calculation
-analytic -6.5397549E+2 -1.0651874E-1 3.9974922E+4 2.3621216E+2 -1.6678377E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Nesquehonite(alpha)
MgCO3:3H2O + 1.000H+ = 1.000HCO3- + 1.000Mg+2 + 3.000H2O
log_k 5.230
delta_h -37.120 #kJ/mol #73rob/hem
-analytic -3.0437984E+3 -5.5905341E-1 1.4745539E+5 1.1325992E+3 -7.2359451E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 73rob/hem; S°: 72rob/hem; Cp: 78hel/del; V°: 78hel/del;
Nesquehonite(beta)
MgCO3:3H2O + 1.000H+ = 1.000HCO3- + 1.000Mg+2 + 3.000H2O
log_k 5.234
#delta_h 0.000 #kJ/mol
-analytic -8.9925534E+2 -1.4295598E-1 4.9951389E+4 3.2742572E+2 -2.7218608E+6
#References = LogK/DGf: Internal calculation; V°: Default value;
Newberyite
MgHPO4:3H2O + 1.000H+ = 1.000Mg+2 + 1.000H2PO4- + 3.000H2O
log_k 1.409
#References = LogK/DGf: 01wen/mus;
#References = LogK/DGf: 01wen/mus; V°: 84nri;
Ni(alpha)
Ni + 0.500O2 + 2.000H+ = 1.000Ni+2 + 1.000H2O
log_k 50.943
delta_h -339.263 #kJ/mol #By convention
-analytic -4.1473001E+2 -6.4641772E-2 4.0484895E+4 1.4748648E+2 -1.4033541E+6
#References = LogK/DGf: Internal calculation; S°: 78hel/del; Cp: 98cha; V°: 78hel/del;
Ni(OH)2
Ni(OH)2 + 2.000H+ = 1.000Ni+2 + 2.000H2O
log_k 11.669
delta_h -82.100 #kJ/mol #10pal/gam
-analytic -2.8702469E+2 -4.4717475E-2 1.9465037E+4 1.0360242E+2 -8.5488125E+5
#References = LogK/DGf: 10pal/gam; DHf/DHr: 10pal/gam; S°: Internal calculation; Cp: 10pal/gam; V°: 04roi;
Ni11As8
Ni11As8 + 22.000H+ + 1.000H2O = 11.000Ni+2 + 8.000AsH3 + 0.500O2
log_k -220.274
delta_h -6714.795 #kJ/mol #05gam/bug
-analytic -2.4255831E+3 -3.8274391E-1 6.7141507E+4 8.7082278E+2 -5.3836935E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value;
Ni2SiO4
Ni2SiO4 + 4.000H+ = 2.000Ni+2 + 1.000H4SiO4
log_k 19.539
delta_h -184.194 #kJ/mol #05gam/bug
-analytic -6.9873606E+2 -1.1255584E-1 4.4446169E+4 2.518723E+2 -1.8206855E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
Ni3(AsO3)2
Ni3(AsO3)2 + 4.000H+ = 2.000H2AsO3- + 3.000Ni+2
log_k 9.884
#References = LogK/DGf: 05gam/bug;
#References = LogK/DGf: 05gam/bug; V°: Default value;
Ni3(AsO4)2:8H2O
Ni3(AsO4)2:8H2O + 4.000H+ = 2.000H2AsO4- + 3.000Ni+2 + 8.000H2O
log_k 8.469
delta_h -105.439 #kJ/mol #05gam/bug
-analytic -2.2446255E+3 -3.1866456E-1 1.2358522E+5 8.0957576E+2 -6.1910121E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value;
Ni3S2
Ni3S2 + 0.500O2 + 4.000H+ = 3.000Ni+2 + 2.000HS- + 1.000H2O
log_k 25.555
delta_h -2011.209 #kJ/mol #05gam/bug
-analytic -2.3504102E+3 -3.7511244E-1 1.4187564E+5 8.4774022E+2 -7.6205178E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
Ni5As2
Ni5As2 + 1.000O2 + 10.000H+ = 5.000Ni+2 + 2.000AsH3 + 2.000H2O
log_k 49.270
delta_h -2383.191 #kJ/mol #05gam/bug
-analytic -1.5496486E+3 -2.4367911E-1 1.0569359E+5 5.5318165E+2 -4.5992316E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value;
Ni9S8
Ni9S8 + 0.94444O2 + 10.000H+ = 9.000Ni+2 + 7.55556HS- + 0.22222S2O3-2 + 1.22222H2O
log_k -1.648
delta_h -7135.846 #kJ/mol #05gam/bug
-analytic -8.3823657E+3 -1.3426882E+0 4.7476695E+5 3.028456E+3 -2.7117226E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value;
NiAs
NiAs + 2.000H+ + 0.500H2O = 1.000Ni+2 + 1.000AsH3 + 0.250O2
log_k -42.628
delta_h -734.181 #kJ/mol #05gam/bug
-analytic -1.4944256E+2 -2.3326378E-2 -5.4186675E+3 5.407394E+1 -1.6526547E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
NiCl2
NiCl2 = 2.000Cl- + 1.000Ni+2
log_k 8.596
delta_h -88.760 #kJ/mol #05gam/bug
-analytic -1.5673252E+3 -2.5504315E-1 9.0038911E+4 5.6886531E+2 -5.1247117E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
NiCl2:2H2O
NiCl2:2H2O = 2.000Cl- + 1.000Ni+2 + 2.000H2O
log_k 4.854
delta_h -51.950 #kJ/mol #05gam/bug
-analytic -1.5470522E+3 -2.526637E-1 8.7238394E+4 5.6248998E+2 -5.0852286E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value;
NiCl2:4H2O
NiCl2:4H2O = 2.000Cl- + 1.000Ni+2 + 4.000H2O
log_k 3.752
delta_h -22.930 #kJ/mol #05gam/bug
-analytic -1.6345803E+3 -2.4643027E-1 8.9410607E+4 5.9315464E+2 -4.960435E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value;
NiCl2:6H2O
NiCl2:6H2O = 2.000Cl- + 1.000Ni+2 + 6.000H2O
log_k 2.973
delta_h -3.940 #kJ/mol #05gam/bug
-analytic -1.6430787E+3 -2.4019684E-1 8.8524833E+4 5.9615668E+2 -4.8356414E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; V°: Default value;
NiCO3
NiCO3 + 1.000H+ = 1.000HCO3- + 1.000Ni+2
log_k -0.736
delta_h -36.110 #kJ/mol #05gam/bug
-analytic -9.0950143E+2 -1.4698566E-1 5.0789886E+4 3.2922265E+2 -2.8802076E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
NiF2
NiF2 = 2.000F- + 1.000Ni+2
log_k -0.251
delta_h -72.900 #kJ/mol #05gam/bug
-analytic -1.6994674E+3 -2.7223057E-1 9.5943543E+4 6.1436795E+2 -5.4783313E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
NiFe2O4
NiFe2O4 + 8.000H+ = 2.000Fe+3 + 1.000Ni+2 + 4.000H2O
log_k 10.775
delta_h -32.557 #kJ/mol #95rob/hem
-analytic -1.2929494E+3 -2.0482446E-1 7.7838533E+4 4.6240384E+2 -3.5972475E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 04roi;
NiS(alpha)
NiS + 1.000H+ = 1.000Ni+2 + 1.000HS-
log_k -9.577
delta_h -856.473 #kJ/mol #05gam/bug
-analytic -9.6861471E+2 -1.5550177E-1 5.1788758E+4 3.502687E+2 -3.1127422E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
NiS2
NiS2 + 0.750H2O = 1.000Ni+2 + 1.500HS- + 0.250S2O3-2
log_k -25.240
delta_h -1421.882 #kJ/mol #05gam/bug
-analytic -1.6261379E+3 -2.6362351E-1 8.3925229E+4 5.8937261E+2 -5.3650359E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: Default value;
NiSO4
NiSO4 = 1.000Ni+2 + 1.000SO4-2
log_k 4.675
delta_h -95.560 #kJ/mol #05gam/bug
-analytic -1.6659996E+3 -2.682593E-1 9.6195258E+4 6.0221288E+2 -5.5221017E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
NiSO4:6H2O
NiSO4:6H2O = 1.000Ni+2 + 1.000SO4-2 + 6.000H2O
log_k -2.324
#delta_h 0.000 #kJ/mol #05gam/bug
-analytic -1.5559677E+3 -2.3857695E-1 8.565653E+4 5.6347689E+2 -5.0495434E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
NiSO4:7H2O
NiSO4:7H2O = 1.000Ni+2 + 1.000SO4-2 + 7.000H2O
log_k -2.340
delta_h 7.680 #kJ/mol #05gam/bug
-analytic -1.5364265E+3 -2.3369079E-1 8.4172504E+4 5.5657337E+2 -4.9566292E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05gam/bug; S°: 05gam/bug; Cp: 05gam/bug; V°: 04roi;
Nontronite(Ca)
Ca0.17Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 0.170Ca+2 + 1.670Fe+3 + 3.660H4SiO4
log_k -2.823
delta_h 19.205 #kJ/mol #15bla/vie
-analytic -1.3317176E+3 -2.2163408E-1 7.0818391E+4 4.8167577E+2 -3.0603286E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Nontronite(K)
K0.34Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 1.670Fe+3 + 0.340K+ + 3.660H4SiO4
log_k -3.993
delta_h 37.737 #kJ/mol #15bla/vie
-analytic -1.3151921E+3 -2.1853713E-1 6.9217702E+4 4.7618789E+2 -3.0309959E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Nontronite(Mg)
Mg0.17Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 1.670Fe+3 + 0.170Mg+2 + 3.660H4SiO4
log_k -3.369
delta_h 18.025 #kJ/mol #15bla/vie
-analytic -1.3483125E+3 -2.2359928E-1 7.177371E+4 4.8733175E+2 -3.1105062E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Nontronite(Na)
Na0.34Fe1.67Al0.67Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.670Al+3 + 1.670Fe+3 + 0.340Na+ + 3.660H4SiO4
log_k -3.494
delta_h 29.119 #kJ/mol #15bla/vie
-analytic -1.3348437E+3 -2.2058158E-1 7.0671984E+4 4.828274E+2 -3.0796478E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Nontronite(Nau2)
Ca0.247K0.02(Si3.458Al0.542)(Fe1.688Al0.276Mg0.068)O10(OH)2 + 8.168H+ + 1.832H2O = 0.818Al+3 + 0.247Ca+2 + 1.688Fe+3 + 0.020K+ + 0.068Mg+2 + 3.458H4SiO4
log_k 1.333
delta_h -20.610 #kJ/mol #13gai/bla
-analytic -1.4070522E+3 -2.4147754E-1 7.5390615E+4 5.1030382E+2 -3.1284309E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 13gai/bla; S°: 13gai/bla; Cp: 09gai; V°: 13gai/bla;
Okenite
CaSi2O4(OH)2:H2O + 2.000H+ + 1.000H2O = 1.000Ca+2 + 2.000H4SiO4
log_k 9.180
delta_h -43.858 #kJ/mol #10abla/bou
-analytic -3.6163465E+2 -5.9241274E-2 1.8698583E+4 1.3453134E+2 -6.3352334E+5
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 92wol;
Olivenite
Cu2AsO4(OH) + 3.000H+ = 1.000H2AsO4- + 2.000Cu+2 + 1.000H2O
log_k 2.390
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Orpiment
As2S3 + 6.000H2O = 2.000H2AsO3- + 3.000HS- + 5.000H+
log_k -65.102
delta_h -2660.246 #kJ/mol #Internal calculation
-analytic -2.6864123E+3 -4.4185309E-1 1.2663353E+5 9.7924806E+2 -8.424208E+6
#References = LogK/DGf: 96pok/gou; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou;
Otavite
CdCO3 + 1.000H+ = 1.000HCO3- + 1.000Cd+2
log_k -1.773
delta_h -13.219 #kJ/mol #Internal calculation
-analytic -8.8925809E+2 -1.4348726E-1 4.8437856E+4 3.2294406E+2 -2.7823266E+6
#References = LogK/DGf: 91rai/fel; DHf/DHr: Internal calculation; S°: 96arc; Cp: 96arc; V°: 95rob/hem;
P(element)
P + 1.500H2O = 1.000PH3 + 0.750O2
log_k -68.934
delta_h -858.688 #kJ/mol #89cox/wag
-analytic 2.9803538E+2 4.5927419E-2 -4.0364308E+4 -1.0553155E+2 1.4090701E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Paragonite
NaAl2(AlSi3)O10(OH)2 + 10.000H+ = 3.000Al+3 + 1.000Na+ + 3.000H4SiO4
log_k 16.788
delta_h -301.623 #kJ/mol #96rou/hov
-analytic -1.7189083E+3 -2.8796471E-1 9.88627E+4 6.2129445E+2 -4.2123891E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 96rou/hov; S°: 84rob/hem; Cp: 84rob/hem; V°: 78hel/del;
Pargasite
Na(Ca2Mg4Al)(Al2Si6)O22(OH)2 + 22.000H+ = 3.000Al+3 + 2.000Ca+2 + 4.000Mg+2 + 1.000Na+ + 6.000H4SiO4
log_k 104.525
delta_h -954.614 #kJ/mol #Internal calculation
-analytic -3.7898861E+3 -6.1724725E-1 2.3589446E+5 1.3713915E+3 -9.4377388E+6
#References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Pb(element)
Pb + 0.500O2 + 2.000H+ = 1.000Pb+2 + 1.000H2O
log_k 47.241
delta_h -278.843 #kJ/mol #By convention
-analytic -3.4851073E+2 -5.4260243E-2 3.4467602E+4 1.2550095E+2 -1.2640441E+6
#References = S°: 89cox/wag; Cp: 98cha; V°: 95rob/hem;
Pb(H2PO4)2
Pb(H2PO4)2 = 2.000H2PO4- + 1.000Pb+2
log_k -9.840
#References = LogK/DGf: 74nri;
#References = LogK/DGf: 74nri; V°: Default value;
Pb(OH)2
Pb(OH)2 + 2.000H+ = 1.000Pb+2 + 2.000H2O
log_k 13.512
delta_h -56.140 #kJ/mol #52lat
-analytic -3.1323007E+2 -4.1680642E-2 1.987237E+4 1.1410949E+2 -8.7469124E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 52lat; S°: 52lat; V°: Default value;
Pb2SiO4
Pb2SiO4 + 4.000H+ = 2.000Pb+2 + 1.000H4SiO4
log_k 15.890
delta_h -81.473 #kJ/mol #98cha
-analytic -6.1988421E+2 -9.8786517E-2 3.6726559E+4 2.2708664E+2 -1.7659193E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan;
Pb3(PO4)2
Pb3(PO4)2 + 4.000H+ = 2.000H2PO4- + 3.000Pb+2
log_k -5.480
delta_h -2.292 #kJ/mol #Internal calculation
-analytic -2.0146304E+3 -3.2440995E-1 1.1078819E+5 7.3123239E+2 -6.6758142E+6
#References = LogK/DGf: 74nri; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz, 68,69,71,76wag/eva, 71par/wag, 60kel; V°: 82wag/eva,60kel;
Pb4O(PO4)2
Pb4O(PO4)2 + 6.000H+ = 2.000H2PO4- + 4.000Pb+2 + 1.000H2O
log_k 4.487
#References = LogK/DGf: 78ric/nri;
#References = LogK/DGf: 78ric/nri; V°: Default value;
PbHPO4
PbHPO4 + 1.000H+ = 1.000H2PO4- + 1.000Pb+2
log_k -4.225
delta_h 16.293 #kJ/mol #Internal calculation
-analytic -9.3895881E+2 -1.4495725E-1 5.0201844E+4 3.4060483E+2 -2.9538797E+6
#References = LogK/DGf: 74nri; DHf/DHr: Internal calculation; S°: 74nau/ryz; V°: Default value;
Pd(element)
Pd + 0.500O2 + 2.000H+ = 1.000Pd+2 + 1.000H2O
log_k 12.061
delta_h -101.834 #kJ/mol #By convention
-analytic -4.0254437E+2 -6.3293533E-2 2.7215174E+4 1.4428338E+2 -1.3176827E+6
#References = LogK/DGf: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Pd(OH)2(s)
Pd(OH)2 + 2.000H+ = 1.000Pd+2 + 2.000H2O
log_k -0.619
delta_h -8.148 #kJ/mol #Internal calculation
-analytic -2.9836756E+2 -4.5415203E-2 1.5670217E+4 1.0813703E+2 -7.8648826E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Pd4S(s)
Pd4S + 1.500O2 + 7.000H+ = 4.000Pd+2 + 1.000HS- + 3.000H2O
log_k -8.841
delta_h -943.649 #kJ/mol #Internal calculation
-analytic -2.1800032E+3 -3.4582882E-1 1.2200829E+5 7.8564141E+2 -7.0194654E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
PdO(s)
PdO + 2.000H+ = 1.000Pd+2 + 1.000H2O
log_k 0.108
delta_h -22.551 #kJ/mol #Internal calculation
-analytic -3.1519711E+2 -4.9219882E-2 1.7411899E+4 1.1373825E+2 -8.7627206E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
PdS2
PdS2 + 0.750H2O = 1.000Pd+2 + 1.500HS- + 0.250S2O3-2
log_k -55.401
delta_h -1234.203 #kJ/mol #Internal calculation
-analytic -1.6072739E+3 -2.6032605E-1 7.2743482E+4 5.8368459E+2 -5.2254574E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Pentahydrite
MgSO4:5H2O = 1.000Mg+2 + 1.000SO4-2 + 5.000H2O
log_k -1.282
delta_h -14.187 #kJ/mol #Internal calculation
-analytic -1.7010546E+3 -2.4539809E-1 9.3233829E+4 6.1371887E+2 -5.1892999E+6
#References = LogK/DGf: 80har/wea; DHf/DHr: Internal calculation; S°: 99yun/glu; V°: 63wyc;
Periclase
MgO + 2.000H+ = 1.000Mg+2 + 1.000H2O
log_k 21.584
delta_h -151.230 #kJ/mol #89cox/wag
-analytic -3.4024528E+2 -5.1189336E-2 2.5596794E+4 1.2206444E+2 -9.6015047E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Philipsbornite
PbAl3(AsO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2AsO4- + 1.000Pb+2 + 6.000H2O
log_k 8.935
#References = LogK/DGf: 93sch/got;
#References = LogK/DGf: 93sch/got; V°: Default value;
Phillipsite(Ca)
Ca0.5AlSi3O8:3H2O + 4.000H+ + 1.000H2O = 1.000Al+3 + 0.500Ca+2 + 3.000H4SiO4
log_k 2.320
delta_h -83.633 #kJ/mol #Internal calculation
-analytic -7.1271357E+2 -1.1918398E-1 3.7005583E+4 2.5968106E+2 -1.4323028E+6
#References = LogK/DGf: 09bla; DHf/DHr: Internal calculation; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Phillipsite(K)
KAlSi3O8:3H2O + 4.000H+ + 1.000H2O = 1.000Al+3 + 1.000K+ + 3.000H4SiO4
log_k 0.040
delta_h -46.436 #kJ/mol #Internal calculation
-analytic -6.6986016E+2 -1.115838E-1 3.3550705E+4 2.4501332E+2 -1.3893971E+6
#References = LogK/DGf: 09bla; DHf/DHr: Internal calculation; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Phillipsite(Na)
NaAlSi3O8:3H2O + 4.000H+ + 1.000H2O = 1.000Al+3 + 1.000Na+ + 3.000H4SiO4
log_k 1.450
delta_h -64.833 #kJ/mol #Internal calculation
-analytic -7.3533029E+2 -1.1744576E-1 3.7864057E+4 2.6754934E+2 -1.5319008E+6
#References = LogK/DGf: 09bla; DHf/DHr: Internal calculation; S°: 09bla; Cp: 10vie; V°: 97coo/alb;
Phlogopite
KMg3(AlSi3)O10(OH)2 + 10.000H+ = 1.000Al+3 + 1.000K+ + 3.000Mg+2 + 3.000H4SiO4
log_k 41.082
delta_h -360.123 #kJ/mol #92cir/nav
-analytic -1.737548E+3 -2.7905657E-1 1.0458653E+5 6.3029339E+2 -4.317962E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 92cir/nav; S°: 84rob/hem; Cp: 84rob/hem; V°: 78hel/del;
Phlogopite(Na)
NaMg3AlSi3O10(OH)2 + 10.000H+ = 1.000Al+3 + 3.000Mg+2 + 1.000Na+ + 3.000H4SiO4
log_k 44.180
delta_h -391.183 #kJ/mol #98hol/pow
-analytic -1.7916703E+3 -2.8509243E-1 1.0894649E+5 6.4882848E+2 -4.448331E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow;
Phosgenite
Pb2(CO3)Cl2 + 1.000H+ = 1.000HCO3- + 2.000Cl- + 2.000Pb+2
log_k -9.573
delta_h 49.187 #kJ/mol #Internal calculation
-analytic -2.4536545E+3 -3.8655339E-1 1.3191468E+5 8.9165001E+2 -7.950751E+6
#References = LogK/DGf: 78ric/nri; DHf/DHr: Internal calculation; S°: 78ric/nri; V°: 90rob/cam;
Picromerite
K2Mg(SO4)2:6H2O = 2.000K+ + 1.000Mg+2 + 2.000SO4-2 + 6.000H2O
log_k -4.332
delta_h 33.490 #kJ/mol #74nau/ryz
-analytic -3.2232732E+3 -4.7661095E-1 1.7543746E+5 1.1668677E+3 -1.0197446E+7
#References = LogK/DGf: 84har/mol; DHf/DHr: 74nau/ryz; S°: Internal calculation; V°: 63wyc;
Pirssonite
Na2Ca(CO3)2:2H2O + 2.000H+ = 2.000HCO3- + 1.000Ca+2 + 2.000Na+ + 2.000H2O
log_k 11.743
delta_h -19.823 #kJ/mol #Internal calculation
-analytic -1.7610201E+3 -2.5863522E-1 9.6514317E+4 6.4080213E+2 -5.28544E+6
#References = LogK/DGf: 99kon/kon; DHf/DHr: Internal calculation; S°: 99kon/kon; V°: 63wyc;
Plattnerite
PbO2 + 2.000H+ = 1.000Pb+2 + 0.500O2 + 1.000H2O
log_k 6.559
delta_h -16.236 #kJ/mol #98cha
-analytic -1.6824063E+2 -2.5792997E-2 9.0502903E+3 6.306036E+1 -3.4699132E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 82pan;
Plumbogummite
PbAl3(PO4)2(OH)5:H2O + 9.000H+ = 3.000Al+3 + 2.000H2PO4- + 1.000Pb+2 + 6.000H2O
log_k 9.643
#References = LogK/DGf: 04gab/vie;
#References = LogK/DGf: 04gab/vie; V°: 63wyc;
Plumbonacrite
Pb10O(OH)6(CO3)6 + 14.000H+ = 6.000HCO3- + 10.000Pb+2 + 7.000H2O
log_k 19.869
#References = LogK/DGf: 84tay/lop;
#References = LogK/DGf: 84tay/lop; V°: 90rob/cam;
Polyhalite
K2MgCa2(SO4)4:2H2O = 2.000Ca+2 + 2.000K+ + 1.000Mg+2 + 4.000SO4-2 + 2.000H2O
log_k -13.741
#References = LogK/DGf: 84har/mol;
#References = LogK/DGf: 84har/mol; V°: 63wyc;
Portlandite
Ca(OH)2 + 2.000H+ = 1.000Ca+2 + 2.000H2O
log_k 22.809
delta_h -130.107 #kJ/mol #Internal calculation
-analytic -2.0860029E+2 -3.3878824E-2 1.7101262E+4 7.6713764E+1 -5.0406986E+5
#References = LogK/DGf: 10abla/bou; DHf/DHr: Internal calculation; S°: 98cha; Cp: 99aki/zot; V°: 95rob/hem;
Prehnite
Ca2Al2Si3O10(OH)2 + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 3.000H4SiO4
log_k 32.580
delta_h -346.617 #kJ/mol #98cha/kru
-analytic -1.544913E+3 -2.6559065E-1 9.1401453E+4 5.6198408E+2 -3.5980949E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha/kru; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
Pseudomalachite
Cu5(PO4)2(OH)4 + 8.000H+ = 5.000Cu+2 + 2.000H2PO4- + 4.000H2O
log_k 22.032
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Pt(element)
Pt + 0.500O2 + 2.000H+ = 1.000Pt+2 + 1.000H2O
log_k -2.159
delta_h -24.919 #kJ/mol #By convention
-analytic -4.0433584E+2 -6.3684693E-2 2.3285215E+4 1.4468282E+2 -1.3282862E+6
#References = S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
PtS2
PtS2 + 0.750H2O = 1.000Pt+2 + 1.500HS- + 0.250S2O3-2
log_k -74.386
delta_h -1125.026 #kJ/mol #Internal calculation
-analytic -1.6095798E+3 -2.6094168E-1 6.7194472E+4 5.8460093E+2 -5.238904E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Pyrite
FeS2 + 0.750H2O = 1.000Fe+2 + 1.500HS- + 0.250S2O3-2
log_k -23.590
delta_h -1409.332 #kJ/mol #05wal/pel
-analytic -1.6076974E+3 -2.6014632E-1 8.2137475E+4 5.8407864E+2 -5.2522406E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 95rob/hem; Cp: 05wal/pel; V°: 78hel/del;
Pyromorphite
Pb5(PO4)3OH + 7.000H+ = 3.000H2PO4- + 5.000Pb+2 + 1.000H2O
log_k -18.120
#References = LogK/DGf: 74nri;
#References = LogK/DGf: 74nri; V°: 90rob/cam;
Pyromorphite(Br)
Pb5(PO4)3Br + 6.000H+ = 1.000Br- + 3.000H2PO4- + 5.000Pb+2
log_k -19.420
#References = LogK/DGf: 74nri;
#References = LogK/DGf: 74nri; V°: 90rob/cam;
Pyromorphite(Cl)
Pb5(PO4)3Cl + 6.000H+ = 1.000Cl- + 3.000H2PO4- + 5.000Pb+2
log_k -25.720
#References = LogK/DGf: 74nri;
#References = LogK/DGf: 74nri; V°: 63wyc;
Pyromorphite(F)
Pb5(PO4)3F + 6.000H+ = 1.000F- + 3.000H2PO4- + 5.000Pb+2
log_k -12.920
#References = LogK/DGf: 74nri;
#References = LogK/DGf: 74nri; V°: 90rob/cam;
Pyrope(alpha)
Mg3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Mg+2 + 3.000H4SiO4
log_k 58.914
delta_h -576.383 #kJ/mol #95rob/hem
-analytic -2.1679284E+3 -3.5264264E-1 1.3716134E+5 7.8170939E+2 -5.5422373E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 78hel/del,78rob/hem; Cp: 78hel/del,78rob/hem; V°: 78hel/del,78rob/hem;
Pyrophyllite
Al2Si4O10(OH)2 + 6.000H+ + 4.000H2O = 2.000Al+3 + 4.000H4SiO4
log_k -0.453
delta_h -138.257 #kJ/mol #95rob/hem
-analytic -1.1628481E+3 -2.049586E-1 6.032886E+4 4.2383278E+2 -2.4523429E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 76rob/hem; Cp: 76rob/hem; V°: 95rob/hem;
Pyroxene(CaAl)
CaAl(AlSi)O6 + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 1.000H4SiO4 + 2.000H2O
log_k 36.226
delta_h -373.125 #kJ/mol #Internal calculation
-analytic -1.1777159E+3 -2.0014945E-1 7.6772081E+4 4.2429487E+2 -3.0017509E+6
#References = LogK/DGf: 78hel/del,92ajoh; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Pyrrhotite
FeS + 1.000H+ = 1.000Fe+2 + 1.000HS-
log_k -3.679
delta_h -878.782 #kJ/mol #05wal/pel
-analytic -1.1321875E+3 -1.8235847E-1 6.1305101E+4 4.1103816E+2 -3.5403698E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 78hel/del;
Quartz(alpha)
SiO2 + 2.000H2O = 1.000H4SiO4
log_k -3.737
delta_h 21.166 #kJ/mol #82ric/bot
-analytic -7.5895338E+1 -1.5422139E-2 1.5615589E+3 2.9087273E+1 -4.0514987E+4
#References = LogK/DGf: Internal calculation; DHf/DHr: 82ric/bot; S°: 82ric/bot; Cp: 82ric/bot; V°: 95rob/hem;
Quartz(beta)
SiO2 + 2.000H2O = 1.000H4SiO4
log_k -3.505
#delta_h 0.000 #kJ/mol
-analytic -6.8943854E+1 -1.453455E-2 1.2544854E+3 2.6568692E+1 -1.5788328E+4
#References = LogK/DGf: Internal calculation; Cp: 89cox/wag; V°: Default value;
Realgar
AsS + 0.250O2 + 2.500H2O = 1.000H2AsO3- + 1.000HS- + 2.000H+
log_k -7.796
delta_h -1038.630 #kJ/mol #Internal calculation
-analytic -1.0561353E+3 -1.7430394E-1 5.555984E+4 3.8460823E+2 -3.3538562E+6
#References = LogK/DGf: 11bla/las; DHf/DHr: Internal calculation; S°: 96pok/gou; Cp: 96pok/gou; V°: 96pok/gou;
Rh(element)
Rh + 0.500O2 + 2.000H+ = 1.000Rh+2 + 1.000H2O
log_k 22.693
delta_h -169.367 #kJ/mol #98sas/sho
-analytic -4.00915E+2 -6.26122E-2 3.0841492E+4 1.4305812E+2 -1.3471779E+6
#References = LogK/DGf: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Rh2O(s)
Rh2O + 0.6666675O2 + 4.66667H+ = 1.33333Rh+2 + 0.66667Rh+3 + 2.333335H2O
log_k 32.167
delta_h -249.665 #kJ/mol #Internal calculation
-analytic -8.796417E+2 -1.3844947E-1 6.2594662E+4 3.1309903E+2 -2.808935E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: Default value;
Rh2O3(s)
Rh2O3 + 6.000H+ = 2.000Rh+3 + 3.000H2O
log_k 12.338
delta_h -71.137 #kJ/mol #Internal calculation
-analytic -9.8681214E+2 -1.5763916E-1 6.2099093E+4 3.5176997E+2 -2.8946162E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Rhodochrosite
MnCO3 + 1.000H+ = 1.000HCO3- + 1.000Mn+2
log_k 0.230
delta_h -22.001 #kJ/mol #Internal calculation
-analytic -8.9448498E+2 -1.447547E-1 4.9048099E+4 3.251749E+2 -2.7786486E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Riebeckite
Na2(Fe3Fe2)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 3.000Fe+2 + 2.000Na+ + 8.000H4SiO4 + 2.000Fe+3
log_k 9.166
delta_h -18.281 #kJ/mol #98hol/pow
-analytic -2.6589261E+3 -4.3918913E-1 1.3789391E+5 9.7129313E+2 -5.9436999E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 95rob/hem; V°: 78hel/del;
Rockbridgite(Zn)
ZnFe4(PO4)3(OH)5 + 11.000H+ = 4.000Fe+3 + 3.000H2PO4- + 1.000Zn+2 + 5.000H2O
log_k 1.839
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: Default value;
Romarchite
SnO + 2.000H+ = 1.000Sn+2 + 1.000H2O
log_k 2.227
delta_h -13.896 #kJ/mol #89cox/wag
-analytic -2.8999155E+2 -4.4343041E-2 1.6701032E+4 1.0507711E+2 -9.4067746E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Romerite
Fe3(SO4)4:14H2O = 2.000Fe+3 + 4.000SO4-2 + 1.000Fe+2 + 14.000H2O
log_k -11.647
delta_h 100.783 #kJ/mol #02hem/sea
-analytic -6.7194301E+3 -1.0032128E+0 3.7007859E+5 2.4250113E+3 -2.0880272E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam;
Rozenite
FeSO4:4H2O = 1.000Fe+2 + 1.000SO4-2 + 4.000H2O
log_k -1.701
delta_h -14.960 #kJ/mol #02cho/sea
-analytic -1.6785167E+3 -2.4719535E-1 9.2179494E+4 6.0611872E+2 -5.1963711E+6
#References = LogK/DGf: 02cho/sea; DHf/DHr: 02cho/sea; S°: Internal calculation; V°: 90rob/cam;
Ru(element)
Ru + 0.500O2 + 2.000H+ = 1.000Ru+2 + 1.000H2O
log_k 16.680
delta_h -157.113 #kJ/mol #Internal calculation
-analytic -4.0063587E+2 -6.2340836E-2 2.8922728E+4 1.4307729E+2 -1.3458802E+6
#References = DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
RuO2(s)
RuO2 + 3.000H+ = 1.000Ru+3 + 0.250O2 + 1.500H2O
log_k -13.123
delta_h 137.924 #kJ/mol #Internal calculation
-analytic -4.0222737E+2 -6.5437289E-2 1.886713E+4 1.4401895E+2 -9.8061537E+5
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Rutile
TiO2 + 2.000H2O = 1.000Ti(OH)4
log_k -8.858
delta_h 0.300 #kJ/mol #89cox/wag
-analytic -5.1540942E+2 -3.9727872E-2 2.5679554E+4 1.7881056E+2 -9.0572332E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
S(alpha)
S + 1.000H2O = 1.000HS- + 0.500O2 + 1.000H+
log_k -45.139
delta_h -605.310 #kJ/mol #By convention
-analytic -5.602288E+2 -9.1663496E-2 1.6254771E+4 2.0503514E+2 -1.7286101E+6
#References = S°: 89cox/wag; Cp: 11par/cor; V°: 11par/cor;
S(beta)
S + 1.000H2O = 1.000HS- + 0.500O2 + 1.000H+
log_k -45.127
#delta_h 0.000 #kJ/mol
-analytic -5.5963535E+2 -9.1584791E-2 1.6243004E+4 2.0480187E+2 -1.727504E+6
#References = LogK/DGf: Internal calculation; Cp: 11par/cor; V°: Default value;
S(gamma)
S + 1.000H2O = 1.000HS- + 0.500O2 + 1.000H+
log_k -45.088
#delta_h 0.000 #kJ/mol
-analytic -5.4308374E+2 -9.0096285E-2 1.5209283E+4 1.9901195E+2 -1.6530806E+6
#References = LogK/DGf: Internal calculation; Cp: 11par/cor; V°: Default value;
Sanidine
K(AlSi3)O8 + 4.000H+ + 4.000H2O = 1.000Al+3 + 1.000K+ + 3.000H4SiO4
log_k 0.609
delta_h -65.203 #kJ/mol #95rob/hem
-analytic -7.3894518E+2 -1.2927442E-1 3.7405984E+4 2.7081817E+2 -1.5543047E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 06bla/pia; V°: 78hel/del;
Saponite(Ca)
Ca0.17Mg3Al0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 0.170Ca+2 + 3.000Mg+2 + 3.660H4SiO4
log_k 29.339
delta_h -271.306 #kJ/mol #15bla/vie
-analytic -1.4679336E+3 -2.3033044E-1 8.6526936E+4 5.3180788E+2 -3.5727334E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(FeCa)
Ca0.17Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 0.170Ca+2 + 1.000Fe+2 + 2.000Mg+2 + 3.660H4SiO4
log_k 26.553
delta_h -259.176 #kJ/mol #15bla/vie
-analytic -1.4361908E+3 -2.2719356E-1 8.4109896E+4 5.2035792E+2 -3.4860626E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(FeK)
K0.34Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 1.000Fe+2 + 0.340K+ + 2.000Mg+2 + 3.660H4SiO4
log_k 25.382
delta_h -240.633 #kJ/mol #15bla/vie
-analytic -1.4165116E+3 -2.2368667E-1 8.2321435E+4 5.1374712E+2 -3.445111E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(FeMg)
Mg0.17Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 1.000Fe+2 + 2.170Mg+2 + 3.660H4SiO4
log_k 26.005
delta_h -260.346 #kJ/mol #15bla/vie
-analytic -1.451627E+3 -2.2900755E-1 8.4995879E+4 5.2560124E+2 -3.5319625E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(FeNa)
Na0.34Mg2FeAl0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 1.000Fe+2 + 2.000Mg+2 + 0.340Na+ + 3.660H4SiO4
log_k 25.707
delta_h -248.261 #kJ/mol #15bla/vie
-analytic -1.4366339E+3 -2.2579273E-1 8.3752012E+4 5.2055425E+2 -3.4955109E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(K)
K0.33Mg3Al0.33Si3.67O10(OH)2 + 7.320H+ + 2.680H2O = 0.330Al+3 + 0.330K+ + 3.000Mg+2 + 3.670H4SiO4
log_k 27.414
delta_h -248.047 #kJ/mol #15bla/vie
-analytic -1.4433778E+3 -2.2608265E-1 8.4228204E+4 5.2345354E+2 -3.5162809E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(Mg)
Mg0.17Mg3Al0.34Si3.66O10(OH)2 + 7.360H+ + 2.640H2O = 0.340Al+3 + 3.170Mg+2 + 3.660H4SiO4
log_k 28.794
delta_h -272.486 #kJ/mol #15bla/vie
-analytic -1.4833657E+3 -2.3214443E-1 8.7413286E+4 5.3705E+2 -3.6186332E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(Na)
Na0.33Mg3Al0.33Si3.67O10(OH)2 + 7.320H+ + 2.680H2O = 0.330Al+3 + 3.000Mg+2 + 0.330Na+ + 3.670H4SiO4
log_k 27.955
delta_h -256.783 #kJ/mol #15bla/vie
-analytic -1.4629424E+3 -2.2812926E-1 8.5687579E+4 5.3006983E+2 -3.5652414E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Saponite(SapCa)
(Na0.394K0.021Ca0.038)(Si3.569Al0.397)(Mg2.949Fe0.055)O10(OH)2 + 7.724H+ + 2.276H2O = 0.397Al+3 + 0.038Ca+2 + 0.034Fe+3 + 0.021K+ + 2.949Mg+2 + 0.394Na+ + 3.569H4SiO4 + 0.021Fe+2
log_k 31.457
delta_h -282.138 #kJ/mol #13gai/bla
-analytic -1.4992947E+3 -2.4230547E-1 8.7573079E+4 5.4512257E+2 -3.5199312E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 13gai/bla; S°: 13gai/bla; Cp: 09gai; V°: 13gai/bla;
Sb(element)
Sb + 0.750O2 + 1.500H2O = 1.000Sb(OH)3
log_k 52.747
delta_h -316.199 #kJ/mol #Internal calculation
-analytic -7.3243948E+1 -1.7339271E-2 1.9544135E+4 2.7218361E+1 -1.5472902E+5
#References = DHf/DHr: Internal calculation; S°: 94aki/zot; Cp: 94aki/zot; V°: 94aki/zot;
Scholzite
CaZn2(PO4)2:2H2O + 4.000H+ = 1.000Ca+2 + 2.000H2PO4- + 2.000Zn+2 + 2.000H2O
log_k 7.440
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Schultenite
PbHAsO4 + 1.000H+ = 1.000H2AsO4- + 1.000Pb+2
log_k -5.410
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Schwertmannite
Fe8O8(OH)6SO4:8H2O + 22.000H+ = 8.000Fe+3 + 1.000SO4-2 + 22.000H2O
log_k 8.953
#References = LogK/DGf: 04maj/nav;
#References = LogK/DGf: 04maj/nav; V°: 90rob/cam;
Scolecite
CaAl2Si3O10:3H2O + 8.000H+ = 2.000Al+3 + 1.000Ca+2 + 3.000H4SiO4 + 1.000H2O
log_k 16.630
delta_h -240.213 #kJ/mol #83joh/flo
-analytic -1.3509071E+3 -2.3333788E-1 7.5509884E+4 4.9198629E+2 -2.9817448E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 83joh/flo; S°: 83joh/flo; Cp: 83joh/flo; V°: 95rob/hem;
Scorodite
FeAsO4:2H2O + 2.000H+ = 1.000H2AsO4- + 1.000Fe+3 + 2.000H2O
log_k -7.371
delta_h 77.472 #kJ/mol #11maj/dra
-analytic -9.9439678E+2 -1.59003E-1 5.357269E+4 3.5903799E+2 -2.9927664E+6
#References = LogK/DGf: 06lan/mah; DHf/DHr: 11maj/dra; S°: Internal calculation; Cp: 90pap/ber; V°: 00bla/bid;
Scorodite(am)
FeAsO4:2H2O + 2.000H+ = 1.000H2AsO4- + 1.000Fe+3 + 2.000H2O
log_k -4.541
#References = LogK/DGf: 06lan/mah;
#References = LogK/DGf: 06lan/mah; V°: 00bla/bid;
Sellaite
MgF2 = 2.000F- + 1.000Mg+2
log_k -9.220
delta_h -13.500 #kJ/mol #89cox/wag
-analytic -1.7205813E+3 -2.7422602E-1 9.3941364E+4 6.2239264E+2 -5.5140069E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Senarmontite
Sb2O3 + 3.000H2O = 2.000Sb(OH)3
log_k -9.831
delta_h 67.343 #kJ/mol #Internal calculation
-analytic 1.180315E+2 7.2977432E-3 -1.4458072E+4 -3.7531885E+1 1.0066432E+6
#References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi;
Sepiolite
Mg4Si6O15(OH)2:6H2O + 8.000H+ + 1.000H2O = 4.000Mg+2 + 6.000H4SiO4
log_k 31.420
delta_h -239.969 #kJ/mol #Internal calculation
-analytic -1.6080804E+3 -2.5767279E-1 8.7642508E+4 5.8951884E+2 -3.231673E+6
#References = LogK/DGf: 88sto; DHf/DHr: Internal calculation; S°: 88sto; Cp: 88sto; V°: 88sto;
Siderite
FeCO3 + 1.000H+ = 1.000HCO3- + 1.000Fe+2
log_k -0.273
delta_h -27.862 #kJ/mol #Internal calculation
-analytic -9.0291123E+2 -1.4586221E-1 4.9931005E+4 3.2756219E+2 -2.8333834E+6
#References = LogK/DGf: 04chi; DHf/DHr: Internal calculation; S°: 04chi; Cp: 04chi; V°: 78hel/del,85hel;
Siderophyllite
KFe2Al3Si2O10(OH)2 + 14.000H+ = 3.000Al+3 + 2.000Fe+2 + 1.000K+ + 2.000H4SiO4 + 4.000H2O
log_k 40.554
delta_h -484.778 #kJ/mol #90hol/pow
-analytic -2.2116482E+3 -3.6267321E-1 1.3526136E+5 7.9696059E+2 -5.8103141E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 90hol/pow; S°: 90hol/pow; Cp: 90hol/pow; V°: 90hol/pow;
Siderotil
FeSO4:5H2O = 1.000Fe+2 + 1.000SO4-2 + 5.000H2O
log_k -2.241
delta_h -4.190 #kJ/mol #02hem/sea
-analytic -1.673414E+3 -2.4257184E-1 9.1189385E+4 6.0422151E+2 -5.1079866E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 90rob/cam;
Sillimanite
Al2SiO5 + 6.000H+ = 2.000Al+3 + 1.000H4SiO4 + 1.000H2O
log_k 16.563
delta_h -250.179 #kJ/mol #Internal calculation
-analytic -9.4796973E+2 -1.6189265E-1 5.8886872E+4 3.4042178E+2 -2.4052505E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Smectite(MX80)
Na0.409K0.024Ca0.009(Si3.738Al0.262)(Al1.598Mg0.214Fe0.208)O10(OH)2 + 7.048H+ + 2.952H2O = 1.860Al+3 + 0.009Ca+2 + 0.173Fe+3 + 0.024K+ + 0.214Mg+2 + 0.409Na+ + 3.738H4SiO4 + 0.035Fe+2
log_k 5.261
delta_h -166.924 #kJ/mol #12gai/bla
-analytic -1.331561E+3 -2.2877809E-1 7.1937629E+4 4.8387027E+2 -2.9826428E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 12gai/bla; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla;
Smectite(MX80:3.989H2O)
Na0.409K0.024Ca0.009(Si3.738Al0.262)(Al1.598Mg0.214Fe0.208)O10(OH)2:3.989H2O + 7.048H+ = 1.860Al+3 + 0.009Ca+2 + 0.173Fe+3 + 0.024K+ + 0.214Mg+2 + 0.409Na+ + 3.738H4SiO4 + 0.035Fe+2 + 1.037H2O
log_k 4.233
delta_h -154.300 #kJ/mol #17gai/vie
-analytic -1.1999669E+3 -2.0062374E-1 6.5971455E+4 4.3404757E+2 -2.780222E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 17gai/vie; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla;
Smectite(MX80:5.189H2O)
Na0.409K0.024Ca0.009(Si3.738Al0.262)(Al1.598Mg0.214Fe0.208)O10(OH)2:5.189H2O + 7.048H+ = 1.860Al+3 + 0.009Ca+2 + 0.173Fe+3 + 0.024K+ + 0.214Mg+2 + 0.409Na+ + 3.738H4SiO4 + 0.035Fe+2 + 2.237H2O
log_k 4.637
delta_h -150.456 #kJ/mol #17gai/vie
-analytic -1.1600134E+3 -1.9437034E-1 6.3696005E+4 4.1985759E+2 -2.6619985E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 17gai/vie; S°: 12gai/bla; Cp: 12gai/bla; V°: 12gai/bla;
Smithsonite
ZnCO3 + 1.000H+ = 1.000HCO3- + 1.000Zn+2
log_k 0.447
delta_h -30.470 #kJ/mol #Internal calculation
-analytic -9.3357478E+2 -1.495946E-1 5.1744281E+4 3.3862817E+2 -2.9193866E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Sn(alpha)
Sn + 0.500O2 + 2.000H+ = 1.000Sn+2 + 1.000H2O
log_k 47.809
delta_h -288.539 #kJ/mol #By convention
-analytic -3.6836533E+2 -5.7511144E-2 3.6049952E+4 1.3232735E+2 -1.3357743E+6
#References = LogK/DGf: Internal calculation; S°: 85jac/hel; Cp: 85jac/hel; V°: 85jac/hel;
Sn(beta)
Sn + 0.500O2 + 2.000H+ = 1.000Sn+2 + 1.000H2O
log_k 48.307
#delta_h 0.000 #kJ/mol
-analytic -3.6524038E+2 -5.6822726E-2 3.6274824E+4 1.3087808E+2 -1.3357743E+6
#References = LogK/DGf: Internal calculation; V°: Default value;
Spencerite
Zn4(PO4)2(OH)2:3H2O + 6.000H+ = 2.000H2PO4- + 4.000Zn+2 + 5.000H2O
log_k 16.829
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Spessartine(alpha)
Mn3Al2Si3O12 + 12.000H+ = 2.000Al+3 + 3.000Mn+2 + 3.000H4SiO4
log_k 49.871
delta_h -478.069 #kJ/mol #98hol/pow
-analytic -2.0606927E+3 -3.4119401E-1 1.2616001E+5 7.4665482E+2 -5.1914285E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Sphaerocobaltite
CoCO3 + 1.000H+ = 1.000HCO3- + 1.000Co+2
log_k -0.873
delta_h -24.122 #kJ/mol #Internal calculation
-analytic -9.0849323E+2 -1.4524623E-1 5.0273155E+4 3.2921944E+2 -2.8733576E+6
#References = LogK/DGf: 99gra; DHf/DHr: Internal calculation; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 90rob/cam;
Sphalerite
ZnS + 1.000H+ = 1.000HS- + 1.000Zn+2
log_k -11.488
delta_h -833.392 #kJ/mol #Internal calculation
-analytic -9.7146192E+2 -1.5443722E-1 5.0803214E+4 3.518045E+2 -3.1017775E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Spinel
MgAl2O4 + 8.000H+ = 2.000Al+3 + 1.000Mg+2 + 4.000H2O
log_k 37.851
delta_h -399.057 #kJ/mol #Internal calculation
-analytic -1.1927622E+3 -1.9510765E-1 8.055579E+4 4.2645175E+2 -3.2559531E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Spingcreekite
BaV3(PO4)2(OH)5:H2O + 9.000H+ = 1.000Ba+2 + 2.000H2PO4- + 3.000V+3 + 6.000H2O
log_k 7.600
#References = LogK/DGf: 04gab/vie;
#References = LogK/DGf: 04gab/vie; V°: Default value;
Sr(element)
Sr + 0.500O2 + 2.000H+ = 1.000Sr+2 + 1.000H2O
log_k 141.779
delta_h -830.663 #kJ/mol #By convention
-analytic -3.5819719E+2 -5.4886853E-2 6.3679171E+4 1.2816679E+2 -1.2783043E+6
#References = S°: 98cha; Cp: 98cha; V°: 95rob/hem;
Sr(OH)2
Sr(OH)2 + 2.000H+ = 1.000Sr+2 + 2.000H2O
log_k 27.513
delta_h -153.670 #kJ/mol #98cha
-analytic -2.6896563E+2 -3.8367288E-2 2.2533353E+4 9.7483067E+1 -7.8892335E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 94pan;
Sr(OH)2:8H2O
Sr(OH)2:8H2O + 2.000H+ = 1.000Sr+2 + 10.000H2O
log_k 24.317
delta_h -57.000 #kJ/mol #82wag/eva
-analytic -3.4955952E+2 -1.7322262E-2 2.0315171E+4 1.2726848E+2 -3.5681706E+5
#References = LogK/DGf: 98fel/dix; DHf/DHr: 82wag/eva; S°: Internal calculation; V°: Default value;
Sr2SiO4
Sr2SiO4 + 4.000H+ = 1.000H4SiO4 + 2.000Sr+2
log_k 43.248
#References = LogK/DGf: 82wag/eva;
#References = LogK/DGf: 82wag/eva; V°: Default value;
Sr3(AsO4)2
Sr3(AsO4)2 + 4.000H+ = 2.000H2AsO4- + 3.000Sr+2
log_k 20.630
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: Default value;
Sr3(PO4)2
Sr3(PO4)2 + 4.000H+ = 2.000H2PO4- + 3.000Sr+2
log_k 10.530
delta_h -147.900 #kJ/mol #06bla/ign
-analytic -2.2048079E+3 -3.3955459E-1 1.2658484E+5 7.9576955E+2 -6.8511451E+6
#References = LogK/DGf: 06bla/ign; DHf/DHr: 06bla/ign; S°: Internal calculation; V°: Default value;
Sr5(PO4)3(OH)
Sr5(PO4)3(OH) + 7.000H+ = 3.000H2PO4- + 5.000Sr+2 + 1.000H2O
log_k 7.170
delta_h -261.630 #kJ/mol #95jem/che
-analytic -3.482658E+3 -5.3045989E-1 2.0041177E+5 1.2512845E+3 -1.0704713E+7
#References = LogK/DGf: 05kin/par; DHf/DHr: 95jem/che; S°: Internal calculation; V°: Default value;
SrCl2
SrCl2 = 2.000Cl- + 1.000Sr+2
log_k 8.644
delta_h -59.210 #kJ/mol #98cha
-analytic -1.5278184E+3 -2.477959E-1 8.7032834E+4 5.5583554E+2 -5.0621232E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 01mer/vie;
SrCl2:2H2O
SrCl2:2H2O = 2.000Cl- + 1.000Sr+2 + 2.000H2O
log_k 3.467
delta_h -18.720 #kJ/mol #82wag/eva
-analytic -1.4930799E+3 -2.3924548E-1 8.2967318E+4 5.4343592E+2 -4.8973686E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: 01mer/vie;
SrCl2:6H2O
SrCl2:6H2O = 2.000Cl- + 1.000Sr+2 + 6.000H2O
log_k 1.613
delta_h 23.760 #kJ/mol #82wag/eva
-analytic -1.5222606E+3 -2.1973607E-1 8.1209221E+4 5.5282481E+2 -4.5263191E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; V°: 01mer/vie;
SrCl2:H2O
SrCl2:H2O = 2.000Cl- + 1.000Sr+2 + 1.000H2O
log_k 4.909
delta_h -34.090 #kJ/mol #82wag/eva
-analytic -1.5110371E+3 -2.4369397E-1 8.476637E+4 5.4976132E+2 -4.9827345E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: 01mer/vie;
SrCrO4
SrCrO4 = 1.000CrO4-2 + 1.000Sr+2
log_k -4.650
delta_h -10.124 #kJ/mol #Internal calculation
-analytic -1.6564001E+3 -2.6000314E-1 9.1561629E+4 5.9947533E+2 -5.4395446E+6
#References = LogK/DGf: 97smi/mar; DHf/DHr: Internal calculation; S°: 97smi/mar; V°: Default value;
SrHPO4
SrHPO4 + 1.000H+ = 1.000H2PO4- + 1.000Sr+2
log_k 0.280
delta_h -19.487 #kJ/mol #Internal calculation
-analytic -9.4351907E+2 -1.4553259E-1 5.2044061E+4 3.4175565E+2 -2.93518E+6
#References = LogK/DGf: 97smi/mar; DHf/DHr: Internal calculation; S°: 82wag/eva; V°: Default value;
SrO
SrO + 2.000H+ = 1.000Sr+2 + 1.000H2O
log_k 41.976
delta_h -244.690 #kJ/mol #98cha
-analytic -2.8441784E+2 -4.2974575E-2 2.8169134E+4 1.028893E+2 -8.7702795E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem;
SrS
SrS + 1.000H+ = 1.000HS- + 1.000Sr+2
log_k 14.685
delta_h -962.343 #kJ/mol #74nau/ryz
-analytic -9.4569983E+2 -1.4806553E-1 5.6587913E+4 3.4309765E+2 -3.0436461E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 74nau/ryz; S°: 82wag/eva; V°: 87pan/mah;
SrSiO3
SrSiO3 + 2.000H+ + 1.000H2O = 1.000H4SiO4 + 1.000Sr+2
log_k 13.159
delta_h -80.274 #kJ/mol #82wag/eva
-analytic -3.5235891E+2 -5.6201995E-2 2.1983027E+4 1.2882838E+2 -9.0980501E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 74nau/ryz; Cp: 74nau/ryz; V°: 94pan;
Staurolite
Fe2Al9Si4O23(OH) + 31.000H+ = 9.000Al+3 + 2.000Fe+2 + 4.000H4SiO4 + 8.000H2O
log_k 216.308
delta_h -1965.817 #kJ/mol #87woo/gar
-analytic -4.7865816E+3 -8.1014799E-1 3.360154E+5 1.7200057E+3 -1.2321298E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 87woo/gar; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Stellerite
Ca2Al4Si14O36:14H2O + 16.000H+ + 6.000H2O = 4.000Al+3 + 2.000Ca+2 + 14.000H4SiO4
log_k 6.921
delta_h -325.102 #kJ/mol #01fri/neu
-analytic -2.8517509E+3 -5.1354039E-1 1.3919701E+5 1.0501014E+3 -4.7551267E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 01fri/neu; S°: 01fri/neu; Cp: 01fri/neu; V°: 01fri/neu;
Sterlinghillite
Mn3(AsO4)2:8H2O + 4.000H+ = 2.000H2AsO4- + 3.000Mn+2 + 8.000H2O
log_k 7.417
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Stibnite
Sb2S3 + 6.000H2O = 3.000HS- + 2.000Sb(OH)3 + 3.000H+
log_k -56.199
delta_h -2297.063 #kJ/mol #Internal calculation
-analytic -1.8531572E+3 -3.15948E-1 8.2416735E+4 6.787817E+2 -5.7665143E+6
#References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi;
Stilbite
NaCa2(Al5Si13)O36:16H2O + 20.000H+ = 5.000Al+3 + 2.000Ca+2 + 1.000Na+ + 13.000H4SiO4
log_k 22.973
delta_h -434.156 #kJ/mol #01fri/neu
-analytic -3.4126235E+3 -5.9615306E-1 1.7540966E+5 1.2520542E+3 -6.4993021E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 01fri/neu; S°: 01fri/neu; Cp: 01fri/neu; V°: 01fri/neu;
Straetlingite
Ca2Al2SiO2(OH)10:2.5H2O + 10.000H+ = 2.000Al+3 + 2.000Ca+2 + 1.000H4SiO4 + 10.500H2O
log_k 49.657
delta_h -408.377 #kJ/mol #Internal calculation
-analytic -1.2612895E+3 -1.984287E-1 8.3082512E+4 4.5496862E+2 -3.0528318E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 10bbla/bou; Cp: 10bbla/bou; V°: 90rin/sac;
Strengite
FePO4:2H2O + 2.000H+ = 1.000Fe+3 + 1.000H2PO4- + 2.000H2O
log_k -5.254
delta_h 64.083 #kJ/mol #Internal calculation
-analytic -1.0334682E+3 -1.6548356E-1 5.6600781E+4 3.7309523E+2 -3.1545409E+6
#References = LogK/DGf: 69wag/eva; DHf/DHr: Internal calculation; S°: 69wag/eva; Cp: 74nau/ryz,76wag/eva, 71par/wag; V°: 95rob/hem;
Strontianite
SrCO3 + 1.000H+ = 1.000HCO3- + 1.000Sr+2
log_k 1.057
delta_h -15.067 #kJ/mol #Internal calculation
-analytic -8.6448542E+2 -1.3949671E-1 4.8173953E+4 3.1423417E+2 -2.8441316E+6
#References = LogK/DGf: 84bus/plu; DHf/DHr: Internal calculation; S°: 84bus/plu; Cp: 06bla/ign; V°: 78hel/del;
Sudoite
Mg2Al4Si3O10(OH)8 + 16.000H+ = 4.000Al+3 + 2.000Mg+2 + 3.000H4SiO4 + 6.000H2O
log_k 37.933
delta_h -530.893 #kJ/mol #05vid/par
-analytic -2.6760736E+3 -4.3984416E-1 1.5858955E+5 9.65323E+2 -6.7021024E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05vid/par; S°: 05vid/par; Cp: 05vid/par; V°: 05vid/par;
Sudoite(Fe)
Fe2Al4Si3O10(OH)8 + 16.000H+ = 4.000Al+3 + 2.000Fe+2 + 3.000H4SiO4 + 6.000H2O
log_k 36.145
delta_h -519.393 #kJ/mol #98hol/pow
-analytic -2.4324526E+3 -4.153796E-1 1.4388972E+5 8.7962252E+2 -5.9322517E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98hol/pow; S°: 98hol/pow; Cp: 98hol/pow; V°: 98hol/pow;
Svanbergite
SrAl3(PO4)(SO4)(OH)6 + 8.000H+ = 3.000Al+3 + 1.000H2PO4- + 1.000SO4-2 + 1.000Sr+2 + 6.000H2O
log_k 7.739
delta_h -301.843 #kJ/mol #Internal calculation
-analytic -3.6907889E+3 -5.7946183E-1 2.1161452E+5 1.3286868E+3 -1.1219514E+7
#References = LogK/DGf: 04gab/vie; DHf/DHr: Internal calculation; S°: 04gab/vie; Cp: 04gab/vie; V°: 04gab/vie;
Sylvite
KCl = 1.000Cl- + 1.000K+
log_k 0.872
delta_h 17.460 #kJ/mol #98cha
-analytic -6.8750815E+2 -1.1145992E-1 3.7309655E+4 2.5158377E+2 -2.3159598E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 78hel/del, 98cha; Cp: 98cha; V°: 78hel/del;
Symplesite
Fe3(AsO4)2:8H2O + 4.000H+ = 2.000H2AsO4- + 3.000Fe+2 + 8.000H2O
log_k -1.573
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Syngenite
K2Ca(SO4)2:6H2O = 1.000Ca+2 + 2.000K+ + 2.000SO4-2 + 6.000H2O
log_k -7.452
#References = LogK/DGf: 84har/mol;
#References = LogK/DGf: 84har/mol; V°: 63wyc;
Szomolnokite
FeSO4:H2O = 1.000Fe+2 + 1.000SO4-2 + 1.000H2O
log_k -1.658
delta_h -41.470 #kJ/mol #02hem/sea
-analytic -1.6955273E+3 -2.6125135E-1 9.490602E+4 6.1222859E+2 -5.4647229E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: 95rob/hem;
Tachyhydrite
Mg2CaCl6:12H2O = 1.000Ca+2 + 6.000Cl- + 2.000Mg+2 + 12.000H2O
log_k 17.376
#References = LogK/DGf: 84har/mol;
#References = LogK/DGf: 84har/mol; V°: 63wyc;
Talc
Mg3Si4O10(OH)2 + 6.000H+ + 4.000H2O = 3.000Mg+2 + 4.000H4SiO4
log_k 24.916
delta_h -210.357 #kJ/mol #01kal/mar
-analytic -1.2497443E+3 -2.0462605E-1 7.0220532E+4 4.5697454E+2 -2.7205664E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 01kal/mar; S°: 63rob/sto; Cp: 79kru/rob; V°: 78hel/del;
Tarbuttite
Zn2(PO4)OH + 3.000H+ = 1.000H2PO4- + 2.000Zn+2 + 1.000H2O
log_k 8.256
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: 63wyc;
Tenorite
CuO + 2.000H+ = 1.000Cu+2 + 1.000H2O
log_k 7.640
delta_h -64.396 #kJ/mol #Internal calculation
-analytic -3.1549585E+2 -4.8140447E-2 1.9607705E+4 1.1373828E+2 -8.6350264E+5
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 98cha; Cp: 98cha; V°: 84pan;
Thaumasite
CaSiO3CaSO4CaCO3:15H2O + 3.000H+ = 1.000HCO3- + 3.000Ca+2 + 1.000SO4-2 + 1.000H4SiO4 + 14.000H2O
log_k 10.296
delta_h -9.040 #kJ/mol #Internal calculation
-analytic -2.4736517E+3 -3.9242372E-1 1.3324475E+5 9.047091E+2 -7.5204153E+6
#References = LogK/DGf: 10bbla/bou; DHf/DHr: Internal calculation; S°: 08sch/lot; Cp: 08sch/lot; V°: 10bbla/bou;
Thenardite
Na2SO4 = 2.000Na+ + 1.000SO4-2
log_k -0.340
delta_h -2.461 #kJ/mol #98cha
-analytic -1.6163303E+3 -2.5323968E-1 8.9803215E+4 5.8641469E+2 -5.4004941E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem;
Thermonatrite
Na2CO3:H2O + 1.000H+ = 1.000HCO3- + 2.000Na+ + 1.000H2O
log_k 10.807
delta_h -26.740 #kJ/mol #82van
-analytic -8.2978986E+2 -1.2422097E-1 4.7349571E+4 3.0256364E+2 -2.6536666E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 82van; S°: Internal calculation; Cp: 82van; V°: 95rob/hem;
Thorianite
ThO2 + 4.000H+ = 1.000Th+4 + 2.000H2O
log_k 1.759
delta_h -113.777 #kJ/mol #89cox/wag
-analytic -5.2134077E+2 -8.5708486E-2 2.9799614E+4 1.8631453E+2 -1.0949333E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 91kna/kub; V°: 95rob/hem;
Titanite
CaTiSiO5 + 2.000H+ + 3.000H2O = 1.000Ca+2 + 1.000H4SiO4 + 1.000Ti(OH)4
log_k 0.986
delta_h -63.035 #kJ/mol #Internal calculation
-analytic -8.3409218E+2 -9.5034928E-2 4.3928881E+4 2.9662305E+2 -1.5911643E+6
#References = LogK/DGf: 78rob/hem,92cjoh; DHf/DHr: Internal calculation; S°: 78rob/hem,92cjoh; Cp: 78rob/hem,92cjoh; V°: 78rob/hem,92cjoh;
Tobermorite(11A)
Ca5Si6H11O22.5 + 10.000H+ + 1.500H2O = 5.000Ca+2 + 6.000H4SiO4
log_k 65.580
delta_h -372.500 #kJ/mol #00zue/feh
-analytic -1.6243549E+3 -2.6787181E-1 9.6822379E+4 5.9990347E+2 -3.4992477E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 00zue/feh; S°: Internal calculation; Cp: 10abla/bou; V°: 00mer/bon;
Tobermorite(14A)
Ca5Si6H21O27.5 + 10.000H+ = 5.000Ca+2 + 6.000H4SiO4 + 3.500H2O
log_k 62.939
delta_h -307.420 #kJ/mol #10abla/bou
-analytic -1.5237542E+3 -2.447415E-1 8.8032255E+4 5.6529749E+2 -3.0571055E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 10abla/bou;
Tremolite
(Ca2Mg5)Si8O22(OH)2 + 14.000H+ + 8.000H2O = 2.000Ca+2 + 5.000Mg+2 + 8.000H4SiO4
log_k 67.249
delta_h -520.914 #kJ/mol #95rob/hem
-analytic -2.7390654E+3 -4.5144381E-1 1.5810894E+5 1.0021641E+3 -6.1494397E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 95rob/hem; S°: 95rob/hem; Cp: 95rob/hem; V°: 78hel/del,92ajoh;
Troilite
FeS + 1.000H+ = 1.000Fe+2 + 1.000HS-
log_k -3.874
delta_h -874.952 #kJ/mol #05wal/pel
-analytic -1.1310906E+3 -1.822577E-1 6.1072903E+4 4.1081089E+2 -3.5386318E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 05wal/pel; S°: 05wal/pel; Cp: 05wal/pel; V°: 63wyc;
Trona(K)
K2NaH(CO3)2:2H2O + 1.000H+ = 2.000HCO3- + 2.000K+ + 1.000Na+ + 2.000H2O
log_k 11.553
#References = LogK/DGf: 84har/mol;
#References = LogK/DGf: 84har/mol; V°: Default value;
Trona(Na)
Na3H(CO3)2:2H2O + 1.000H+ = 2.000HCO3- + 3.000Na+ + 2.000H2O
log_k 9.273
delta_h 9.560 #kJ/mol #82van
-analytic -1.5229698E+3 -2.2969604E-1 8.3727672E+4 5.5556062E+2 -4.8709595E+6
#References = LogK/DGf: 84har/mol; DHf/DHr: 82van; S°: Internal calculation; Cp: 82van; V°: 95rob/hem;
Truscottite
Ca7Si12O29(OH)4:H2O + 14.000H+ + 14.000H2O = 7.000Ca+2 + 12.000H4SiO4
log_k 77.088
delta_h -479.092 #kJ/mol #10abla/bou
-analytic -2.573506E+3 -4.3832078E-1 1.450533E+5 9.5161333E+2 -5.3280247E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 10abla/bou; S°: Internal calculation; Cp: 10abla/bou; V°: 95ant/bid;
Tsumebite
Pb2Cu(PO4)(SO4)OH + 3.000H+ = 1.000Cu+2 + 1.000H2PO4- + 2.000Pb+2 + 1.000SO4-2 + 1.000H2O
log_k -66.025
#References = LogK/DGf: 78ric/nri;
#References = LogK/DGf: 78ric/nri; V°: 63wyc;
U3O8
U3O8 + 4.000H+ = 2.000UO2+ + 1.000UO2+2 + 2.000H2O
log_k -3.599
delta_h -333.921 #kJ/mol #89cox/wag
-analytic -5.9578031E+2 -1.0007877E-1 3.5429929E+4 2.1240963E+2 -1.9917555E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89bar/sau; V°: 95rob/hem;
Ulvospinel
Fe2TiO4 + 4.000H+ = 2.000Fe+2 + 1.000Ti(OH)4
log_k 16.405
delta_h -201.464 #kJ/mol #Internal calculation
-analytic -1.119804E+3 -1.335895E-1 6.8782959E+4 3.9491641E+2 -2.8317374E+6
#References = LogK/DGf: 95rob/hem; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 95rob/hem; V°: 95rob/hem;
UO3(gamma)
UO3 + 2.000H+ = 1.000UO2+2 + 1.000H2O
log_k 7.711
delta_h -81.129 #kJ/mol #89cox/wag
-analytic -2.0467744E+2 -3.6004832E-2 1.3267577E+4 7.3980565E+1 -3.9440265E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 95rob/hem;
Uraninite
UO2 + 4.000H+ = 1.000U+4 + 2.000H2O
log_k -4.842
delta_h -213.866 #kJ/mol #Internal calculation
-analytic -5.2469868E+2 -8.6296615E-2 2.8066957E+4 1.8745581E+2 -1.1020781E+6
#References = LogK/DGf: 97csho/sas; DHf/DHr: Internal calculation; S°: 97csho/sas; Cp: 97csho/sas; V°: 95rob/hem;
Valentinite
Sb2O3 + 3.000H2O = 2.000Sb(OH)3
log_k -8.512
delta_h 57.242 #kJ/mol #Internal calculation
-analytic 1.1956057E+2 7.278992E-3 -1.3997644E+4 -3.8222275E+1 1.0030841E+6
#References = LogK/DGf: 03zot/shi; DHf/DHr: Internal calculation; S°: 03zot/shi; Cp: 03zot/shi; V°: 03zot/shi;
Variscite
AlPO4:2H2O + 2.000H+ = 1.000Al+3 + 1.000H2PO4- + 2.000H2O
log_k -2.160
delta_h -59.250 #kJ/mol #Internal calculation
-analytic -1.0269597E+3 -1.6683393E-1 5.7502935E+4 3.7069509E+2 -3.1633237E+6
#References = LogK/DGf: 74nau/ryz; DHf/DHr: Internal calculation; S°: 66ega/wak; Cp: 74nau/ryz; V°: 63wyc;
Vaterite
CaCO3 + 1.000H+ = 1.000HCO3- + 1.000Ca+2
log_k 2.427
delta_h -29.630 #kJ/mol #87gar/par
-analytic -8.8571848E+2 -1.3868773E-1 4.9073707E+4 3.2146058E+2 -2.7141208E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 87gar/par; S°: 87gar/par; V°: 95rob/hem;
VermiculiteSO
Ca0.445(Si2.778Al1.222)(Al0.216Mg2.475Fe0.254)O10(OH)2 + 10.888H+ = 1.438Al+3 + 0.445Ca+2 + 0.226Fe+3 + 2.475Mg+2 + 2.778H4SiO4 + 0.028Fe+2 + 0.888H2O
log_k 45.888
delta_h -441.531 #kJ/mol #13gai/bla
-analytic -1.9223485E+3 -3.1254347E-1 1.1864607E+5 6.9416321E+2 -4.8163495E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 13gai/bla; S°: 13gai/bla; Cp: 13gai/bla; V°: 13gai/bla;
Vermiculite(Ca)
Ca0.43Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 0.430Ca+2 + 3.000Mg+2 + 3.140H4SiO4
log_k 39.547
delta_h -377.539 #kJ/mol #15bla/vie
-analytic -1.7433973E+3 -2.7353854E-1 1.0659164E+5 6.2916221E+2 -4.4296492E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Vermiculite(K)
K0.86Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 0.860K+ + 3.000Mg+2 + 3.140H4SiO4
log_k 37.445
delta_h -335.540 #kJ/mol #15bla/vie
-analytic -1.6936279E+3 -2.6466982E-1 1.0232437E+5 6.1244388E+2 -4.3260939E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Vermiculite(Mg)
Mg0.43Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 3.430Mg+2 + 3.140H4SiO4
log_k 38.042
delta_h -379.809 #kJ/mol #15bla/vie
-analytic -1.7824468E+3 -2.7812893E-1 1.08797E+5 6.4242701E+2 -4.5457841E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Vermiculite(Na)
Na0.86Mg3.00Si3.14Al0.86O10(OH)2 + 9.440H+ + 0.560H2O = 0.860Al+3 + 3.000Mg+2 + 0.860Na+ + 3.140H4SiO4
log_k 38.389
delta_h -355.542 #kJ/mol #15bla/vie
-analytic -1.7445392E+3 -2.6999731E-1 1.0598044E+5 6.2966633E+2 -4.4535832E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 15bla/vie; S°: 15bla/vie; Cp: 15bla/vie; V°: 15bla/vie;
Vivianite
Fe3(PO4)2:8H2O + 4.000H+ = 3.000Fe+2 + 2.000H2PO4- + 8.000H2O
log_k -3.283
#References = LogK/DGf: 94alb/tom;
#References = LogK/DGf: 94alb/tom; V°: 63wyc;
Voltaite
K2Fe9(SO4)12:18H2O = 5.000Fe+2 + 2.000K+ + 12.000SO4-2 + 4.000Fe+3 + 18.000H2O
log_k -38.258
delta_h 48.226 #kJ/mol #02hem/sea
-analytic -2.0701974E+4 -3.1805283E+0 1.147179E+6 7.4793303E+3 -6.6028469E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 02hem/sea; S°: 02hem/sea; V°: Default value;
Vysotskite
PdS + 1.000H+ = 1.000Pd+2 + 1.000HS-
log_k -44.806
delta_h -636.207 #kJ/mol #Internal calculation
-analytic -9.6499267E+2 -1.5521681E-1 3.9896865E+4 3.5036381E+2 -3.049251E+6
#References = LogK/DGf: 98sas/sho; DHf/DHr: Internal calculation; S°: 98sas/sho; Cp: 98sas/sho; V°: 98sas/sho;
Wairakite
Ca(Al2Si4)O12:2H2O + 8.000H+ + 2.000H2O = 2.000Al+3 + 1.000Ca+2 + 4.000H4SiO4
log_k 14.425
delta_h -246.217 #kJ/mol #96kis/nav
-analytic -1.4045591E+3 -2.446591E-1 7.782647E+4 5.1134281E+2 -3.0567161E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 96kis/nav; S°: 96kis/nav; Cp: 07neu/wan; V°: 97coo/alb;
Wavellite
Al3(PO4)2(OH)3:5H2O + 7.000H+ = 3.000Al+3 + 2.000H2PO4- + 8.000H2O
log_k 12.147
#References = LogK/DGf: 79vie/tar;
#References = LogK/DGf: 79vie/tar; V°: 63wyc;
Waylandite
BiAl3(PO4)2(OH)6 + 10.000H+ = 3.000Al+3 + 1.000Bi+3 + 2.000H2PO4- + 6.000H2O
log_k 10.919
#References = LogK/DGf: 04gab/vie;
#References = LogK/DGf: 04gab/vie; V°: Default value;
Weillite
CaHAsO4 + 1.000H+ = 1.000H2AsO4- + 1.000Ca+2
log_k 2.360
#References = LogK/DGf: 01gas/aza;
#References = LogK/DGf: 01gas/aza; V°: 00bla/bid;
Westerveldite
FeAs + 2.000H+ + 0.500H2O = 1.000AsH3 + 1.000Fe+2 + 0.250O2
log_k -30.679
delta_h -791.989 #kJ/mol #Internal calculation
-analytic -1.4444745E+2 -2.2174141E-2 -2.6539329E+3 5.2861713E+1 -1.3528589E+5
#References = LogK/DGf: 08per/pok; DHf/DHr: Internal calculation; S°: 08per/pok; Cp: 08per/pok; V°: 08per/pok;
Whitlockite(high)
Ca3(PO4)2 + 4.000H+ = 3.000Ca+2 + 2.000H2PO4-
log_k 10.120
delta_h -124.730 #kJ/mol #Internal calculation
-analytic -1.9939263E+3 -3.2962076E-1 1.1275229E+5 7.2498498E+2 -6.2028438E+6
#References = LogK/DGf: 84nan; DHf/DHr: Internal calculation; S°: 84nan; Cp: 60kel; V°: 95rob/hem;
Whitlockite(low)
Ca3(PO4)2 + 4.000H+ = 3.000Ca+2 + 2.000H2PO4-
log_k 8.393
delta_h -113.380 #kJ/mol #71par/wag
-analytic -1.9877501E+3 -3.2533291E-1 1.1250393E+5 7.2186031E+2 -6.2576891E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 71par/wag; S°: 71par/wag; Cp: 60kel; V°: 95rob/hem;
Wollastonite
CaSiO3 + 2.000H+ + 1.000H2O = 1.000Ca+2 + 1.000H4SiO4
log_k 14.043
delta_h -88.320 #kJ/mol #78hel/del,92ajoh
-analytic -3.2608155E+2 -5.6196709E-2 2.0008233E+4 1.2035952E+2 -7.1562503E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 78hel/del,92ajoh; S°: 78hel/del,92ajoh; Cp: 78hel/del,92ajoh; V°: 78hel/del,92ajoh;
Woodhouseite
CaAl3(PO4)(SO4)(OH)6 + 8.000H+ = 3.000Al+3 + 1.000Ca+2 + 1.000H2PO4- + 1.000SO4-2 + 6.000H2O
log_k 8.885
#References = LogK/DGf: 04gab/vie;
#References = LogK/DGf: 04gab/vie; V°: Default value;
Wurtzite
ZnS + 1.000H+ = 1.000HS- + 1.000Zn+2
log_k -9.189
delta_h -846.573 #kJ/mol #Internal calculation
-analytic -9.7140841E+2 -1.5442444E-1 5.149764E+4 3.5177515E+2 -3.1030568E+6
#References = LogK/DGf: 78hel/del; DHf/DHr: Internal calculation; S°: 78hel/del; Cp: 78hel/del; V°: 78hel/del;
Wustite
Fe0.947O + 2.000H+ = 0.841Fe+2 + 0.106Fe+3 + 1.000H2O
log_k 12.238
delta_h -89.963 #kJ/mol #98cha
-analytic -3.1290545E+2 -4.8807168E-2 2.1464713E+4 1.1226518E+2 -8.9695966E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 95rob/hem;
Xonotlite
Ca6Si6O17(OH)2 + 12.000H+ + 5.000H2O = 6.000Ca+2 + 6.000H4SiO4
log_k 91.342
delta_h -573.865 #kJ/mol #56new
-analytic -1.9705197E+3 -3.2969573E-1 1.2545995E+5 7.2395722E+2 -4.6242043E+6
#References = LogK/DGf: 10abla/bou; DHf/DHr: 56new; S°: Internal calculation; Cp: 10abla/bou; V°: 56den/tay;
Yavapaiite
KFe(SO4)2 = 1.000Fe+3 + 1.000K+ + 2.000SO4-2
log_k -5.569
delta_h 21.862 #kJ/mol #05for/dro
-analytic -3.3189879E+3 -5.2021513E-1 1.8590243E+5 1.1990955E+3 -1.0852329E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 05for/dro; S°: 05for/dro; V°: 90rob/cam;
Zairite
BiFe3(PO4)2(OH)6 + 10.000H+ = 1.000Bi+3 + 3.000Fe+3 + 2.000H2PO4- + 6.000H2O
log_k -3.689
#References = LogK/DGf: 04gab/vie;
#References = LogK/DGf: 04gab/vie; V°: Default value;
ZeoliteP(Ca)
Ca2Al4Si4O16:9H2O + 16.000H+ = 4.000Al+3 + 2.000Ca+2 + 4.000H4SiO4 + 9.000H2O
log_k 45.147
delta_h -527.740 #kJ/mol #10bbla/bou
-analytic -2.3199815E+3 -3.836539E-1 1.3966093E+5 8.3827025E+2 -5.6140691E+6
#References = LogK/DGf: 08bla; DHf/DHr: 10bbla/bou; S°: Internal calculation; Cp: 10vie; V°: 97coo/alb;
Zincite
ZnO + 2.000H+ = 1.000Zn+2 + 1.000H2O
log_k 11.206
delta_h -88.806 #kJ/mol #89cox/wag
-analytic -3.2526377E+2 -4.911508E-2 2.1606424E+4 1.168152E+2 -9.2509648E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 95rob/hem; V°: 95rob/hem;
Zn3(PO4)2
Zn3(PO4)2 + 4.000H+ = 2.000H2PO4- + 3.000Zn+2
log_k 14.495
delta_h -165.908 #kJ/mol #84vie/tar, after 74avol/yag
-analytic -2.304674E+3 -3.5529749E-1 1.3202677E+5 8.3298516E+2 -7.0125306E+6
#References = LogK/DGf: 84vie/tar,after 78yag; DHf/DHr: 84vie/tar, after 74avol/yag; S°: Internal calculation; V°: Default value;
Zn3(PO4)2:2H2O
Zn3(PO4)2:2H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 2.000H2O
log_k 8.254
delta_h -120.868 #kJ/mol #84vie/tar, after 78yag
-analytic -2.3140709E+3 -3.4906406E-1 1.2978032E+5 8.359872E+2 -6.887737E+6
#References = LogK/DGf: 84vie/tar,after 78yag; DHf/DHr: 84vie/tar, after 78yag; S°: Internal calculation; V°: Default value;
Zn3(PO4)2:H2O
Zn3(PO4)2:H2O + 4.000H+ = 2.000H2PO4- + 3.000Zn+2 + 1.000H2O
log_k 10.927
delta_h -139.638 #kJ/mol #84vie/tar, after 78yag
-analytic -2.3091622E+3 -3.5218077E-1 1.3070767E+5 8.3448618E+2 -6.9501338E+6
#References = LogK/DGf: 84vie/tar,after 78yag; DHf/DHr: 84vie/tar, after 78yag; S°: Internal calculation; V°: Default value;
Zn5(PO4)3Cl
Zn5(PO4)3Cl + 6.000H+ = 1.000Cl- + 3.000H2PO4- + 5.000Zn+2
log_k 24.888
#References = LogK/DGf: 76nri;
#References = LogK/DGf: 76nri; V°: Default value;
Zn5(PO4)3OH
Zn5(PO4)3OH + 7.000H+ = 3.000H2PO4- + 5.000Zn+2 + 1.000H2O
log_k 13.220
#References = LogK/DGf: 84nri;
#References = LogK/DGf: 84nri; V°: Default value;
ZnHPO4
ZnHPO4 + 1.000H+ = 1.000H2PO4- + 1.000Zn+2
log_k -2.324
delta_h -80.083 #kJ/mol #Internal calculation
-analytic -9.9029785E+2 -1.5078022E-1 5.6709636E+4 3.5416085E+2 -2.9889752E+6
#References = LogK/DGf: 06pia/bod; DHf/DHr: Internal calculation; S°: 78hel/del,92ajoh; V°: Default value;
ZnSiO3glass
ZnSiO3 + 2.000H+ + 1.000H2O = 1.000H4SiO4 + 1.000Zn+2
log_k 1.760
delta_h -91.675 #kJ/mol #Internal calculation
-analytic -4.6229816E+2 -6.6648079E-2 2.7115855E+4 1.6360517E+2 -1.0532576E+6
#References = LogK/DGf: 92plo/wic; DHf/DHr: Internal calculation; S°: 95rob/hem; V°: Default value;
Zoisite
Ca2Al3Si3O12(OH) + 13.000H+ = 3.000Al+3 + 2.000Ca+2 + 3.000H4SiO4 + 1.000H2O
log_k 43.830
delta_h -492.113 #kJ/mol #01sme/fra
-analytic -2.0153884E+3 -3.4381262E-1 1.2267663E+5 7.29736E+2 -4.9262375E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 01sme/fra; S°: 04got; Cp: 04got; V°: 04got;
Tl2O
Tl2O + 2.000H+ = 2.000Tl+ + 1.000H2O
log_k 27.770
delta_h -106.097 #kJ/mol #84pan/stu
-analytic -1.3779969E+2 -1.8256508E-2 1.4686438E+4 5.1948012E+1 -6.0337941E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu;
Tl2O3
Tl2O3 + 6.000H+ = 2.000Tl+3 + 3.000H2O
log_k -5.208
delta_h 107.287 #kJ/mol #84pan/stu
-analytic -7.7868005E+2 -1.2475717E-1 4.0987774E+4 2.80279E+2 -1.8078453E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu;
Tl2S
Tl2S + 1.000H+ = 1.000HS- + 2.000Tl+
log_k -7.145
delta_h -782.325 #kJ/mol #84pan/stu
-analytic -7.7799341E+2 -1.2228162E-1 3.9977829E+4 2.8460894E+2 -2.7580346E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu;
Doralcharite
TlFe3(SO4)2(OH)6 + 6.000H+ = 3.000Fe+3 + 2.000SO4-2 + 1.000Tl+ + 6.000H2O
log_k -2.229
delta_h 65.735 #kJ/mol #09xio
-analytic -4.1086384E+3 -6.5737596E-1 2.3484562E+5 1.4809988E+3 -1.332554E+7
#References = LogK/DGf: Internal calculation; DHf/DHr: 09xio; S°: 09xio; Cp: 84pan/stu; V°: 84pan/stu;
Lammuchangite
TlAl(SO4)2:12H2O = 1.000Al+3 + 2.000SO4-2 + 1.000Tl+ + 12.000H2O
log_k -16.502
delta_h 37.510 #kJ/mol #09xio
-analytic -2.9379292E+3 -4.6277286E-1 1.6058528E+5 1.0634207E+3 -9.828777E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 09xio; S°: 09xio; Cp: 84pan/stu; V°: 84pan/stu;
TlOH
TlOH + 1.000H+ = 1.000Tl+ + 1.000H2O
log_k 12.898
delta_h -41.580 #kJ/mol #82wag/eva
-analytic -6.5037615E+1 -6.465787E-3 6.5645382E+3 2.4588317E+1 -2.6637801E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: 17abla;
Tl2SO4
Tl2SO4 = 1.000SO4-2 + 2.000Tl+
log_k -3.841
delta_h 33.555 #kJ/mol #84pan/stu
-analytic -1.4949834E+3 -2.3643404E-1 8.2536057E+4 5.429417E+2 -5.215045E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu;
Tl2CO3
Tl2CO3 + 1.000H+ = 1.000HCO3- + 2.000Tl+
log_k 6.531
delta_h 20.627 #kJ/mol #84pan/stu
-analytic -7.2446132E+2 -1.1510594E-1 3.9839149E+4 2.665531E+2 -2.4782164E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu;
Tl(OH)3
Tl(OH)3 + 3.000H+ = 1.000Tl+3 + 3.000H2O
log_k -1.821
#References = LogK/DGf: 52lat;
#References = LogK/DGf: 52lat; V°: Default value;
MSH06
Mg0.82SiO2.385(OH)0.87 + 1.640H+ + 0.745H2O = 0.820Mg+2 + 1.000H4SiO4
log_k 9.120
delta_h -71.083 #kJ/mol #Internal calculation
-analytic -3.5739156E+2 -5.4264042E-2 2.1203118E+4 1.2966146E+2 -8.2349206E+5
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
MSH12
Mg1.07SiO2.075(OH)1.99 + 2.140H+ = 1.070Mg+2 + 1.000H4SiO4 + 0.065H2O
log_k 12.730
delta_h -83.582 #kJ/mol #Internal calculation
-analytic -4.4363918E+2 -6.5039211E-2 2.6374842E+4 1.6120704E+2 -1.0309293E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.7SH
Ca1.4Si2O5.9496H1.0992:1.378H2O + 2.800H+ + 0.6724H2O = 1.400Ca+2 + 2.000H4SiO4
log_k 17.730
delta_h -102.902 #kJ/mol #Internal calculation
-analytic -4.5480973E+2 -7.5079405E-2 2.6613555E+4 1.6810221E+2 -9.1522423E+5
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.8SH
Ca1.6Si2O6.1698H1.1396:1.6122H2O + 3.200H+ + 0.218H2O = 1.600Ca+2 + 2.000H4SiO4
log_k 21.800
delta_h -126.127 #kJ/mol #Internal calculation
-analytic -5.0535129E+2 -8.2688453E-2 3.042881E+4 1.8652259E+2 -1.0482162E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.9SH
Ca1.8Si2O6.4048H1.2096:1.7014H2O + 3.600H+ = 1.800Ca+2 + 2.000H4SiO4 + 0.1062H2O
log_k 25.448
delta_h -147.603 #kJ/mol #Internal calculation
-analytic -5.5886361E+2 -9.0915164E-2 3.4314441E+4 2.0600546E+2 -1.1929862E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1SH
Ca2Si2O6.6436H1.2872:1.7542H2O + 4.000H+ = 2.000Ca+2 + 2.000H4SiO4 + 0.3978H2O
log_k 29.464
delta_h -171.346 #kJ/mol #Internal calculation
-analytic -6.1312207E+2 -9.9296646E-2 3.8359056E+4 2.2575524E+2 -1.3407073E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.1SH
Ca2.2Si2O6.8821H1.3642:1.867H2O + 4.400H+ = 2.200Ca+2 + 2.000H4SiO4 + 0.7491H2O
log_k 33.727
delta_h -196.114 #kJ/mol #Internal calculation
-analytic -6.6617853E+2 -1.0740309E-1 4.2391199E+4 2.450789E+2 -1.4831689E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.2SH
Ca2.4Si2O7.1203H1.4406:2.0692H2O + 4.800H+ = 2.400Ca+2 + 2.000H4SiO4 + 1.1895H2O
log_k 37.938
delta_h -220.008 #kJ/mol #Internal calculation
-analytic -7.1744469E+2 -1.1509923E-1 4.6279348E+4 2.6376796E+2 -1.6177839E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.3SH
Ca2.6Si2O7.3957H1.5914:2.1702H2O + 5.200H+ = 2.600Ca+2 + 2.000H4SiO4 + 1.5659H2O
log_k 42.397
delta_h -245.273 #kJ/mol #Internal calculation
-analytic -7.7091003E+2 -1.2313669E-1 5.0356075E+4 2.8326094E+2 -1.7588389E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.4SH
Ca2.8Si2O7.687H1.774:2.2274H2O + 5.600H+ = 2.800Ca+2 + 2.000H4SiO4 + 1.9144H2O
log_k 46.925
delta_h -270.917 #kJ/mol #Internal calculation
-analytic -8.2532625E+2 -1.3132256E-1 5.4503203E+4 3.0310139E+2 -1.9026944E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.5SH
Ca3Si2O7.9783H1.9566:2.2848H2O + 6.000H+ = 3.000Ca+2 + 2.000H4SiO4 + 2.2631H2O
log_k 51.447
delta_h -296.525 #kJ/mol #Internal calculation
-analytic -8.7973847E+2 -1.395075E-1 5.8648226E+4 3.2294042E+2 -2.0465323E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.6SH
Ca3.2Si2O8.2682H2.1364:2.3446H2O + 6.400H+ = 3.200Ca+2 + 2.000H4SiO4 + 2.6128H2O
log_k 55.941
delta_h -321.982 #kJ/mol #Internal calculation
-analytic -8.3735546E+2 -1.3511831E-1 5.7036948E+4 3.0831552E+2 -1.8336474E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.7A0.01SH
Ca1.4Al0.04Si2O6.0128H1.1056:1.4156H2O + 2.920H+ + 0.5716H2O = 0.040Al+3 + 1.400Ca+2 + 2.000H4SiO4
log_k 17.999
delta_h -108.203 #kJ/mol #Internal calculation
-analytic -4.699089E+2 -7.7782293E-2 2.7654279E+4 1.7344013E+2 -9.6187107E+5
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.8A0.01SH
Ca1.6Al0.04Si2O6.2343H1.1486:1.63H2O + 3.320H+ + 0.1357H2O = 0.040Al+3 + 1.600Ca+2 + 2.000H4SiO4
log_k 21.633
delta_h -129.042 #kJ/mol #Internal calculation
-analytic -5.2085275E+2 -8.5478093E-2 3.1366908E+4 1.9200393E+2 -1.0965191E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.9A0.01SH
Ca1.8Al0.04Si2O6.4696H1.2192:1.708H2O + 3.720H+ = 0.040Al+3 + 1.800Ca+2 + 2.000H4SiO4 + 0.1776H2O
log_k 25.654
delta_h -152.713 #kJ/mol #Internal calculation
-analytic -5.7459058E+2 -9.3755329E-2 3.537949E+4 2.1156691E+2 -1.2422548E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1A0.01SH
Ca2Al0.04Si2O6.7077H1.2954:1.7598H2O + 4.120H+ = 0.040Al+3 + 2.000Ca+2 + 2.000H4SiO4 + 0.4675H2O
log_k 29.973
delta_h -178.207 #kJ/mol #Internal calculation
-analytic -6.2886578E+2 -1.0214375E-1 3.9516599E+4 2.3132216E+2 -1.3901103E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.1A0.01SH
Ca2.2Al0.04Si2O6.9455H1.371:1.885H2O + 4.520H+ = 0.040Al+3 + 2.200Ca+2 + 2.000H4SiO4 + 0.8305H2O
log_k 34.274
delta_h -203.124 #kJ/mol #Internal calculation
-analytic -6.8167084E+2 -1.1019548E-1 4.3542779E+4 2.5055626E+2 -1.5315271E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.2A0.01SH
Ca2.4Al0.04Si2O7.1845H1.449:2.0794H2O + 4.920H+ = 0.040Al+3 + 2.400Ca+2 + 2.000H4SiO4 + 1.2639H2O
log_k 38.465
delta_h -226.944 #kJ/mol #Internal calculation
-analytic -7.3309682E+2 -1.1792484E-1 4.7435764E+4 2.6930249E+2 -1.6667755E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.3A0.01SH
Ca2.6Al0.04Si2O7.4606H1.6012:2.1732H2O + 5.320H+ = 0.040Al+3 + 2.600Ca+2 + 2.000H4SiO4 + 1.6338H2O
log_k 42.832
delta_h -251.718 #kJ/mol #Internal calculation
-analytic -7.8670951E+2 -1.2599309E-1 5.1494849E+4 2.8884814E+2 -1.8084176E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.4A0.01SH
Ca2.8Al0.04Si2O7.7502H1.7804:2.2294H2O + 5.720H+ = 0.040Al+3 + 2.800Ca+2 + 2.000H4SiO4 + 1.9796H2O
log_k 47.252
delta_h -276.779 #kJ/mol #Internal calculation
-analytic -8.4113778E+2 -1.3418923E-1 5.5612366E+4 3.0869174E+2 -1.9524737E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.5A0.01SH
Ca3Al0.04Si2O8.0399H1.9598:2.2858H2O + 6.120H+ = 0.040Al+3 + 3.000Ca+2 + 2.000H4SiO4 + 2.3257H2O
log_k 51.685
delta_h -301.918 #kJ/mol #Internal calculation
-analytic -8.0522772E+2 -1.3064855E-1 5.4368643E+4 2.9637122E+2 -1.7635145E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.7A0.025SH
Ca1.4Al0.1Si2O6.1077H1.1154:1.5092H2O + 3.100H+ + 0.3831H2O = 0.100Al+3 + 1.400Ca+2 + 2.000H4SiO4
log_k 18.465
delta_h -116.266 #kJ/mol #Internal calculation
-analytic -4.9181375E+2 -8.1665145E-2 2.9180312E+4 1.8118348E+2 -1.0285614E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.8A0.025SH
Ca1.6Al0.1Si2O6.331H1.162:1.6746H2O + 3.500H+ = 0.100Al+3 + 1.600Ca+2 + 2.000H4SiO4 + 0.0056H2O
log_k 22.347
delta_h -138.807 #kJ/mol #Internal calculation
-analytic -5.4374652E+2 -8.9580366E-2 3.3035982E+4 2.0009889E+2 -1.1674018E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.9A0.025SH
Ca1.8Al0.1Si2O6.5669H1.2338:1.7244H2O + 3.900H+ = 0.100Al+3 + 1.800Ca+2 + 2.000H4SiO4 + 0.2913H2O
log_k 26.541
delta_h -163.639 #kJ/mol #Internal calculation
-analytic -5.9805145E+2 -9.7985338E-2 3.7140315E+4 2.1986322E+2 -1.315579E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1A0.025SH
Ca2Al0.1Si2O6.8039H1.3078:1.774H2O + 4.300H+ = 0.100Al+3 + 2.000Ca+2 + 2.000H4SiO4 + 0.5779H2O
log_k 30.922
delta_h -189.516 #kJ/mol #Internal calculation
-analytic -6.5236552E+2 -1.0638756E-1 4.1299671E+4 2.3963151E+2 -1.463701E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.1A0.025SH
Ca2.2Al0.1Si2O7.0406H1.3812:1.93H2O + 4.700H+ = 0.100Al+3 + 2.200Ca+2 + 2.000H4SiO4 + 0.9706H2O
log_k 35.178
delta_h -213.999 #kJ/mol #Internal calculation
-analytic -7.0454912E+2 -1.1430126E-1 4.5269142E+4 2.5864468E+2 -1.6024806E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.2A0.025SH
Ca2.4Al0.1Si2O7.2809H1.4618:2.1052H2O + 5.100H+ = 0.100Al+3 + 2.400Ca+2 + 2.000H4SiO4 + 1.3861H2O
log_k 39.460
delta_h -238.434 #kJ/mol #Internal calculation
-analytic -7.5636538E+2 -1.2211461E-1 4.9215567E+4 2.7753006E+2 -1.7393322E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.3A0.025SH
Ca2.6Al0.1Si2O7.5579H1.6158:2.1808H2O + 5.500H+ = 0.100Al+3 + 2.600Ca+2 + 2.000H4SiO4 + 1.7387H2O
log_k 43.944
delta_h -263.978 #kJ/mol #Internal calculation
-analytic -8.1034646E+2 -1.3026358E-1 5.3335066E+4 2.9720685E+2 -1.8825162E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.4A0.025SH
Ca2.8Al0.1Si2O7.8451H1.7902:2.2346H2O + 5.900H+ = 0.100Al+3 + 2.800Ca+2 + 2.000H4SiO4 + 2.0797H2O
log_k 48.414
delta_h -289.389 #kJ/mol #Internal calculation
-analytic -7.8042196E+2 -1.2751558E-1 5.2461083E+4 2.8701572E+2 -1.7158666E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.5A0.025SH
Ca3Al0.1Si2O8.1324H1.9648:2.2886H2O + 6.300H+ = 0.100Al+3 + 3.000Ca+2 + 2.000H4SiO4 + 2.421H2O
log_k 52.886
delta_h -314.809 #kJ/mol #Internal calculation
-analytic -8.2758634E+2 -1.3478154E-1 5.6166021E+4 3.0427149E+2 -1.83337E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.7A0.05SH
Ca1.4Al0.2Si2O6.2658H1.1316:1.6968H2O + 3.400H+ + 0.0374H2O = 0.200Al+3 + 1.400Ca+2 + 2.000H4SiO4
log_k 19.900
delta_h -133.257 #kJ/mol #Internal calculation
-analytic -5.2768921E+2 -8.7991406E-2 3.187456E+4 1.9386485E+2 -1.136936E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.8A0.05SH
Ca1.6Al0.2Si2O6.4921H1.1842:1.7636H2O + 3.800H+ = 0.200Al+3 + 1.600Ca+2 + 2.000H4SiO4 + 0.2557H2O
log_k 23.764
delta_h -156.278 #kJ/mol #Internal calculation
-analytic -5.8160902E+2 -9.6350235E-2 3.5864147E+4 2.1348635E+2 -1.2842534E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C0.9A0.05SH
Ca1.8Al0.2Si2O6.7289H1.2578:1.7572H2O + 4.200H+ = 0.200Al+3 + 1.800Ca+2 + 2.000H4SiO4 + 0.4861H2O
log_k 28.379
delta_h -183.860 #kJ/mol #Internal calculation
-analytic -6.3704272E+2 -1.0501076E-1 4.0174046E+4 2.3365125E+2 -1.4373162E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1A0.05SH
Ca2Al0.2Si2O6.9642H1.3284:1.8024H2O + 4.600H+ = 0.200Al+3 + 2.000Ca+2 + 2.000H4SiO4 + 0.7666H2O
log_k 33.085
delta_h -211.659 #kJ/mol #Internal calculation
-analytic -6.9143688E+2 -1.134389E-1 4.443832E+4 2.534468E+2 -1.5859379E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.1A0.05SH
Ca2.2Al0.2Si2O7.1991H1.3982:2.02H2O + 5.000H+ = 0.200Al+3 + 2.200Ca+2 + 2.000H4SiO4 + 1.2191H2O
log_k 37.610
delta_h -237.307 #kJ/mol #Internal calculation
-analytic -6.7753942E+2 -1.1265172E-1 4.4549741E+4 2.4893329E+2 -1.480404E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.2A0.05SH
Ca2.4Al0.2Si2O7.4415H1.483:2.1564H2O + 5.400H+ = 0.200Al+3 + 2.400Ca+2 + 2.000H4SiO4 + 1.5979H2O
log_k 42.303
delta_h -264.305 #kJ/mol #Internal calculation
-analytic -7.2288188E+2 -1.196934E-1 4.8241853E+4 2.6551379E+2 -1.5937687E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.3A0.05SH
Ca2.6Al0.2Si2O7.7201H1.6402:2.1962H2O + 5.800H+ = 0.200Al+3 + 2.600Ca+2 + 2.000H4SiO4 + 1.9163H2O
log_k 47.278
delta_h -292.853 #kJ/mol #Internal calculation
-analytic -7.7031714E+2 -1.2705732E-1 5.2126066E+4 2.8285983E+2 -1.7131993E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.4A0.05SH
Ca2.8Al0.2Si2O8.0032H1.8064:2.2448H2O + 6.200H+ = 0.200Al+3 + 2.800Ca+2 + 2.000H4SiO4 + 2.248H2O
log_k 52.187
delta_h -320.883 #kJ/mol #Internal calculation
-analytic -8.1758219E+2 -1.3436375E-1 5.5973338E+4 3.0014851E+2 -1.8315015E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
C1.5A0.05SH
Ca3Al0.2Si2O8.2864H1.9728:2.2938H2O + 6.600H+ = 0.200Al+3 + 3.000Ca+2 + 2.000H4SiO4 + 2.5802H2O
log_k 57.105
delta_h -348.954 #kJ/mol #Internal calculation
-analytic -8.6483923E+2 -1.4166794E-1 5.9822317E+4 3.1743442E+2 -1.94976E+6
#References = LogK/DGf: 17roo/vie; DHf/DHr: Internal calculation; S°: 17roo/vie; Cp: 17roo/vie; V°: 17roo/vie;
Cu(OH)2
Cu(OH)2 + 2.000H+ = 1.000Cu+2 + 2.000H2O
log_k 8.669
delta_h -62.657 #kJ/mol #Internal calculation
-analytic -2.9452318E+2 -4.3540153E-2 1.845324E+4 1.0634043E+2 -7.8678568E+5
#References = LogK/DGf: 07pow/bro; DHf/DHr: Internal calculation; S°: 98cha; Cp: 98cha; V°: 84pan/stu;
CuF
CuF = 1.000Cu+ + 1.000F-
log_k -4.712
delta_h -129.724 #kJ/mol #84pan/stu
-analytic -7.9465376E+2 -1.2605647E-1 4.2205101E+4 2.8862866E+2 -2.5089325E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 09hon;
CuF2
CuF2 = 1.000Cu+2 + 2.000F-
log_k 1.114
delta_h -66.622 #kJ/mol #84pan/stu
-analytic -1.6993413E+3 -2.7172468E-1 9.5415187E+4 6.1527699E+2 -5.4239787E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 84pan/stu; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu;
CuF2:2H2O
CuF2:2H2O = 1.000Cu+2 + 2.000F- + 2.000H2O
log_k -4.551
delta_h -15.030 #kJ/mol #Internal calculation
-analytic -1.6573332E+3 -2.6149983E-1 9.063817E+4 6.0052159E+2 -5.262911E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 07gre/per;
Nantokite
CuCl = 1.000Cl- + 1.000Cu+
log_k -6.800
delta_h -103.430 #kJ/mol #Internal calculation
-analytic -7.2286759E+2 -1.1683599E-1 3.6968263E+4 2.6376791E+2 -2.2904645E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 84pan/stu; Cp: 84pan/stu; V°: 84pan/stu;
Melanothallite
CuCl2 = 1.000Cu+2 + 2.000Cl-
log_k 3.730
delta_h -48.708 #kJ/mol #Internal calculation
-analytic -1.5643025E+3 -2.5355698E-1 8.7639994E+4 5.6848485E+2 -5.066404E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 98cha; Cp: 98cha; V°: 84pan/stu;
Atacamite
Cu4Cl2(OH)6 + 6.000H+ = 2.000Cl- + 4.000Cu+2 + 6.000H2O
log_k 14.918
delta_h -142.094 #kJ/mol #Internal calculation
-analytic -2.4620526E+3 -3.8707733E-1 1.3878896E+5 8.9345209E+2 -7.4591846E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam;
Anilite
Cu1.75S + 1.000H+ = 1.500Cu+ + 0.250Cu+2 + 1.000HS-
log_k -31.220
delta_h -910.262 #kJ/mol #Internal calculation
-analytic -8.87995E+2 -1.392376E-1 3.877071E+4 3.2302246E+2 -2.759868E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 00pui; V°: 95rob/hem;
Djurleite
Cu1.934S + 1.000H+ = 1.868Cu+ + 0.066Cu+2 + 1.000HS-
log_k -33.330
delta_h -943.325 #kJ/mol #Internal calculation
-analytic -8.6915799E+2 -1.3576826E-1 3.6698016E+4 3.1661844E+2 -2.6872612E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 95rob/hem; Cp: 00pui; V°: 95rob/hem;
Cu2SO4
Cu2SO4 = 2.000Cu+ + 1.000SO4-2
log_k -1.387
delta_h -307.302 #kJ/mol #00pui
-analytic -1.5682312E+3 -2.4863215E-1 8.6686198E+4 5.6886229E+2 -5.1011765E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 00pui; S°: 00pui; Cp: 84pan/stu; V°: 84pan/stu;
Chalcanthite
CuSO4:5H2O = 1.000Cu+2 + 1.000SO4-2 + 5.000H2O
log_k -2.688
delta_h 6.384 #kJ/mol #Internal calculation
-analytic -1.6525922E+3 -2.4199862E-1 8.9694992E+4 5.9749946E+2 -5.0896659E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 95rob/hem; V°: 95rob/hem;
Brochantite
Cu4SO4(OH)6 + 6.000H+ = 4.000Cu+2 + 1.000SO4-2 + 6.000H2O
log_k 15.535
delta_h -175.083 #kJ/mol #Internal calculation
-analytic -2.5944891E+3 -4.0655611E-1 1.4781572E+5 9.3942886E+2 -7.9197585E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 95rob/hem; V°: 95rob/hem;
Langite
Cu4SO4(OH)6:H2O + 6.000H+ = 4.000Cu+2 + 1.000SO4-2 + 7.000H2O
log_k 17.487
delta_h -163.966 #kJ/mol #Internal calculation
-analytic -2.5330455E+3 -3.9031759E-1 1.4504863E+5 9.1671363E+2 -7.8171334E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam;
Antlerite
Cu3SO4(OH)4 + 4.000H+ = 3.000Cu+2 + 1.000SO4-2 + 4.000H2O
log_k 8.907
delta_h -128.158 #kJ/mol #Internal calculation
-analytic -2.2359098E+3 -3.5291038E-1 1.2793027E+5 8.0874917E+2 -7.1328777E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam;
Cu2SO5
Cu2SO5 + 2.000H+ = 2.000Cu+2 + 1.000SO4-2 + 1.000H2O
log_k 10.303
delta_h -137.222 #kJ/mol #00pui
-analytic -1.9763415E+3 -3.1468292E-1 1.146949E+5 7.1443294E+2 -6.403795E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 00pui; S°: 00pui; Cp: 98cha; V°: 98cha;
Cu4(NO3)2(OH)6
Cu4(NO3)2(OH)6 + 6.000H+ = 4.000Cu+2 + 2.000NO3- + 6.000H2O
log_k 14.498
delta_h 668.973 #kJ/mol #Internal calculation
-analytic -2.4055117E+3 -3.7174769E-1 1.349721E+5 8.7333888E+2 -7.3668105E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value;
Connellite
Cu37Cl8(SO4)2(OH)62:8H2O + 62.000H+ = 8.000Cl- + 37.000Cu+2 + 2.000SO4-2 + 70.000H2O
log_k 187.978
delta_h -1554.394 #kJ/mol #Internal calculation
-analytic -1.8625944E+4 -2.8480997E+0 1.0723675E+6 6.7442025E+3 -5.5269055E+7
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: 90rob/cam;
CuCO3
CuCO3 + 1.000H+ = 1.000HCO3- + 1.000Cu+2
log_k -1.120
delta_h -19.418 #kJ/mol #Internal calculation
-analytic -9.2673067E+2 -1.49069E-1 5.083938E+4 3.3633843E+2 -2.9075306E+6
#References = LogK/DGf: 00pui; DHf/DHr: Internal calculation; S°: 00pui; Cp: 00pui; V°: Default value;
# PMATCH GASES
Ar(g)
Ar = 1.000Ar
log_k -2.853
delta_h -12.011 #kJ/mol #Internal calculation
-analytic 1.0247191E+2 2.1560262E-2 -6.095971E+3 -3.9305313E+1 5.2903324E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
Br2(g)
Br2 + 2.500O2 + 1.000H2O = 2.000BrO3- + 2.000H+
log_k -40.271
delta_h 5.797 #kJ/mol #89cox/wag
-analytic -1.5145706E+3 -2.465034E-1 8.0920616E+4 5.4319619E+2 -6.0196789E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
CH4(g)
CH4 = 1.000CH4
log_k -2.852
delta_h -876.620 #kJ/mol #98cha
-analytic 2.1637571E+2 3.7708515E-2 -1.3407146E+4 -7.9788351E+1 1.0603261E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 98cha; S°: 98cha; Cp: 98cha; V°: 18sig;
Cl2(g)
Cl2 + 1.500O2 + 1.000H2O = 2.000ClO2- + 2.000H+
log_k -43.201
delta_h -54.397 #kJ/mol #By convention
-analytic -1.4812619E+3 -2.3817595E-1 7.5490338E+4 5.3237005E+2 -5.4614111E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
CO(g)
CO = 1.000CO
log_k -3.028
delta_h -287.503 #kJ/mol #89cox/wag
-analytic 2.039238E+2 3.3602959E-2 -1.3511309E+4 -7.4398533E+1 1.1059207E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
CO2(g)
CO2 + 1.000H2O = 1.000HCO3- + 1.000H+
log_k -7.819
delta_h -10.590 #kJ/mol #89cox/wag
-analytic -5.9614375E+2 -9.6336782E-2 3.2735447E+4 2.1383481E+2 -1.9439521E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
F2(g)
F2 + 1.000H2O = 2.000F- + 0.500O2 + 2.000H+
log_k 55.653
delta_h -390.937 #kJ/mol #By convention
-analytic -1.3156268E+3 -2.1051755E-1 9.1021366E+4 4.7499188E+2 -4.1405003E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
H2(g)
H2 + 0.500O2 = 1.000H2O
log_k 43.000
delta_h -279.763 #kJ/mol #By convention
-analytic -7.299061E+1 -9.6878407E-3 1.9260027E+4 2.3600172E+1 -3.6591724E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
H2O(g)
H2O = 1.000H2O
log_k 1.505
delta_h -44.004 #kJ/mol #89cox/wag
-analytic 1.1010218E-1 3.0216325E-3 1.8000225E+3 -2.5376E+0 6.5365932E+4
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
H2S(g)
H2S = 1.000HS- + 1.000H+
log_k -7.998
delta_h -864.473 #kJ/mol #89cox/wag
-analytic -7.7128067E+2 -1.2255574E-1 4.1398045E+4 2.7827883E+2 -2.4543487E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
HCl(g)
HCl = 1.000Cl- + 1.000H+
log_k 6.299
delta_h -74.770 #kJ/mol #89cox/wag
-analytic -6.3720544E+2 -1.0269616E-1 3.8570831E+4 2.2966743E+2 -2.0926558E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
He(g)
He = 1.000He
log_k -3.409
delta_h -0.634 #kJ/mol #By convention
-analytic 1.0815677E+2 2.2564966E-2 -6.7332064E+3 -4.102242E+1 5.153555E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
Hg(CH3)2(g)
Hg(CH3)2 + 2.000H+ = 1.000Hg+2 + 2.000CH4
log_k 8.824
delta_h -1827.166 #kJ/mol #82wag/eva
-analytic 1.186317E+2 2.4722556E-2 -6.5145222E+3 -4.4108205E+1 1.227984E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 82wag/eva; S°: 82wag/eva; Cp: 82wag/eva; V°: Default value;
Hg(g)
Hg = 1.000Hg
log_k -0.918
delta_h -170.933 #kJ/mol #89cox/wag
-analytic 1.4728151E+2 2.7804284E-2 -1.0282302E+4 -5.4875078E+1 1.2251434E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
I2(g)
I2 + 2.500O2 + 1.000H2O = 2.000IO3- + 2.000H+
log_k 13.954
delta_h 103.527 #kJ/mol #89cox/wag
-analytic -1.5955227E+3 -2.5854904E-1 1.0217236E+5 5.7111378E+2 -6.1610666E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
Kr(g)
Kr = 1.000Kr
log_k -2.599
delta_h -15.265 #kJ/mol #By convention
-analytic 1.5418728E+2 2.7181776E-2 -1.0136035E+4 -5.695289E+1 8.9175512E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
N2(g)
N2 = 1.000N2
log_k -3.181
delta_h 676.156 #kJ/mol #By convention
-analytic 1.912961E+2 3.2724035E-2 -1.2195929E+4 -7.0432479E+1 9.7360502E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
Ne(g)
Ne = 1.000Ne
log_k -3.340
delta_h -3.645 #kJ/mol #By convention
-analytic 1.0930257E+2 2.2478035E-2 -6.8539596E+3 -4.1431936E+1 5.4794524E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
NH3(g)
NH3 = 1.000NH3
log_k 1.810
delta_h -35.627 #kJ/mol #89cox/wag
-analytic -1.0678754E+2 -7.888845E-3 8.4083629E+3 3.5264317E+1 -4.0102718E+5
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
O2(g)
O2 = 1.000O2
log_k -2.893
delta_h -12.134 #kJ/mol #By convention
-analytic 1.7801864E+2 3.029253E-2 -1.1471782E+4 -6.5497358E+1 9.4241768E+5
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
S2(g)
S2 + 2.000H2O = 2.000HS- + 1.000O2 + 2.000H+
log_k -76.313
delta_h -1339.219 #kJ/mol #89cox/wag
-analytic -1.1526864E+3 -1.8611104E-1 4.0487117E+4 4.1853952E+2 -3.5184361E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
SO2(g)
SO2 + 1.000H2O = 1.000SO3-2 + 2.000H+
log_k -8.935
delta_h -320.633 #kJ/mol #89cox/wag
-analytic -9.7001743E+2 -1.5605541E-1 5.6939963E+4 3.4593396E+2 -3.4986818E+6
#References = LogK/DGf: Internal calculation; DHf/DHr: 89cox/wag; S°: 89cox/wag; Cp: 89cox/wag; V°: 18sig;
Xe(g)
Xe = 1.000Xe
log_k -2.358
delta_h -18.860 #kJ/mol #By convention
-analytic 2.4653608E+2 3.823462E-2 -1.6842529E+4 -8.8954045E+1 1.4495983E+6
#References = S°: 89cox/wag; Cp: 89cox/wag; V°: Default value;
References
# 00bru/dur Bruno J. and Duro L. (2000) Reply to W. Hummel's comment on and correction to 'On the influence of carbonate in mineral dissolution: 1. The thermodynamics and kinetics of hematite dissolution in bicarbonate solutions at T = 25 C' by J. Bruno, W. Stumm, P. Wersin, and F. Brandberg. Geochimica et Cosmochimica Acta 64(12), 2173-2176.
# 00bla/bid Bladh K.W., Bideaux R.A., Anthony-Morton E., Nichols B.G. (2000) The Handbook of Mineralogy Volume IV, Mineralogical Society of America.
# 00cou Courault, A. C., 2000, Simulation experimentale des C-S-H dans les betons modernes : etude de la composition et des proprietes a l'equilibre dans des milieux complexes : Ph.D. thesis, Universite de Bourgogne, Dijon, 201 p.
# 00cra/eig Crannell B.S., Eighmy T.T., Krzanowski J.E., Eusden J.D. Jr., Shaw E.L., Francis C.A., 2000, Heavy metal stabilization in municipal solid waste combustion bottom ash using soluble phosphate. Waste Manag., 20, 135-148
# 00deb/cas Deberdt S., Castet S., Dandurand J.L. and Harrichoury J.C., 2000. Potentiometric study of Gd- and Yb-acetate complexing in the temperature range 25-80 C. Chemical Geology, Volume 167, Issues 1-2, 5 June 2000, Pages 75-88
# 00gun/arn Gunnarson I., and Arnorsson S., 2000. Amorphous silica solubility and the thermodynamic properties of H4SiO4 in the range of 0 to 350 C at Psat. Geochimica et Cosmochimica Acta, 64, p. 2295-2307.
# 00lyd Lyde D.R., 2000. CRC Handbook of Chemistry and Physics, 2000-200. CRC Press
# 00mer/bon Merlino, S., Bonaccorsi, E., and Armbruster, T., 2000, The real structure of clinotobermorite and tobermorite 9 A: OD character, polytypes, and structural relationships: European Journal of Mineralogy, v. 12, p. 411-429.
# 00per/pal Perkins R.B. and Palmer C.D., 2000. Solubility of Ca6[Al(OH)6]2(CrO4)3.26 H2O, the chromate analog of ettringite; 5-75 C. Applied Geochem., 15, p. 1203-1218.
# 00rea/fag Reardon E.J., and Fagan R., 2000. The calcite/portlandite phase boundary: enhanced calcite solubility at high pH. Applied Geochemistry, 15, p. 327 335.
# 00sto/alp Stoffregen R. E., Alpers C. N., and Jambor J. L. (2000) Alunite-jarosite crystallography, thermodynamics, and geochronology. Rev. Mineral. Geochem. 40, 453-479.
# 00tag/dia Tagirov B. R., Diakonov I. I., Devina O. A., and Zotov A. V. (2000) Standard ferric-ferrous potential and stability of FeCl2+ to 90 C. Thermodynamic properties of Fe(aq)3+ and ferric-chloride species. Chemical Geology 162(3-4), 193-219.
# 00vie Vieillard P., 2000. A new method for the prediction of Gibbs free energies of formation of hydrated clay minerals based on the electronegativity scale. Clays and Clay Minerals, 48, p. 459-473.
# 00zue/feh Zuern, S.G., and Fehr, K.T., 2000. Phase relations and thermodynamic properties of 1.13 nm tobermorite and xonotlite. In: Sixth International Symposium on Hydrothermal reactions/Fourth International Conference on Solvo-thermal Reactions, Kochi, Japan, pp. 286-289.
# 01aki/zot Akinfiev N. N. and Zotov A. V., 2001. Thermodynamic Description of Chloride, Hydrosulfide, and Hydroxo Complexes of Ag(I), Cu(I), and Au(I) at Temperatures of 25-500oC and Pressures of 1-2000 bar. Geochem. Intern., v. 39, No 10, p. 990-1006. Abstract
# 01aya/mad Ayati M., and Madsen H.E.L., 2001. Solubility Product of the Cadmium Phosphate Cd5H2(PO4)4.4H2O at 37 C. J. Chem. Eng. Data, 46, p. 113 116.
# 01ben/jem Ben Cherifa A., and Jemal M., 2001. Synthese et thermochimie de phosphates au cadmium: Partie I: Cas du phosphate tricadmique et de la chlorapatite cadmiee. Thermochimica Acta, 366, p. 1 6.
# 01ben/pal Benezeth P., Palmer D.A., and Wesolowski D.J., 2001. Aqueous high-temperature solubility studies. II. The solubility of boehmite at 0.03 m ionic strength as a function of temperature and pH as determined by in situ measurements. Geochimica et Cosmochimica Acta, 65, p. 2097-2111
# 01fel/cho Felmy A. R., Cho H., Rustad J. R., and Mason M. J. (2001) An aqueous thermodynamic model for polymerized silica species to high ionic strength. Journal of Solution Chemistry 30(6), 509-525.
# 01fia/nav Fialips C.-I., Navrotsky A. and Petit S. (2001) - Crystal properties and energetics of synthetic kaolinite. American Mineralogist, 86, p. 304.311.
# 01fri/neu Fridriksson, T., Neuhoff, P. S., Arnorsson, S., and Bird, D. K., 2001, Geological constraints on the thermodynamic properties of the stilbite-stellerite solid solution in low-grade metabasalts. Geochimica Cosochimica Acta, v. 65, p. 3993-4008.
# 01gas/aza Gaskova O., Azaroual M., Piantone, P., Lassin A. (2001) - Arsenic behaviour in subsurface hydrogeochemical systems - A critical review of thermodynamic data forarsenic minerals and aqueous species - A compilation of arsenic surface complexation reactions. BRGM Report RP-51356-FR, 78 p.
# 01kal/mar Kahl W.A. and Maresch W.V., 2001. Enthalpies of formation of tremolite and talc by high-temperature solution calorimetry-a consistent picture. American Mineralogist, 86, p. 1345-1357
# 01mer/vie Lionel Mercury, Philippe Vieillard, Yves Tardy, 2001. Thermodynamics of ice polymorphs and 'ice-like' water in hydrates and hydroxides. Applied Geochemistry, Volume 16, Issue 2, February 2001, Pages 161-181
# 01per/hef Pererra N.W., Hefter G., and Sipos P.M., 2001. An Investigation of the Lead(II)-Hydroxide System. Inorg. Chem., 40, p. 3974-3978.
# 01per/pal Perkins R.B. and Palmer C.D., 2001. Solubility of chromate hydrocalumite (3CaO.Al2O3.CaCrO4.nH2O) at 5-75 C. Cement and Concrete Research, 31, pp. 983-992.
# 01pre/gam Preis W., and Gamsjager H., 2001. Invited Review Thermodynamic Investigation of Phase Equilibria in Metal Carbonate Water Carbon Dioxide Systems. Monatshefte fur Chemie, 132, p. 1327 1346.
# 01sch/sho Schulte M.D., Shock E.L. and Wood R.H., 2001. The temperature dependence of the standard-state thermodynamic properties of aqueous nonelectrolytes. Geochimica et Cosmochimica Acta, 65, 3919-3930
# 01ste A. Stefansson, 2001Dissolution of primary minerals of basalt in natural waters: I. Calculation of mineral solubilities from 0 C to 350 C. Chemical Geology, Volume 172, Issues 3-4, 225-250
# 01tag/sch Tagirov B., and Schott J., 2001. Aluminum speciation in crustal fluids revisited Geochim. Cosmochim. Acta (Helgeson's special issue), 65, p. 3965 3992.
# 01vid/par Vidal, O., Parra, T. and Trotet, F (2001): A thermodynamic model for Fe-Mg aluminous chlorite using data from phase equilibrium experiments and natural pelitic assemblages in the 100-600 C, 1-25 kbar P-T range. Am. J. Sci., 301, 557-592.
# 01wen/mus Wentzel M.C., Musvoto E.V. and Ekama G.A., 2001. Application of integrated chemical - physical processes modelling to aeration treatment of anaerobic digester liquors. Environmental Technology, 22, 1287-1293
# 02cho/sea Chou, I.M., Seal, R.R., Hemingway, B.S. (2002) Determination of melanterite-rozenite and chalcanthite-bonattite equilibria by humidity measurements at 0.1 MPa, Am. Mineral. 87, 108-114.
# 02dut Dutrizac J.E., 2002. Calcium sulphate solubilities in simulated zinc processing solutions. Hydrometallurgy, 65, p. 109-135.
# 02hem/sea Hemingway, B.S., Seal, R.R., II, and Chou, I-M. (2002) Thermodynamic data for modeling acid mine drainage problems. Part I. Selected soluble iron-sulfate minerals. U.S. Geological Survey Open File Report 02 - 161, 13 p.
# 02hum/ber NAGRA Hummel W., Berner U., Curti E., Pearson F.J., and Thoenen T., 2002. Nagra/PSI Chemical Thermodynamic Data Base 01/01. Universal Publishers (uPUBL.com), 600 pp.
# 02mig/will Migdisov Art A. and Williams-Jones A. E. 2002. A spectrophotometric study of neodymium(III) complexation in chloride solutions. Geochimica et Cosmochimica Acta, 66, 4311-4323
# 02ogo/mel Ogorodova L.P., Melchakova L.V., Kiseleva I.A. 2002 Enthalpies of formation of formation of natural zeolites - gismondine, garronite and amicite. Experimental mineralogy, petrology and geochemistry annual seminar 2002, April 16-17, 2002, Moscow
# 02par/vid Parra, T., Vidal, O., and Agard, P., 2002, A thermodynamic model for fe-mg dioctahedral k white micas using data from phase-equilibrium experiments and natural pelitic assemblages: Contribution to Mineralogy and Petrology, v. 143, p. 706-732.
# 03alt/met Altamaier M., Metz V., Neck V., Muller R.and Fanghanel Th., 2003. Solid liquid equilibria of Mg(OH)2(cr) and Mg2(OH)3Cl.4H2O(cr) in the system Mg Na H OH Cl H2O at 25 C. Geochimica et Cosmochimica Acta, 67, p. 3595-3601.
# 03bou Bourbon X., 2003. Chemical conceptual model for cement based materials ~ mineral phases and thermodynamic data. Technical report C.NT.ASCM.03.026, 14 p.
# 03chr Christov C., 2003. Thermodynamic study of the aqueous sodium, potassium, and chromium chloride systems at the temperature 298.15K. J. Chem. Thermodynamics, 35, p. 909-917.
# 03dea Dean J.A. 2003. Lange's Handbook of chemistry, 2nd edition. Science and technology press: Beijing (in Chinese).
# 03dro/bar Drouet C. , Baron D. , Navrotsky A. (2003) On the thermochemistry of the solid solution between jarosite and its chromate analog. American Mineralogist, 88, 1949-1954
# 03dro/nav Drouet C, Navrotsky A (2003) Synthesis, characterization and thermochemistry of K-Na-H3O jarosites. Geochim Cosmochim Acta 67:2063-2076
# 03fre/voi Freyer D., and Voigt W., 2003. Invited Review : Crystallization and Phase Stability of CaSO4 and CaSO4 - Based Salts. Monatshefte fur Chemie, 134, p. 693-719.
# 03maj/gre Majzlan., J., Grevel, K.-D., Navrotsky, A., (2003) Thermodynamics of iron oxides. H. Enthalpies of formation and relative stability of goethite (a-FeOOH), lepidocrocite (y-FeOOH), and maghemite (y-Fe2O3). American Mineralogist 88, 855-859.
# 03web/hun Weber C.F., and Hunt R.D., 2003. Modeling Alkaline Silicate Solutions at 25 C. Ind. Eng. Chem. Res., 42, p. 6970 6976.
# 03wil/wal Wilkin, R. T., D. Wallschlager, and R. G. Ford. 2003. Speciation of arsenic in sulfidic waters. Geochem. Trans. 4:1-7.
# 03zot/shi Zotov A. V., Shikina N. D. and Akinfiev N. N., 2003. Thermodynamic properties of the Sb(III) hydroxide complex Sb(OH)3(aq) at hydrothermal conditions. Geochimica et Cosmochimica Acta, Volume 67, 1821-1836
# 04chi Chivot J., 2004. Thermodynamique des produits de corrosion. Fonctions thermodynamiques de solubilite, diagrammes E-pH des systemes Fe-H2O, Fe-CO2-H2O, Fe-S-H2O, Cr-H2O et Ni-H2O en fonction de la temperature. Document ANDRA, Collection Sciences et Techniques.
# 04chr Christov C., 2004. 'Pitzer ion-interaction parameters for Fe(II) and Fe(III) in the quinary {Na + K + Mg + Cl + SO4 + H2O} system at T = 298.15 K.' J. Chem. Thermod. 36: 223-235.
# 04ess/fos Essington M.E., Foss J.E. and Roh Y., 2004. The soil mineralogy of lead at Horace's Villa. Soil Sci. Soc. Am. J., 68, p. 979 993.
# 04eva Evans B. (2004) The serpentine multisystem revisited: Chrysotile is metastable, International Geology Review, 46, 479-506
# 04fab/sax Fabrichnaya O., Saxena S.K., Richet P. and Westrum E.F. (Eds), 2004. Thermodynamic data, models, and phase diagrams in multicomponent oxide systems. ISBN 3-540-14018-2 Springer Verlag Berlin Heidelberg New York, 198 p.
# 04gab/vie Gaboreau S. and Vieillard Ph. (2004). Prediction of Gibbs free energies of formation of minerals of the alunite supergroup. Geochimica and Cosmochimica Acta, 68, 3307-3316
# 04gar/muc Alain Garand, Alfonso Mucci. The solubility of fluorite as a function of ionic strength and solution composition at 25 C and 1 atm total pressure. Marine Chemistry, Volume 91, Issues 1-4, 15 November 2004, Pages 27-35
# 04loo/pas Loos D., Pasel C., Luckas M., Schmidt Klaus G., and Herbell J.D., 2004. Experimental investigation and modelling of the solubility of calcite and gypsum in aqueous systems at higher ionic strength. Fluid Phase Equilibria, 219, p. 219-229.
# 04maj/nav Majzlan, J., Navrotsky, A., Schwertmann, U. (2004) Thermodynamics of iron oxides: Part III. Enthalpies of formation and stability of ferrihydrite (~Fe(OH)3), schwertmannite (~FeO(OH)3/4(SO4)1/8), and e-Fe2O3. Geochimica et Cosmochimica Acta 68, 1049-1059
# 04maj/ste Majzlan, J., Stevens, R., Boerio-Goates, J., Woodfield, B.F., Navrotsky, A., Burns, P.C., Crawford, M.K., Amos, T.G. (2004) Thermodynamic properties, low-temperature heat capacity anomalies, and single crystal X-ray refinement of hydronium jarosite, (H3O)Fe3(SO4)2(OH)6. Physics and Chemistry of Minerals 31, 518-531
# 04neu/hov Neuhoff, P.S., Hovis, G.L., Balassone, G., and Stebbins, J.F., 2004, Thermodynamic properties of analcime solid solutions. American Journal of Science, v. 304, p. 21-66.
# 04roi Roine A., 2004. HSC Chemistry: v5.0, Outokompu Research Oy: Pori.
# 04smi/mar Smith R.M., and Martell A.E., 2004. NIST Critically Selected Stability Constants of Metals Complexes Database, V 8.0. National Institute of Standards and Technology (NIST); Texas A and M University.
# 04wan/li Wang T. and Li Z., 2004. Some thermodynamic properties of calcium chromate. J. Chem. Eng. Data, 49, p. 1300-1302.
# 04xu/app Xu, T, J. A. Apps, and K. Pruess, Numerical simulation of CO2 disposal by mineral trapping in deep aquifers, Applied Geochemistry, 19, 917-936, 2004
# 05bes/app Bessinger, B. and Apps, J.A., 2005. The Hydrothermal Chemistry of Gold, Arsenic, Antimony, Mercury and Silver. Report LBNL-57395, 52 p.
# 05for/dro Forray, F.L., Drouet, C, Navrotsky, A. (2005) Thermochemistry of yavapaiite KFe(SO4)2: Formation and decomposition. Geochimica et Cosmochimica Acta 69(8), 2133-2140
# 05kin/par Kim T.G. and Park B., 2005. Synthesis and Growth Mechanisms of One-Dimensional Strontium Hydroxyapatite Nanostructures. Inorganic chemistry, 44, p. 9895-9901
# 05las/aza Lassin A., Azaroual M., Mercury L. (2005) 'Geochemistry of Unsaturated Soil Systems: Aqueous Speciation and Solubility of Minerals and Gases in Capillary Solutions'. Geochim. Cosmochim. Acta 69, 5187-5201.
# 05liu/mcp Liu W. and McPhail D.C., 2005. Thermodynamic properties of copper chloride complexes and copper transport in magmatic-hydrothermal solutions. Chemical Geology, 221, 21-39
# 05maj/nav Majzlan, J., Navrotsky, A., Stevens, R., Donaldson, M., Woodfield, B.F., Boerio-Goates, J. (2005) Thermodynamics of monoclinic Fe2(SO4)3. Journal of Chemical Thermodynamics 37, 802-809
# 05pok/rou Pokrovski G.S., Roux J., Hazemann J.L. and Testemale D. , 2005. An X-ray absorption spectroscopy study of argutite solubility and aqueous Ge(IV) speciation in hydrothermal fluids to 500 C and 400 bar. Chemical Geology, 217, 127-145
# 05vid/par Vidal O., Parra T., Vieillard, P., 2005. Thermodynamic properties of the Tschermak solid solution in Fe-chlorite: Application to natural examples and possible role of oxidation. American Mineralogist 90, 347-358.
# 05wal/pel Waldner, P., Pelton, A.D. (2005) Thermodynamic modeling of the Fe-S system. Journal of Phase Equilibria and Diffusion 26, 23-38.
# 06bla/ign Blanc P., Ignatadis I., Lassin A. et Burnol A., 2006. Thermochimie : Selection de constantes thermodynamiques pour le chrome, le cobalt et le strontium. Rapport final. Rapport BRGM 55083-FR.
# 06bla/las Blanc P., Lassin A., Gaucher E.C. et Jacquot E., 2006. Un modele thermodynamique et mineralogique de beton : prise en compte de l'influence de la temperature. Rapport final. Rapport BRGM 55084-FR.
# 06bla/pia Blanc P., Piantone P., Lassin A. et Burnol A., 2006. Thermochimie : Selection de constantes thermodynamiques pour les elements majeurs, le plomb et le cadmium. Rapport final. Rapport BRGM 54902-FR
# 06bod/las Bodenan F., Lassin A., Hottier M., Filippov L. et Piantone P., 2006. Projet Decalco - Piegeage et valorisation de dechet alcalin par passivation au CO2 industriel. Rapport BRGM/RP-55015-FR, 140 p.
# 06deo/nav Deore S., and Navrotsky A., 2006. Oxide melt solution calorimetry of sulfides: Enthalpy of formation of sphalerite, galena, greenockite, and hawleyite. American Mineralogist, 91, p. 400 403.
# 06gai/bla Gailhanou H., et Blanc P., 2006. Thermochimie - Estimation des entropies, capacites calorifiques et volumes molaires des phyllosilicates 2 :1 deshydrates. BRGM/RP-55095-FR
# 06gau/bla Gaucher E. C., Blanc P., Bardot F., Braibant G., Buschaert S., Crouzet C., Gautier A., Girard J.-P., Jacquot E., Lassin A., Negrel G., Tournassat C., Vinsot A., Altmann S. (2006) Modelling the porewater chemistry of the Callovian-Oxfordian formation at a at a regional scale, C. R. Geoscience 338 (2006).
# 06lan/mah Langmuir D, Mahoney J, Rowson J (2006) Solubility products of amorphous ferric arsenate and crystalline scorodite (Fe- AsO4_2H2O) and their application to arsenic behavior in buried mine tailings. Geochim Cosmochim Acta 70:2942-2956
# 06las/bla Lassin A. et Blanc P., 2006. Considerations sur les contraintes liees a la gestion des donnees thermodynamiques en vue de la creation de la base de donnees THERMODDEM. Rapport BRGM/RP-55118-FR, 120 p.
# 06mes/bou Messnaoui B., and Bounahmidi T., 2006. On the modeling of calcium sulfate solubility in aqueous solutions. Fluid Phase Equilibria, 244, p. 117-127.
# 06pia/bod Piantone P., Bodenan F. et Lassin A., 2006. Projet NOVOSOL - Evaluation environnementale de sediments phosphates et calcines. Rapport BRGM/RP-54845-FR, 133 p.
# 06pia/now Piantone P., Nowak C., Blanc P., Lassin A. et Burnol A., 2006. Themoddem : THERmodynamique et MOdelisation de la Degradation DEchets Mineraux. Rapport d'avancement. Rapport BRGM n BRGM/RP- 54547-FR, 52 p.
# 07avie Vieillard P., 2007. Estimation des entropies et capacites calorifiques des zeolithes. Rapport CNRS-Hydrasa 2007-2, 30 p.
# 07bla/bou Blanc P., Bourbon X. et Lassin A. (2007) Un modele thermodynamique et mineralogique de beton : selection de constantes thermodynamiques. Rapport final. Rapport BRGM/RP-55967-FR
# 07bla/gai Blanc P. et Gailhanou H. (2007) Thermochimie : Estimation des entropies, capacites calorifiques et volumes molaires des phyllosilicates deshydrates et hydrates. Rapport final. Rapport BRGM/RP-55966-FR.
# 07gai/bla Gailhanou H. et Blanc P., 2007. Thermochimie : Acquisition des proprietes thermodynamiques sur une saponite et revision des donnees sur les mineraux argileux. Rapport final BRGM/RP-55925-FR
# 07las brgm report in progress
# 07mar/acc Marini L, Accornero M (2007) Prediction of the thermodynamic properties of metal-arsenate and metal-arsenite aqueous complexes to high temperatures and pressures and some geological consequences. Environ Geol 52:1343-1363
# 07neu/wan Neuhoff P. S. and Wang J. (2007) Heat capacity of hydration. American Mineralogist 92, 1358-1367
# 07ste Stefansson A. (2007) Iron(III) hydrolysis at 25 C. Environ. Sci. Technol. 2007, 41, 6117-6123
# 07vie Vieillard P., 2007. THERMOCHIMIE : Estimation des enthalpies de formation des Phyllosilicates (7, 10 et 14A) anhydres. Rapport final. CNRS-Hydrasa 2007-1, 21 p.
# 08aza/and Azaroual M., Andre L., Blanc Ph., Jacquemet N., Crouzet C. (2008) Modelisation thermocinetique des phenomenes d'interaction eaux riches en gaz acides - ciment du casing des forages petroliers. Rapport BRGM/RC-56584-FR, 48 fig., 14 tabl., 124 p
# 08bas/pet Basciano L.C., Peterson R.C. (2008) Amer. Mineral., 93, 853-862
# 08bla Blanc P. (2008) : Thermoddem - Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses de fer. Rapport final. Rapport BRGM/RP-56587-FR, 70p.
# 08gai Gailhanou H. (2008) : Thermochimie : Acquisition des proprietes thermodynamiques sur une berthierine et revision des donnees sur les mineraux argileux. Rapport final BRGM/RP-56838-FR
# 08las Lassin A., 2008, personal calculations.
# 08per/pok Perfetti E., Pokrovski G., Ballerat-Busserolles K., Majer V., Gibert F. (2008) Densities and heat capacities of aqueous arsenious and arsenic acid solutions to 350 C and 300 bar, and revised thermodynamic properties of As(OH)3(aq), AsO(OH)3(aq) and iron sulfarsenide minerals. Geochimica et Cosmochimica Acta 72, 713-731
# 08sch/lot Schmidt, T., Lothenbach, B., Romer, M., Scrivener, K.L., Rentsch, D., Figi, R. (2008), A thermodynamic and experimental study of the conditions of thaumasite formation, Cement and Concrete Research, 38(3), 337-349.
# 08vie Vieillard P., 2008. Estimation des entropies et capacites calorifiques des zeolithes. Rapport CNRS-Hydrasa 2008, 29 p.
# 09bla Blanc P. (2009) - Thermochimie - Selection de constantes thermodynamiques pour les zeolites : version 2. Rapport final. Rapport BRGM/RP-57796-FR. 55 p.
# 09gai Gailhanou H. (2009) : Thermochimie : Acquisition des proprietes thermodynamiques d'une nontronite, d'une beidellite et revision des donnees de la saponite Sap-Ca-1. Rapport final BRGM/RP-57797-FR
# 09gai/rog Gailhanou, H., Rogez, J., van Miltenburg, J.C., van Genderen, A.C.G., Greneche, J.M., Gilles, C., Jalabert, D., Michau, N., Gaucher, E.C., Blanc, P., 2009. Thermodynamic properties of chlorite CCa-2. Heat capacities, heat contents and entropies. Geochimica et Cosmochimica Acta 73, 4738-4749.
# 10abla/bou Blanc, Ph.; Bourbon, X.; Lassin, A.; Gaucher, E.C. 2010 - Chemical model for cement-based materials: Temperature dependence of thermodynamic functions for nanocrystalline and crystalline C-S-H phases. Cement and Concrete Research, 40, p. 851-867
# 10bbla/bou Blanc, Ph.; Bourbon, X.; Lassin, A.; Gaucher, E.C. 2010 - Chemical model for cement-based materials: Thermodynamic data assessment for phases other than C-S-H. Cement and Concrete Research, 40, p. 1360-1374.
# 10bla/vie Blanc P. and Vieillard P. (2010) - Thermochimie: Estimation of the thermodynamic properties of dehydrated phyllosilicates. Final Report. BRGM/RP-57798-FR.
# 10vie Vieillard P., 2010 - A predictive model for the entropies and heat capacities of zeolites. Eur. J. Mineral. 22, 823-836
# 11bla/las Blanc P., Lassin A. 2011. Thermoddem report 2011
# 11maj/dra Majzlan J, Drahota P, Filippi M, Novak M, Loun J and Grevel K-D 2011. Thermodynamics of Crystalline iron(III) Arsenates Scorodite, Kankite, and Bukovskyite. Goldschmidt 2011 Conference Abstract 1391
# 11par/cor Parmentier M., Corvisier J., Chiquet P., Parra T. et Sterpenich J. 2011. La modelisation geochimique de la reactivite des gaz annexes co-injectes avec le CO2 : possibilites et limites des codes de calcul via une application. BRGM/RP-60605-FR
# 11vie/bla Vieillard, P., Blanc, P., Fialips, C.I., Gailhanou, H., Gaboreau, S., 2011. Hydration thermodynamics of the SWy-1 montmorillonite saturated with alkali and alkaline-earth cations: A predictive model. Geochimica et Cosmochimica Acta 75, 5664-5685. doi:10.1016/j.gca.2011.07.014
# 12bla Blanc P., 2012, Mercury associated physical and chemical constants: updating of the THERMODDEM database, IMaHg project, rapport BRGM RP-61299-FR, 32p
# 12gai/bla Gailhanou, H., Blanc, P., Rogez, J., Mikaelian, G., Kawaji, H., Olives, J., Amouric, M., Denoyel, R., S., B., Montouillout, V., Vieillard, P., Fialips, C. I., Giffaut, E., Michau, N., and Gaucher, E. C., 2012, Thermodynamic properties of illite IMt-2, smectite MX-80 and beidellite SBld-1 by calorimetric methods: Enthalpies of formation, heat capacities , entropies and Gibbs free energies of formation. : Geochimica Cosmochimica Acta, v. 89, p. 279-301.
# 13bla/gab Blanc P., Gaboreau S. (2013) - Thermoddem : Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses de nickel. Rapport final. BRGM/RP-61871-FR. 35 p., 12 fig., 4 tabl.
# 13bla/las Blanc P., Lassin A. (2013) - Thermoddem : Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses d'arsenic. Rapport final. BRGM/RP-62585-FR. 29 p., 5 fig., 3 tabl.
# 13gai/bla Gailhanou, H., Blanc, P., Rogez, J., Mikaelian, G., Horiuchi, K., Yamamura, Y., Saito, K., Kawaji, H., Warmont, F., Greneche, J.-M., Vieillard, P., Fialips, C.I., Giffaut, E., Gaucher, E.C., 2013. Thermodynamic properties of saponite, nontronite, and vermiculite derived from calorimetric measurements. American Mineralogist 98, 1834-1847.
# 14bla/gai Blanc, P., Gailhanou, H., Rogez, J., Mikaelian, G., Kawaji, H., Warmont, F., Grangeon, S., Greneche, J.M., Fialips, C.I., Giffaut, E., Gaucher, E.C., Claret, F., 2014, Thermodynamic properties of a chlorite and a berthierine by calorimetric methods: Physics and Chemistry of Minerals (accdepted)
# 14las/pia Lassin, A., Piantone, P., Crouzet, C., Bodenan, F., Blanc, P., 2014. Estimated thermodynamic properties of NaFeS2 and erdite (NaFeS2:2H2O). Applied Geochemistry 45, 14-24. doi:10.1016/j.apgeochem.2014.02.015
# 33dan D'Ans J., 1933. Die Losegleichgewichte der Systeme der Salze ozeanischer Salzablagerungen. Kaliorschungs Anstalt GmbH, Berlin Verlagsgesellschaft fur Ackerbau MBH, Berlin SW11
# 37hil Hill A.E., 1937. J. Am. Chem. Soc., 59, p. 2242.
# 37kie Kielland J., 1937. Individual Activity Coefficients of Ions in Aqueous Solutions. Journal of the American Chemical Society, 59, p. 1675 1678.
# 40rol/erv Roller P.S., and Ervin G., 1940. The system calcium oxide silicawater at 30 C. The association of silicate ion in dilute alkaline solution. J. Amer. Chem. Soc., 62, p. 461 471.
# 40sbo/bia Sborgi U., and Bianchi C., 1940. Ga. Chim. Ital., 70, p. 823.
# 41cor Correns C.W., 1941. Beitrage zur Petrographie und Genesis der Lydite (Kieselschiefer): Preuss. Geol. Ladesanstalt, Mitt. d. Abt. f. Gesteins , Erz , Kohle und Salz Untersuchungen, 1, p. 18 38.
# 41hum/sto Hume D.H. and Stone H.W. 1941. The apparent solubility product of chromous hydroxide. The significance of the solubility products of hydroxides of the metals with form basic salts. J. Am. Chem. Soc., 63 p. 1197-1199.
# 42kol/per Koltoff I.M., Perlich R.W. and Weiblen D., 1942. Solubility of lead sulfate and lead oxalate in various media. J. Phys. Chem, 46, p. 561.
# 50ken Kennedy G.C., 1950. A portion of the system silica water. Econ. Geol., 45, p. 629 653.
# 51den/mon Denney T.O. and Monk C.D. Trans. Faraday Soc., 47, p. 992.
# 51sch/mul Schwarz V.R., and Muller W.D., 1951. Die wasserlosliche monokieselsaure. Z. Anorg. Allg. Chemie., 2296, p. 273 279.
# 51zha Zharovskii F.G., 1951, The solubility of phosphates. Trudy. Kom. Anal. Khim. Akad. Nauk. SSSR, 3, 101-115 (in russian)
# 52lat Latimer W.M., 1952. Oxidation states of the elements and their potentials in aqueous solution, Prentice Hall, New Jersey,.392 pp.
# 52meg Megaw D., 1952, The structure of afwillite, Ca3(SiO3OH)2*2H2O, Locality: Scawt Hill, Northern Ireland, Act. Cryst.D60, v. 5, p. 477-495.
# 53bell/geo Bell R.P. et George J.H.B., 1953. Trans. Faraday Soc., 49, pp. 619-627
# 53hem Hemley J.J., 1953. A study of lead sulfide solubility and its relation to ore deposition. Econ. Geol., 48, p. 113 138.
# 53leu/kho Leussing, D.L., Kholtoff, I.M. (1953) The solubility product of ferrous and the ionization of aquo-ferrous ion. J. Amer. Chem. Soc. 75, 2476-2479.
# 53pag Page F.M., 1953. The dissociation constants of thiosulphuric acid. J. Chem. Soc., p. 1719 1724.
# 54ale/hes Alexander G.B., Heston W.M. and Iler R.K., 1954. The Solubility of Amorphous Silica in Water. J. Phys. Chem., 58, p. 453.
# 54dan D'Ans J., Bredtschneider D., Eick H., and Freund H E., 1954. Kali u Steinsalz, 9, p. 17.
# 56den/tay Dent, L. S., and Taylor, H. F. W., 1956, The dehydration of Xonotlite: Acta Crystallographica, v. 9, p. 1002-1004.
# 56new Newman, E., 1956., Heats. of Formation of Xonotlite, Hillebrandite, and Foshagite: Journal of Research of the National Bureau of. Standards, v. 57, p. 27-30.
# 57gre/pri Greenberg S.A., and Price E.W., 1957. The solubility of silica in solutions of electrolytes. J. Phys. Chem., 61, p. 1539 1541.
# 57oka/oku Okamoto G., Okura T., and Goto K., 1957. Properties of silica in water. Geochimica et Cosmochimica Acta, 12, p. 123 132.
# 59ing Ingri N., 1959. Equilibrium studies of polyanions IV. Silicate ions in NaC1 medium. Acta Chem. Scand. 13, p. 758 775.
# 59lag Lagerstrom G., 1959. Equilibrium studies of polyanions III. Silicate ions in NaCIO4 medium. Acta Chem. Scand., 13, p. 722 736.
# 60gar/tho Garrels R.M., Thompson M.E., and Siever R., 1960. Stability of some carbonates at 25 degrees C and one atmosphere total pressure. Am. J. Sci., 258, p. 402 418.
# 60kel Kelley, K.K., 1960, Contributions to the Data in Theoretical Metallurgy XIII: High Temperature Heat Content, Heat Capacities and Entropy Data for the Elements and Inorganic Compounds. U.S. Bureau of Mines Bulletin 584, 232 p.
# 60kit Kitahara S., 1960. The solubility of quartz in water at high temperatures and high pressures. Rev. Phys. Chem. Japan, 30, p. 109 137.
# 60lin/mor Lindsay W.L., Moreno E.C., 1960, Phosphate phase equilibria in soils. Soil Sci. Am. Proc., 24, 177-182
# 60pou Pourbaix M., 1960. Standard free energies of formation at 25 C, CEBELCOR Report, 684, Brussels, 57 pp.
# 60van/bru Van Lier J.A., de Bruyn P.L., and Overbeek J.T.G., 1960. The solubility of quartz. J. Phys. Chem., 64, p. 1675 1682.
# 61bchu/aly Chukhlantsev V.G., Alyamovskaya K.V., 1961b, Solubility product of copper, cobalt, nickel, and cadmium phosphates. Izvest. Vyss. Uch. Zaved. Khim. Khim. Tekh., 4, 706-709 (in russian)
# 61ber/new Berman H.A. and Newman E.S., 1961. Heat of formation of calcium aluminate monocarbonate at 25 C, Journal of Research of the National Bureau of Standards. A, Physics and Chemistry, 65, pp. 197-207
# 61boc Bock E., 1961. Can. J. Chem., 39, p. 1746.
# 61kel/kin Kelley K.K. and King E.G. (1961) U.S. Bureau of Mines Bulletin 500
# 61tru/hos Truesdell A.H., and Hostetler P.B., 1961. Dissociation constants of KSO4 from 10 500C. Geochim. Cosmochim. Acta, 32, p. 1019 1022.
# 62gar/tho Garrels R.M., and Thompson M.E., 1962. A chemical model for sea water at 25 degrees C and one atmosphere total pressure. Am. J. Sci., 260, p. 57 66.
# 62mor/fou Morey G.W., Foumier R.O., and Rowe J.J., 1962. The solubility of quartz in water in the temperature interval from 25 to 300 C. Geochim. Cusmochim. Acta, 26, p. 1029 1043.
# 62sie Siever R., 1962. Silica Solubility, 0 200 C, and the diagenesis of siliceous sediments. J. Geol., 70, p. 127 150.
# 63ber/new Berman H.A. and Newman E.S. 1963 - Heat of formation of calcium aluminate monosulfate at 25 C, Journal of Research of the National Bureau of Standards. A, Physics and Chemistry, 65, pp. 1-13
# 63fis Fischer K. (1963) Amer. Mineral., 48, 664-672
# 63hos Hostetler P.B., 1963. The stability and surface energy of Brucite in water at 25 C. Am. J. Sci., 261, p. 238-258.
# 63oet/mdo Oetting F.L., Mac Donald R.A., 1963, The thermodynamic properties of magnesium orthophosphate and magnesium pyrophosphate. J. Phys. Chem., 63, 2737-2743
# 63rob/sto Robie, R. A., and J. W. Stout, 1963. Heat capacity from 12 to 305K and entropy of talc and tremolite. J. Phys. Chem., 57, p. 2252-2256
# 63tay/fra Taylor A.W., Frazier A.W., Gurney E.L. and Smith J.P., 1963. Solubility product of di- and tri-magnesium phosphates and the dissociation of magnesium phosphate solutions. Trans. Farad. Soc., 59, 1585-1589
# 63wil Willix R. L. S. (1963) Ferrous-ferric redox reaction in the presence of sulphate ion, Trans. Faraday Soc., 59, 1315-1324
# 63wyc Wyckoff, R.W.G., 1963, Crystal Structures, Second edition, tome 4, Interscience Publishers, New York, p. 320-322.
# 64aega/wak Egan E.P., Wakefield Z.T., 1964a, Low temperature, heat capacity and entropy of anhydrous dicalcium phosphate 10 to 310 K. J. Chem. Eng. Data, 4, 541-544
# 64atay/gur Taylor A.W., Gurney E.L., 1964a, The dissolution of calcium aluminum phosphate CaAlH(PO4)2.6H2O. Soil Sci. Soc. Am. Proc., 28, 63-64
# 64bega/wak Egan E.P., Wakefield Z.T., 1964b, Low temperature, heat capacity and entropy of dicalcium phosphate dihydrate 10 to 310 K. J. Chem. Eng. Data, 9, 544-545
# 64sil/mar Sillen LG. and Martell A.E. 1964 - Stability constants of metal-complexes. The chemical society, special publication N 17, London.
# 65gam/stu Gamsjager H., Stuber H.U., and Schindler P., 1965. Helv. Chim. Acta, 48, p. 723.
# 65gre/bas Grezes G., and Bassett M., 1965. Contribution a l'etude de 1s eolubilite du carbonate de calcium. Compt. Rend. Accad. Sci., 260, p. 869 872.
# 65lah Lahiri S.C., 1965, Ferric-phosphoric acid system. J. Ind. Chem. Soc., 42, 715-724
# 65wyc Wyckoff R.W.G., 1965. Crystal Structures, v.3
# 66ega/wak Egan E.P., Wakefield Z.T., 1966, Low temperature, heat capacity and entropy of variscite, AlPO4.2H2O, 10 to 310 K. J. Chem. Eng. Data, 11, 610-611
# 66lah/adi Lahiri S.C. and Aditya S. 1966. J. Indian Chem. Soc., 43, 513.
# 66spi/mik Spitsyn V.I., Mikheev H.B., Khermann A., 1966, Thermodynamic study of the distribution of micro quantities of strontium between barium hydrogen phosphate and a solution. Dokl. Akad. Nauk. SSSR, 166, 658-659 (in russian)
# 67and/cou Andon R.J.L., Counsell J.F., Martin J.F., and Mash C.J., 1967. Thermodynamic properties of phosphorus compounds: II. Low temperature heat capacity and entropy of sodium mono-, di-, and triphosphates. J. Appl. Chem., 17, 65-70
# 68chu/mar Chughtai A., Marshall R., Nancollas G.H., 1968, Complexes in calcium phosphate solutions. J. Phys. Chem., 72, 208-211
# 68dan D'Ans J., 1968. Kali Steinsalz, 5, p. 109.
# 68mca Mac Cann H.G., 1968, The solubility of fluorapatite and its relationships to that of calcium fluoride. Arch. Oral Biol., 13, 987-1001
# 68nak Nakayama M., 1968. Calcium activity, complex and ion pair in saturated CaCO, solutions. Soil sci., 106, p. 429 434.
# 68rac/sop Racz G.J., Soper R.J., 1968, Solubility of dimagnesium phosphate trihydrate and trimagnesium phosphate. Can. J. Soil Sci., 48, 265-269
# 68val/kog Valyashko V.M., Kogarko L.N., Khodakovsky I.L., 1968, Stability of fluorapatite, chlorapatite, and hydroxylapatite in aqueous solutions at different temperature. Geoch. Inter., 5, 21-30
# 68wag/eva Wagman D.D., Evans W.H., Parker V.B., Halow I., Bailey S.M., Schumm R.H., 1968. Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-3, 264 p.
# 69bol/ptu Bol'shakov, A.P. and L.I. Ptushko (1969) Alteration products of melanterite from Nikitov mercury ore deposits. Zap. Vses. Mineral. Obshch., 3, 288-294 (in Russian).
# 69hel Helgeson, 1969H.C. Helgeson, Thermodynamics of hydrothermal systems at elevated temperatures and pressures, Am. J. Sci. 267 (1969), pp. 729-804.
# 69iza/eat Izatt R.M., Eatough D.E., Christensen J.J., Bartholomew C.H. (1969) Calorimetrically determined log K, DeltaH and DeltaS values for the inter-action of sulphate ion with several bi- and ter-valent metal ions. J. Chem. Soc. (A), 47-53.
# 69qui/mar Quist A.S., and Marshall W.L., 1969. The electrical conductances of some alkali metal halides in aqueous solutions from 0 to 800 and pressures to 4000 bars. J. Phys. Chem., 73, p. 978 985.
# 69wag/eva Wagman D.D., Evans W.H., Parker V.B., Halow I., Bailey S.M., Schumm R.H., 1969. Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-4, 152 p.
# 70gre/mor Gregory T.M., Moreno E.C., Brown W.E., 1970, Solubility of CaHPO4.2H2O in the system Ca(OH)2-H3PO4-H2O at 5, 15, 25, and 37 C. J. Res. NBS, 74A, 461-475
# 70moo/tay Moore A.E., Taylor H.F.W., 1970. Acta Cryst., B26, 386-393
# 70pan Pankratz, L.B., 1970, Thermodynamic Data for Silver Chloride and Silver Bromide: U.S. Bureau of Mines Report of Investigations #7430, 12 p.
# 70pan/kin Pankratz, L.B., and King, E.G., 1970, High-Temperature Enthalpies and entropies of chalcopyrite and bornite: U.S. Bureau of Mines Report of Investigations #7435, 10 p.
# 70web/rac Webber M.D., Racz G.J., 1970, Soluble complexes in the systems dicalcium phosphate dihydrate or dimagnesium phosphate trihydrate equilibrated with aqueous salt solutions. Can. J. Soil Sci., 50, 243-253
# 71aduf Duff E.J., 1971a, Orthophosphates. II. The transformation Brushite -> Fluorapatite and Monetite -> Fluorapatite in aqueous potassium fluoride solution. J. Chem. Soc. A, 33-38
# 71bduf Duff E.J., 1971b, Orthophosphates. III. The hydrolysis of secondary calcium orthophosphates. J. Chem. Soc. A, 917-921
# 71cre/and Crerar D.A., and Anderson G.M., 1971. Solubility and solvation reactions of quartz in dilute hydrothermal solutions. Chem. Geol., 8, p. 107 122.
# 71ell/gig Ellis A.J., and Giggenbach W., 1971. Hydrogen sulphide ionization and sulphur hydrolysis in high temperature solution. Geochim. Cosmochim. Acta, 35, p. 247 260.
# 71mac/gee Mackenzie F.T., and Gees R., 1971. Quartz: Synthesis at earthsurface conditions. Science, 173, p. 533 535.
# 71nri Nriagu J.O., 1971. Experimental investigation of a portion of the system PbS NaCl HCl H 2 O at elevated temperatures. American Journal of Science, 271, p.157 169.
# 71par/wag Parker V.B., Wagman D.D., Evans W.H., 1971, Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-6 - 270-119
# 71sil/mar Sillen L G and Martell A E 1971 Stability constant of metal ion complexes, Special publications 17 and 25 (London: The Chemical Society)
# 71wag/eva Wagman D.D., Evans W.H., Parker V.B., Halow I., Bailey S.M., Schumm R.H., Churney K.L., 1971. Selected values of chemical thermodynamic properties. Natl. Bur. Stand. Tech. Note, 270-5, 49 p.
# 72anri Nriagu J.O., 1972a, Lead orthophosphates. I. Solubility and hydrolysis of secondary lead orthophosphates. Inorg. Chem., 11, 2499-2503
# 72bduf Duff E.J., 1972b, Orthophosphates. IX. Chlorapatite: Phase relationships under aqueous conditions along Ca5F(PO4)3-Ca5(OH)(PO4)3-Ca5Cl(PO4)3 joins of the system CaO-CaCl2-CaF2-P2O5-H2O. J. Inorg. Nucl. Chem., 34, 859-871
# 72bnri Nriagu J.O., 1972b, Stability of vivianite and ion-pair formation in the system Fe3(PO4)2-H3PO4-H2O. Geochim. Cosmochim. Acta, 36, 459-470
# 72cnri Nriagu J.O., 1972c, Solubility equilibrium constant of strengite. Am. J. Sci., 272, 476-484
# 72hem/rob Hemingway B.S. and Robie R.A., 1972. The heat capacities at low temperatures and entropies at 298.15 K of huntite, CaMg3(CO3)4, and artinite, Mg2(OH)2CO3 z 3 H2O. Am. Mineral., 57, pp. 1754-1767.
# 72mer Mereiter K (1972) Tschermaks Mineralogische und Petrographische Mitteilungen , 18, p.185-202, Die kristallstruktur des voltaits, K2Fe2+5Fe3+3Al[SO4]12*18H2O
# 72rob/hem Robie R.A. and Hemingway B.S., 1972. The heat capacities at low-temperatures and entropies at 298.15 K of nesquehonite, MgCO3 :3H2O, and hydromagnesite. Am. Mineral., 57, pp. 1768-1781.
# 72vol/kho Volosov A.G., Khodakovskiy I.L., and Ryzhenko B.N., 1972. Equilibria in the system SiO2 H20 at elevated temperatures along the lower three phase curve. Geochem. Intl., 9, p. 362 377.
# 73anri Nriagu J.O., 1973a, Lead orthophosphates. II. Stability of chloropyromorphite at 25 C. Geochim. Cosmochim. Acta, 37, 367-377
# 73bar/kna Barin I. and Knacke O., 1973, Thermochemical Properties of Inorganic Substances. Berlin: Springer-Verlag.
# 73bnri Nriagu J.O., 1973b, Solubility equilibrium constant of a-hopeite. Geochim. Cosmochim. Acta, 37, 2357-2361
# 73hem/rob Hemingway B. S. and Robie R. A., 1973. A calorimetric determination of the standard enthalpies of formation of huntite, CaMg3(CO3)4, and artinite, Mg2(OH)2CO3 z 3 H2O, and their standard Gibbs free energies of formation. J. Res. U.S. Geol. Survey, 1, pp. 535-541.
# 73hul/des Hultgren R., Desai P. D., Hawkins D. T., Gleiser M., Kelly K. K. and Wagman D. (1973) Selected Values of the Thermodynamic Properties of the Elements. Metals Park, Ohio, AMS.
# 73hul/tur Hull H. and Turnbull A.J., 1973, A thermochemical study of monohydrocalcite. Geochim. Cosmochim. Acta, 37, 685-694
# 73rob/hem Hemingway B. S. and Robie R. A., 1973. A calorimetric determination of the standard enthalpies of formation of huntite, CaMg3(CO3)4, and artinite, Mg2(OH)2CO3 z 3 H2O, and their standard Gibbs free energies of formation. J. Res. U.S. Geol. Survey, 1, pp. 535-541.
# 74avol/yag Volkov A.I., Yaglov V.N., Novikov G.I.,1974a, Heat of formation of trizinc diorthophosphate. Russ. J. Phys. Chem., 48, 1697
# 74cat/fer Catti M , Ferraris G , Acta Crystallographica, Section B , 30 (1974) p.1789-1794, Crystal structure of Ca5(HAsO4)2(AsO4)2*9H2O (guerinite), Locality: synthetic
# 74ham Hamann S.D., 1974. Electrolyte solutions at high pressure. In Modern Aspects of Electrachemistry, Plenum, No. 9 (ed. Conway B.E. and Bockris J. O.), p. 47 158.
# 74jac/lan Jacobson R.L., and Langmuir D., 1974. Dissociation constants of calcite and CaHCO3+ from 0 to 50 C. Geochimica et Cosmochimica Acta, 88, p. 301 318.
# 74mil Mills K.C., 1974, Thermodynamic data for inorganic sulfides, selenides, and tellurides. Butterworths, London, 845 p.
# 74nau/ryz Naumov G.B., Ryzhenko B.N., and Khodakovsky I.L., 1974. Handbook of Thermodynamic Data. U.S. Geol. Surv.WRD 74 001, 328 pp.
# 74nri Nriagu J.O., 1974. Lead orthophosphates-IV Formation and stability in the environment. Geochimica et Cosmochimica Acta, 38, p. 887 898.
# 74rea/lan Reardon E.J., and Langmuir D., 1974. Thermodynamic properties of the ion pairs CaCO3 and MgCO3 from 10 to 50 C. Am. J. Sci., 274, p. 599-612.
# 74sew Seward T.M., 1974. Determination of the first ionization constant of silicic acid from quartz soIubility in borate buffer soIutions to 350 C. Geochimica et Cosmochimica Acta, 38, p. 1651 1664.
# 74tru/jon Truesdell A.H., Jones B.F., 1974, WATEQ, a computer program for calculating chemical equilibria of natural waters. J. Res. US Geol. Surv., 2, 233-248
# 75kas/bor Kashkai C. M., Borovskaya Y. B., and Badazade M. A. (1975) Determination of DG f,298 of synthetic jarosite and its sulfate analogues. Geokhimiya 7, 771-783 (in Russian).
# 76ale/mas Aleshchkina A.E., Masalovich V.M., Agasyan P.K., Sereda B.P., 1976, Chromium (III) phosphate-complexes. Russ. J. Inorg. Chem., 21, 973-975
# 76bae/mes Baes Jr. C.F., and Mesmer R.E., 1976. The Hydrolysis of Cations. Wiley Interscience, 489 pp.
# 76del/hal Dellien I., Hall F.M. and Hepler L.G. 1976. Chromium, molybdenum and tungsten: Thermodynamic properties, chemical equilibria, and standard potentials. Chemical Reviews, 76, p. 283-310.
# 76del/hep Dellien I. and Hepler L.G., 1976b. Enthalpies of formation of Cr3+(aq) and the inner sphere complexes CrF2+(aq), CrCl2+(aq), CrBr2+(aq), and CrSO4+(aq). Can. J. Chem., 54, p.1383-1387.
# 76fer/stu Ferrante M.J., Stuve J.M. and Richardson D.W., 1976. Thermodynamic data for synthetic dawsonite. U.S. Bur. Mines Rept. Inv., 5, 577-582
# 76gro/wes Gronvold and Westrum, 1976. F. Gronvold and E.F. Westrum, Heat capacities of iron disulfides. Thermodynamics of marcasite from 5 to 700 K, pyrite from 300 to 780 K, and the transformation of marcasite to pyrite. J. Chem. Therm. 8 (1976), pp. 1039-1048
# 76hou/ste Houtepen, C. J. M., and Stein, H. N., 1976, The enthalpies of formation and of dehydration of some AFm phases with singly charged anions: Cement and Concrete Research, v. 6, p. 651-658
# 76men/sab Menchetti S., Sabelli C. (1976) Neues Jb. Miner., Mh., H.9, 406-417
# 76nri Nriagu J.O., 1976, Phosphate-clay mineral relations in soils and sediments. Can. J. Earth Sci., 13, 717-736
# 76plu/jon Plummer L.N., Jones B.F. and Truesdell A.H., 1976, WATEQF - A FORTRAN IV version of WATEQ, a computer program for calculating chemical equilibrium of natural waters: U.S.G.S. Water Resources Inv. 76-13., 63 p.
# 76rob/hem Robie R.A., Hemingway B.S. et Wilson H.W., 1976. The heat capacities of calorimetry conference copper and of muscovite, pyrophylite, and illite between 15 and 375 K and their standard entropies at 298.15 K. J. Research U.S. Geol. Survey., 4, p. 631-644.
# 76rob/hem Robie R.A., Hemingway B.S. and Wilson H.W. (1976) - The heat capacities of calorimetry conference copper and of muscovite, pyrophylite, and illite between 15 and 375 K and their standard entropies at 298.15 K. J. Research U.S. Geol. Survey., 4, p. 631-644.
# 76smi/mar Smith R.M., Martell A.E., 1976, Critical stability constants, Vol. 4: Inorganic complexes. Plenum, New York, 257 p.
# 76tso Tsonopoulos C., Coulson D.M., and Inman L.B., 1976. Ionization constants of water pollutants. J. Chem. Eng. Data, 21, p. 190 193.
# 76wag/eva Wagman D.D., Evans W.H., Parker V.B., Schumm R.H., 1976. Chemical thermodynamic properties of compounds of sodium, potassium, and rubidium, an interim tabulation of selected values. Natl. Bur. Stand. Tech. Note, 270, 73 p.
# 77bar/kna Barin I., Knacke O., and Kubaschewski I., 1977: Thermochemical properties of inorganic substances. Springer Verlag, Berlin.
# 77bus/mes Busey R.H., and Mesmer R.E., 1977. Ionization equilibria of silicic acid and polysilicate formation in aqueous sodium chloride solutions to 300 C. Inorg. Chem., 16, p. 2444 2450.
# 77fou/row Fournier R.O., and Rowe J.J., 1977. The solubility of amorphous silica in water at high temperatures and high pressures. Amer. Mineral., 62, p. 1052 1056.
# 77hem/rob Hemingway B.S., Robie R.A., Fisher J.R., et Wilson W.H., 1977. Heat capacity of gibbsite, Al(OH)3, between 13 and 480 K and magnesite, MgCO3, between 13 and 380 K and their standard entropies at 289.15 K, and the heat capacities of calorimetry conference benzoic acid between 12 and 316 K. J. Res. U. S. Geol. Survey, 5, p. 797-806.
# 77mac/hos MacGee K.A., and Hostetler P.B., 1977. Studies in the system MgO SiO2 CO2 H2O (IV): The stability of MgOH+ from 10 to 90 C., Am. J. Sci., 275, p. 304 317.
# 77rie/gam Riesen W., Gamsjager H., and Schindler P.W., 1977. Complex formation in the ternary system Mg(II) CO2 H2O . Geochimica et Cosmochimica Acta, 41, p. 1193 1200.
# 77sre Sretenskaya N.G., 1977. Dissociation of hydrogen sulfide acid under pressure. Geokhimiya, 3, p. 430 438 (in Russian).
# 78hel/del Helgeson, H.C., Delany, J.M, Nesbitt, H.W., and Bird, D.K., 1978. Summary and Critique of the Thermodynamic Properties of Rock Forming Minerals: Amer. J. Sci., 278A, 229 pp.
# 78kru/sta Kruykov P.A., and Starostina L.I., 1978. The first ionization constants of hydrogen sulfide at temperature to 150 C. lzvestija Sibirskogo Otdeleniya AN SSSR, 14, p. 87 93.
# 78ric/nri Rickard D.T., Nriagu J.O., 1978, Aqueous environmental chemistry of lead. In: The biochemistry of lead in the environment. Part A. Ecological Cycles, J.O. Nriagu (Ed), Elsevier/North-Holland Biomedical Press, 219-284
# 78rob/hem Robie R.A., Hemingway B.S., and Fisher J.R., 1978. Thermodynamic properties of minerals and related substances at 298.15K and 1 bar 105 Pascals pressure and at higher temperatures. US Geol. Survey Bull., 1452, 456 pp.
# 78yag Yaglov V.N., 1978, Some characteristics of dehydration of hydrates of 3d elements orthophosphates. Khim. Khim. Tekhnol. (Minsk), 13, 7-14 (in russian)
# 79ede/sat Ederova, J., and Satava, V., 1979, Heat capacities of C3AH6, C4ASH12 and C6AS3H32: Thermochimica Acta, v. 31, p. 126-128
# 79kru/rob Krupka, K.M., Robie, R.A., Hemingway, B.S., 1979. High-temperatur heat capacities of corundum, periclas, anorthite, CaAl2S2O8 glass, muscovite, pyrophyllite, KAlSi3O8 glass, grossular and NaAlSi3O8 glass. Am. Mineral., 64, p. 86-101
# 79lan Langmuir D., 1979, Techniques of estimating thermodynamic properties for some aqueous complexes of geochemical interest, in Jenne, E.A., ed., Chemical Modeling in Aqueous systems: Speciation, Sorption, Solubility, and Kinetics: ACS Symp. Ser. 93, Amer. Ch
# 79lle Iler R.K., 1979. The Chemistry of Silica: Solubility, Polymerization, Colloid and Surface Properties, and Biochemistry. Wiley, New York.
# 79mat/spo Mattigod S.V., and Sposito G., 1979, Chemical modeling of trace metal equilibria in contaminated soil solutions using the computer program GEOCHEM. In: Chemical Modeling in Aqueous Systems: Speciation, Sorption, Solubility, and Kinetics, E.A. Jenne (Ed),
# 79may/hel May H.M., Helmke P.A., and Jackson M.L., 1979. Gibbsite solubility and thermodynamic properties of hydroxy aluminum ions in aqueous solution at 25 C. Geochimica et Cosmochimica Acta, 43, 861 868.
# 79vie/tar Vieillard P., Tardy Y., Nahon D., 1979, Stability field of clays and aluminum phosphates: Parageneses in lateritic weathering of argillaceous phosphatic sediments. Am. Miner., 64, 626-634
# 79vol Volkov A.I., 1979, Thermochemical study of 3d element orthophosphates. Khim. Khim. Tekhnol. (Minsk), 14, 58-64 (in russian)
# 80bal/nor Ball J.W., Nordstrom D.K., Everett A.J., 1980, Additional and revised thermochemical data and computer code for WATEQ 2. A computerized chemical model for trace and major element speciation and mineral equilibria of natural waters. US Geol. Surv. Wat. Res
# 80cle/joh Clever H.L. and Johnston F.J., 1980. The solubility of some sparingly soluble lead salts: An evaluation of the solubility in water and aqueous electrolyte solutions, J. Phys. Chem. Ref. Data, 9, p. 751 784.
# 80har/wea Harvie C.E., and Weare J.H., 1980. The prediction of mineral soluhilities in natural waters: the Na K Mg Ca Cl SO4 H2O system from zero to high concentration at 25 C. Geochimica et Cosmochimica Acta, 44, p. 981 997.
# 80hem/mon Hemley J.J., Montoya J.W., Marinenko J.W., and Lute R.W., 1980. Equilibria in the system Al2O3 SiO2 H2O and some general implications for alteration/mineralization processes. Econ. Geol., 75, p. 210 228.
# 81bae/mes Baes Jr. C.F., and Mesmer R.E., 1981. The thermodynamics of cation hydrolysis. Am. J. Sci., 281, p. 935-962.
# 81tur/whi Turner D.R., Whitfield M. and Dickson A.G., 1981. The equilibrium speciation of dissolved components in freshwater and seawater at 25 C and 1 atm. pressure. Geochim. Cosmochim. Acta, 45, p. 855 881.
# 82bar/mcc Barbero J.A., McCurdy K.G., and Tremaine P.R., 1982. Apparent molal heat capacities and volumes of aqueous hydrogen sulphide and sodium hydrogen sulfide near 25 C: The temperature dependence of H2S ionization. Canadian J. Chem., 60, p. 1872 1880.
# 82bil/sch Bilinski H., and Schindler P., 1982. Solubility and equilibrium constants of lead in carbonate solutions (25 C, I = 0.3 mol dm 3). Geochimica et Cosmochimica Acta, 46, p. 921 928.
# 82cox/wag Cox J.D., Wagman D.D., et Medvedev V.A., 1989. CODATA Key Values for Thermodynamics.: editors. Hemisphere Publishing Corp.: New York. 279 pp.
# 82dek DeKock, C.W., 1982, Thermodynamic properties of selected transition metal sulfates and their hydrates: U.S. Bur. Mines Info. Circ. 8910, 45 p.
# 82far/fra V.C. Farmer and A.R. Fraser, Chemical and colloidal stability of sols in the Al2O3-Fe2O3-SiO2-H2O system: Their role in podzolization, J. Soil Sci. 33 (1982), pp. 737-742
# 82joh/flo Johnson G. K., Flotow H. E., O'Hare P. A. G., and Wise W. S. (1982) Thermodynamic studies of zeolites : analcime and dehydrated analcime. American Mineralogist 67, 736-748.
# 82pan Pankratz L. B., 1982, Thermodynamic Properties of Elements and Oxides (U. S. Bureau of Mines Bulletin 672, 1982, 509 p).
# 82pat/slo Patterson C.S., Slocum G.H., Busey R.H., and Mesmer R.E., 1982. Carbonate equilibria in hydrothermal systems: first ionization of carbonic acid in NaCl media to 300 C. Geochimica and Cosmochimica Acta, 46, p. 1653
# 82plu/bus Plummer, L.N. and Busenberg, E., 1982. The Solubilities of Calcite, Aragonite, and Vaterite in CO2-H2O Solutions Between 0 and 90 C and an Evaluation of the Aqueous Model of the System CaCO3-CO2-H2O. Geochimica et Cosmochimica Acta, Vol. 46, p. 1011-1040.
# 82ric/bot Richet P., Bottinga Y., Denielon L., Petitet J.P., and Tequi C., 1982. Thermodynamics properties of quartz, cristobalite and amorphous SiO2: Drop calorimetry measurements between 1000 and 1800 K and a review from 0 to 2000 K. Geochimica et Cosmochimica Acta, 46, p. 2639-2658.
# 82van Vanderzee C.E., 1982. Thermodynamic relations and equilibria in (Na2CO3 + NaHCO3 + H2O): Standard Gibbs energies of formation and other properties of sodium hydrogen carbonate, sodium carbonate heptahydrate, sodium carbonate decahydrate, trona: (Na2CO3CNaHCO3C2H2O), and Wegscheider's salt: (Na2CO3C3NaHCO3). J. Chem. Thermodynamics, 14, 219-238
# 82wag/eva Wagman D.D., Evans W.H., Parker V.B., Schumm R.H., Halow I., Bailey S.M., Churney K.L., and Nutall R.L., 1982. The NBS Tables of Chemical Thermodynamic Properties. J. Phys. Chem. Ref. Data, 11, Suppl. 2.
# 83bow/hel Bowers, T.S., and Helgeson, H.C., 1983, Calculation of the thermodynamic and geochemical consequences of nonideal mixing in the system H2O-CO2-NaCl on phase relations in geologic systems: Equation of state for H2O-CO2-NaCl fluids at high pressures and temperatures: Geochim. Cosmo. Acta, v. 47, pp. 1247-1275.
# 83joh/flo Johnson G. K., Flotow H. E., and O'Hare P. A. G. (1983) Thermodynamic studies of zeolites:natrolite mesolite and scolecite. American Mineralogist 68, 1137-1145
# 83mic/deb Micskei K., Debreczeni F. and Nagypal I., 1983. Equilibria in aqueous solutions of some chromium (2+) complexes. J. Chem. Soc. Dalton Trans., p. 1335-1338.
# 83miy/kle Miyano T, Klein C (1983 a) Phase relations of orthopyroxene, olivine, and grunerite in high-grade metamorphic iron-formation.Am Mineral 68:699-716
# 83san/bar Sangameshwar S.R., and Barnes H.L., 1983. Supergene processes in zinc lead silver sulfide ores in carbonates, Econ. Geol., 78, p 1379 1397.
# 84bus/plu Busenberg E., Plummer L.N. and Parker V.B., 1984. The solubility of strontianite (SrCO3) in CO2-H2O solutions between 2 and 91 C, the association constants of SrHCO3+(aq) and SrCO3O(aq) between 5 and 80 C, and an evaluation of the thermodynamic properties of Sr++(aq) and SrCO3(cr) at 25 C and 1 atm total pressure. Geochim. et Cosmochim. Acta, 48, p. 2021-2035.
# 84har/mol Harvie C.E., Moller N., and Weare J.H.. 1984, The prediction of mineral solubilities in natural waters: The Na-K-Mg-Ca-H-Cl-SO4-OH-HCO3-CO3-CO2-H2O system to high ionic strengths at 25 C. Geochimica Cosmochimica Acta, 48, pp. 723-751.
# 84mak Makarov, T.I., Sidorov, Y.I., and Naumov, V.B. (1984) Formation conditions for iron minerals in ultrabasic-alkali metasomites. Geochemistry International, 21, 148-160.
# 84nan Nancollas G.H., 1984, The nucleation and growth of phosphate minerals, Chap. 2. In: Phosphate Minerals, J.O. Nriagu and P.B. Moore (Eds), Springer-Verlag, ISBN 3-540-12757-7, 318-329
# 84nri Nriagu J.O., 1984, Formation and stability of base metal phosphates in soils and sediments, Chap. 10. In: Phosphate Minerals, J.O. Nriagu and P.B. Moore (Eds), Springer-Verlag, ISBN 3-540-12757-7, 318-329
# 84pan Pankratz L. B., 1984, Thermodynamic Properties of Halides (U. S. Bureau of Mines Bulletin 674, 1984, 826 p).
# 84pan/stu L.B. Pankratz, J.M. Stuve, and N.A. Gokcen, 'Thermodynamic Data for Mineral Technology,' Bulletin 677, U.S. Bureau of Mines (1984).
# 84rob/hem Robie R. A. and Hemingway B. S., 1984. Heat capacities and entropies of phlogopite KMg3AlSi3O1O(OH)2 and paragonite NaAl2AlSi3O1O(OH)2 between 5 and 9OO K and estimates of the enthalpies and Gibbs free energies of formation. Amer. Miner., 69, p. 858-868.
# 84sew Seward T. M., 1984. The formation of lead (II) chloride complexes to 300 C. A spectrophotometric study. Geochim. Cosmochim. Acta, 48, p. 121 134.
# 84tay/lop Taylor P., and Lopata V.J., 1984. Stability and solubility relationships between some solids in the system PbO CO2 H2O. Can. J. Chem., 62, p. 395 402.
# 84vie/tar Vieillard P., Tardy Y., 1984, Thermochemical properties of phosphates, Chap. 4. In: Phosphate Minerals, J.O. Nriagu and P.B. Moore (Eds), Springer-Verlag, New York, ISBN 3-540-12757-7, 171-198
# 85bab/mat Babushkin, V.I., Matveyev, G.M., and Mchedlov-Petrossyan, O.P. 1985. Thermodynamics of Silicates. New York, New York: Springer-Verlag. NNA.19920401.0112
# 85ber/bro Berman, R.G., Brown, T.H., 1985. Heat capacity of minerals in the system Na2O-K2O-CaO-MgO-FeO-Fe2O3-AI2O3-SiO2-TiO2-H2O-CO2: representation, estimation and high temperature extrapolation. Contribution to Mineralogy and Petrolology 89, 168-183.
# 85cha/dav Chase, M. W., Jr., C. A. Davies, J. R. Downey, Jr., D. J. Frurip, R. A. McDonald, and A. N. Syverud 1985. JANAF Thermochemical Tables, 3rd. ed., J. Phys. Chem. Ref. Data 14, Suppl. 1, Am. Chem. Soc. and Am. Inst. of Physics, Washington, D. C.
# 85gol/par Goldberg R.N., and Parker V.B., 1985. Thermodynamics of solution of SO2(g) in water and of aqueous sulfur dioxide solutions. J. Res. Natl. Bur. Stand., 90, p. 341 358.
# 85hel Helgeson, H.C., 1985, Errata II. Thermodynamics of minerals, reactions, and aqueous solutions at high pressures and temperatures: Amer. Jour. Sci., v. 285, pp. 845-855.
# 85jac/hel Jackson, K.J., and Helgeson, H.C., 1985, Chemical and thermodynamic constraints on the hydrothermal transport and deposition of tin: II. Interpretation of phase relations in the Southeast Asian tin belt: Econ. Geol., v. 80, no. 5, pp. 1365-1378.
# 87fer Fernandez Guillermet A. (1987) Critical evaluation of the thermodynamic properties of cobalt. Int. J. Thermophys., 8 (4), 481-510
# 87gar/par CODATA87 Garvin D., Parker V.B and White H.J., 1987. CODATA Series on Thermodynamic Properties, Hemisphere, Washington, DC.
# 87pan/mah Pankratz L. B., 1987, A. D. Mah, and S. W. Watson, Thermodynamic Properties of Sulfides (U. S. Bureau of Mines Bulletin 689, 1987, 427 p).
# 87rai/sas Rai D., Sass B.M. and Moore D.A., 1987. Chromium (III) hydrolysis constants and solubility of chromium (III) hydroxide. Inorg. Chem., 26, p. 345-349.
# 87sve Sverjensky, D.A., 1987, Calculations of the thermodynamic properties of aqueous species and the solubilities of minerals in supercritical electrolyte solutions, in Carmichael, I.S.E. and H.P. Eugster, eds., Thermodynamic Modeling of Geologic Materials: Minerals, Fluids and Melts: Mineral. Soc. Amer., Reviews in Mineralogy, v. 17, pp. 177-209.
# 87woo/gar Woods T. L. and Garrels R. M. (1987) Thermodynamic values at low temperature for natural inorganic materials. An uncritical summary. Oxford University Press, New York.
# 88cha/new Chandratillake M.R., Newton G.W.A. and Robinson V.J., 1988. Chemval project EUR11891 EN. Comparison of thermodynamic databases used in geochemical modelling., 19 p.
# 88eva/gug Evans B. and Guggenheim S. (1988) Talc, pyrophyllite, and related minerals, Hydrous Phyllosilicates (exclusive of micas). In: S.W. Bailey, Editor, Reviews in Mineralogy vol. 19 (1988), pp. 225-294.
# 88haa Haas J.L., Jr. (1988) Recommended standard electrochemical potentials and fugacities of oxygen for the solid buffers and thermodynamic data in the systems iron-silicon-oxygen, nickel-oxygen, and copper-oxygen. Preliminary report of January 17, 1988 to the CODATA Task Group on Chemical Thermodynamic Tables, U.S. Geological Survey, Reston, Virginia.
# 88mer Merlino, S., 1988, Gyrolite: its crystal structure and crystal chemistry. Mineralogical Magazine, v. 52, p. 377-387.
# 88mol Moller N., 1988. The prediction of mineral solubilities in natural waters: A chemical equilibrium model for the Na Ca Cl SO4 H2O system, to high temperature and concentration. Geochirmica et Cosmochimica Acta, 52, p. 821 837.
# 88phi/hal Phillips, S.L., Hale, F.V., Silvester, L.F., and Siegel, M.D. (1988) Thermodynamic tables for nuclear waste isolation, an aqueous solutions database. vol 1, 181 p. Report NUREG/CR-4864, LBL-22860, SAND87-0323, Lawrence Berkeley Laboratory, Berkeley, California.
# 88rea Reardon E. (1988) J. Phys. Chem., 92, 6426-6431
# 88rua Ruaya J.R., 1988. Estimation of instability constants of metal chloride complexes in hydrothermal solutions up to 300 C. Geochimica et Cosmochimica Acta, 52, p. 1983 1996.
# 88sac/pas Sacerdoti M., Passaglia E. (1988) Neues Jb. Miner., Mh., H.10, 462-475
# 88sho/hel Shock E.L. and Helgeson H.C., 1988. Calculation of the thermodynamic and transport properties of aqueous species at high pressures and temperatures: Correlation algorithms for ionic aqueous species and equation of state predictions to 5 kb and 1000 C. Geochim. Cosmochim. Acta, 52, pp. 2009-2036.
# 88sto Stoessell, R. K. (1988) 25oC and 1 atm dissolution experiments of sepiolite and kerolite: Geochimica Cosmochimica Acta, 52, 365-374.
# 89asho/hel Shock, E.L., and Helgeson, H.C., 1989, Corrections to Shock and Helgeson (1988): Geochim. Cosmo. Acta, v. 53, p. 215.
# 89bar/sau Barin, I., F. Sauert, et al. (1989). Thermochemical Data of Pure Substances. Germany, VCH, Verlagsgesellschaft.
# 89bsho/hel Shock E.L., Helgeson H.C. and Sverjensky D.A., 1989. Calculation of the thermodynamic and transport properties of aqueous species at high pressures and temperatures: Standard partial molal properties of inorganic neutral species. Geochim. Cosmochim. Acta, 53, pp. 2157-2183.
# 89cox/wag Cox J.D., Wagman D.D., and Medvedev V.A., 1989. CODATA Key Values for Thermodynamics. Hemisphere Publishing Corp., New York, 279 p.
# 89mar/smi Martell A.E., and Smith R.M., 1989, Critical Stability Constants, Vol. 3: Other Organic Ligands (2nd printing). Plenum, New York, 495 p.
# 89pan/sus Pan P. and Susak N.J. (1989) Co(II)-chloride and -bromide complexes in aqueous solutions up to 5 m NaX and 90[deg]C: Spectrophotometric study and geological implications. Geochimica et Cosmochimica Acta 53(2), 327-341.
# 89sch/her Schwab R. G., Herold H., Costa M. L. D., and Oliveira N. P. (1989) The formation of aluminous phosphates through lateritic weathering of rocks. Weathering 2, 369-386.
# 90hem Hemingway B. S. (1990) Thermodynamic properties for bunsenite, NiO, magnetite, Fe3O4, and hematite, Fe2O3, with comments on selected oxygen buffer reactions. American Mineralogist 75(7-8), 781-790.
# 90hol/pow Holland T. J. B. and Powell R. (1990) An enlarged and updated internally consistent thermodynamic dataset with uncertainties and correlations: the system K2O-Na2O-CaO-MgO-MnO-FeO-Fe2O3-Al2O3-TiO2-SiO2-C-H2-O2. Journal of Metamorphic Geology 8(1), 89-124.
# 90kun/kih Kuniaki Kihara (1990) Eur. J. Mineral., 2, 63-77
# 90nor/plu Nordstrom D.K., Plummer L.N., Langmuir D., Busenberg E., May H.M., Jones B.F., and Parkhurst D.L., 1990. Revised chemical equilibrium data for major water-mineral reactions and their limitations, in Bassett, R.L. and Melchior, D. eds., Chemical modeling in aqueous systems II: Washington D.C., American Chemical Society Symposium Series 416, p. 398-413.
# 90pap/ber V.G. Papangelakis, D. Berk and G.P. Demopoulos, Mathematical modeling of an exothermic leaching reaction system: pressure oxidation of wide size arsenopyrite particulates. Metall. Trans. B, 21B (1990), pp. 827-837.
# 90rin/sac Rinaldi R., Sacerdoti M., Passaglia E. (1990) Eur. J. Mineral., 2, 841-849
# 90rob/cam Roberts, Willard L., Campbell, Thomas J., and Rapp, George R.: Encyclopedia of Minerals. (Van Nostrand Reinhold Co., 2nd ed., 1990)
# 90sho/hel Shock, E.L., and Helgeson, H.C., 1990, Calculation of the thermodynamic and transport properties of aqueous species at high pressures and temperatures: Standard partial molal properties of organic species: Geochim. Cosmo. Acta, v. 54, pp. 915-945.
# 90sto/cyg Stoffregen R. E., Cygan G.L. (1990). An experimental study of Na-K exchange between alunite and aqueous sulfate solutions. Am. Min., 75:209-220
# 91all/bro Allison J.D., Brown D.S., and Novo-Gradac K.J. 1991. Minteqa2/prodefa2, a geochemical assessment model for environmental systems: version 3.0 user's manual, EPA/600/3-91/021, March 1991 by U.s. Environmental Protection Agency Athens, Georgia 30605.
# 91atk/gla Atkins, M., Glasser, F.P., Kindness, A., and MacPhee, D.E. 1991. Solubility Data for Cement Hydrate Phases (25 C). Washington, District of Columbia: U.S. Department of Energy. (DOE/HMIP/RR/91/032)
# 91din Dinsdale A.T., 1991. SGTE Data for Pure Elements, CALPHAD, 15(4), p. 317-425.
# 91hem/rob Hemingway B.S., Robie R.A., and Apps J.A., 1991. Revised values for the thermodynamic properties of boehmite, AlO(OH), and related species and phases in the system Al O H. Am. Mineral., 76, p. 445-457.
# 91kna/kub O. Knacke, O. Kubaschewski and K. Hesselmann: Thermochemical Properties of Inorganic Substances, Second Edition, (Springer-Verlag, 1991)
# 91kon/hau Konigsberger E., Hausner R., and Gamsjager H., 1991. Solid solute phase equilibria in aqueous solution. V: The system CdC03 CaC03 C02 H20. Geochimica and Cosmochimica Acta, 55, p. 3505 3514.
# 91nag/las Nagy K.L., and Lasaga A.C., 1991. Dissolution and precipitation kinetics of gibbsite at 80 C and pH 3: The dependence on solution saturation state. Geochimica et Cosmochimica Acta, 56, p. 3093 3111.
# 91pab/pit Pabalan R., Pitzer K. (1991) in: K. Pitzer (Ed.), Activity Coefficients in Electrolyte Solutions, Chapter 7. CRC Press, Boca Ration, FL
# 91rai/fel Rai D., Felmy A.R., and Szelmeczka R.W., 1991. Hydrolysis Constants and Ion Interaction Parameters For Cd(II) in Zero to High Concentrations of NaOH KOH, and the Solubility Product of Crystalline Cd(OH)2. Journal of Solution Chemistry, 20, p. 375 390.
# 91rob/hem Robie R.A. and Hemingway B.S. (1991) - Heat capacities of kaolinite from 7 to 380 K and of DSMO-intercalated kaolinite AI2Si20 (OH). Clays and Clay Minerals, 39, p. 362-368
# 91sve/hem Sverjensky, D.A., Hemley, J.J., and D'Angelo, W.M., 1991, Thermodynamic assessment of hydrothermal alkali feldspar- mica-aluminosilicate equilibria: Geochim. Cosmo. Acta, v. 55, pp. 989-1004.
# 92ajoh Ref. 1+19 in slop98.dat: GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University.
# 92bal/nor Ball J.W., and Nordstrom D.K., 1992. User's manual for WATEQ4F, with revised thermodynamic data base and test cases for calculating speciation of major, trace and redox elements in natural waters. U.S. Geol. Survey Open-File Report 91-183 (revised and reprinted 1992), Menlo Park, California. 189 pp.
# 92bjoh Ref. 17 in slop98.dat: GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University.
# 92bru/stu Bruno J., Stumm W., Wersin P., and Brandberg F. (1992) On the influence of carbonate in mineral dissolution: I. The thermodynamics and kinetics of hematite dissolution in bicarbonate solutions at T = 25 C. Geochimica et Cosmochimica Acta 56(3), 1139-1147.
# 92bru/wer Bruno J., Wersin P., and Stumm W. (1992) On the influence of carbonate in mineral dissolution: II. The solubility of FeCO3 (s) at 25 C and 1 atm total pressure. Geochimica et Cosmochimica Acta 56(3), 1149-1155.
# 92cir/nav Circone S. and Navrotsky A., 1992. Substitution of (6,4)Al in phlogopite : high pressure solution calorimetry , heat capacities and thermodynamic properties of the phlogopite -eastonite join. American Mineralogist, 77, p. 1191-1205.
# 92cjoh Ref. 7+9+19 in slop98.dat: GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University.
# 92cle/der Clever L.H., Derrick E.M., and Johnson S.A., 1992. The solubility of Some Sparingly Soluble Salts on Zinc and Cadmium In water and in aqueous electrolyte solutions. J. Phys. Chem. Ref. Data, 21, p. 941 966.
# 92gre/fug Grenthe I., Fuger J., Konings R.J.M., Lemire R.J., Muller A.B., Nguyen Trung C., and Wanner H., 1992. Chemical Thermodynamics, Volume 1: Chemical Thermodynamics of Uranium. North Holland, Amsterdam, 1, 714 pp.
# 92joh/oel Johnson J.W., Oelkers E.H. and Helgeson H.C., 1992. SUPCRT92: A software package for calculating the standard molal thermodynamic properties of minerals, gases, aqueous species, and reactions from 1 to 5000 bar and 0 to 1000'C. Comput.Geosci., 18, p. 899
# 92joh/tas Johnson G. K., Tasker I. R., Flotow H. E., and O'Hare P. A. G. (1992) Thermodynamic studies of mordenite,dehydrated mordenite and gibbsite. American Mineralogist 77(1-2), 85-93
# 92pal/wes Palmer D.A., and Wesolowski D.J., 1992. Aluminum speciation and equilibria in aqueous solution: II. The solubility of gibbsite in acidic sodium chloride solutions from 30 to 70 C. Geochimica et Cosmochimica Acta, 56, p. 1093 1111.
# 92plo/wic Plodinec M. J. and Wicks G. G. (1992) Applications of hydration thermodynamics to in-situ tests results. In: Proc. Workshop on In Situ Testiong of Radioactive Waste Forms and Engineered Barriers, Corsendonk, Belgium, oct. 13-16, 1992.
# 92sea/rob Seal R.R., Robie R.A., Barton P.B., and Hemingway B.S. (1992) Superambient heat capacities of synthetic stibnite, berthierite, and chalcostibnite: Revised thermodynamic properties and implications for phase equilibria. Econ. Geol. 87, 1911-1918.
# 92sho Shock, E.L., 1992, Stability of peptides in high-temperature aqueous solutions: Geochim. Cosmo. Acta, v. 56, pp. 3481-3491.
# 92sti/par Stipp S.L.S., Parks G.A., Nordstrom K.D., and Leckie J.O., 1992. Solubility product constant and thermodynamic properties for synthetic otavite, CdC03(s) and aqueous association constants for the Cd( II) C02 H20 system. Geochimica et Cosmochimica Acta, 57
# 92tay Taylor, H. F. W., 1992, Cement Chemistry, third edition: London, Thomas Telford, 475 p.
# 92wol Wolery T.J., 1992. EQ3/6: A software Package for Geochemical Modelling of Aqueous Systems: Package Overview and Installation Guide. Technical Report UCRL-MA-110662 PT I ed., Lawrence Livermore National Laboratory (USA).
# 93bal/chr Balarew C., Christov C., Valyashko V., Petrenko S. (1993) J. Solution Chem., 22, 173-181
# 93bar Barin, I. (1993) Thermochemical Data of Pure Substances, Weinheim, FRG, VCH.
# 93pal/wel Palmer D.A., and Wesolowski D.J., 1993. Aluminum speciation and equilibrium in aqueous solution: III. Potentiometric determination of the first hydrolysis constant of aluminum (III) in sodium chloride solutions to 125 C. Geochim. Cosmochim. Acta, 57, p. 2
# 93sax/cha Saxena S.K., Chaterjee N., Fei Y., Shen G. (1993) Thermodynamic data on oxides and silicates. Springer. New-York.
# 93sch/got Schwab R. G., Gotz C., Herold H., and Oliveira N. P. (1993) Compounds of the crandallite type-Thermodynamic properties of Caphosphates, Sr-phosphates, Ba-phosphates, Pb-phosphates, La-phosphates, Ce-phosphates to Gd-phosphates and Ca-arsenates, Ba-arsenates, Pb-arsenates, La-arsenates, Ce-arsenate.Srarsenates, Neues Jahrb Miner Monatsh. 12, 551-568.
# 93sch/sho Schulte, M.D., and Shock, E.L., 1993, Aldehydes in hydrothermal solution: Standard partial molal thermodynamic properties and relative stabilities at high temperatures and pressures: Geochim. Cosmo. Acta, v. 57, pp. 3835-3846.
# 93sho Shock, E.L., 1993, Hydrothermal dehydration of aqueous organic compounds: Geochim. Cosmo. Acta, v. 57, pp. 3341-2249.
# 93sho/kor Shock, E.L., and Koretsky, C.M., 1993, Metal-organic complexes in geochemical processes: Calculation of standard partial molal thermodynamic properties of aqueous acetate complexes at high pressures and temperatures: Geochim. Cosmo. Acta, v.57, pp. 4899-4
# 93sho/mck Shock, E.L., and McKinnon, W.B., 1993, Hydrothermal Processing of Cometary Volatiles--Applications to Triton: Icarus, v. 106, pp. 464-477.
# 93sto Stoffregen R.E. (1993). Stability relations of jaroiste and natrojarosite. Geoch. And Cosmoch. Acta, 57, 2417-2419.
# 94aki/zot Akinfiev N.N., Zotov A.V., and Shikina N.D. (1994) Experimental investigation and thermodynamic correlation in the Sb(III)-S(II)-O-H system. Geochem. Intern. 31, 27-40.
# 94alb/tom Al-Borno, A., Tomson, M.B. (1994) The temperature dependence of the solubility product constant of vivianite. Geochim. Cosmochim. Acta 58, 5373-5378
# 94dam/str Damidot, D., Stronach, S., Kindness, A., Atkins, M., and Glasser, F.P. 1994. Thermodynamic investigation of the CaO-Al2O3-CaCO3-H2O closed system at 25C and influence of Na2O. Cem. Concr. Res. 24(3):563-572.
# 94dia/kho I. Diakonov, I. Khodakovsky, J. Schott, E. Sergeeva (1994) Thermodynamic properties of iron oxides and hydroxides. I. Surface and bulk thermodynamic properties of goethite (alpha-FeOOH) up to 500 K. Eur. J. Mineral., 6(6), 967-983.
# 94pan Pankratz L. B., 1994, Thermodynamic Properties of Carbides, Nitrides, and Other Selected Substances (U. S. Bureau of Mines Bulletin 696, 1994, 957 p).
# 95ant/bid Anthony J.W., Bideaux R.A., Bladh K.W. and Nichols M.C., 1995. Handbook of Mineralogy, Volume II. Silica, Silicates. Mineral Data Publishing, Tucson, 904 pp., 2 vols.
# 95bev/pui Beverskog, B., Puigdomenech, I. (1995) Revised Pourbaix diagrams for iron at 25-300 C; Corr. Sci. 38, p. 2121-2135.
# 95bou Bourbon X., 1995. Selection de donnees thermodynamiques afferentes aux corrections de Temperature sur les equilibres chimiques. I/II Analyse de bases de donnees. ANDRA Report, C RP O. HEM 95.001.
# 95dac/ben Dachs, E. and Benisek, A., 1995. The stability of annite+quartz: reversed experimental data for the reaction 2 annite+3 quartz=2 sanidine+3 fayalite+2 H2O. Contributions to Mineralogy and Petrology, 121, p. 380-387.
# 95dai/pos Dai, Y., and Post, J. E,. 1995, Crystal structure of hillebrandite: a natural analogue of calcium silicate hydrate (CSH) phases in Portland cement: American Mineralogist, v. 80, p. 841-844.
# 95haa/sho Haas, J.R., Shock, E.L., and Sassani, D.C., 1995, Rare earth elements in hydrothermal systems: Estimates of standard partial molal thermodynamic properties of aqueous complexes of the rare earth elements at high pressures and temperatures: Geochim. Cosmo. Acta, v. 59, no. 21, pp. 4329-4350.
# 95has/cyg Haselton H.T., Cygan G.L. and Jenkins D.M., 1995. Experimental study of muscovite stability in pure H 2 O and 1 molal KCl-HCl solutions. Geochimica et Cosmochimica Acta, 59, p. 429-442
# 95jem/che Jemal M., Ben Cherifa A., Kattech I. and Ntahomvukiye I., 1995. Standard enthalpies of formation and mixing of hydroxy- and fluorapatites. Thermochimica Acta, 259, p. 13-21
# 95mar/mac Marani D., Macchi G., and Pagano M., 1995. Lead precipitation in the presence of sulphate and carbonate : testing of thermodynamic predictions. Water Research, 29, p. 1085 1092.
# 95mir/kis Mironova V.E., Kiselev V.P., Egizaryan M.B., Golovnev N.N., Pashkov G.L. (1995) Ion association in aqueous solutions of calcium arsenate. Russ. J. Inorg. Chem., 40, 1690-1691
# 95par/kho Parker, V.B., Khodakovsky, I.L. (1995) Thermodynamic properties of aqueous ions (2+ et 3+) of iron and the key compouds of iron. J. Phys. Chem. Ref. Data 24 (5) p. 1699-1745.
# 95pok/hel Pokrovskii, V.A., and Helgeson, H.C., 1995, Thermodynamic properties of aqueous species and the solubilities of minerals at high pressures and temperatures: The system Al2O3-H2O-NaCl: Amer. J. Sci., 295, 1255-1342.
# 95pok/sch Pokrovski G.S., Schott J. and Sergeyev A.S., 1995. Experimental determination of the stability constants of NaSO4minus and NaB (OH)40 in hydrothermal solutions using a new high-temperature sodium-selective glass electrode - Implications for boron isotopic fractionation. Chemical Geology, 124, p. 253-265.
# 95rob/hem Robie R.A., and Hemingway B.S., 1995. Thermodynamic properties of minerals and related substances at 298.15 K and 1 Bar (105 Pascals) pressure and at higher temperatures. U.S. Geol. Survey Bull., 2131, 461 pp.
# 95sho Shock, E.L., 1995, Organic acids in hydrothermal solution: Standard molal thermodynamic properties of carboxylic acids and estimates of dissociation constants at high temperatures and pressures: Amer. Jour. Science, v. 295, pp. 496-580.
# 95sho/kor Shock, E.L., and Koretsky, C.M., 1995, Metal-organic complexes in geochemical processes: Estimation of standard partial molal thermodynamic properties of aqueous complexes between metal cations and monovalent organic acid ligands at high pressures and temperatures. Geochim. Cosmo. Acta, 59, pp. 1497-1532.
# 95sil/bid Silva R.J., Bidoglio G., Rand M.H, Robouch P.B., Wanner H., and Puigdomenech I., 1995. Chemical Thermodynamics Vol.2. Chemical Thermodynamics of Americium. NEA, Elsevier.
# 95tro Trotignon L. (1995) Critique et selection de donnees thermodynamiques en vue de modeliser les equilibres mineral-solution. Rapport annuel 1995 SESD95/49
# 96abar/pal Baron D. and Palmer C. D., 1996a. Solubility of KFe3(CrO4)2(OH)6 at 4-35 C. Geochim. Cosmochim. Acta, 60, pp. 3815-3824.
# 96arc Archer D.G., 1996. Thermodynamic Properties of Synthetic Otavite, CdCO3(cr): Enthalpy Increment Measurements from 4.5 K to 350 K. J. Chem. Eng. Data, 41, p. 852 858.
# 96bbar/pal Baron D. and Palmer C. D. (1996b) Solubility of jarosite at 4-35 C. Geochim. Cosmochim. Acta 60, 185-195.
# 96bev/pui Beverskog, B., Puigdomenech, I., 1996. Revised pourbaix diagrams for iron at 25-300 C. Corros. Sci. 38, 2121-2135.
# 96bou Bourbon X., 1996. Selection de donnees thermodynamiques afferentes aux corrections de Temperature sur les equilibres chimiques (Sodium, Potassium, cesium, Magnesium, Calcium, Strontium, Cobalt, Nickel, Paladium). ANDRA Report, CRP OHEM 96.001.
# 96fal/rea Falck W.E., Read D. and Thomas J.B., 1996. Chemval2: thermodynamic database EUR16897 EN
# 96gal/boll Gal J.Y., Bollingerb J.C., Tolosa H., and Gache N., 1996. Calcium carbonate solubility: a reappraisal of scale formation and inhibition. Talanta, 43, p. 1497 1509.
# 96gem GEMBOCHS, 1996, THERMODYNAMIC DATABASE: thermo.com.V8.R6.full, generated by GEMBOCHS.V2-Jewel.src.R6 03-dec-1996 16:55:04
# 96hud/str Hudson Lamb D.L., Strydom C.A., and Potgieter J.H., 1996. The thermal dehydration of natural gypsum and pure calcium sulphate dihydrate (gypsum). Thermochimica Acta, 282/283, p. 483 492.
# 96kis/nav Kiseleva I., Navrotsky A., Belitskii I. A., and Fursenko B. A. (1996) Thermochemistry and phase equilibria in calcium zeolites. American Mineralogist 81(5-6), 658-667
# 96pok/gou Pokrovski G., Gout R., Schott J., Zotov A. and Harrichoury J.C., 1996. Thermodynamic properties and stoichiometry of As (III) hydroxide complexes at hydrothermal conditions. Geochimica et Cosmochimica Acta, 60, 737-749
# 96rou/hov Roux J. and Hovis G. L., 1996. Thermodynamic mixing models for muscovite-paragonite solutions based on solution calorimetric and phase equilibrium data. Journal of Petrology, 37, p. 1241-1254
# 96su/har Su, C., and J.B. Harsh. 1996. Influence of soluble aluminosilicate complex formation on imogolite solubility determination. Geochim. Cosmochim. Acta 60:4275-4277.
# 97all/dol Allal K. M., Dolinger J.-C., and Martin G. (1997) Determination of thermodynamical data of calcium hydroxichloride. Revue de l'Institut Francais du Petrole 52(3), 361-368.
# 97apok/hel Pokrovskii V.A., and Helgeson H.C., 1997a. Thermodynamic properties of aqueous species and the solubilities of minerals at high pressures and temperatures: the system Al2O3 H2O KOH. Chemical Geology, 137, p. 221 242.
# 97asho/sas Shock, E.L., Sassani, D.C., Willis, M., and Sverjensky, D.A., 1997, Inorganic species in geologic fluids: Correlations among standard molal thermodynamic properties of aqueous ions and hydroxide complexes: Geochim. Cosmo. Acta, v. 61, no. 5, pp. 907-950.
# 97ben/dia Benezeth P., Diakonov I.I., Pokrovski G.S., Dandurand J.L., Schott J. and Khodakovsky I.L., 1997. Gallium speciation in aqueous solution. Experimental study and modelling: Part 2. Solubility of alpha-GaOOH in acidic solutions from 150 to 250 C and hydrolysis constants of gallium (III) to 300oC. Geochim. Cosmochim. Acta, 61, pp. 1345-1357
# 97bon/hea Bond K. A., Heath T. G. and Tweed C. J., 1997. HATCHES: A Referenced Thermodynamic Database for Chemical Equilibrium Studies. Nirex Report NSS/R379
# 97bpok/hel Pokrovskii V., and Helgeson H.C., 1997b. Calculation of the standard partial molal thermodynamic properties of KCl0 and activity coefficients of aqueous KC1 at temperatures and pressures to 1000 C and 5 kbar. Geochimica et Cosmochimica Acta, 61, p. 2175-2183.
# 97bsho/sas Shock, E.L., Sassani, D.C., and Betz, H., 1997, Uranium in geologic fluids: Estimates of standard partial molal properties, oxidation potentials, and hydrolysis constants at high temperatures and pressures: Geohim. Cosmo. Acta, v. 61, no. 20, pp. 4245-426
# 97coo/alb Coombs, D.S., Alberti, A., Armbruster, T., Artioli, G., Colella, C., Galli, E., Grice, J.D., Liebau, F., Mandarino, J.A., Minato, H., Nickel, E.H., Passaglia, E., Peacor, D.R., Quartieri, S., Rinaldi, R., Ross, M., Sheppard, R.A., Tillmanns, E., Vealini, G., 1997. Recommended nomenclature for zeolite minerals - report of the subcommittee on zeolites of the international mineralogical association, commission on new minerals and mineral names. Canadian Mineralogist, 35, 1571-1606.
# 97cro Cromieres L., 1997. Selection de donnees thermodynamiques le cadmium, le mercure et le bore, et evaluation de leur manche. Technical report Andra C.RP.AMAT.97.043
# 97csho/sas Shock, E.L., Sassani, D.C., and Betz, H., 1997, Uranium in geologic fluids: Estimates of standard partial molal properties, oxidation potentials, and hydrolysis constants at high temperatures and pressures: Geohim. Cosmo. Acta, v. 61, no. 20, pp. 4245-4266
# 97dal/sho Dale, J.D., Shock, E.L., MacLeod, G., Aplin, A.C., and Larter, S.R., 1997, Standard partial molal properties of aqueous alkylphenols at high pressures and temperatures: Geochim. Cosmo. Acta, v. 61, no. 19, pp. 4017-4024.
# 97got Gottschalk M. (1997) Internally consistent thermodynamic data set for rock forming minerals in the system SiO2-TiO2-Al2O3-Fe2O3-CaO-MgO-FeO-K2O-Na2O-H2O-CO2: an alternative approach. European Journal of Mineralogy, 9, p. 175-223.
# 97mcc/sho McCollom, T.M., and Shock, E.L., 1997, Geochemical constraints on chemolithoautotrophic metabolism by microorganisms in seafloor hydrothermal systems: Geochim. Cosmo. Acta, v. 61, no. 20, pp. 4375-4391.
# 97pal/wes Palmer D.A., and Wesolowski D.J., 1997. Potentiometric measurements of the first hydrolysis quotient of magnesium(II) to 250 C and 5 molal ionic strength. J. Sol. Chem., 26, p. 217-232.
# 97rim Rimstidt D.J., 1997. Quartz solubility at low temperatures. Geochimica et Cosmochimica Acta, 61, p. 2553 2558.
# 97sho/sas Shock E.L., Sassani D.C., Willis M., and Sverjensky D.A., 1997. Inorganic species in geologic fluids: Correlations among standard molal thermodynamic properties of aqueous ions and hydroxide complexes. Geochim. Cosmo. Acta, 61, p. 907 950.
# 97smi/mar Smith R. M., Martell A. E., and Motekaitis R. J. (1997) NIST Critically Selected Stability Constants of Metal Complexes Database, Version 4.0. NIST Standard Reference Database 46. U.S. Department of Commerce
# 97sul/sew Suleimenov O.M., and Seward T.M., 1997. A spectrophotometric study of hydrogen sulphide ionisation in aqueous solutions to 350 C. Geochimica et Cosmochimica Acta, 61, p. 5187 5198.
# 97sve/sho Sverjensky, D.A., Shock, E.L., and Helgeson, H.C., 1997 Prediction of the thermodynamic properties of aqueous metal complexes to 1000 C and 5 kb: Geochim. Cosmo. Acta, v. 61, No. 7, pp. 1359-1412.
# 97tag/zot Tagirov B. R., Zotov A. V. and Akinfiev N. N., 1997. Experimental study of dissociation of HCl from 350 to 500 C and from 500 to 2500 bars: Thermodynamic properties of HCl (aq). Geochimica et Cosmochimica Acta, 61, 4267-4280
# 97tay Taylor H.F.W. , 1997 Cement Chemistry, 2nd. Ed., Thomas Telford, London.
# 98adia I.I. Diakonov (1998) Thermodynamic properties of iron oxides and hydroxides. II. Estimation of the surface and bulk thermodynamic properties of ordered and disordered maghemite (gamma-Fe2O3). Eur. J. Mineral., 10(1), 17-29.
# 98arc Archer D.G., 1998. Thermodynamic Properties of Import to Environmental Processes and Remediation. I. Previous Thermodynamic Property Values for Cadmium and Some of Its Compounds. Journal of Physical and Chemical Reference Data, 27, p. 915
# 98bal/nor Ball J.W. and Nordstrom D.K., 1998. Critical evaluation and selection of standard state thermodynamic properties for chromium metal and its aqueous ions, hydrolysis species, oxides and hydroxides. J. Chem. Eng. Data 43, p. 895-918.
# 98bar/pal Baron D. and Palmer C. D., 1998. Solubility of KFe(CrO4)2-2H2O at 4-75 C. Appl. Geochem., 12, pp. 961-973.
# 98bdia I.I. Diakonov (1998) Thermodynamic properties of iron oxides and hydroxides. III. Surface and bulk thermodynamic properties of lepidocrocite (gamma-FeOOH) to 500 K. Eur. J. Mineral., 10(1), 31-41.
# 98bre/lin Brennan, E.W., Lindsay, W.L. (1998) Reduction and oxidation effect on the solubility and transformation of iron oxides, Soil Sci. Soc. Am. J. 62, 930-937
# 98cha Chase, M.W.J., 1998. NIST-JANAF Thermochemical Tables, Journal of Physical Chemistry Reference Data, Vol. 9, 4th Edition. National Institute of Standards and Technology, Washington DC, 1951 pp.
# 98fel/dix Felmy A.R., Dixon D.A., Rustad J.R., Mason M.J. and Onishi L.M., 1998. The Hydrolysis and Carbonate Complexation of Strontium and Calcium in Aqueous Electrolytes: Use of Molecular Modeling Calculations in the Development of Aqueous Thermodynamic Models. J. Chem. Thermodynamics, 30, p. 1103-1120
# 98gam/kon Gamsjager H., Konigsberger E., and Preis W., 1998. Solubilities of metal carbonates. Pure and Appl. Chem., 70, p. 1913 1920.
# 98gla/tyr Glasser, F. P., Tyrer, M., Quillin, K., Ross, D., Pedersen, J., Goldthorpe, K., Bennett, D., and Atkins, M., 1998, The chemistry of blended cements and backfills intended for use in radioactive waste disposal: Research and development Technical Report P98, UK Environment Agency, 332 p.
# 98hol/pow Holland T.J.B., and Powell R., 1998. An internally consistent thermodynamic data set for phases of petrological interest. Journal of Metamorphic Geology, 16, p. 309 343.
# 98kin King D. W. (1998) Role of Carbonate Speciation on the Oxidation Rate of Fe(II) in Aquatic Systems. Environ. Sci. Technol. 32(19), 2997-3003.
# 98mer/roc Mercy M.A., Rock P.A., Casey W.H., and Mokarram M.M., 1998. Gibbs energies of formation for hydrocerussite [Pb(OH)2.(PbCO3)2(s)] and hydrozincite {[Zn(OH)2]3.(ZnCO3)2(s)} at 298 K and 1 bar from electrochemical cell measurements. American Mineralogist, 83, p. 739-745.
# 98ply/zha Plyasunova N. V., Zhang Y., and Muhammed M. (1998) Critical evaluation of thermodynamics of complex formation of metal ions in aqueous solutions. V. hydrolysis and hydroxo-complexes of Co2+ at 298.15 K. Hydrometallurgy 48(2), 153-169.
# 98pok/sch Pokrovski G.S. and Schott J., 1998. Thermodynamic properties of aqueous Ge(IV) hydroxide complexes from 25 to 350 C: Implications for the behavior of germanium and the Ge/Si ratio in hydrothermal fluids. Geochimica et Cosmochimica Acta, 62, 1631-1642
# 98ras/eva RASMUSSEN G., EVANS B .W. and Kusmmn S.M. (1998): Low-temperature fayalite, greenalite, and minnesotaite from the Overlook gold deposit, Washington: phase relations in the system FeO-SiO2-H2O. Can. Mineral.36, 147-162
# 98sal/pok Salvi S, Pokrovski G.S. and Schott J. 1998. Experimental investigation of aluminum-silica aqueous complexing at 300 C. Chemical Geology, 151, 51-67
# 98sas/sho Sassani, D.C., and Shock, E.L., Solubility and Transport of Platinum-Group Elements in Supercritical fluids: Estimates of standard partial molal properties, oxidation potentials, and hydrolysis constants at high temperatures and pressures: Geohim. Cosmo. Acta, v. 61, no. 20, pp. 4245-4266.
# 98sav Savage, D., 1998, Zeolite occurrence, stability and behaviour, in Maqarin, analogue study, Phase III, Smellie, J. A. T., editor, SKB Report TR 98-04, v. 1, p. 281-307.
# 98zie/jon Ziemniak S.E., Jones M.E. and Combs K.E.S. 1998. Solubility and phase behaviour of Cr(III) oxides in alkaline media at elevated temperatures. J. Solution Chemistry, Vol. 27, N 1, p.33-66.
# 99aki/zot Akinfiev N. and Zotov A., 1999. Thermodynamic description of equilibria in mixed fluids (H2O-non-polar gas) over a wide range of temperature (25-700 C) and pressure (1-5000 bars). Geochimica et Cosmochimica Acta, 63, 2025-2041
# 99all Allison Geoscience Consultants, Inc., HydroGeoLogic, Inc., 1999, MINTEQA2/PRODEFA2, a geochemical assessment model for environmental systems: User manual supplement for version 4.0., U.S. Environmental Protection Agency, 76 p.
# 99bot/bro Bothe JV, Brown PW (1999) The stabilities of calcium arsenates at 23 C. J Hazard Mater B 69:197-207
# 99dav/phi Davison W., Phillips N., and Tabner B. J. (1999) Soluble iron sulfide species in natural waters: Reappraisal of their stoichiometry and stability constants. Aquatic Sciences - Research Across Boundaries 61(1), 23-43.
# 99dia/sch Diakonov I.I., Schott J., Martin F., Harrichourry J.C. and Escalier J., 1999. Iron(III) solubility and speciation in aqueous solutions. experimental study and modelling: part 1. hematite solubility from 60 to 300 C in NaOH-NaCl solutions and thermodynamic properties of Fe(OH)4-(aq) - Revised equation od state for the standard partial properties of ions and electrolytes. Geochimica et Cosmochimica Acta, Volume 63, Number 15, August 1999 , pp. 2247-2261(15)
# 99gra Grauer R., 1999. Solubility products of M(II) carbonates. Waste Management laboratory, PSI Bericht Nr. 99-04 January 1999 ISSN 1019-0643.
# 99kon/kon Konigsberger E., Konisberger L.C., and Gamsjager H., 1999. Low temperature thermodynamic model for the system Na2CO3 MgCO3 CaCO3 H2O. Geochimica et Cosmochimica Acta, 63, p. 3105-3119.
# 99lot/och Lothenbach B., Ochs M., Wanner H., and Yui M., 1999. Thermodynamic data for the speciation and solubility of Pd, Pb, Sn, Sb, Nb and Bi in aqueous solution. JNC TN8400 99 011.
# 99par/app Parkhurst D.L., and Appelo C.A.J., 1999. User's guide to Phreeqc (version 2)- a computer program for speciation, batch-reaction, one-dimensional transport, and inverse geochemical calculation. USGS WRI Report 99-4259, 312 pp.
# 99sav/sav Savenko V. S. and Savenko A. V. (1999) Solubility of cobalt(III) and the stability constant of the hydroxo complex Co(OH)30 in aqueous solution. Geochemistry International 37(4), 385-387.
# 99sch/bar Schoonen M.A.A, and Barnes H.L., 1988. An approximation of the second dissociation constant for H2S. Geochim. Cosmo. Acta, 52, p. 649-654.
# 99sch/nav Schoenitz, M., and Navrotsky, A., 1999, Enthalpy of Formation of Katoite Ca3Al2[(OH)4]3: Energetics of the Hydrogarnet Substitution. American Mineralogist, v. 84, p.389-391
# 99wan/tes Wang F., and Tessier A., 1999. Cadmium Complexation with Bisulfide. Environ. Sci. Technol., 33, p. 4270 4277.
# 99yun/glu Yungman V.S., and Glusko V.P., 1999. Thermal constants of substances. Wiley, Begell House, New York.
# CODATA87 Garvin D., Parker V.B and White H.J., 1987. CODATA Series on Thermodynamic Properties, Hemisphere, Washington, DC.
# NIST46.4 NIST (1997) Critical stability constants of metal complexes database, NIST Standard Reference Database 46, v4.0. Website: http://www.nist.gov/srd/nist46.htm
# Piantone, pers. Comm.Piantone, pers. Comm., 2005
# slop98 GEOPIG., 1998. Slop98.dat, http://geopig.asu.edu/supcrt_data.html, Washington University.
# 17abla Blanc P. (2017) Selection de proprietes thermodynamiques pour les principales especes aqueuses et minerales porteuses de thallium. Rapport final. Rapport BRGM 66385-FR.
# 15bla/vie Blanc, P., Vieillard, P., Gailhanou, H., Gaboreau, S., Gaucher, E.C., Fialips, C.I., Made, B., Giffaut, E., 2015. A generalized model for predicting the thermodynamic properties of clay minerals. American Journal of Science 315, 734-780.
# 17bbla Blanc P., 2017 D3E/BGE N 2017-077 (Compte-rendu de reunion), 17 p.
# 16bla Blanc P., (2016) Biomore WP1 progress report
# 17roo/vie Roosz et al., 2017. Thermodynamic properties of C-(A)-S-H and M-S-H phases: results from direct measurements and predictive modelling. Applied Geochemistry, submitted
# 07pow/bro Powell, K.J., Brown, P.L., Byrne, R.H., Gadja, T., Hefter, G., Sjoberg, S., Wanner, H., 2007. Chemical speciation of environmentally significant metals with inorganic ligands Part 2 : The Cu[2+]-OH[-], Cl[-], CO[3][2-], SO[4][2-], and PO[4][3-] systems : (IUPAC Technical Report). Pure and applied chemistry, USA.
# 00pui Puigdomenech, I., 2000. Thermodynamic data for copper: implications for the corrosion of copper under repository conditions, SKB report. SKB/Swedish Nuclear Fuel and Waste Management, p. 96.
# 09xio Xiong, Y., 2009. The aqueous geochemistry of thallium: speciation and solubility of thallium in low temperature systems. Environmental Chemistry 6, 441-451.
# 18nea NEA, 2018. Forthcoming TDB selection on cement minerals
# 18sig SIGARRR, 2018. Forthcoming results from the project.
# unp unpublished data
# 03ald/gan Alderighi, L., Gans, P., Midollini, S., Vacca, A., 2003. Co-ordination chemistry of the methylmercury(II) ion in aqueous solution: a thermodynamic investigation. Inorganica Chimica Acta 356, 8-18.
# 98cha/kru Chatterjee, N.D., Kruger, R., Haller, G., Olbricht, W., 1998. The Bayesian approach to an internally consistent thermodynamic database: theory, database, and generation of phase diagrams. Contributions to Mineralogy and Petrology 133, 149-168.
# 12coo/oli Cook, W.G., Olive, R.P., 2012. Pourbaix diagrams for the nickel-water system extended to high-subcritical and low-supercritical conditions. Corrosion Science 58, 284-290.
# 05gam/bug Gamsjager, H., Bugajski, J., Gajda, T., Lemire, R., 2005. Chemical Thermodynamics of Nickel. Elsevier Science.
# 04got Gottschalk, M., 2004. Thermodynamic Properties of Zoisite, Clinozoisite and Epidote. Reviews in Mineralogy and Geochemistry 56, 83-124.
# 11pal/ben Palmer, D.A., Benezeth, P., Wesolowski, D.J., 2011. Solubility of Nickel Oxide and Hydroxide in Water, 14th International Conference on the Properties of Water and Steam, pp. 264-269.
# 10pal/gam Palmer, D.A., Gamsjager, H., 2010. Solubility measurements of crystalline beta-Ni(OH)2 in aqueous solution as a function of temperature and pH. Journal of Coordination Chemistry 63, 2888-2908.
# 97ply/wan Plyasunova, N.V., Wang, M., Zhang, Y., Muhammed, M., 1997. Critical evaluation of thermodynamics of complex formation of metal ions in aqueous solutions II. Hydrolysis and hydroxo-complexes of Cu2+ at 298.15 K. Hydrometallurgy 45, 37-51.
# 05pow/bro Powell, K.J., Brown, P.L., Byrne, R.H., Gajda, T., Hefter, G., Sjoberg, S., Wanner, H., 2005. Chemical speciation of environmentally significant heavy metals with inorganic ligands. Part 1: The Hg2+- Cl-, OH-, CO32-, SO42-, and PO43- aqueous systems (IUPAC Technical Report). Pure and Applied Chemistry 77, 739-800.
# 63sch/wid Schwarzenbach, G., Widmer, M., 1963. Die loslichkeit von metallsulfiden I. schwarzes quecksilbersulfid. Helvetica chimica acta 46, 2613-2628.
# 11sky Skyllberg, U., 2011. Chemical Speciation of Mercury in Soil and Sediment, Environmental Chemistry and Toxicology of Mercury. John Wiley and Sons, Inc., pp. 219-258.
# 01sme/fra Smelik, E.A., Franz, G., Navrotsky, A., 2001. A calorimetric study of zoisite and clinozoisite solid solutions. American Mineralogist 86, 80-91.
# 13ste/ben Stefansson, A., Benezeth, P., Schott, J., 2013. Carbonic acid ionization and the stability of sodium bicarbonate and carbonate ion pairs to 200 C - A potentiometric and spectrophotometric study. Geochimica et Cosmochimica Acta 120, 600-611.
# 96stu/mor Stumm, W., Morgan, J.J., 1996. Aquatic chemistry: chemical equilibria and rates in natural waters. Wiley.
# 02wal/pre Wallner, H., Preis, W., Gamsjager, H., 2002. Solid-solute phase equilibria in aqueous solutions: XV [1]. Thermodynamic analysis of the solubility of nickel carbonates. Thermochimica acta 382, 289-296.
# 07gre/per Green, D., Perry, R., 2007. Perry's Chemical Engineers' Handbook, Eighth Edition. McGraw-Hill Education.
# 09hon Honerlage, B., 2009. CuF: lattice constants, in: Roessler, U. (Ed.), New Data and Updates for I-VII, III-V, III-VI and IV-VI Compounds. Springer Berlin Heidelberg, Berlin, Heidelberg, pp. 149-149.
# 96dia/sch Diakonov, I.I., Schott, J., Martin, F., Harrichourry, J.-C., Escalier, J., 1999. Iron (III) solubility and speciation in aqueous solutions. experimental study and modelling: part 1. hematite solubility from 60 to 300 C in NaOH-NaCl solutions and thermodynamic properties of Fe (OH) 4minus(aq). Geochimica et Cosmochimica Acta 63, 2247-2261.
# 17gai/vie Gailhanou, H., Vieillard, P., Blanc, P., Lassin, A., Denoyel, R., Bloch, E., De Weireld, G., Claret, F., Fialips, C.I., Made, B., Giffaut, E., 2017. Methodology for determining the thermodynamic properties of hydration of Na-smectite considering the energetic contribution of capillary water. Applied Geochemistry.
END
Reference in New Issue View Git Blame Copy Permalink